diff --git a/include/lgi/common/StringClass.h b/include/lgi/common/StringClass.h --- a/include/lgi/common/StringClass.h +++ b/include/lgi/common/StringClass.h @@ -1,1379 +1,1379 @@ /* * A mis-guided attempt to make a string class look and feel like a python string. * * Author: Matthew Allen * Email: fret@memecode.com * Created: 16 Sept 2014 */ #pragma once #include #include #include #if defined(_MSC_VER) || defined(__GTK_H__) // This fixes compile errors in VS2008/Gtk #undef _SIGN_DEFINED #undef abs #endif #include #if defined(_MSC_VER) && _MSC_VER < 1800/*_MSC_VER_VS2013*/ #include #define PRId64 "I64i" #else #define __STDC_FORMAT_MACROS 1 #include #include #ifndef PRId64 #warning "PRId64 not defined." #define PRId64 "Ld" #endif #endif #include "LgiOsDefs.h" #include "lgi/common/Unicode.h" #include "lgi/common/Array.h" #ifndef IsDigit #define IsDigit(ch) ((ch) >= '0' && (ch) <= '9') #endif LgiExtern int LPrintf(class LString &Str, const char *Format, va_list &Arg); #ifdef LGI_UNIT_TESTS LgiExtern size_t LString_RefStrCount; #endif /// A pythonic string class. class LString { protected: /// This structure holds the string's data itself and is shared /// between one or more LString instances. struct RefStr { /// A reference count int32 Refs; /// The bytes in 'Str' not including the NULL terminator size_t Len; /// The first byte of the string. Further bytes are allocated /// off the end of the structure using malloc. This must always /// be the last element in the struct. char Str[1]; /// Ptr to the NULL char at the end. char *End() { return Str + Len; } } *Str; inline void _strip(LString &ret, const char *set, bool left, bool right) { if (!Str) return; char *s = Str->Str; char *e = s + Str->Len; if (!set) set = " \t\r\n"; if (left) { while (s < e && strchr(set, *s)) s++; } if (right) { while (e > s && strchr(set, e[-1])) e--; } if (e > s) ret.Set(s, e - s); } public: /// A copyable array of strings class Array : public LArray { public: Array(size_t PreAlloc = 0) : LArray(PreAlloc) { // This allows the parent array to return an empty // string without asserting if the caller requests an // out of range index warnResize = false; } Array(const Array &a) { *this = (Array&)a; } Array &operator =(const Array &a) { *((LArray*)this) = a; fixed = a.fixed; warnResize = a.warnResize; return *this; } Array &operator +=(const Array &a) { SetFixedLength(false); Add(a); SetFixedLength(true); return *this; } Array &operator +=(const LArray &a) { SetFixedLength(false); Add(a); SetFixedLength(true); return *this; } }; /// Empty constructor LString() { Str = NULL; } // This odd looking constructor allows the object to be used as the value type // in a GHashTable, where the initialiser is '0', an integer. LString(int i) { Str = NULL; } #ifndef _MSC_VER // This odd looking constructor allows the object to be used as the value type // in a GHashTable, where the initialiser is '0', an integer. LString(long int i) { Str = NULL; } #endif /// String constructor LString(const char *str, ptrdiff_t bytes) { Str = NULL; Set(str, bytes); } /// const char* constructor LString(const char *str) { Str = NULL; Set(str); } /// const char16* constructor LString(const wchar_t *str, ptrdiff_t wchars = -1) { Str = NULL; SetW(str, wchars); } /// Utf32 constructor LString(const uint32_t *utf32, ptrdiff_t wchars = -1) { Str = NULL; if (sizeof(*utf32) == sizeof(char16)) { // 1:1 mapping SetW((char16*)utf32, wchars); } else if (sizeof(char16) == 2) // Ie windows: { // Convert UTF32 to utf-8 if (!utf32) return; // Measure size: ptrdiff_t bytes = 0; uint8_t utf8[6]; for (ptrdiff_t i=0; (wchars >= 0 && i < wchars) || (wchars < 0 && utf32[i]); i++) { uint8_t *out = utf8; ssize_t outBufSize = sizeof(utf8); if (!LgiUtf32To8(utf32[i], out, outBufSize)) break; bytes += out - utf8; } // Create memory buffer: if (!Length(bytes)) return; // Convert string: uint8_t *p = (uint8_t*) Str->Str; auto end = p + Str->Len; for (ptrdiff_t i=0; (wchars >= 0 && i < wchars) || (wchars < 0 && utf32[i]); i++) { ssize_t outBufSize = end - p; if (!LgiUtf32To8(utf32[i], p, outBufSize)) break; } assert((char*)p == Str->End()); *p = 0; // NULL terminate string } else assert(!"No valid mapping for UTF32 to char16?"); } /* #if defined(_WIN32) || defined(MAC) /// const uint32* constructor LString(const uint32_t *str, ptrdiff_t chars = -1) { Str = NULL; if (chars < 0) chars = Strlen(str); ptrdiff_t utf_len = 0; const uint32_t *end = str + chars; const uint32_t *c = str; while (c < end) { uint8_t utf[6], *u = utf; ssize_t len = sizeof(utf); if (!LgiUtf32To8(*c++, u, len)) break; utf_len += u - utf; } if (Length((uint32_t)utf_len)) { c = str; uint8_t *u = (uint8_t*)Str->Str; ssize_t len = Str->Len; while (c < end) { if (!LgiUtf32To8(*c++, u, len)) break; } *u++ = 0; } } #endif */ /// LString constructor LString(const LString &s) { Str = s.Str; if (Str) Str->Refs++; } // Move constructor LString(LString&& s) { Str = s.Str; s.Str = NULL; } ~LString() { Empty(); } /// Removes a reference to the string and deletes if needed void Empty() { if (!Str) return; Str->Refs--; if (Str->Refs < 0) { assert(!"Invalid refs"); } if (Str->Refs == 0) { free(Str); #ifdef LGI_UNIT_TESTS LString_RefStrCount--; #endif } Str = NULL; } /// Returns the pointer to the string data char *Get() const { return Str ? Str->Str : NULL; } /// Sets the string to a new value bool Set ( /// Can be a pointer to string data or NULL to create an empty buffer (requires valid length) const char *str, /// Byte length of input string or -1 to copy till the NULL terminator. ptrdiff_t bytes = -1 ) { Empty(); if (bytes < 0) { if (str) bytes = strlen(str); else return false; } Str = (RefStr*)malloc(sizeof(RefStr) + bytes); if (!Str) return false; Str->Refs = 1; Str->Len = (uint32_t)bytes; #ifdef LGI_UNIT_TESTS LString_RefStrCount++; #endif if (str) memcpy(Str->Str, str, bytes); Str->Str[bytes] = 0; return true; } /// Sets the string to a new value bool SetW ( /// Can be a pointer to string data or NULL to create an empty buffer (requires valid length) const wchar_t *str, /// Number of 'char16' values in the input string or -1 to copy till the NULL terminator. ptrdiff_t wchars = -1 ) { size_t Sz = WideToUtf8Len(str, wchars); if (Length(Sz)) { #ifdef _MSC_VER const uint16 *i = (const uint16*) str; ssize_t InLen = wchars >= 0 ? wchars << 1 : 0x7fffffff; assert(sizeof(*i) == sizeof(*str)); uint8_t *o = (uint8_t*)Str->Str; ssize_t OutLen = Str->Len; for (uint32_t ch; ch = LgiUtf16To32(i, InLen); ) { if (!LgiUtf32To8(ch, o, OutLen)) { *o = 0; break; } } #else uint8_t *o = (uint8_t*)Str->Str; ssize_t OutLen = Str->Len; if (wchars >= 0) { const wchar_t *end = str + wchars; for (const wchar_t *ch = str; ch < end; ch++) { if (!LgiUtf32To8(*ch, o, OutLen)) { *o = 0; break; } } } else { for (const wchar_t *ch = str; *ch; ch++) { if (!LgiUtf32To8(*ch, o, OutLen)) { *o = 0; break; } } } #endif *o = 0; } return true; } /// Equality operator (case sensitive) bool operator ==(const LString &s) { const char *a = Get(); const char *b = s.Get(); if (!a && !b) return true; if (!a || !b) return false; return !strcmp(a, b); } bool operator !=(const LString &s) { return !(*this == s); } // Equality function (default: case insensitive, as the operator== is case sensitive) bool Equals(const char *b, bool CaseInsensitive = true) const { const char *a = Get(); if (!a && !b) return true; if (!a || !b) return false; return !(CaseInsensitive ? _stricmp(a, b) : strcmp(a, b)); } // Equality function (default: case insensitive, as the operator== is case sensitive) bool Equals(const LString &s, bool CaseInsensitive = true) const { const char *a = Get(); const char *b = s.Get(); if (!a && !b) return true; if (!a || !b) return false; return !(CaseInsensitive ? _stricmp(a, b) : strcmp(a, b)); } /// Assignment operator to copy one string to another LString &operator =(const LString &s) { if (this != &s) { Empty(); Str = s.Str; if (Str) Str->Refs++; } return *this; } /// Equality with a C string (case sensitive) bool operator ==(const char *b) { const char *a = Get(); if (!a && !b) return true; if (!a || !b) return false; return !strcmp(a, b); } bool operator !=(const char *b) { return !(*this == b); } /// Assignment operators LString &operator =(const char *s) { if (Str == NULL || s < Str->Str || s > Str->End()) { Empty(); Set(s); } else if (s != Str->Str) { // Special case for setting it to part of itself // If you try and set a string to the start, it's a NOP ptrdiff_t Off = s - Str->Str; memmove(Str->Str, s, Str->Len - Off + 1); Str->Len -= (uint32_t)Off; } return *this; } LString &operator =(const wchar_t *s) { SetW(s); return *this; } LString &operator =(int val) { char n[32]; sprintf_s(n, sizeof(n), "%i", val); Set(n); return *this; } LString &operator =(int64 val) { char n[32]; sprintf_s(n, sizeof(n), "%" PRId64, (int64_t)val); Set(n); return *this; } /// Cast to C string operator operator char *() const { return Str && Str->Len > 0 ? Str->Str : NULL; } int operator -(const LString &s) const { return Stricmp(Get(), s.Get()); } /// Concatenation operator LString operator +(const LString &s) { LString Ret; size_t Len = Length() + s.Length(); if (Ret.Set(NULL, Len)) { char *p = Ret.Get(); if (p) { if (Str) { memcpy(p, Str->Str, Str->Len); p += Str->Len; } if (s.Str) { memcpy(p, s.Str->Str, s.Str->Len); p += s.Str->Len; } *p++ = 0; } } return Ret; } /// Concatenation / assignment operator LString &operator +=(const LString &s) { ssize_t Len = Length() + s.Length(); ssize_t Alloc = sizeof(RefStr) + Len; RefStr *rs = (RefStr*)malloc(Alloc); if (rs) { rs->Refs = 1; rs->Len = Len; #ifdef LGI_UNIT_TESTS LString_RefStrCount++; #endif char *p = rs->Str; if (Str) { memcpy(p, Str->Str, Str->Len); p += Str->Len; } if (s.Str) { memcpy(p, s.Str->Str, s.Str->Len); p += s.Str->Len; } *p++ = 0; assert(p - (char*)rs <= Alloc); Empty(); Str = rs; } return *this; } LString operator *(ssize_t mul) { LString s; if (Str) { s.Length(Str->Len * mul); char *out = s.Get(); for (ssize_t i=0; iLen) memcpy(out, Str->Str, Str->Len); *out = 0; } return s; } /// Gets the length in bytes size_t Length() const { return Str ? Str->Len : 0; } size_t Length(ssize_t NewLen) { if (NewLen < 0) { LAssert(!"No negative string len."); Empty(); } else if (Str) { if (NewLen <= (ssize_t)Str->Len) { Str->Len = NewLen; Str->Str[NewLen] = 0; } else { RefStr *n = (RefStr*)malloc(sizeof(RefStr) + NewLen); if (n) { n->Len = NewLen; n->Refs = 1; memcpy(n->Str, Str->Str, Str->Len); n->Str[Str->Len] = 0; // NULL terminate... Empty(); // Deref the old string... Str = n; } else return 0; } } else { Str = (RefStr*)malloc(sizeof(RefStr) + NewLen); if (Str) { Str->Len = NewLen; Str->Refs = 1; Str->Str[0] = 0; // NULL terminate... } else return 0; } return Str ? Str->Len : 0; } /// Splits the string into parts using a separator Array Split(const char *Sep, int Count = -1, bool CaseSen = false) { Array a; if (Str && Sep) { const char *s = Str->Str, *Prev = s; const char *end = s + Str->Len; size_t SepLen = strlen(Sep); if (s[Str->Len] == 0) { while ((s = CaseSen ? strstr(s, Sep) : Stristr(s, Sep))) { if (s > Prev) a.New().Set(Prev, s - Prev); s += SepLen; Prev = s; if (Count > 0 && a.Length() >= (uint32_t)Count) break; } if (Prev < end) a.New().Set(Prev, end - Prev); a.SetFixedLength(); } else assert(!"String not NULL terminated."); } return a; } /// Splits the string into parts using a separator Array RSplit(const char *Sep, int Count = -1, bool CaseSen = false) { Array a; if (Str && Sep) { const char *s = Get(); size_t SepLen = strlen(Sep); LArray seps; while ((s = CaseSen ? strstr(s, Sep) : Stristr(s, Sep))) { seps.Add(s); s += SepLen; } ssize_t i, Last = seps.Length() - 1; LString p; for (i=Last; i>=0; i--) { const char *part = seps[i] + SepLen; if (i == Last) p.Set(part); else p.Set(part, seps[i+1]-part); a.AddAt(0, p); if (Count > 0 && a.Length() >= (uint32_t)Count) break; } const char *End = seps[i > 0 ? i : 0]; p.Set(Get(), End - Get()); a.AddAt(0, p); } a.SetFixedLength(true, false); return a; } /// Splits the string into parts using delimiter chars Array SplitDelimit(const char *Delimiters = NULL, int Count = -1, bool GroupDelimiters = true) const { Array a; if (Str) { const char *delim = Delimiters ? Delimiters : " \t\r\n"; const char *s = Get(), *end = s + Length(); while (s < end) { // Skip over non-delimiters const char *e = s; while (e < end && !strchr(delim, *e)) e++; if (e > s || !GroupDelimiters) a.New().Set(s, e - s); s = e; if (*s) s++; if (GroupDelimiters) { // Skip any delimiters while (s < end && strchr(delim, *s)) s++; } // Create the string if (Count > 0 && a.Length() >= (uint32_t)Count) break; } if ( s < end || ( !GroupDelimiters && s > Get() && strchr(delim, s[-1]) ) ) a.New().Set(s); } a.SetFixedLength(true, false); return a; } /// Joins an array of strings using a separator LString Join(const LArray &a) { LString ret; if (a.Length() == 0) return ret; char *Sep = Get(); size_t SepLen = Sep ? strlen(Sep) : 0; size_t Bytes = SepLen * (a.Length() - 1); LArray ALen; for (unsigned i=0; iStr; LArray Matches; while ((Match = (CaseSen ? strstr(Match, Old) : Stristr(Match, Old)))) { Matches.Add(Match); if (Count >= 0 && (int)Matches.Length() >= Count) break; Match += OldLen; } size_t NewSize = Str->Len + (Matches.Length() * (NewLen - OldLen)); s.Length((uint32_t)NewSize); char *Out = s.Get(); char *In = Str->Str; // For each match... for (unsigned i=0; iEnd(); if (In < End) { ptrdiff_t Bytes = End - In; memcpy(Out, In, Bytes); Out += Bytes; } assert(Out - s.Get() == NewSize); // Check we got the size right... *Out = 0; // Null terminate } else { s = *this; } return s; } /// Convert string to double double Float() { return Str ? atof(Str->Str) : NAN; } /// Convert to integer int64 Int(int Base = 10, int64 Default = -1) { if (!Str) return Default; if ( Str->Len > 2 && Str->Str[0] == '0' && ( Str->Str[1] == 'x' || Str->Str[1] == 'X' ) ) { return Atoi(Str->Str + 2, 16); } return Atoi(Str->Str, Base); } /// Checks if the string is a number bool IsNumeric() { if (!Str) return false; for (char *s = Str->Str; *s; s++) { if (!IsDigit(*s) && !strchr("e-+.", *s)) return false; } return true; } /// Check for non whitespace - bool IsEmpty() + bool IsEmpty() const { if (!Str) return true; for (char *s = Str->Str; *s; s++) { if (*s != ' ' && *s != '\t' && *s != '\r' && *s != '\n') return false; } return true; } /// Check string is UTF8 bool IsUtf8() { return Str ? LIsUtf8(Str->Str, Str->Len) : true; } /// Reverses all the characters in the string LString Reverse() { LString s; if (Length() > 0) { s = Str->Str; for (auto *a = s.Get(), *b = s.Get() + s.Length() - 1; a < b; a++, b--) { char t = *a; *a = *b; *b = t; } } return s; } /// Find a sub-string ssize_t Find(const char *needle, ssize_t start = 0, ssize_t end = -1) { if (!needle) return -1; char *c = Get(); if (!c) return -1; char *pos = c + start; while (c < pos) { if (!*c) return -1; c++; } char *found = (end > 0) ? Strnstr(c, needle, end - start) : strstr(c, needle); return (found) ? found - Get() : -1; } /// Reverse find a string (starting from the end) ssize_t RFind(const char *needle, int start = 0, ssize_t end = -1) { if (!needle) return -1; char *c = Get(); if (!c) return -1; char *pos = c + start; while (c < pos) { if (!*c) return -1; c++; } char *found, *prev = NULL; size_t str_len = strlen(needle); while (( found = ( (end > 0) ? Strnstr(c, needle, end - start) : strstr(c, needle) ) )) { prev = found; c = found + str_len; } return (prev) ? prev - Get() : -1; } /// Returns a copy of the string with all the characters converted to lower case LString Lower() { LString s; if (Str && s.Set(Str->Str, Str->Len)) Strlwr(s.Get()); return s; } /// Returns a copy of the string with all the characters converted to upper case LString Upper() { LString s; if (Str && s.Set(Str->Str, Str->Len)) Strupr(s.Get()); return s; } void Swap(LString &s) { LSwap(Str, s.Str); } /// Gets the character at 'index' int operator() (ssize_t index) const { if (!Str) return 0; char *c = Str->Str; if (index < 0) { size_t idx = Str->Len + index; return c[idx]; } else if (index < (int)Str->Len) { return c[index]; } return 0; } /// Gets the string between at 'start' and 'end' (not including the end'th character) LString operator() (ptrdiff_t start, ptrdiff_t end) { LString s; if (Str) { ptrdiff_t start_idx = start < 0 ? Str->Len + start + 1 : start; if (start_idx >= 0 && (uint32_t)start_idx < Str->Len) { ptrdiff_t end_idx = end < 0 ? Str->Len + end + 1 : end; if (end_idx >= start_idx && (uint32_t)end_idx <= Str->Len) s.Set(Str->Str + start_idx, end_idx - start_idx); } } return s; } /// Strip off any leading and trailing characters from 'set' (or whitespace if NULL) LString Strip(const char *set = NULL) { LString ret; _strip(ret, set, true, true); return ret; } /// Strip off any leading characters from 'set' (or whitespace if NULL) LString LStrip(const char *set = NULL) { LString ret; _strip(ret, set, true, false); return ret; } /// Strip off any trailing characters from 'set' (or whitespace if NULL) LString RStrip(const char *set = NULL) { LString ret; _strip(ret, set, false, true); return ret; } /// Prints a formatted string to this object int Printf(const char *Fmt, ...) { Empty(); va_list Arg; va_start(Arg, Fmt); int Bytes = Printf(Arg, Fmt); va_end(Arg); return Bytes; } // Formats a string and returns it static LString Fmt(const char *Fmt, ...) { LString s; va_list Arg; va_start(Arg, Fmt); s.Printf(Arg, Fmt); va_end(Arg); return s; } /// Prints a varargs string int Printf(va_list &Arg, const char *Fmt) { Empty(); return LPrintf(*this, Fmt, Arg); } static LString Escape(const char *In, ssize_t Len = -1, const char *Chars = "\r\n\b\\\'\"", char hexMode = 'x') { LString s; if (In && Chars) { char Buf[256]; int Ch = 0; if (Len < 0) Len = strlen(In); while (Len-- > 0) { if (Ch > sizeof(Buf)-16) { // Buffer full, add substring to 's' Buf[Ch] = 0; s += Buf; Ch = 0; } if (strchr(Chars, *In)) { Buf[Ch++] = '\\'; switch (*In) { #undef EscChar #define EscChar(from, to) \ case from: Buf[Ch++] = to; break EscChar('\n', 'n'); EscChar('\r', 'r'); EscChar('\\', '\\'); EscChar('\b', 'b'); EscChar('\a', 'a'); EscChar('\t', 't'); EscChar('\v', 'v'); EscChar('\'', '\''); EscChar('\"', '\"'); EscChar('&', '&'); EscChar('?', '?'); EscChar(' ', ' '); #undef EscChar default: if (hexMode == 'u') Ch += sprintf_s(Buf+Ch, sizeof(Buf)-Ch, "u%04x", *In); else Ch += sprintf_s(Buf+Ch, sizeof(Buf)-Ch, "x%02x", *In); break; } } else Buf[Ch++] = *In; In++; } if (Ch > 0) { Buf[Ch] = 0; s += Buf; } } return s; } LString Escape() { return LString::Escape(Get(), Length()); } template static LString UnEscape(const T *In, ssize_t Len = -1) { if (!In) return LString(); LString s; if (Len < 0) // As memory allocation/copying around data is far slower then // just scanning the string for size... don't try and chunk the // processing. Len = Strlen(In); if (!s.Length(Len)) return LString(); auto *Out = s.Get(); auto *End = In + Len; auto DoHex = [&](int chars) { int buf = 0; for (int i=0; i= '0' && *In <= '9') buf |= *In - '0'; else if (*In >= 'a' && *In <= 'f') buf |= *In - 'a' + 10; else if (*In >= 'A' && *In <= 'F') buf |= *In - 'A' + 10; else return; In++; } *Out++ = buf; In--; }; while (In < End) { if (*In == '\\') { In++; switch (*In) { case 'n': case 'N': *Out++ = '\n'; break; case 'r': case 'R': *Out++ = '\r'; break; case 'b': case 'B': *Out++ = '\b'; break; case 't': case 'T': *Out++ = '\t'; break; default: *Out++ = *In; break; case 0: break; case 'x': case 'X': In++; // consume the 'x' DoHex(2); break; case 'u': case 'U': In++; // consume the 'u' DoHex(4); break; } if (*In) In++; else break; } else *Out++ = *In++; } // Trim excess size off string s.Length(Out - s.Get()); return s; } static LString UnEscape(LString s) { return UnEscape(s.Get(), s.Length()); } #if defined(__GTK_H__) #elif defined(MAC) // && __COREFOUNDATION_CFBASE__ LString(const CFStringRef r) { Str = NULL; *this = r; } LString &operator =(CFStringRef r) { if (r) { CFIndex length = CFStringGetLength(r); CFRange range = CFRangeMake(0, length); CFIndex usedBufLen = 0; CFIndex slen = CFStringGetBytes(r, range, kCFStringEncodingUTF8, '?', false, NULL, 0, &usedBufLen); if (Set(NULL, usedBufLen)) { slen = CFStringGetBytes( r, range, kCFStringEncodingUTF8, '?', false, (UInt8*)Str->Str, Str->Len, &usedBufLen); Str->Str[usedBufLen] = 0; // NULL terminate } } return *this; } CFStringRef CreateStringRef() { char *s = Get(); if (!s) return NULL; return CFStringCreateWithCString(kCFAllocatorDefault, s, kCFStringEncodingUTF8); } #ifdef __OBJC__ NSString *NsStr() { if (Str) return [[NSString alloc] initWithBytes:Str->Str length:Str->Len encoding:NSUTF8StringEncoding]; return nil; } bool operator=(NSString *const s) { *this = [s UTF8String]; return !IsEmpty(); } LString(NSString *const s) { Str = NULL; *this = [s UTF8String]; } #endif #endif }; diff --git a/lvc/src/VcFolder.cpp b/lvc/src/VcFolder.cpp --- a/lvc/src/VcFolder.cpp +++ b/lvc/src/VcFolder.cpp @@ -1,5151 +1,5155 @@ #include "Lvc.h" #include "lgi/common/Combo.h" #include "lgi/common/ClipBoard.h" #include "lgi/common/Json.h" #include "lgi/common/ProgressDlg.h" #include "lgi/common/IniFile.h" #include "resdefs.h" #ifndef CALL_MEMBER_FN #define CALL_MEMBER_FN(object,ptrToMember) ((object).*(ptrToMember)) #endif #define MAX_AUTO_RESIZE_ITEMS 2000 #define PROFILE_FN 0 #if PROFILE_FN #define PROF(s) Prof.Add(s) #else #define PROF(s) #endif class TmpFile : public LFile { int Status; LString Hint; public: TmpFile(const char *hint = NULL) { Status = 0; if (hint) Hint = hint; else Hint = "_lvc"; } LFile &Create() { LFile::Path p(LSP_TEMP); p += Hint; do { char s[256]; sprintf_s(s, sizeof(s), "../%s%i.tmp", Hint.Get(), LRand()); p += s; } while (p.Exists()); Status = LFile::Open(p.GetFull(), O_READWRITE); return *this; } }; bool TerminalAt(LString Path) { #if defined(MAC) const char *Locations[] = { "/System/Applications/Utilities/Terminal.app", "/Applications/Utilities/Terminal.app", NULL }; for (size_t i=0; Locations[i]; i++) { if (LFileExists(Locations[i])) { LString term; term.Printf("%s/Contents/MacOS/Terminal", Locations[i]); return LExecute(term, Path); } } #elif defined(WINDOWS) TCHAR w[MAX_PATH_LEN]; auto r = GetWindowsDirectory(w, CountOf(w)); if (r > 0) { LFile::Path p = LString(w); p += "system32\\cmd.exe"; FileDev->SetCurrentFolder(Path); return LExecute(p); } #elif defined(LINUX) LExecute("gnome-terminal", NULL, Path); #endif return false; } int Ver2Int(LString v) { auto p = v.Split("."); int i = 0; for (auto s : p) { auto Int = s.Int(); if (Int < 256) { i <<= 8; i |= (uint8_t)Int; } else { LAssert(0); return 0; } } return i; } int ToolVersion[VcMax] = {0}; #define DEBUG_READER_THREAD 0 #if DEBUG_READER_THREAD #define LOG_READER(...) printf(__VA_ARGS__) #else #define LOG_READER(...) #endif ReaderThread::ReaderThread(VersionCtrl vcs, LAutoPtr p, LStream *out) : LThread("ReaderThread") { Vcs = vcs; Process = p; Out = out; Result = -1; FilterCount = 0; // We don't start this thread immediately... because the number of threads is scaled to the system // resources, particularly CPU cores. } ReaderThread::~ReaderThread() { Out = NULL; while (!IsExited()) LSleep(1); } const char *HgFilter = "We\'re removing Mercurial support"; const char *CvsKill = "No such file or directory"; int ReaderThread::OnLine(char *s, ssize_t len) { switch (Vcs) { case VcHg: { if (strnistr(s, HgFilter, len)) FilterCount = 4; if (FilterCount > 0) { FilterCount--; return 0; } else if (LString(s, len).Strip().Equals("remote:")) { return 0; } break; } case VcCvs: { if (strnistr(s, CvsKill, len)) return -1; break; } default: break; } return 1; } bool ReaderThread::OnData(char *Buf, ssize_t &r) { LOG_READER("OnData %i\n", (int)r); #if 1 char *Start = Buf; for (char *c = Buf; c < Buf + r;) { bool nl = *c == '\n'; c++; if (nl) { int Result = OnLine(Start, c - Start); if (Result < 0) { // Kill process and exit thread. Process->Kill(); return false; } if (Result == 0) { ssize_t LineLen = c - Start; ssize_t NextLine = c - Buf; ssize_t Remain = r - NextLine; if (Remain > 0) memmove(Start, Buf + NextLine, Remain); r -= LineLen; c = Start; } else Start = c; } } #endif Out->Write(Buf, r); return true; } int ReaderThread::Main() { bool b = Process->Start(true, false); if (!b) { LString s("Process->Start failed.\n"); Out->Write(s.Get(), s.Length(), ErrSubProcessFailed); return ErrSubProcessFailed; } char Buf[1024]; ssize_t r; LOG_READER("%s:%i - starting reader loop, pid=%i\n", _FL, Process->Handle()); while (Process->IsRunning()) { if (Out) { LOG_READER("%s:%i - starting read.\n", _FL); r = Process->Read(Buf, sizeof(Buf)); LOG_READER("%s:%i - read=%i.\n", _FL, (int)r); if (r > 0) { if (!OnData(Buf, r)) return -1; } } else { Process->Kill(); return -1; break; } } LOG_READER("%s:%i - process loop done.\n", _FL); if (Out) { while ((r = Process->Read(Buf, sizeof(Buf))) > 0) OnData(Buf, r); } LOG_READER("%s:%i - loop done.\n", _FL); Result = (int) Process->GetExitValue(); #if _DEBUG if (Result) printf("%s:%i - Process err: %i 0x%x\n", _FL, Result, Result); #endif return Result; } ///////////////////////////////////////////////////////////////////////////////////////////// int VcFolder::CmdMaxThreads = 0; int VcFolder::CmdActiveThreads = 0; void VcFolder::Init(AppPriv *priv) { if (!CmdMaxThreads) CmdMaxThreads = LAppInst->GetCpuCount(); d = priv; Expanded(false); Insert(Tmp = new LTreeItem); Tmp->SetText("Loading..."); LAssert(d != NULL); } VcFolder::VcFolder(AppPriv *priv, const char *uri) { Init(priv); Uri.Set(uri); GetType(); } VcFolder::VcFolder(AppPriv *priv, LXmlTag *t) { Init(priv); Serialize(t, false); } VcFolder::~VcFolder() { if (d->CurFolder == this) d->CurFolder = NULL; Log.DeleteObjects(); } VersionCtrl VcFolder::GetType() { if (Type == VcNone) Type = d->DetectVcs(this); return Type; } bool VcFolder::IsLocal() { return Uri.IsProtocol("file"); } const char *VcFolder::LocalPath() { if (!Uri.IsProtocol("file") || Uri.sPath.IsEmpty()) { LAssert(!"Shouldn't call this if not a file path."); return NULL; } auto c = Uri.sPath.Get(); #ifdef WINDOWS if (*c == '/') c++; #endif return c; } const char *VcFolder::GetText(int Col) { switch (Col) { case 0: { if (Uri.IsFile()) Cache = LocalPath(); else Cache.Printf("%s%s", Uri.sHost.Get(), Uri.sPath.Get()); if (Cmds.Length()) Cache += " (...)"; return Cache; } case 1: { CountCache.Printf("%i/%i", Unpulled, Unpushed); CountCache = CountCache.Replace("-1", "--"); return CountCache; } } return NULL; } bool VcFolder::Serialize(LXmlTag *t, bool Write) { if (Write) t->SetContent(Uri.ToString()); else { LString s = t->GetContent(); bool isUri = s.Find("://") >= 0; if (isUri) Uri.Set(s); else Uri.SetFile(s); } return true; } LXmlTag *VcFolder::Save() { LXmlTag *t = new LXmlTag(OPT_Folder); if (t) Serialize(t, true); return t; } const char *VcFolder::GetVcName() { if (!VcCmd) VcCmd = d->GetVcName(GetType()); return VcCmd; } char VcFolder::GetPathSep() { if (Uri.IsFile()) return DIR_CHAR; return '/'; // FIXME: Assumption is that the remote system is unix based. } bool VcFolder::RunCmd(const char *Args, LoggingType Logging, std::function Callback) { Result Ret; Ret.Code = -1; const char *Exe = GetVcName(); if (!Exe || CmdErrors > 2) return false; if (Uri.IsFile()) { new ProcessCallback(Exe, Args, LocalPath(), Logging == LogNone ? d->Log : NULL, GetTree()->GetWindow(), Callback); } else { LAssert(!"Impl me."); return false; } return true; } #if HAS_LIBSSH SshConnection::LoggingType Convert(LoggingType t) { switch (t) { case LogNormal: case LogSilo: return SshConnection::LogInfo; case LogDebug: return SshConnection::LogDebug; } return SshConnection::LogNone; } #endif bool VcFolder::StartCmd(const char *Args, ParseFn Parser, ParseParams *Params, LoggingType Logging) { const char *Exe = GetVcName(); if (!Exe) return false; if (CmdErrors > 2) return false; if (Uri.IsFile()) { if (d->Log && Logging != LogSilo) d->Log->Print("%s %s\n", Exe, Args); LAutoPtr Process(new LSubProcess(Exe, Args)); if (!Process) return false; Process->SetInitFolder(Params && Params->AltInitPath ? Params->AltInitPath.Get() : LocalPath()); #if 0//def MAC // Mac GUI apps don't share the terminal path, so this overrides that and make it work auto Path = LGetPath(); if (Path.Length()) { LString Tmp = LString(LGI_PATH_SEPARATOR).Join(Path); printf("Tmp='%s'\n", Tmp.Get()); Process->SetEnvironment("PATH", Tmp); } #endif LString::Array Ctx; Ctx.SetFixedLength(false); Ctx.Add(LocalPath()); Ctx.Add(Exe); Ctx.Add(Args); LAutoPtr c(new Cmd(Ctx, Logging, d->Log)); if (!c) return false; c->PostOp = Parser; c->Params.Reset(Params); c->Rd.Reset(new ReaderThread(GetType(), Process, c)); Cmds.Add(c.Release()); } else { #if HAS_LIBSSH auto c = d->GetConnection(Uri.ToString()); if (!c) return false; if (!c->Command(this, Exe, Args, Parser, Params, Convert(Logging))) return false; #endif } Update(); return true; } int LogDateCmp(LListItem *a, LListItem *b, NativeInt Data) { VcCommit *A = dynamic_cast(a); VcCommit *B = dynamic_cast(b); if ((A != NULL) ^ (B != NULL)) { // This handles keeping the "working folder" list item at the top return (A != NULL) - (B != NULL); } // Sort the by date from most recent to least return -A->GetTs().Compare(&B->GetTs()); } void VcFolder::AddGitName(LString Hash, LString Name) { if (!Hash || !Name) { LAssert(!"Param error"); return; } LString Existing = GitNames.Find(Hash); if (Existing) GitNames.Add(Hash, Existing + "," + Name); else GitNames.Add(Hash, Name); } LString VcFolder::GetGitNames(LString Hash) { LString Short = Hash(0, 11); return GitNames.Find(Short); } bool VcFolder::ParseBranches(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcGit: { LString::Array a = s.SplitDelimit("\r\n"); for (auto &l: a) { LString::Array c; char *s = l.Get(); while (*s && IsWhite(*s)) s++; bool IsCur = *s == '*'; if (IsCur) s++; while (*s && IsWhite(*s)) s++; if (*s == '(') { s++; auto e = strchr(s, ')'); if (e) { c.New().Set(s, e - s); e++; c += LString(e).SplitDelimit(" \t"); } } else { c = LString(s).SplitDelimit(" \t"); } if (c.Length() < 1) { d->Log->Print("%s:%i - Too few parts in line '%s'\n", _FL, l.Get()); continue; } if (IsCur) SetCurrentBranch(c[0]); AddGitName(c[1], c[0]); Branches.Add(c[0], new VcBranch(c[0], c[1])); } break; } case VcHg: { auto a = s.SplitDelimit("\r\n"); for (auto b: a) { if (b.Find("inactive") > 0) continue; auto name = b(0, 28).Strip(); auto refs = b(28, -1).SplitDelimit()[0].SplitDelimit(":"); auto branch = Branches.Find(name); if (branch) branch->Hash = refs.Last(); else Branches.Add(name, new VcBranch(name, refs.Last())); } if (Params && Params->Str.Equals("CountToTip")) CountToTip(); break; } default: { break; } } IsBranches = Result ? StatusError : StatusNone; OnBranchesChange(); return false; } void VcFolder::GetRemoteUrl(std::function Callback) { LAutoPtr p(new ParseParams); p->Callback = Callback; switch (GetType()) { case VcGit: { StartCmd("config --get remote.origin.url", NULL, p.Release()); break; } case VcSvn: { StartCmd("info --show-item=url", NULL, p.Release()); break; } case VcHg: { StartCmd("paths default", NULL, p.Release()); break; } default: break; } } void VcFolder::SelectCommit(LWindow *Parent, LString Commit, LString Path) { bool requireFullMatch = true; if (GetType() == VcGit) requireFullMatch = false; // This function find the given commit and selects it such that the diffs are displayed in the file list VcCommit *ExistingMatch = NULL; for (auto c: Log) { char *rev = c->GetRev(); bool match = requireFullMatch ? Commit.Equals(rev) : Strstr(rev, Commit.Get()) != NULL; if (match) { ExistingMatch = c; break; } } FileToSelect = Path; if (ExistingMatch) { ExistingMatch->Select(true); } else { // If the commit isn't there, it's likely that the log item limit was reached before the commit was // found. In which case we should go get just that commit and add it: d->Files->Empty(); // Diff just that ref: LString a; switch (GetType()) { case VcGit: { a.Printf("diff %s~ %s", Commit.Get(), Commit.Get()); StartCmd(a, &VcFolder::ParseSelectCommit); break; } case VcHg: { a.Printf("log -p -r %s", Commit.Get()); StartCmd(a, &VcFolder::ParseSelectCommit); break; } default: { NoImplementation(_FL); break; } } // if (Parent) LgiMsg(Parent, "The commit '%s' wasn't found", AppName, MB_OK, Commit.Get()); } } bool VcFolder::ParseSelectCommit(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcGit: case VcHg: case VcSvn: case VcCvs: { ParseDiff(Result, s, Params); break; } default: { NoImplementation(_FL); break; } } return false; } void VcFolder::OnBranchesChange() { auto *w = d->Tree->GetWindow(); if (!w || !LTreeItem::Select()) return; if (Branches.Length()) { // Set the colours up LString Default; for (auto b: Branches) { if (!stricmp(b.key, "default") || !stricmp(b.key, "trunk")) Default = b.key; /* else printf("Other=%s\n", b.key); */ } int Idx = 1; for (auto b: Branches) { if (!b.value->Colour.IsValid()) { if (Default && !stricmp(b.key, Default)) b.value->Colour = GetPaletteColour(0); else b.value->Colour = GetPaletteColour(Idx++); } } } UpdateBranchUi(); } void VcFolder::DefaultFields() { if (Fields.Length() == 0) { switch (GetType()) { case VcHg: { Fields.Add(LGraph); Fields.Add(LIndex); Fields.Add(LRevision); Fields.Add(LBranch); Fields.Add(LAuthor); Fields.Add(LTime); Fields.Add(LMessageTxt); break; } case VcGit: { Fields.Add(LGraph); Fields.Add(LRevision); Fields.Add(LBranch); Fields.Add(LAuthor); Fields.Add(LTime); Fields.Add(LMessageTxt); break; } default: { Fields.Add(LGraph); Fields.Add(LRevision); Fields.Add(LAuthor); Fields.Add(LTime); Fields.Add(LMessageTxt); break; } } } } int VcFolder::IndexOfCommitField(CommitField fld) { return (int)Fields.IndexOf(fld); } void VcFolder::UpdateColumns(LList *lst) { if (!lst) lst = d->Commits; lst->EmptyColumns(); for (auto c: Fields) { switch (c) { case LGraph: lst->AddColumn("---", 60); break; case LIndex: lst->AddColumn("Index", 60); break; case LBranch: lst->AddColumn("Branch", 60); break; case LRevision: lst->AddColumn("Revision", 60); break; case LAuthor: lst->AddColumn("Author", 240); break; case LTime: lst->AddColumn("Date", 130); break; case LMessageTxt: lst->AddColumn("Message", 700); break; default: LAssert(0); break; } } } void VcFolder::FilterCurrentFiles() { LArray All; d->Files->GetAll(All); // Update the display property for (auto i: All) { auto fn = i->GetText(COL_FILENAME); bool vis = !d->FileFilter || Stristr(fn, d->FileFilter.Get()); i->GetCss(true)->Display(vis ? LCss::DispBlock : LCss::DispNone); // LgiTrace("Filter '%s' by '%s' = %i\n", fn, d->FileFilter.Get(), vis); } d->Files->Sort(0); d->Files->UpdateAllItems(); d->Files->ResizeColumnsToContent(); } void VcFolder::UpdateAuthorUi() { - if (AuthorEmail && AuthorName) - { - auto author = LString::Fmt("%s <%s>", AuthorName.Get(), AuthorEmail.Get()); - d->Wnd()->SetCtrlName(IDC_AUTHOR, author); - } + if (AuthorLocal) + d->Wnd()->SetCtrlName(IDC_AUTHOR, AuthorLocal.ToString()); + else if (AuthorGlobal) + d->Wnd()->SetCtrlName(IDC_AUTHOR, AuthorGlobal.ToString()); } LString VcFolder::GetConfigFile(bool local) { switch (GetType()) { case VcHg: { LFile::Path p; if (local) { p = LFile::Path(LocalPath()) / ".hg" / "hgrc"; } else { p = LFile::Path(LSP_HOME) / ".hgrc"; if (!p.Exists()) p = LFile::Path(LSP_HOME) / "mercurial.ini"; } d->Log->Print("%s: %i\n", p.GetFull().Get(), p.Exists()); if (p.Exists()) return p.GetFull(); break; } default: { NoImplementation(_FL); return false; } } return LString(); } - - bool VcFolder::GetAuthor(bool local, std::function callback) { auto scope = local ? "--local" : "--global"; + auto target = local ? &AuthorLocal : &AuthorGlobal; switch (GetType()) { case VcGit: { + if (target->InProgress) + return true; + auto params = new ParseParams; - params->Callback = [this, callback](auto code, auto s) + params->Callback = [this, callback, target](auto code, auto s) { for (auto ln: s.Strip().SplitDelimit("\r\n")) { auto parts = ln.SplitDelimit("=", 1); if (parts.Length() == 2) { if (parts[0].Equals("user.email")) - AuthorEmail = parts[1]; + target->email = parts[1]; else if (parts[0].Equals("user.name")) - AuthorName = parts[1]; + target->name = parts[1]; } } - IsGettingAuthor = false; - callback(AuthorName, AuthorEmail); + target->InProgress = false; + if (callback) + callback(target->name, target->email); }; auto args = LString::Fmt("-P config -l %s", scope); - StartCmd(args, NULL, params); + target->InProgress = StartCmd(args, NULL, params); break; } case VcHg: { auto config = GetConfigFile(local); if (!config) return false; LIniFile data(config); auto author = data.Get("ui", "username"); auto start = author.Find("<"); auto end = author.Find(">", start); if (start >= 0 && end >= start) { - AuthorName = author(0, start).Strip(); - AuthorEmail = author(start + 1, end).Strip(); + target->name = author(0, start).Strip(); + target->email = author(start + 1, end).Strip(); } IsGettingAuthor = false; - callback(AuthorName, AuthorEmail); + callback(target->name, target->email); break; } default: { NoImplementation(_FL); return false; } } return true; } bool VcFolder::SetAuthor(bool local, LString name, LString email) { auto scope = local ? "--local" : "--global"; - - if (local) - { - AuthorName = name; - AuthorEmail = email; - } + auto target = local ? &AuthorLocal : &AuthorGlobal; + + target->name = name; + target->email = email; switch (GetType()) { case VcGit: { auto args = LString::Fmt("config %s user.name \"%s\"", scope, name.Get()); StartCmd(args); args = LString::Fmt("config %s user.email \"%s\"", scope, email.Get()); StartCmd(args); break; } case VcHg: { auto config = GetConfigFile(local); if (!config) return false; LString author; author.Printf("%s <%s>", name.Get(), email.Get()); LIniFile data(config); data.Set("ui", "username", author); return data.Write(); } default: { NoImplementation(_FL); return false; } } return true; } void VcFolder::Select(bool b) { #if PROFILE_FN LProfile Prof("Select"); #endif if (!b) { auto *w = d->Tree->GetWindow(); w->SetCtrlName(IDC_BRANCH, NULL); } PROF("Parent.Select"); LTreeItem::Select(b); if (b) { if (Uri.IsFile() && !LDirExists(LocalPath())) return; PROF("DefaultFields"); DefaultFields(); - if (AuthorEmail) - UpdateAuthorUi(); - else + if (!AuthorLocal) GetAuthor(true, [this](auto name, auto email) { UpdateAuthorUi(); }); + if (!AuthorGlobal) + GetAuthor(false, [this](auto name, auto email) + { + UpdateAuthorUi(); + }); + UpdateAuthorUi(); PROF("Type Change"); if (GetType() != d->PrevType) { d->PrevType = GetType(); UpdateColumns(); } PROF("UpdateCommitList"); if ((Log.Length() == 0 || CommitListDirty) && !IsLogging) { switch (GetType()) { case VcGit: { LVariant Limit; d->Opts.GetValue("git-limit", Limit); LString cmd = "rev-list --all --header --timestamp --author-date-order", s; if (Limit.CastInt32() > 0) { s.Printf(" -n %i", Limit.CastInt32()); cmd += s; } IsLogging = StartCmd(cmd, &VcFolder::ParseRevList); break; } case VcSvn: { LVariant Limit; d->Opts.GetValue("svn-limit", Limit); if (CommitListDirty) { IsLogging = StartCmd("up", &VcFolder::ParsePull, new ParseParams("log")); break; } LString s; if (Limit.CastInt32() > 0) s.Printf("log --limit %i", Limit.CastInt32()); else s = "log"; IsLogging = StartCmd(s, &VcFolder::ParseLog); break; } case VcHg: { IsLogging = StartCmd("log", &VcFolder::ParseLog); StartCmd("resolve -l", &VcFolder::ParseResolveList); break; } case VcPending: { break; } default: { IsLogging = StartCmd("log", &VcFolder::ParseLog); break; } } CommitListDirty = false; } PROF("GetBranches"); if (GetBranches()) OnBranchesChange(); if (d->CurFolder != this) { PROF("RemoveAll"); d->CurFolder = this; d->Commits->RemoveAll(); } PROF("Uncommit"); if (!Uncommit) Uncommit.Reset(new UncommitedItem(d)); d->Commits->Insert(Uncommit, 0); PROF("Log Loop"); int64 CurRev = Atoi(CurrentCommit.Get()); List Ls; for (auto l: Log) { if (CurrentCommit && l->GetRev()) { switch (GetType()) { case VcSvn: { int64 LogRev = Atoi(l->GetRev()); if (CurRev >= 0 && CurRev >= LogRev) { CurRev = -1; l->SetCurrent(true); } else { l->SetCurrent(false); } break; } default: l->SetCurrent(!_stricmp(CurrentCommit, l->GetRev())); break; } } LList *CurOwner = l->GetList(); if (!CurOwner) Ls.Insert(l); } PROF("Ls Ins"); d->Commits->Insert(Ls); if (d->Resort >= 0) { PROF("Resort"); d->Commits->Sort(LstCmp, d->Resort); d->Resort = -1; } PROF("ColSizing"); if (d->Commits->Length() > MAX_AUTO_RESIZE_ITEMS) { int i = 0; if (GetType() == VcHg && d->Commits->GetColumns() >= 7) { d->Commits->ColumnAt(i++)->Width(60); // LGraph d->Commits->ColumnAt(i++)->Width(40); // LIndex d->Commits->ColumnAt(i++)->Width(100); // LRevision d->Commits->ColumnAt(i++)->Width(60); // LBranch d->Commits->ColumnAt(i++)->Width(240); // LAuthor d->Commits->ColumnAt(i++)->Width(130); // LTimeStamp d->Commits->ColumnAt(i++)->Width(400); // LMessage } else if (d->Commits->GetColumns() >= 5) { d->Commits->ColumnAt(i++)->Width(40); // LGraph d->Commits->ColumnAt(i++)->Width(270); // LRevision d->Commits->ColumnAt(i++)->Width(240); // LAuthor d->Commits->ColumnAt(i++)->Width(130); // LTimeStamp d->Commits->ColumnAt(i++)->Width(400); // LMessage } } else d->Commits->ResizeColumnsToContent(); PROF("UpdateAll"); d->Commits->UpdateAllItems(); PROF("GetCur"); GetCurrentRevision(); } } int CommitRevCmp(VcCommit **a, VcCommit **b) { int64 arev = Atoi((*a)->GetRev()); int64 brev = Atoi((*b)->GetRev()); int64 diff = (int64)brev - arev; if (diff < 0) return -1; return (diff > 0) ? 1 : 0; } int CommitIndexCmp(VcCommit **a, VcCommit **b) { auto ai = (*a)->GetIndex(); auto bi = (*b)->GetIndex(); auto diff = (int64)bi - ai; if (diff < 0) return -1; return (diff > 0) ? 1 : 0; } int CommitDateCmp(VcCommit **a, VcCommit **b) { LTimeStamp ats, bts; (*a)->GetTs().Get(ats); (*b)->GetTs().Get(bts); int64 diff = (int64)bts.Get() - ats.Get(); if (diff < 0) return -1; return (diff > 0) ? 1 : 0; } void VcFolder::GetCurrentRevision(ParseParams *Params) { if (CurrentCommit || IsIdent != StatusNone) return; switch (GetType()) { case VcGit: if (StartCmd("rev-parse HEAD", &VcFolder::ParseInfo, Params)) IsIdent = StatusActive; break; case VcSvn: if (StartCmd("info", &VcFolder::ParseInfo, Params)) IsIdent = StatusActive; break; case VcHg: if (StartCmd("id -i -n", &VcFolder::ParseInfo, Params)) IsIdent = StatusActive; break; case VcCvs: break; default: break; } } bool VcFolder::GetBranches(ParseParams *Params) { if (Branches.Length() > 0 || IsBranches != StatusNone) return true; switch (GetType()) { case VcGit: if (StartCmd("-P branch -v", &VcFolder::ParseBranches, Params)) IsBranches = StatusActive; break; case VcSvn: Branches.Add("trunk", new VcBranch("trunk")); OnBranchesChange(); break; case VcHg: { if (StartCmd("branches", &VcFolder::ParseBranches, Params)) IsBranches = StatusActive; auto p = new ParseParams; p->Callback = [this](auto code, auto str) { SetCurrentBranch(str.Strip()); }; StartCmd("branch", NULL, p); break; } case VcCvs: break; default: break; } return false; } bool VcFolder::ParseRevList(int Result, LString s, ParseParams *Params) { Log.DeleteObjects(); int Errors = 0; switch (GetType()) { case VcGit: { LString::Array Commits; Commits.SetFixedLength(false); // Split on the NULL chars... char *c = s.Get(); char *e = c + s.Length(); while (c < e) { char *nul = c; while (nul < e && *nul) nul++; if (nul <= c) break; Commits.New().Set(c, nul-c); if (nul >= e) break; c = nul + 1; } for (auto Commit: Commits) { LAutoPtr Rev(new VcCommit(d, this)); if (Rev->GitParse(Commit, true)) { Log.Add(Rev.Release()); } else { // LAssert(!"Parse failed."); LgiTrace("%s:%i - Failed:\n%s\n\n", _FL, Commit.Get()); Errors++; } } LinkParents(); break; } default: LAssert(!"Impl me."); break; } IsLogging = false; return Errors == 0; } LString VcFolder::GetFilePart(const char *uri) { LUri u(uri); LString File = u.IsFile() ? u.DecodeStr(u.LocalPath()) : u.sPath(Uri.sPath.Length(), -1).LStrip("/"); return File; } void VcFolder::ClearLog() { Uncommit.Reset(); Log.DeleteObjects(); } void VcFolder::LogFilter(const char *Filter) { if (!Filter) { LAssert(!"No filter."); return; } switch (GetType()) { case VcGit: { // See if 'Filter' is a commit id? LString args; args.Printf("-P show %s", Filter); ParseParams *params = new ParseParams; params->Callback = [this, Filter=LString(Filter)](auto code, auto str) { ClearLog(); if (code == 0 && str.Find(Filter) >= 0) { // Found the commit... d->Commits->Empty(); CurrentCommit.Empty(); ParseLog(code, str, NULL); d->Commits->Insert(Log); } else { // Not a commit ref...? LString args; args.Printf("log --grep \"%s\"", Filter.Get()); IsLogging = StartCmd(args, &VcFolder::ParseLog); } }; StartCmd(args, NULL, params); break; } default: { NoImplementation(_FL); break; } } } void VcFolder::LogFile(const char *uri) { LString Args; if (IsLogging) { d->Log->Print("%s:%i - already logging.\n", _FL); return; } const char *Page = ""; switch (GetType()) { case VcGit: Page = "-P "; // fall through case VcSvn: case VcHg: { FileToSelect = GetFilePart(uri); if (IsLocal() && !LFileExists(FileToSelect)) { LFile::Path Abs(LocalPath()); Abs += FileToSelect; if (Abs.Exists()) FileToSelect = Abs; } ParseParams *Params = new ParseParams(uri); Args.Printf("%slog \"%s\"", Page, FileToSelect.Get()); IsLogging = StartCmd(Args, &VcFolder::ParseLog, Params, LogNormal); break; } default: NoImplementation(_FL); break; } } VcLeaf *VcFolder::FindLeaf(const char *Path, bool OpenTree) { VcLeaf *r = NULL; if (OpenTree) DoExpand(); for (auto n = GetChild(); !r && n; n = n->GetNext()) { auto l = dynamic_cast(n); if (l) r = l->FindLeaf(Path, OpenTree); } return r; } bool VcFolder::ParseLog(int Result, LString s, ParseParams *Params) { int Skipped = 0, Errors = 0; bool LoggingFile = Params ? Params->Str != NULL : false; VcLeaf *File = LoggingFile ? FindLeaf(Params->Str, true) : NULL; // This may be NULL even if we are logging a file... LArray *Out, BrowseLog; if (File) Out = &File->Log; else if (LoggingFile) Out = &BrowseLog; else Out = &Log; LHashTbl, VcCommit*> Map; for (auto pc: *Out) Map.Add(pc->GetRev(), pc); if (File) { for (auto Leaf = File; Leaf; Leaf = dynamic_cast(Leaf->GetParent())) Leaf->OnExpand(true); File->Select(true); File->ScrollTo(); } switch (GetType()) { case VcGit: { LString::Array c; c.SetFixedLength(false); char *prev = s.Get(); #if 0 LFile::Path outPath("~/code/dump.txt"); LFile out(outPath.Absolute(), O_WRITE); out.Write(s); #endif if (!s) { OnCmdError(s, "No output from command."); return false; } char *i = s.Get(); while (*i) { if (!strnicmp(i, "commit ", 7)) { if (i > prev) { c.New().Set(prev, i - prev); // LgiTrace("commit=%i\n", (int)(i - prev)); } prev = i; } while (*i) { if (*i++ == '\n') break; } } if (prev && i > prev) { // Last one... c.New().Set(prev, i - prev); } for (auto txt: c) { LAutoPtr Rev(new VcCommit(d, this)); if (Rev->GitParse(txt, false)) { if (!Map.Find(Rev->GetRev())) Out->Add(Rev.Release()); else Skipped++; } else { LgiTrace("%s:%i - Failed:\n%s\n\n", _FL, txt.Get()); Errors++; } } Out->Sort(CommitDateCmp); break; } case VcSvn: { LString::Array c = s.Split("------------------------------------------------------------------------"); for (unsigned i=0; i Rev(new VcCommit(d, this)); LString Raw = c[i].Strip(); if (Rev->SvnParse(Raw)) { if (File || !Map.Find(Rev->GetRev())) Out->Add(Rev.Release()); else Skipped++; } else if (Raw) { OnCmdError(Raw, "ParseLog Failed"); Errors++; } } Out->Sort(CommitRevCmp); break; } case VcHg: { LString::Array c = s.Split("\n\n"); LHashTbl, VcCommit*> Idx; for (auto &Commit: c) { LAutoPtr Rev(new VcCommit(d, this)); if (Rev->HgParse(Commit)) { auto Existing = File ? NULL : Map.Find(Rev->GetRev()); if (!Existing) Out->Add(Existing = Rev.Release()); if (Existing->GetIndex() >= 0) Idx.Add(Existing->GetIndex(), Existing); } } if (!File) { // Patch all the trivial parents... for (auto c: Log) { if (c->GetParents()->Length() > 0) continue; auto CIdx = c->GetIndex(); if (CIdx <= 0) continue; auto Par = Idx.Find(CIdx - 1); if (Par) c->GetParents()->Add(Par->GetRev()); } } Out->Sort(CommitIndexCmp); if (!File) LinkParents(); d->Resort = 1; break; } case VcCvs: { if (Result) { OnCmdError(s, "Cvs command failed."); break; } LHashTbl, VcCommit*> Map; LString::Array c = s.Split("============================================================================="); for (auto &Commit: c) { if (Commit.Strip().Length()) { LString Head, File; LString::Array Versions = Commit.Split("----------------------------"); LString::Array Lines = Versions[0].SplitDelimit("\r\n"); for (auto &Line: Lines) { LString::Array p = Line.Split(":", 1); if (p.Length() == 2) { // LgiTrace("Line: %s\n", Line->Get()); LString Var = p[0].Strip().Lower(); LString Val = p[1].Strip(); if (Var.Equals("branch")) { if (Val.Length()) Branches.Add(Val, new VcBranch(Val)); } else if (Var.Equals("head")) { Head = Val; } else if (Var.Equals("rcs file")) { LString::Array f = Val.SplitDelimit(","); File = f.First(); } } } // LgiTrace("%s\n", Commit->Get()); for (unsigned i=1; i= 3) { LString Ver = Lines[0].Split(" ").Last(); LString::Array a = Lines[1].SplitDelimit(";"); LString Date = a[0].Split(":", 1).Last().Strip(); LString Author = a[1].Split(":", 1).Last().Strip(); LString Id = a[2].Split(":", 1).Last().Strip(); LString Msg = Lines[2]; LDateTime Dt; if (Dt.Parse(Date)) { LTimeStamp Ts; if (Dt.Get(Ts)) { VcCommit *Cc = Map.Find(Ts.Get()); if (!Cc) { Map.Add(Ts.Get(), Cc = new VcCommit(d, this)); Out->Add(Cc); Cc->CvsParse(Dt, Author, Msg); } Cc->Files.Add(File.Get()); } else LAssert(!"NO ts for date."); } else LAssert(!"Date parsing failed."); } } } } break; } default: LAssert(!"Impl me."); break; } if (File) { File->ShowLog(); } else if (LoggingFile) { if (auto ui = new BrowseUi(BrowseUi::TLog, d, this, Params->Str)) ui->ParseLog(BrowseLog, s); } // LgiTrace("%s:%i - ParseLog: Skip=%i, Error=%i\n", _FL, Skipped, Errors); IsLogging = false; return !Result; } void VcFolder::LinkParents() { #if PROFILE_FN LProfile Prof("LinkParents"); #endif LHashTbl,VcCommit*> Map; // Index all the commits int i = 0; for (auto c:Log) { c->Idx = i++; c->NodeIdx = -1; Map.Add(c->GetRev(), c); } // Create all the edges... PROF("Create edges."); for (auto c:Log) { auto *Par = c->GetParents(); for (auto &pRev : *Par) { auto *p = Map.Find(pRev); if (p) new VcEdge(p, c); #if 0 else return; #endif } } // Map the edges to positions PROF("Map edges."); typedef LArray EdgeArr; LArray Active; for (auto c:Log) { for (unsigned i=0; c->NodeIdx<0 && iParent == c) { c->NodeIdx = i; break; } } } // Add starting edges to active set for (auto e:c->Edges) { if (e->Child == c) { if (c->NodeIdx < 0) c->NodeIdx = (int)Active.Length(); e->Idx = c->NodeIdx; c->Pos.Add(e, e->Idx); Active[e->Idx].Add(e); } } // Now for all active edges... assign positions for (unsigned i=0; iLength(); n++) { LAssert(Active.PtrCheck(Edges)); VcEdge *e = (*Edges)[n]; if (c == e->Child || c == e->Parent) { LAssert(c->NodeIdx >= 0); c->Pos.Add(e, c->NodeIdx); } else { // May need to untangle edges with different parents here bool Diff = false; for (auto edge: *Edges) { if (edge != e && edge->Child != c && edge->Parent != e->Parent) { Diff = true; break; } } if (Diff) { int NewIndex = -1; // Look through existing indexes for a parent match for (unsigned ii=0; iiParent? bool Match = true; for (auto ee: Active[ii]) { if (ee->Parent != e->Parent) { Match = false; break; } } if (Match) NewIndex = ii; } if (NewIndex < 0) // Create new index for this parent NewIndex = (int)Active.Length(); Edges->Delete(e); auto &NewEdges = Active[NewIndex]; NewEdges.Add(e); Edges = &Active[i]; // The 'Add' above can invalidate the object 'Edges' refers to e->Idx = NewIndex; c->Pos.Add(e, NewIndex); n--; } else { LAssert(e->Idx == i); c->Pos.Add(e, i); } } } } // Process terminating edges for (auto e: c->Edges) { if (e->Parent == c) { if (e->Idx < 0) { // This happens with out of order commits..? continue; } int i = e->Idx; if (c->NodeIdx < 0) c->NodeIdx = i; if (Active[i].HasItem(e)) Active[i].Delete(e); else LgiTrace("%s:%i - Warning: Active doesn't have 'e'.\n", _FL); } } // Collapse any empty active columns for (unsigned i=0; iIdx > 0); edge->Idx--; c->Pos.Add(edge, edge->Idx); } } i--; } } } } void VcFolder::UpdateBranchUi() { auto w = d->Wnd(); DropDownBtn *dd; if (w->GetViewById(IDC_BRANCH_DROPDOWN, dd)) { LString::Array a; for (auto b: Branches) a.Add(b.key); dd->SetList(IDC_BRANCH, a); } LViewI *b; if (Branches.Length() > 0 && w->GetViewById(IDC_BRANCH, b)) { if (CurrentBranch) { b->Name(CurrentBranch); } else { auto it = Branches.begin(); if (it != Branches.end()) b->Name((*it).key); } } LCombo *Cbo; if (w->GetViewById(IDC_BRANCHES, Cbo)) { Cbo->Empty(); int64 select = -1; for (auto b: Branches) { if (CurrentBranch && CurrentBranch == b.key) select = Cbo->Length(); Cbo->Insert(b.key); } if (select >= 0) Cbo->Value(select); Cbo->SendNotify(LNotifyTableLayoutRefresh); // LgiTrace("%s:%i - Branches len=%i->%i\n", _FL, (int)Branches.Length(), (int)Cbo->Length()); } } VcFile *AppPriv::FindFile(const char *Path) { if (!Path) return NULL; LArray files; if (Files->GetAll(files)) { LString p = Path; p = p.Replace(DIR_STR, "/"); for (auto f : files) { auto Fn = f->GetFileName(); if (p.Equals(Fn)) return f; } } return NULL; } VcFile *VcFolder::FindFile(const char *Path) { return d->FindFile(Path); } void VcFolder::NoImplementation(const char* file, int line) { LString s; s.Printf("%s, uri=%s, type=%s (%s:%i)", LLoadString(IDS_ERR_NO_IMPL_FOR_TYPE), Uri.ToString().Get(), toString(GetType()), file, line); OnCmdError(LString(), s); } void VcFolder::OnCmdError(LString Output, const char *Msg) { if (!CmdErrors) { if (Output.Length()) d->Log->Write(Output, Output.Length()); auto vc_name = GetVcName(); if (vc_name) { LString::Array a = GetProgramsInPath(GetVcName()); d->Log->Print("'%s' executables in the path:\n", GetVcName()); for (auto Bin : a) d->Log->Print(" %s\n", Bin.Get()); } else if (Msg) { d->Log->Print("%s\n", Msg); } } CmdErrors++; d->Tabs->Value(1); GetCss(true)->Color(LColour::Red); Update(); } void VcFolder::ClearError() { GetCss(true)->Color(LCss::ColorInherit); } bool VcFolder::ParseInfo(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcGit: case VcHg: { auto p = s.Strip().SplitDelimit(); CurrentCommit = p[0].Strip(" \t\r\n+"); if (p.Length() > 1) CurrentCommitIdx = p[1].Int(); else CurrentCommitIdx = -1; if (Params && Params->Str.Equals("CountToTip")) CountToTip(); break; } case VcSvn: { if (s.Find("client is too old") >= 0) { OnCmdError(s, "Client too old"); break; } LString::Array c = s.Split("\n"); for (unsigned i=0; iStr.Equals("Branch")) SetCurrentBranch(NewRev); else CurrentCommit = NewRev; } NewRev.Empty(); IsUpdate = false; return true; } bool VcFolder::ParseWorking(int Result, LString s, ParseParams *Params) { IsListingWorking = false; switch (GetType()) { case VcSvn: case VcHg: { ParseParams Local; if (!Params) Params = &Local; Params->IsWorking = true; ParseStatus(Result, s, Params); break; } case VcCvs: { bool Untracked = d->IsMenuChecked(IDM_UNTRACKED); if (Untracked) { auto Lines = s.SplitDelimit("\n"); for (auto Ln: Lines) { auto p = Ln.SplitDelimit(" \t", 1); if (p.Length() > 1) { auto f = new VcFile(d, this, LString(), true); f->SetText(p[0], COL_STATE); f->SetText(p[1], COL_FILENAME); f->GetStatus(); d->Files->Insert(f); } } } // else fall thru } default: { ParseDiffs(s, LString(), true); break; } } FilterCurrentFiles(); d->Files->ResizeColumnsToContent(); if (GetType() == VcSvn) { Unpushed = d->Files->Length() > 0 ? 1 : 0; Update(); } return false; } void VcFolder::DiffRange(const char *FromRev, const char *ToRev) { if (!FromRev || !ToRev) return; switch (GetType()) { case VcSvn: { ParseParams *p = new ParseParams; p->IsWorking = false; p->Str = LString(FromRev) + ":" + ToRev; LString a; a.Printf("diff -r%s:%s", FromRev, ToRev); StartCmd(a, &VcFolder::ParseDiff, p); break; } case VcGit: { ParseParams *p = new ParseParams; p->IsWorking = false; p->Str = LString(FromRev) + ":" + ToRev; LString a; a.Printf("-P diff %s..%s", FromRev, ToRev); StartCmd(a, &VcFolder::ParseDiff, p); break; } case VcCvs: case VcHg: default: LAssert(!"Impl me."); break; } } bool VcFolder::ParseDiff(int Result, LString s, ParseParams *Params) { if (Params) ParseDiffs(s, Params->Str, Params->IsWorking); else ParseDiffs(s, LString(), true); return false; } void VcFolder::Diff(VcFile *file) { auto Fn = file->GetFileName(); if (!Fn || !Stricmp(Fn, ".") || !Stricmp(Fn, "..")) return; const char *Prefix = ""; switch (GetType()) { case VcGit: Prefix = "-P "; // fall through case VcHg: { LString a; auto rev = file->GetRevision(); if (rev) a.Printf("%sdiff %s \"%s\"", Prefix, rev, Fn); else a.Printf("%sdiff \"%s\"", Prefix, Fn); StartCmd(a, &VcFolder::ParseDiff); break; } case VcSvn: { LString a; if (file->GetRevision()) a.Printf("diff -r %s \"%s\"", file->GetRevision(), Fn); else a.Printf("diff \"%s\"", Fn); StartCmd(a, &VcFolder::ParseDiff); break; } case VcCvs: break; default: LAssert(!"Impl me."); break; } } void VcFolder::InsertFiles(List &files) { d->Files->Insert(files); if (FileToSelect) { LListItem *scroll = NULL; for (auto f: files) { // Convert to an absolute path: bool match = false; auto relPath = f->GetText(COL_FILENAME); if (IsLocal()) { LFile::Path p(LocalPath()); p += relPath; match = p.GetFull().Equals(FileToSelect); } else { match = !Stricmp(FileToSelect.Get(), relPath); } f->Select(match); if (match) scroll = f; } if (scroll) scroll->ScrollTo(); } } bool VcFolder::ParseDiffs(LString s, LString Rev, bool IsWorking) { LAssert(IsWorking || Rev.Get() != NULL); switch (GetType()) { case VcGit: { List Files; LString::Array a = s.Split("\n"); LString Diff; VcFile *f = NULL; for (unsigned i=0; iSetDiff(Diff); Diff.Empty(); auto Bits = a[i].SplitDelimit(); LString Fn, State = "M"; if (Bits[1].Equals("--cc")) { Fn = Bits.Last(); State = "C"; } else Fn = Bits.Last()(2,-1); // LgiTrace("%s\n", a[i].Get()); f = FindFile(Fn); if (!f) f = new VcFile(d, this, Rev, IsWorking); f->SetText(State, COL_STATE); f->SetText(Fn.Replace("\\","/"), COL_FILENAME); f->GetStatus(); Files.Insert(f); } else if (!_strnicmp(Ln, "new file", 8)) { if (f) f->SetText("A", COL_STATE); } else if (!_strnicmp(Ln, "deleted file", 12)) { if (f) f->SetText("D", COL_STATE); } else if (!_strnicmp(Ln, "index", 5) || !_strnicmp(Ln, "commit", 6) || !_strnicmp(Ln, "Author:", 7) || !_strnicmp(Ln, "Date:", 5) || !_strnicmp(Ln, "+++", 3) || !_strnicmp(Ln, "---", 3)) { // Ignore } else { if (Diff) Diff += "\n"; Diff += a[i]; } } if (f && Diff) { f->SetDiff(Diff); Diff.Empty(); } InsertFiles(Files); break; } case VcHg: { LString Sep("\n"); LString::Array a = s.Split(Sep); LString::Array Diffs; VcFile *f = NULL; List Files; LProgressDlg Prog(GetTree(), 1000); Prog.SetDescription("Reading diff lines..."); Prog.SetRange(a.Length()); // Prog.SetYieldTime(300); for (unsigned i=0; iSetDiff(Sep.Join(Diffs)); Diffs.Empty(); auto MainParts = a[i].Split(" -r "); auto FileParts = MainParts.Last().Split(" ",1); LString Fn = FileParts.Last(); f = FindFile(Fn); if (!f) f = new VcFile(d, this, Rev, IsWorking); f->SetText(Fn.Replace("\\","/"), COL_FILENAME); // f->SetText(Status, COL_STATE); Files.Insert(f); } else if (!_strnicmp(Ln, "index", 5) || !_strnicmp(Ln, "commit", 6) || !_strnicmp(Ln, "Author:", 7) || !_strnicmp(Ln, "Date:", 5) || !_strnicmp(Ln, "+++", 3) || !_strnicmp(Ln, "---", 3)) { // Ignore } else { Diffs.Add(a[i]); } Prog.Value(i); if (Prog.IsCancelled()) break; } if (f && Diffs.Length()) { f->SetDiff(Sep.Join(Diffs)); Diffs.Empty(); } InsertFiles(Files); break; } case VcSvn: { List Files; LString::Array a = s.Replace("\r").Split("\n"); LString Diff; VcFile *f = NULL; bool InPreamble = false; bool InDiff = false; for (unsigned i=0; iSetDiff(Diff); f->Select(false); } Diff.Empty(); InDiff = false; InPreamble = false; LString Fn = a[i].Split(":", 1).Last().Strip(); f = FindFile(Fn); if (!f) f = new VcFile(d, this, Rev, IsWorking); f->SetText(Fn.Replace("\\","/"), COL_FILENAME); f->SetText("M", COL_STATE); f->GetStatus(); Files.Insert(f); } else if (!_strnicmp(Ln, "------", 6)) { InPreamble = !InPreamble; } else if (!_strnicmp(Ln, "======", 6)) { InPreamble = false; InDiff = true; } else if (InDiff) { if (!strncmp(Ln, "--- ", 4) || !strncmp(Ln, "+++ ", 4)) { } else { if (Diff) Diff += "\n"; Diff += a[i]; } } } InsertFiles(Files); if (f && Diff) { f->SetDiff(Diff); Diff.Empty(); } break; } case VcCvs: { break; } default: { LAssert(!"Impl me."); break; } } FilterCurrentFiles(); return true; } bool VcFolder::ParseFiles(int Result, LString s, ParseParams *Params) { d->ClearFiles(); ParseDiffs(s, Params->Str, false); IsFilesCmd = false; FilterCurrentFiles(); return false; } #if HAS_LIBSSH void VcFolder::OnSshCmd(SshParams *p) { if (!p || !p->f) { LAssert(!"Param error."); return; } LString s = p->Output; int Result = p->ExitCode; if (Result == ErrSubProcessFailed) { CmdErrors++; } else if (p->Parser) { bool Reselect = CALL_MEMBER_FN(*this, p->Parser)(Result, s, p->Params); if (Reselect) { if (LTreeItem::Select()) Select(true); } } if (p->Params && p->Params->Callback) { p->Params->Callback(Result, s); } } #endif void VcFolder::OnPulse() { bool Reselect = false, CmdsChanged = false; static bool Processing = false; if (!Processing) { Processing = true; // Lock out processing, if it puts up a dialog or something... // bad things happen if we try and re-process something. // printf("Cmds.Len=%i\n", (int)Cmds.Length()); for (unsigned i=0; iRd->GetState()); if (c->Rd->GetState() == LThread::THREAD_INIT) { if (CmdActiveThreads < CmdMaxThreads) { c->Rd->Run(); CmdActiveThreads++; // printf("CmdActiveThreads++ = %i\n", CmdActiveThreads); } // else printf("Too many active threads.\n"); } else if (c->Rd->IsExited()) { CmdActiveThreads--; // printf("CmdActiveThreads-- = %i\n", CmdActiveThreads); LString s = c->GetBuf(); int Result = c->Rd->ExitCode(); if (Result == ErrSubProcessFailed) { if (!CmdErrors) d->Log->Print("Error: Can't run '%s'\n", GetVcName()); CmdErrors++; } else if (c->PostOp) { if (s.Length() == 18 && s.Equals("GSUBPROCESS_ERROR\n")) { OnCmdError(s, "Sub process failed."); } else { Reselect |= CALL_MEMBER_FN(*this, c->PostOp)(Result, s, c->Params); } } if (c->Params && c->Params->Callback) { c->Params->Callback(Result, s); } Cmds.DeleteAt(i--, true); delete c; CmdsChanged = true; } // else printf("Not exited.\n"); } Processing = false; } if (Reselect) { if (LTreeItem::Select()) Select(true); } if (CmdsChanged) { Update(); } if (CmdErrors) { d->Tabs->Value(1); CmdErrors = false; } } void VcFolder::OnRemove() { LXmlTag *t = d->Opts.LockTag(OPT_Folders, _FL); if (t) { Uncommit.Reset(); if (LTreeItem::Select()) { d->Files->Empty(); d->Commits->RemoveAll(); } bool Found = false; auto u = Uri.ToString(); for (auto c: t->Children) { if (!c->IsTag(OPT_Folder)) printf("%s:%i - Wrong tag: %s, %s\n", _FL, c->GetTag(), OPT_Folder); else if (!c->GetContent()) printf("%s:%i - No content.\n", _FL); else { auto Content = c->GetContent(); if (!_stricmp(Content, u)) { c->RemoveTag(); delete c; Found = true; break; } } } LAssert(Found); d->Opts.Unlock(); } } void VcFolder::Empty() { Type = VcNone; IsCommit = false; IsLogging = false; IsUpdate = false; IsFilesCmd = false; CommitListDirty = false; IsUpdatingCounts = false; IsBranches = StatusNone; IsIdent = StatusNone; Unpushed = Unpulled = -1; CmdErrors = 0; CurrentCommitIdx = -1; CurrentCommit.Empty(); RepoUrl.Empty(); VcCmd.Empty(); Uncommit.Reset(); Log.DeleteObjects(); d->Commits->Empty(); d->Files->Empty(); if (!Uri.IsFile()) GetCss(true)->Color(LColour::Blue); } void VcFolder::OnMouseClick(LMouse &m) { if (m.IsContextMenu()) { LSubMenu s; s.AppendItem("Browse To", IDM_BROWSE_FOLDER, Uri.IsFile()); s.AppendItem( #ifdef WINDOWS "Command Prompt At", #else "Terminal At", #endif IDM_TERMINAL, Uri.IsFile()); s.AppendItem("Clean", IDM_CLEAN); s.AppendSeparator(); s.AppendItem("Pull", IDM_PULL); s.AppendItem("Status", IDM_STATUS); s.AppendItem("Push", IDM_PUSH); s.AppendItem("Update Subs", IDM_UPDATE_SUBS, GetType() == VcGit); s.AppendSeparator(); s.AppendItem("Remove", IDM_REMOVE); s.AppendItem("Remote URL", IDM_REMOTE_URL); if (!Uri.IsFile()) { s.AppendSeparator(); s.AppendItem("Edit Location", IDM_EDIT); } int Cmd = s.Float(GetTree(), m); switch (Cmd) { case IDM_BROWSE_FOLDER: { LBrowseToFile(LocalPath()); break; } case IDM_TERMINAL: { TerminalAt(LocalPath()); break; } case IDM_CLEAN: { Clean(); break; } case IDM_PULL: { Pull(); break; } case IDM_STATUS: { FolderStatus(); break; } case IDM_PUSH: { Push(); break; } case IDM_UPDATE_SUBS: { UpdateSubs(); break; } case IDM_REMOVE: { OnRemove(); delete this; break; } case IDM_EDIT: { auto Dlg = new LInput(GetTree(), Uri.ToString(), "URI:", "Remote Folder Location"); Dlg->DoModal([this, Dlg](auto dlg, auto ctrlId) { if (ctrlId) { Uri.Set(Dlg->GetStr()); Empty(); Select(true); } delete dlg; }); break; } case IDM_REMOTE_URL: { GetRemoteUrl([this](auto code, auto str) { LString Url = str.Strip(); if (Url) { auto a = new LAlert(GetTree(), "Remote Url", Url, "Copy", "Ok"); a->DoModal([this, Url](auto dlg, auto code) { if (code == 1) { LClipBoard c(GetTree()); c.Text(Url); } delete dlg; }); } }); break; } default: break; } } } LString &VcFolder::GetCurrentBranch() { return CurrentBranch; } void VcFolder::SetCurrentBranch(LString name) { if (CurrentBranch != name) { CurrentBranch = name; UpdateBranchUi(); } } void VcFolder::Checkout(const char *Rev, bool isBranch) { if (!Rev || IsUpdate) return; LString Args; LAutoPtr params(new ParseParams(isBranch ? "Branch" : "Rev")); NewRev = Rev; switch (GetType()) { case VcGit: Args.Printf("checkout %s", Rev); IsUpdate = StartCmd(Args, &VcFolder::ParseCheckout, params.Release(), LogNormal); break; case VcSvn: Args.Printf("up -r %s", Rev); IsUpdate = StartCmd(Args, &VcFolder::ParseCheckout, params.Release(), LogNormal); break; case VcHg: Args.Printf("update -r %s", Rev); IsUpdate = StartCmd(Args, &VcFolder::ParseCheckout, params.Release(), LogNormal); break; default: { NoImplementation(_FL); break; } } } /////////////////////////////////////////////////////////////////////////////////////// int FolderCompare(LTreeItem *a, LTreeItem *b, NativeInt UserData) { VcLeaf *A = dynamic_cast(a); VcLeaf *B = dynamic_cast(b); if (!A || !B) return 0; return A->Compare(B); } struct SshFindEntry { LString Flags, Name, User, Group; uint64_t Size; LDateTime Modified, Access; SshFindEntry &operator =(const LString &s) { auto p = s.SplitDelimit("/"); if (p.Length() == 7) { Flags = p[0]; Group = p[1]; User = p[2]; Access.Set((uint64_t) p[3].Int()); Modified.Set((uint64_t) p[4].Int()); Size = p[5].Int(); Name = p[6]; } return *this; } bool IsDir() { return Flags(0) == 'd'; } bool IsHidden() { return Name(0) == '.'; } const char *GetName() { return Name; } static int Compare(SshFindEntry *a, SshFindEntry *b) { return Stricmp(a->Name.Get(), b->Name.Get()); } }; bool VcFolder::ParseRemoteFind(int Result, LString s, ParseParams *Params) { if (!Params || !s) return false; auto Parent = Params->Leaf ? static_cast(Params->Leaf) : static_cast(this); LUri u(Params->Str); auto Lines = s.SplitDelimit("\r\n"); LArray Entries; for (size_t i=1; iStr, Dir.GetName(), true); } } else if (!Dir.IsHidden()) { char *Ext = LGetExtension(Dir.GetName()); if (!Ext) continue; if (!stricmp(Ext, "c") || !stricmp(Ext, "cpp") || !stricmp(Ext, "h")) { LUri Path = u; Path += Dir.GetName(); new VcLeaf(this, Parent, Params->Str, Dir.GetName(), false); } } } return false; } void VcFolder::ReadDir(LTreeItem *Parent, const char *ReadUri) { LUri u(ReadUri); if (u.IsFile()) { // Read child items LDirectory Dir; for (int b = Dir.First(u.LocalPath()); b; b = Dir.Next()) { auto name = Dir.GetName(); if (Dir.IsHidden()) continue; LUri Path = u; Path += name; new VcLeaf(this, Parent, u.ToString(), name, Dir.IsDir()); } } #if HAS_LIBSSH else { auto c = d->GetConnection(ReadUri); if (!c) return; LString Path = u.sPath(Uri.sPath.Length(), -1).LStrip("/"); LString Args; Args.Printf("\"%s\" -maxdepth 1 -printf \"%%M/%%g/%%u/%%A@/%%T@/%%s/%%P\n\"", Path ? Path.Get() : "."); auto *Params = new ParseParams(ReadUri); Params->Leaf = dynamic_cast(Parent); c->Command(this, "find", Args, &VcFolder::ParseRemoteFind, Params, SshConnection::LogNone); return; } #endif Parent->Sort(FolderCompare); } void VcFolder::OnVcsType(LString errorMsg) { if (!d) { LAssert(!"No priv instance"); return; } #if HAS_LIBSSH auto c = d->GetConnection(Uri.ToString(), false); if (c) { auto NewType = c->Types.Find(Uri.sPath); if (NewType && NewType != Type) { if (NewType == VcError) { OnCmdError(LString(), errorMsg); } else { Type = NewType; ClearError(); Update(); if (LTreeItem::Select()) Select(true); for (auto &e: OnVcsTypeEvents) e(); OnVcsTypeEvents.Empty(); } } } #endif } void VcFolder::DoExpand() { if (Tmp) { Tmp->Remove(); DeleteObj(Tmp); ReadDir(this, Uri.ToString()); } } void VcFolder::OnExpand(bool b) { if (b) DoExpand(); } void VcFolder::ListCommit(VcCommit *c) { if (!IsFilesCmd) { LString Args; switch (GetType()) { case VcGit: Args.Printf("-P show %s^..%s", c->GetRev(), c->GetRev()); IsFilesCmd = StartCmd(Args, &VcFolder::ParseFiles, new ParseParams(c->GetRev())); break; case VcSvn: Args.Printf("log --verbose --diff -r %s", c->GetRev()); IsFilesCmd = StartCmd(Args, &VcFolder::ParseFiles, new ParseParams(c->GetRev())); break; case VcCvs: { d->ClearFiles(); for (unsigned i=0; iFiles.Length(); i++) { VcFile *f = new VcFile(d, this, c->GetRev(), false); if (f) { f->SetText(c->Files[i], COL_FILENAME); d->Files->Insert(f); } } FilterCurrentFiles(); break; } case VcHg: { Args.Printf("diff --change %s", c->GetRev()); IsFilesCmd = StartCmd(Args, &VcFolder::ParseFiles, new ParseParams(c->GetRev())); break; } default: LAssert(!"Impl me."); break; } if (IsFilesCmd) d->ClearFiles(); } } LString ConvertUPlus(LString s) { LArray c; LUtf8Ptr p(s); int32 ch; while ((ch = p)) { if (ch == '{') { auto n = p.GetPtr(); if (n[1] == 'U' && n[2] == '+') { // Convert unicode code point p += 3; ch = (int32)htoi(p.GetPtr()); c.Add(ch); while ((ch = p) != '}') p++; } else c.Add(ch); } else c.Add(ch); p++; } c.Add(0); #ifdef LINUX return LString((char16*)c.AddressOf()); #else return LString(c.AddressOf()); #endif } bool VcFolder::ParseStatus(int Result, LString s, ParseParams *Params) { bool ShowUntracked = d->Wnd()->GetCtrlValue(IDC_UNTRACKED) != 0; bool IsWorking = Params ? Params->IsWorking : false; List Ins; switch (GetType()) { case VcCvs: { LHashTbl,VcFile*> Map; for (auto i: *d->Files) { VcFile *f = dynamic_cast(i); if (f) Map.Add(f->GetText(COL_FILENAME), f); } #if 0 LFile Tmp("C:\\tmp\\output.txt", O_WRITE); Tmp.Write(s); Tmp.Close(); #endif LString::Array a = s.Split("==================================================================="); for (auto i : a) { LString::Array Lines = i.SplitDelimit("\r\n"); if (Lines.Length() == 0) continue; LString f = Lines[0].Strip(); if (f.Find("File:") == 0) { LString::Array Parts = f.SplitDelimit("\t"); LString File = Parts[0].Split(": ").Last().Strip(); LString Status = Parts[1].Split(": ").Last(); LString WorkingRev; for (auto l : Lines) { LString::Array p = l.Strip().Split(":", 1); if (p.Length() > 1 && p[0].Strip().Equals("Working revision")) { WorkingRev = p[1].Strip(); } } VcFile *f = Map.Find(File); if (!f) { if ((f = new VcFile(d, this, WorkingRev, IsWorking))) Ins.Insert(f); } if (f) { f->SetText(Status, COL_STATE); f->SetText(File, COL_FILENAME); f->Update(); } } else if (f(0) == '?' && ShowUntracked) { LString File = f(2, -1); VcFile *f = Map.Find(File); if (!f) { if ((f = new VcFile(d, this, LString(), IsWorking))) Ins.Insert(f); } if (f) { f->SetText("?", COL_STATE); f->SetText(File, COL_FILENAME); f->Update(); } } } for (auto i: *d->Files) { VcFile *f = dynamic_cast(i); if (f) { if (f->GetStatus() == VcFile::SUnknown) f->SetStatus(VcFile::SUntracked); } } break; } case VcGit: { auto Lines = s.SplitDelimit("\r\n"); int Fmt = ToolVersion[VcGit] >= Ver2Int("2.8.0") ? 2 : 1; for (auto Ln : Lines) { auto Type = Ln(0); if (Ln.Lower().Find("error:") >= 0) { } else if (Ln.Find("usage: git") >= 0) { // It's probably complaining about the --porcelain=2 parameter OnCmdError(s, "Args error"); } else if (Type != '?') { VcFile *f = NULL; if (Fmt == 2) { LString::Array p = Ln.SplitDelimit(" ", 8); if (p.Length() < 7) d->Log->Print("%s:%i - Error: not enough tokens: '%s'\n", _FL, Ln.Get()); else { auto path = p[6]; f = new VcFile(d, this, path, IsWorking); auto state = p[1].Strip("."); auto pos = p[1].Find(state); d->Log->Print("%s state='%s' pos=%i\n", path.Get(), state.Get(), (int)pos); f->SetText(state, COL_STATE); f->SetText(p.Last(), COL_FILENAME); f->SetStaged(pos == 0); } } else if (Fmt == 1) { LString::Array p = Ln.SplitDelimit(" "); f = new VcFile(d, this, LString(), IsWorking); f->SetText(p[0], COL_STATE); f->SetText(p.Last(), COL_FILENAME); } if (f) Ins.Insert(f); } else if (ShowUntracked) { VcFile *f = new VcFile(d, this, LString(), IsWorking); f->SetText("?", COL_STATE); f->SetText(Ln(2,-1), COL_FILENAME); Ins.Insert(f); } } break; } case VcHg: case VcSvn: { if (s.Find("failed to import") >= 0) { OnCmdError(s, "Tool error."); return false; } LString::Array Lines = s.SplitDelimit("\r\n"); for (auto Ln : Lines) { char Type = Ln(0); if (Ln.Lower().Find("error:") >= 0) { } else if (Ln.Find("client is too old") >= 0) { OnCmdError(s, "Client too old."); return false; } else if (Strchr(" \t", Type) || Ln.Find("Summary of conflicts") >= 0) { // Ignore } else if (Type != '?') { LString::Array p = Ln.SplitDelimit(" ", 1); if (p.Length() == 2) { LString File; if (GetType() == VcSvn) File = ConvertUPlus(p.Last()); else File = p.Last(); if (GetType() == VcSvn && File.Find("+ ") == 0) { File = File(5, -1); } VcFile *f = new VcFile(d, this, LString(), IsWorking); f->SetText(p[0], COL_STATE); f->SetText(File.Replace("\\","/"), COL_FILENAME); f->GetStatus(); Ins.Insert(f); } else LAssert(!"What happen?"); } else if (ShowUntracked) { VcFile *f = new VcFile(d, this, LString(), IsWorking); f->SetText("?", COL_STATE); f->SetText(Ln(2,-1), COL_FILENAME); Ins.Insert(f); } } break; } default: { LAssert(!"Impl me."); break; } } if ((Unpushed = Ins.Length() > 0)) { if (CmdErrors == 0) GetCss(true)->Color(LColour(255, 128, 0)); } else if (Unpulled == 0) { GetCss(true)->Color(LCss::ColorInherit); } Update(); if (LTreeItem::Select()) { d->Files->Insert(Ins); FilterCurrentFiles(); } else { Ins.DeleteObjects(); } if (Params && Params->Leaf) Params->Leaf->AfterBrowse(); return false; // Don't refresh list } // Clone/checkout any sub-repositries. bool VcFolder::UpdateSubs() { LString Arg; switch (GetType()) { default: case VcSvn: case VcHg: case VcCvs: return false; case VcGit: Arg = "submodule update --init --recursive"; break; } return StartCmd(Arg, &VcFolder::ParseUpdateSubs, NULL, LogNormal); } bool VcFolder::ParseUpdateSubs(int Result, LString s, ParseParams *Params) { switch (GetType()) { default: case VcSvn: case VcHg: case VcCvs: return false; case VcGit: break; } return false; } void VcFolder::FolderStatus(const char *uri, VcLeaf *Notify) { LUri Uri(uri); if (Uri.IsFile() && Uri.sPath) { LFile::Path p(Uri.sPath(1,-1)); if (!p.IsFolder()) { LAssert(!"Needs to be a folder."); return; } } if (LTreeItem::Select()) d->ClearFiles(); LString Arg; switch (GetType()) { case VcSvn: case VcHg: Arg = "status"; break; case VcCvs: Arg = "status -l"; break; case VcGit: if (!ToolVersion[VcGit]) LAssert(!"Where is the version?"); // What version did =2 become available? It's definitely not in v2.5.4 // Not in v2.7.4 either... if (ToolVersion[VcGit] >= Ver2Int("2.8.0")) Arg = "-P status --porcelain=2"; else Arg = "-P status --porcelain"; break; default: return; } ParseParams *p = new ParseParams; if (uri && Notify) { p->AltInitPath = uri; p->Leaf = Notify; } else { p->IsWorking = true; } StartCmd(Arg, &VcFolder::ParseStatus, p); switch (GetType()) { case VcHg: CountToTip(); break; default: break; } } void VcFolder::CountToTip() { // if (Path.Equals("C:\\Users\\matthew\\Code\\Lgi\\trunk")) { // LgiTrace("%s: CountToTip, br=%s, idx=%i\n", Path.Get(), CurrentBranch.Get(), (int)CurrentCommitIdx); if (!CurrentBranch) GetBranches(new ParseParams("CountToTip")); else if (CurrentCommitIdx < 0) GetCurrentRevision(new ParseParams("CountToTip")); else { LString Arg; Arg.Printf("id -n -r %s", CurrentBranch.Get()); StartCmd(Arg, &VcFolder::ParseCountToTip); } } } bool VcFolder::ParseCountToTip(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcHg: if (CurrentCommitIdx >= 0) { auto p = s.Strip(); auto idx = p.Int(); if (idx >= CurrentCommitIdx) { Unpulled = (int) (idx - CurrentCommitIdx); Update(); } } break; default: break; } return false; } void VcFolder::ListWorkingFolder() { if (IsListingWorking) return; d->ClearFiles(); bool Untracked = d->IsMenuChecked(IDM_UNTRACKED); LString Arg; switch (GetType()) { case VcPending: OnVcsTypeEvents.Add([this]() { ListWorkingFolder(); }); break; case VcCvs: if (Untracked) Arg = "-qn update"; else Arg = "-q diff --brief"; break; case VcSvn: Arg = "status"; break; case VcGit: #if 1 Arg = "-P status -vv"; #else Arg = "-P diff --diff-filter=CMRTU --cached"; #endif break; case VcHg: Arg = "status -mard"; break; default: return; } IsListingWorking = StartCmd(Arg, &VcFolder::ParseWorking); } void VcFolder::GitAdd() { if (!PostAdd) return; LString Args; if (PostAdd->Files.Length() == 0) { LString m(PostAdd->Msg); m = m.Replace("\"", "\\\""); Args.Printf("commit -m \"%s\"", m.Get()); IsCommit = StartCmd(Args, &VcFolder::ParseCommit, PostAdd->Param, LogNormal); PostAdd.Reset(); } else { char NativeSep[] = {GetPathSep(), 0}; LString Last = PostAdd->Files.Last(); Args.Printf("add \"%s\"", Last.Replace("\"", "\\\"").Replace("/", NativeSep).Get()); PostAdd->Files.PopLast(); StartCmd(Args, &VcFolder::ParseGitAdd, NULL, LogNormal); } } bool VcFolder::ParseGitAdd(int Result, LString s, ParseParams *Params) { if (Result) { OnCmdError(s, "add failed."); } else { GitAdd(); } return false; } bool VcFolder::ParseCommit(int Result, LString s, ParseParams *Params) { if (LTreeItem::Select()) Select(true); CommitListDirty = Result == 0; CurrentCommit.Empty(); IsCommit = false; if (Result) { switch (GetType()) { case VcGit: { if (s.Find("Please tell me who you are") >= 0) { auto i = new LInput(GetTree(), "", "Git user name:", AppName); i->DoModal([this, i](auto dlg, auto ctrlId) { if (ctrlId) { LString Args; Args.Printf("config --global user.name \"%s\"", i->GetStr().Get()); StartCmd(Args); auto inp = new LInput(GetTree(), "", "Git user email:", AppName); i->DoModal([this, inp](auto dlg, auto ctrlId) { if (ctrlId) { LString Args; Args.Printf("config --global user.email \"%s\"", inp->GetStr().Get()); StartCmd(Args); } delete dlg; }); } delete dlg; }); } break; } default: break; } return false; } if (Result == 0 && LTreeItem::Select()) { d->ClearFiles(); auto *w = d->Diff ? d->Diff->GetWindow() : NULL; if (w) w->SetCtrlName(IDC_MSG, NULL); } switch (GetType()) { case VcGit: { Unpushed++; CommitListDirty = true; Update(); if (Params && Params->Str.Find("Push") >= 0) Push(); break; } case VcSvn: { CurrentCommit.Empty(); CommitListDirty = true; GetTree()->SendNotify((LNotifyType)LvcCommandEnd); if (!Result) { Unpushed = 0; Update(); GetCss(true)->Color(LColour::Green); } break; } case VcHg: { CurrentCommit.Empty(); CommitListDirty = true; GetTree()->SendNotify((LNotifyType)LvcCommandEnd); if (!Result) { Unpushed = 0; Update(); if (Params && Params->Str.Find("Push") >= 0) Push(); else GetCss(true)->Color(LColour::Green); } break; } case VcCvs: { CurrentCommit.Empty(); CommitListDirty = true; GetTree()->SendNotify((LNotifyType)LvcCommandEnd); if (!Result) { Unpushed = 0; Update(); GetCss(true)->Color(LColour::Green); } break; } default: { LAssert(!"Impl me."); break; } } return true; } void VcFolder::Commit(const char *Msg, const char *Branch, bool AndPush) { LArray Add; bool Partial = false; for (auto fp: *d->Files) { VcFile *f = dynamic_cast(fp); if (f) { int c = f->Checked(); if (c > 0) Add.Add(f); else Partial = true; } } if (CurrentBranch && Branch && !CurrentBranch.Equals(Branch)) { int Response = LgiMsg(GetTree(), "Do you want to start a new branch?", AppName, MB_YESNO); if (Response != IDYES) return; LJson j; j.Set("Command", "commit"); j.Set("Msg", Msg); j.Set("AndPush", (int64_t)AndPush); StartBranch(Branch, j.GetJson()); return; } if (!IsCommit) { LString Args; ParseParams *Param = AndPush ? new ParseParams("Push") : NULL; switch (GetType()) { case VcGit: { if (Add.Length() == 0) { break; } else if (Partial) { if (PostAdd.Reset(new GitCommit)) { PostAdd->Files.SetFixedLength(false); for (auto f : Add) PostAdd->Files.Add(f->GetFileName()); PostAdd->Msg = Msg; PostAdd->Branch = Branch; PostAdd->Param = Param; GitAdd(); } } else { LString m(Msg); m = m.Replace("\"", "\\\""); Args.Printf("commit -am \"%s\"", m.Get()); IsCommit = StartCmd(Args, &VcFolder::ParseCommit, Param, LogNormal); } break; } case VcSvn: { LString::Array a; a.New().Printf("commit -m \"%s\"", Msg); for (auto pf: Add) { LString s = pf->GetFileName(); if (s.Find(" ") >= 0) a.New().Printf("\"%s\"", s.Get()); else a.New() = s; } Args = LString(" ").Join(a); IsCommit = StartCmd(Args, &VcFolder::ParseCommit, Param, LogNormal); if (d->Tabs && IsCommit) { d->Tabs->Value(1); GetTree()->SendNotify((LNotifyType)LvcCommandStart); } break; } case VcHg: { LString::Array a; LString CommitMsg = Msg; TmpFile Tmp; if (CommitMsg.Find("\n") >= 0) { Tmp.Create().Write(Msg); a.New().Printf("commit -l \"%s\"", Tmp.GetName()); } else { a.New().Printf("commit -m \"%s\"", Msg); } if (Partial) { for (auto pf: Add) { LString s = pf->GetFileName(); if (s.Find(" ") >= 0) a.New().Printf("\"%s\"", s.Get()); else a.New() = s; } } Args = LString(" ").Join(a); IsCommit = StartCmd(Args, &VcFolder::ParseCommit, Param, LogNormal); if (d->Tabs && IsCommit) { d->Tabs->Value(1); GetTree()->SendNotify((LNotifyType)LvcCommandStart); } break; } case VcCvs: { LString a; a.Printf("commit -m \"%s\"", Msg); IsCommit = StartCmd(a, &VcFolder::ParseCommit, NULL, LogNormal); break; } default: { OnCmdError(LString(), "No commit impl for type."); break; } } } } bool VcFolder::ParseStartBranch(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcHg: { if (Result == 0 && Params && Params->Str) { LJson j(Params->Str); auto cmd = j.Get("Command"); if (cmd.Equals("commit")) { auto Msg = j.Get("Msg"); auto AndPush = j.Get("AndPush").Int(); if (Msg) { Commit(Msg, NULL, AndPush > 0); } } } break; } default: { OnCmdError(LString(), "No commit impl for type."); break; } } return true; } void VcFolder::StartBranch(const char *BranchName, const char *OnCreated) { if (!BranchName) return; switch (GetType()) { case VcHg: { LString a; a.Printf("branch \"%s\"", BranchName); StartCmd(a, &VcFolder::ParseStartBranch, OnCreated ? new ParseParams(OnCreated) : NULL); break; } default: { NoImplementation(_FL); break; } } } void VcFolder::Push(bool NewBranchOk) { LString Args; bool Working = false; switch (GetType()) { case VcHg: { auto args = NewBranchOk ? "push --new-branch" : "push"; Working = StartCmd(args, &VcFolder::ParsePush, NULL, LogNormal); break; } case VcGit: { LString args; if (NewBranchOk) { if (CurrentBranch) { args.Printf("push --set-upstream origin %s", CurrentBranch.Get()); } else { OnCmdError(LString(), "Don't have the current branch?"); return; } } else { args = "push"; } Working = StartCmd(args, &VcFolder::ParsePush, NULL, LogNormal); break; } case VcSvn: { // Nothing to do here.. the commit pushed the data already break; } default: { OnCmdError(LString(), "No push impl for type."); break; } } if (d->Tabs && Working) { d->Tabs->Value(1); GetTree()->SendNotify((LNotifyType)LvcCommandStart); } } bool VcFolder::ParsePush(int Result, LString s, ParseParams *Params) { bool Status = false; if (Result) { bool needsNewBranchPerm = false; switch (GetType()) { case VcHg: { needsNewBranchPerm = s.Find("push creates new remote branches") >= 0; break; } case VcGit: { needsNewBranchPerm = s.Find("The current branch") >= 0 && s.Find("has no upstream branch") >= 0; break; } } if (needsNewBranchPerm && LgiMsg(GetTree(), LLoadString(IDS_CREATE_NEW_BRANCH), AppName, MB_YESNO) == IDYES) { Push(true); return false; } OnCmdError(s, "Push failed."); } else { switch (GetType()) { case VcGit: break; case VcSvn: break; default: break; } Unpushed = 0; GetCss(true)->Color(LColour::Green); Update(); Status = true; } GetTree()->SendNotify((LNotifyType)LvcCommandEnd); return Status; // no reselect } void VcFolder::Pull(int AndUpdate, LoggingType Logging) { bool Status = false; if (AndUpdate < 0) AndUpdate = GetTree()->GetWindow()->GetCtrlValue(IDC_UPDATE) != 0; switch (GetType()) { case VcNone: return; case VcHg: Status = StartCmd(AndUpdate ? "pull -u" : "pull", &VcFolder::ParsePull, NULL, Logging); break; case VcGit: Status = StartCmd(AndUpdate ? "pull" : "fetch", &VcFolder::ParsePull, NULL, Logging); break; case VcSvn: Status = StartCmd("up", &VcFolder::ParsePull, NULL, Logging); break; case VcPending: OnVcsTypeEvents.New() = [this, AndUpdate, Logging]() { Pull(AndUpdate, Logging); }; break; default: NoImplementation(_FL); break; } if (d->Tabs && Status) { d->Tabs->Value(1); GetTree()->SendNotify((LNotifyType)LvcCommandStart); } } bool VcFolder::ParsePull(int Result, LString s, ParseParams *Params) { GetTree()->SendNotify((LNotifyType)LvcCommandEnd); if (Result) { OnCmdError(s, "Pull failed."); return false; } else ClearError(); switch (GetType()) { case VcGit: { // Git does a merge by default, so the current commit changes... CurrentCommit.Empty(); break; } case VcHg: { CurrentCommit.Empty(); auto Lines = s.SplitDelimit("\n"); bool HasUpdates = false; for (auto Ln: Lines) { if (Ln.Find("files updated") < 0) continue; auto Parts = Ln.Split(","); for (auto p: Parts) { auto n = p.Strip().Split(" ", 1); if (n.Length() == 2) { if (n[0].Int() > 0) HasUpdates = true; } } } if (HasUpdates) GetCss(true)->Color(LColour::Green); else GetCss(true)->Color(LCss::ColorInherit); break; } case VcSvn: { // Svn also does a merge by default and can update our current position... CurrentCommit.Empty(); LString::Array a = s.SplitDelimit("\r\n"); for (auto &Ln: a) { if (Ln.Find("At revision") >= 0) { LString::Array p = Ln.SplitDelimit(" ."); CurrentCommit = p.Last(); break; } else if (Ln.Find("svn cleanup") >= 0) { OnCmdError(s, "Needs cleanup"); break; } } if (Params && Params->Str.Equals("log")) { LVariant Limit; d->Opts.GetValue("svn-limit", Limit); LString Args; if (Limit.CastInt32() > 0) Args.Printf("log --limit %i", Limit.CastInt32()); else Args = "log"; IsLogging = StartCmd(Args, &VcFolder::ParseLog); return false; } break; } default: break; } CommitListDirty = true; return true; // Yes - reselect and update } void VcFolder::MergeToLocal(LString Rev) { switch (GetType()) { case VcGit: { LString Args; Args.Printf("merge -m \"Merge with %s\" %s", Rev.Get(), Rev.Get()); StartCmd(Args, &VcFolder::ParseMerge, NULL, LogNormal); break; } case VcHg: { LString Args; Args.Printf("merge -r %s", Rev.Get()); StartCmd(Args, &VcFolder::ParseMerge, NULL, LogNormal); break; } default: LgiMsg(GetTree(), LLoadString(IDS_ERR_NO_IMPL_FOR_TYPE), AppName); break; } } bool VcFolder::ParseMerge(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcGit: case VcHg: if (Result == 0) CommitListDirty = true; else OnCmdError(s, LLoadString(IDS_ERR_MERGE_FAILED)); break; default: LAssert(!"Impl me."); break; } return true; } void VcFolder::Refresh() { CommitListDirty = true; CurrentCommit.Empty(); GitNames.Empty(); Branches.DeleteObjects(); if (Uncommit && Uncommit->LListItem::Select()) Uncommit->Select(true); Select(true); } void VcFolder::Clean() { switch (GetType()) { case VcSvn: StartCmd("cleanup", &VcFolder::ParseClean, NULL, LogNormal); break; default: LgiMsg(GetTree(), LLoadString(IDS_ERR_NO_IMPL_FOR_TYPE), AppName); break; } } bool VcFolder::ParseClean(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcSvn: if (Result == 0) GetCss(true)->Color(LCss::ColorInherit); break; default: LAssert(!"Impl me."); break; } return false; } LColour VcFolder::BranchColour(const char *Name) { if (!Name) return GetPaletteColour(0); auto b = Branches.Find(Name); if (!b) // Must be a new one? { int i = 1; for (auto b: Branches) { auto &v = b.value; if (!v->Colour.IsValid()) { if (v->Default) v->Colour = GetPaletteColour(0); else v->Colour = GetPaletteColour(i++); } } Branches.Add(Name, b = new VcBranch(Name)); b->Colour = GetPaletteColour((int)Branches.Length()); } return b ? b->Colour : GetPaletteColour(0); } void VcFolder::CurrentRev(std::function Callback) { LString Cmd; Cmd.Printf("id -i"); RunCmd(Cmd, LogNormal, [Callback](auto r) { if (r.Code == 0) Callback(r.Out.Strip()); }); } bool VcFolder::RenameBranch(LString NewName, LArray &Revs) { switch (GetType()) { case VcHg: { // Update to the ancestor of the commits LHashTbl,int> Refs(0, -1); for (auto c: Revs) { for (auto p:*c->GetParents()) if (Refs.Find(p) < 0) Refs.Add(p, 0); if (Refs.Find(c->GetRev()) >= 0) Refs.Add(c->GetRev(), 1); } LString::Array Ans; for (auto i:Refs) { if (i.value == 0) Ans.Add(i.key); } LArray Ancestors = d->GetRevs(Ans); if (Ans.Length() != 1) { // We should only have one ancestor LString s, m; s.Printf("Wrong number of ancestors: " LPrintfInt64 ".\n", Ans.Length()); for (auto i: Ancestors) { m.Printf("\t%s\n", i->GetRev()); s += m; } LgiMsg(GetTree(), s, AppName, MB_OK); break; } LArray Top; for (auto c:Revs) { for (auto p:*c->GetParents()) if (Refs.Find(p) == 0) Top.Add(c); } if (Top.Length() != 1) { d->Log->Print("Error: Can't find top most commit. (%s:%i)\n", _FL); return false; } // Create the new branch... auto First = Ancestors.First(); LString Cmd; Cmd.Printf("update -r " LPrintfInt64, First->GetIndex()); RunCmd(Cmd, LogNormal, [this, &Cmd, NewName, &Top](auto r) { if (r.Code) { d->Log->Print("Error: Cmd '%s' failed. (%s:%i)\n", Cmd.Get(), _FL); return; } Cmd.Printf("branch \"%s\"", NewName.Get()); RunCmd(Cmd, LogNormal, [this, &Cmd, NewName, &Top](auto r) { if (r.Code) { d->Log->Print("Error: Cmd '%s' failed. (%s:%i)\n", Cmd.Get(), _FL); return; } // Commit it to get a revision point to rebase to Cmd.Printf("commit -m \"Branch: %s\"", NewName.Get()); RunCmd(Cmd, LogNormal, [this, &Cmd, NewName, &Top](auto r) { if (r.Code) { d->Log->Print("Error: Cmd '%s' failed. (%s:%i)\n", Cmd.Get(), _FL); return; } CurrentRev([this, &Cmd, NewName, &Top](auto BranchNode) { // Rebase the old tree to this point Cmd.Printf("rebase -s %s -d %s", Top.First()->GetRev(), BranchNode.Get()); RunCmd(Cmd, LogNormal, [this, &Cmd, NewName, Top](auto r) { if (r.Code) { d->Log->Print("Error: Cmd '%s' failed. (%s:%i)\n", Cmd.Get(), _FL); return; } CommitListDirty = true; d->Log->Print("Finished rename.\n", _FL); }); }); }); }); }); break; } default: { LgiMsg(GetTree(), LLoadString(IDS_ERR_NO_IMPL_FOR_TYPE), AppName); break; } } return true; } bool VcFolder::ParseAddFile(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcCvs: { if (Result) { d->Tabs->Value(1); OnCmdError(s, LLoadString(IDS_ERR_ADD_FAILED)); } else ClearError(); break; } default: break; } return false; } bool VcFolder::AddFile(const char *Path, bool AsBinary) { if (!Path) return false; switch (GetType()) { case VcCvs: { auto p = LString(Path).RSplit(DIR_STR, 1); ParseParams *params = NULL; if (p.Length() >= 2) { if ((params = new ParseParams)) params->AltInitPath = p[0]; } LString a; a.Printf("add%s \"%s\"", AsBinary ? " -kb" : "", p.Length() > 1 ? p.Last().Get() : Path); return StartCmd(a, &VcFolder::ParseAddFile, params); break; } default: { NoImplementation(_FL); break; } } return false; } bool VcFolder::ParseRevert(int Result, LString s, ParseParams *Params) { if (GetType() == VcSvn) { if (s.Find("Skipped ") >= 0) Result = 1; // Stupid svn... *sigh* } if (Result) { OnCmdError(s, LLoadString(IDS_ERR_REVERT_FAILED)); } ListWorkingFolder(); return false; } bool VcFolder::Revert(LString::Array &Uris, const char *Revision) { if (Uris.Length() == 0) return false; switch (GetType()) { case VcGit: { LStringPipe cmd, paths; LAutoPtr params; if (Revision) { cmd.Print("checkout %s", Revision); } else { // Unstage the file... cmd.Print("reset"); } for (auto u: Uris) { auto Path = GetFilePart(u); paths.Print(" \"%s\"", Path.Get()); } auto p = paths.NewLStr(); cmd.Write(p); if (!Revision) { if (params.Reset(new ParseParams)) { params->Callback = [this, p](auto code, auto str) { LString c; c.Printf("checkout %s", p.Get()); StartCmd(c, &VcFolder::ParseRevert); }; } } return StartCmd(cmd.NewLStr(), &VcFolder::ParseRevert, params.Release()); break; } case VcHg: case VcSvn: { LStringPipe p; if (Revision) p.Print("up -r %s", Revision); else p.Print("revert"); for (auto u: Uris) { auto Path = GetFilePart(u); p.Print(" \"%s\"", Path.Get()); } auto a = p.NewLStr(); return StartCmd(a, &VcFolder::ParseRevert); break; } default: { NoImplementation(_FL); break; } } return false; } bool VcFolder::ParseResolveList(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcHg: { auto lines = s.Replace("\r").Split("\n"); for (auto &ln: lines) { auto p = ln.Split(" ", 1); if (p.Length() == 2) { if (p[0].Equals("U")) { auto f = new VcFile(d, this, LString(), true); f->SetText(p[0], COL_STATE); f->SetText(p[1], COL_FILENAME); f->GetStatus(); d->Files->Insert(f); } } } break; } default: { NoImplementation(_FL); break; } } return true; } bool VcFolder::ParseResolve(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcGit: { break; } case VcHg: { d->Log->Print("Resolve: %s\n", s.Get()); break; } default: { NoImplementation(_FL); break; } } return true; } bool VcFolder::Resolve(const char *Path, LvcResolve Type) { if (!Path) return false; switch (GetType()) { case VcGit: { LString a; auto local = GetFilePart(Path); LAutoPtr params(new ParseParams(Path)); switch (Type) { case ResolveIncoming: a.Printf("checkout --theirs \"%s\"", local.Get()); break; case ResolveLocal: a.Printf("checkout --ours \"%s\"", local.Get()); break; case ResolveMark: a.Printf("add \"%s\"", local.Get()); break; default: OnCmdError(Path, "No resolve type implemented."); return false; } if (Type == ResolveIncoming || Type == ResolveLocal) { // Add the file after the resolution: params->Callback = [this, local](auto code, auto str) { LString a; a.Printf("add \"%s\"", local.Get()); StartCmd(a, &VcFolder::ParseAddFile); Refresh(); }; } return StartCmd(a, &VcFolder::ParseResolve, params.Release()); } case VcHg: { LString a; auto local = GetFilePart(Path); switch (Type) { case ResolveMark: a.Printf("resolve -m \"%s\"", local.Get()); break; case ResolveUnmark: a.Printf("resolve -u \"%s\"", local.Get()); break; case ResolveLocal: a.Printf("resolve -t internal:local \"%s\"", local.Get()); break; case ResolveIncoming: a.Printf("resolve -t internal:other \"%s\"", local.Get()); break; default: break; } if (a) return StartCmd(a, &VcFolder::ParseResolve, new ParseParams(Path)); break; } case VcSvn: case VcCvs: default: { NoImplementation(_FL); break; } } return false; } bool BlameLine::Parse(VersionCtrl type, LArray &out, LString in) { auto lines = in.SplitDelimit("\n", -1, false); switch (type) { case VcGit: { for (auto &ln: lines) { auto s = ln.Get(); auto open = ln.Find("("); auto close = ln.Find(")", open); if (open > 0 && close > open) { auto eRef = ln(0, open-1); auto fields = ln(open + 1, close); auto parts = fields.SplitDelimit(); auto &o = out.New(); o.ref = eRef; o.line = parts.Last(); parts.PopLast(); LString::Array name; LDateTime dt; for (auto p: parts) { auto first = p(0); if (IsDigit(first)) { if (p.Find("-") > 0) dt.SetDate(p); else if (p.Find(":") > 0) dt.SetTime(p); } else if (first == '+') dt.SetTimeZone((int)p.Int(), false); else name.Add(p); } o.user = LString(" ").Join(name); o.date = dt.Get(); o.src = ln(close + 1, -1); } else if (ln.Length() > 0) { int asd=0; } } break; } case VcHg: { for (auto &ln: lines) { auto s = ln.Get(); auto eUser = strchr(s, ' '); if (!eUser) continue; auto eRef = strchr(eUser, ':'); if (!eRef) continue; auto &o = out.New(); o.user.Set(s, eUser++ - s); o.ref.Set(eUser, eRef - eUser); o.src = eRef + 1; } break; } /* case VcSvn: { break; } */ default: { LAssert(0); return false; } } return true; } bool VcFolder::ParseBlame(int Result, LString s, ParseParams *Params) { if (!Params) { LAssert(!"Need the path in the params."); return false; } LArray lines; if (BlameLine::Parse(GetType(), lines, s)) { if (auto ui = new BrowseUi(BrowseUi::TBlame, d, this, Params->Str)) ui->ParseBlame(lines, s); } else NoImplementation(_FL); return false; } bool VcFolder::Blame(const char *Path) { if (!Path) return false; auto file = GetFilePart(Path); LAutoPtr Params(new ParseParams(file)); LUri u(Path); switch (GetType()) { case VcGit: { LString a; a.Printf("-P blame \"%s\"", file.Get()); return StartCmd(a, &VcFolder::ParseBlame, Params.Release()); break; } case VcHg: { LString a; a.Printf("annotate -un \"%s\"", file.Get()); return StartCmd(a, &VcFolder::ParseBlame, Params.Release()); break; } case VcSvn: { LString a; a.Printf("blame \"%s\"", file.Get()); return StartCmd(a, &VcFolder::ParseBlame, Params.Release()); break; } default: { NoImplementation(_FL); break; } } return true; } bool VcFolder::SaveFileAs(const char *Path, const char *Revision) { if (!Path || !Revision) return false; return true; } bool VcFolder::ParseSaveAs(int Result, LString s, ParseParams *Params) { return false; } bool VcFolder::ParseCounts(int Result, LString s, ParseParams *Params) { switch (GetType()) { case VcGit: { Unpushed = (int) s.Strip().Split("\n").Length(); break; } case VcSvn: { int64 ServerRev = 0; bool HasUpdate = false; LString::Array c = s.Split("\n"); for (unsigned i=0; i 1 && a[0].Equals("Status")) ServerRev = a.Last().Int(); else if (a[0].Equals("*")) HasUpdate = true; } if (ServerRev > 0 && HasUpdate) { int64 CurRev = CurrentCommit.Int(); Unpulled = (int) (ServerRev - CurRev); } else Unpulled = 0; Update(); break; } default: { LAssert(!"Impl me."); break; } } IsUpdatingCounts = false; Update(); return false; // No re-select } void VcFolder::SetEol(const char *Path, int Type) { if (!Path) return; switch (Type) { case IDM_EOL_LF: { ConvertEol(Path, false); break; } case IDM_EOL_CRLF: { ConvertEol(Path, true); break; } case IDM_EOL_AUTO: { #ifdef WINDOWS ConvertEol(Path, true); #else ConvertEol(Path, false); #endif break; } } } void VcFolder::UncommitedItem::Select(bool b) { LListItem::Select(b); if (b) { LTreeItem *i = d->Tree->Selection(); VcFolder *f = dynamic_cast(i); if (f) f->ListWorkingFolder(); if (d->Msg) { d->Msg->Name(NULL); auto *w = d->Msg->GetWindow(); if (w) { w->SetCtrlEnabled(IDC_COMMIT, true); w->SetCtrlEnabled(IDC_COMMIT_AND_PUSH, true); } } } } void VcFolder::UncommitedItem::OnPaint(LItem::ItemPaintCtx &Ctx) { LFont *f = GetList()->GetFont(); f->Transparent(false); f->Colour(Ctx.Fore, Ctx.Back); LDisplayString ds(f, "(working folder)"); ds.Draw(Ctx.pDC, Ctx.x1 + ((Ctx.X() - ds.X()) / 2), Ctx.y1 + ((Ctx.Y() - ds.Y()) / 2), &Ctx); } ////////////////////////////////////////////////////////////////////////////////////////// VcLeaf::VcLeaf(VcFolder *parent, LTreeItem *Item, LString uri, LString leaf, bool folder) { Parent = parent; d = Parent->GetPriv(); LAssert(uri.Find("://") >= 0); // Is URI Uri.Set(uri); LAssert(Uri); Leaf = leaf; Folder = folder; Item->Insert(this); if (Folder) { Insert(Tmp = new LTreeItem); Tmp->SetText("Loading..."); } } VcLeaf::~VcLeaf() { for (auto l: Log) { if (!l->GetList()) delete l; } } LString VcLeaf::Full() { LUri u = Uri; u += Leaf; return u.ToString(); } void VcLeaf::OnBrowse() { auto full = Full(); LList *Files = d->Files; Files->Empty(); LDirectory Dir; for (int b = Dir.First(full); b; b = Dir.Next()) { if (Dir.IsDir()) continue; VcFile *f = new VcFile(d, Parent, LString(), true); if (f) { f->SetUri(LString("file://") + full); f->SetText(Dir.GetName(), COL_FILENAME); Files->Insert(f); } } Files->ResizeColumnsToContent(); if (Folder) Parent->FolderStatus(full, this); } void VcLeaf::AfterBrowse() { } VcLeaf *VcLeaf::FindLeaf(const char *Path, bool OpenTree) { if (!Stricmp(Path, Full().Get())) return this; if (OpenTree) DoExpand(); VcLeaf *r = NULL; for (auto n = GetChild(); !r && n; n = n->GetNext()) { auto l = dynamic_cast(n); if (l) r = l->FindLeaf(Path, OpenTree); } return r; } void VcLeaf::DoExpand() { if (Tmp) { Tmp->Remove(); DeleteObj(Tmp); Parent->ReadDir(this, Full()); } } void VcLeaf::OnExpand(bool b) { if (b) DoExpand(); } const char *VcLeaf::GetText(int Col) { if (Col == 0) return Leaf; return NULL; } int VcLeaf::GetImage(int Flags) { return Folder ? IcoFolder : IcoFile; } int VcLeaf::Compare(VcLeaf *b) { // Sort folders to the top... if (Folder ^ b->Folder) return (int)b->Folder - (int)Folder; // Then alphabetical return Stricmp(Leaf.Get(), b->Leaf.Get()); } bool VcLeaf::Select() { return LTreeItem::Select(); } void VcLeaf::Select(bool b) { LTreeItem::Select(b); if (b) { d->Commits->RemoveAll(); OnBrowse(); ShowLog(); } } void VcLeaf::ShowLog() { if (!Log.Length()) return; d->Commits->RemoveAll(); Parent->DefaultFields(); Parent->UpdateColumns(); for (auto i: Log) // We make a copy of the commit here so that the LList owns the copied object, // and this object still owns 'i'. d->Commits->Insert(new VcCommit(*i), -1, false); d->Commits->UpdateAllItems(); d->Commits->ResizeColumnsToContent(); } void VcLeaf::OnMouseClick(LMouse &m) { if (m.IsContextMenu()) { LSubMenu s; s.AppendItem("Log", IDM_LOG); s.AppendItem("Blame", IDM_BLAME, !Folder); s.AppendSeparator(); s.AppendItem("Browse To", IDM_BROWSE_FOLDER); s.AppendItem("Terminal At", IDM_TERMINAL); int Cmd = s.Float(GetTree(), m - _ScrollPos()); switch (Cmd) { case IDM_LOG: { Parent->LogFile(Full()); break; } case IDM_BLAME: { Parent->Blame(Full()); break; } case IDM_BROWSE_FOLDER: { LBrowseToFile(Full()); break; } case IDM_TERMINAL: { TerminalAt(Full()); break; } } } } ///////////////////////////////////////////////////////////////////////////////////////// ProcessCallback::ProcessCallback(LString exe, LString args, LString localPath, LTextLog *log, LView *view, std::function callback) : Log(log), View(view), Callback(callback), LThread("ProcessCallback.Thread"), LSubProcess(exe, args) { SetInitFolder(localPath); if (Log) Log->Print("%s %s\n", exe.Get(), args.Get()); Run(); } int ProcessCallback::Main() { if (!Start()) { Ret.Out.Printf("Process failed with %i", GetErrorCode()); Callback(Ret); } else { while (IsRunning()) { auto Rd = Read(); if (Rd.Length()) { Ret.Out += Rd; if (Log) Log->Write(Rd.Get(), Rd.Length()); } } auto Rd = Read(); if (Rd.Length()) { Ret.Out += Rd; if (Log) Log->Write(Rd.Get(), Rd.Length()); } Ret.Code = GetExitValue(); } View->PostEvent(M_HANDLE_CALLBACK, (LMessage::Param)this); return 0; } void ProcessCallback::OnComplete() // Called in the GUI thread... { Callback(Ret); } diff --git a/lvc/src/VcFolder.h b/lvc/src/VcFolder.h --- a/lvc/src/VcFolder.h +++ b/lvc/src/VcFolder.h @@ -1,407 +1,415 @@ #ifndef _VcFolder_h_ #define _VcFolder_h_ #include #include "lgi/common/SubProcess.h" #include "lgi/common/Uri.h" #include "SshConnection.h" class VcLeaf; enum LoggingType { LogNone, // No output from cmd LogNormal, // Output appears as it's available LogSilo, // Output appears after cmd finished (keeps it non-interleaved with other log msgs) LogDebug, // Debug log level }; enum LvcError { ErrNone, ErrSubProcessFailed = GSUBPROCESS_ERROR, }; enum LvcStatus { StatusNone, StatusActive, StatusError, }; enum LvcResolve { ResolveNone, //--- ResolveMark, ResolveUnmark, //--- ResolveLocal, ResolveIncoming, ResolveTool, }; class ReaderThread : public LThread { VersionCtrl Vcs; LStream *Out; LAutoPtr Process; int FilterCount; int OnLine(char *s, ssize_t len); bool OnData(char *Buf, ssize_t &r); public: int Result; ReaderThread(VersionCtrl vcs, LAutoPtr p, LStream *out); ~ReaderThread(); int Main(); }; extern int Ver2Int(LString v); extern int ToolVersion[VcMax]; extern int LstCmp(LListItem *a, LListItem *b, int Col); const char *GetVcName(VersionCtrl type); struct Result { int Code; LString Out; }; struct ProcessCallback : public LThread, public LSubProcess { Result Ret; LView *View = NULL; LTextLog *Log = NULL; std::function Callback; public: ProcessCallback(LString exe, LString args, LString localPath, LTextLog *log, LView *view, std::function callback); int Main(); void OnComplete(); }; struct VcBranch : public LString { bool Default; LColour Colour; LString Hash; VcBranch(LString name, LString hash = LString()) { Default = name.Equals("default") || name.Equals("trunk") || name.Equals("main"); Set(name); if (hash) Hash = hash; } }; #if HAS_LIBSSH struct SshParams { SshConnection *c = NULL; SshConnection::LoggingType LogType = SshConnection::LogNone; VcFolder *f = NULL; LString Exe, Args, Path, Output; VersionCtrl Vcs = VcNone; ParseFn Parser = NULL; ParseParams *Params = NULL; int ExitCode = -1; SshParams(SshConnection *con) : c(con) { } }; #endif class VcFolder : public LTreeItem { friend class VcCommit; + struct Author + { + bool InProgress = false; + LString name, email; + operator bool() const { return !name.IsEmpty() && !email.IsEmpty(); } + LString ToString() { return LString::Fmt("%s <%s>", name.Get(), email.Get()); } + }; + class Cmd : public LStream { LString::Array Context; LStringPipe Buf; public: LoggingType Logging; LStream *Log; LAutoPtr Rd; ParseFn PostOp; LAutoPtr Params; LvcError Err; Cmd(LString::Array &context, LoggingType logging, LStream *log) { Context = context; Logging = logging; Log = log; Err = ErrNone; } ~Cmd() { } LString GetBuf() { LString s = Buf.NewLStr(); if (Log && Logging == LogSilo) { LString m; m.Printf("=== %s ===\n\t%s %s\n", Context[0].Get(), Context[1].Get(), Context[2].Get()); Log->Write(m.Get(), m.Length()); auto Lines = s.Split("\n"); for (auto Ln : Lines) Log->Print("\t%s\n", Ln.Get()); } return s; } ssize_t Write(const void *Ptr, ssize_t Size, int Flags = 0) { ssize_t Wr = Buf.Write(Ptr, Size, Flags); if (Log && Logging == LogNormal) Log->Write(Ptr, Size, Flags); if (Flags) Err = (LvcError) Flags; return Wr; } }; class UncommitedItem : public LListItem { AppPriv *d; public: UncommitedItem(AppPriv *priv) { d = priv; } void OnPaint(LItem::ItemPaintCtx &Ctx); void Select(bool b); }; AppPriv *d; VersionCtrl Type = VcNone; LUri Uri; LString CurrentCommit, RepoUrl, VcCmd; int64 CurrentCommitIdx = -1; LArray Log; LString CurrentBranch; LHashTbl,VcBranch*> Branches; LAutoPtr Uncommit; LString Cache, NewRev; bool CommitListDirty = false; int Unpushed = -1, Unpulled = -1; LString CountCache; LTreeItem *Tmp = NULL; int CmdErrors = 0; LArray Fields; LArray> OnVcsTypeEvents; // Author name/email - LString AuthorName, AuthorEmail; + Author AuthorLocal, AuthorGlobal; bool IsGettingAuthor = false; // This is set when a blame or log is looking at a particular file, // and wants it selected after the file list is populated LString FileToSelect; void InsertFiles(List &files); // Git specific LHashTbl,LString> GitNames; void AddGitName(LString Hash, LString Name); LString GetGitNames(LString Hash); static int CmdMaxThreads; static int CmdActiveThreads; struct GitCommit { LString::Array Files; LString Msg, Branch; ParseParams *Param; GitCommit() { Param = NULL; } }; LAutoPtr PostAdd; void GitAdd(); LArray Cmds; bool IsLogging = false, IsUpdate = false, IsFilesCmd = false; bool IsCommit = false, IsUpdatingCounts = false; bool IsListingWorking = false; LvcStatus IsBranches = StatusNone, IsIdent = StatusNone; void Init(AppPriv *priv); const char *GetVcName(); char GetPathSep(); bool StartCmd(const char *Args, ParseFn Parser = NULL, ParseParams *Params = NULL, LoggingType Logging = LogNone); bool RunCmd(const char *Args, LoggingType Logging, std::function Callback); void OnBranchesChange(); void NoImplementation(const char *file, int line); void OnCmdError(LString Output, const char *Msg); void ClearError(); VcFile *FindFile(const char *Path); void LinkParents(); void CurrentRev(std::function Callback); LColour BranchColour(const char *Name); void UpdateBranchUi(); bool ParseDiffs(LString s, LString Rev, bool IsWorking); bool ParseRevList(int Result, LString s, ParseParams *Params); bool ParseLog(int Result, LString s, ParseParams *Params); bool ParseInfo(int Result, LString s, ParseParams *Params); bool ParseFiles(int Result, LString s, ParseParams *Params); bool ParseWorking(int Result, LString s, ParseParams *Params); bool ParseCheckout(int Result, LString s, ParseParams *Params); bool ParseCommit(int Result, LString s, ParseParams *Params); bool ParseGitAdd(int Result, LString s, ParseParams *Params); bool ParsePush(int Result, LString s, ParseParams *Params); bool ParsePull(int Result, LString s, ParseParams *Params); bool ParseCounts(int Result, LString s, ParseParams *Params); bool ParseRevert(int Result, LString s, ParseParams *Params); bool ParseResolveList(int Result, LString s, ParseParams *Params); bool ParseResolve(int Result, LString s, ParseParams *Params); bool ParseBlame(int Result, LString s, ParseParams *Params); bool ParseSaveAs(int Result, LString s, ParseParams *Params); bool ParseBranches(int Result, LString s, ParseParams *Params); bool ParseStatus(int Result, LString s, ParseParams *Params); bool ParseAddFile(int Result, LString s, ParseParams *Params); bool ParseVersion(int Result, LString s, ParseParams *Params); bool ParseClean(int Result, LString s, ParseParams *Params); bool ParseDiff(int Result, LString s, ParseParams *Params); bool ParseMerge(int Result, LString s, ParseParams *Params); bool ParseCountToTip(int Result, LString s, ParseParams *Params); bool ParseUpdateSubs(int Result, LString s, ParseParams *Params); bool ParseRemoteFind(int Result, LString s, ParseParams *Params); bool ParseStartBranch(int Result, LString s, ParseParams *Params); bool ParseSelectCommit(int Result, LString s, ParseParams *Params); void DoExpand(); public: VcFolder(AppPriv *priv, const char *uri); VcFolder(AppPriv *priv, LXmlTag *t); ~VcFolder(); VersionCtrl GetType(); AppPriv *GetPriv() { return d; } bool IsLocal(); const char *LocalPath(); LUri GetUri() { return Uri; } VcLeaf *FindLeaf(const char *Path, bool OpenTree); void DefaultFields(); void UpdateColumns(LList *lst = NULL); int IndexOfCommitField(CommitField fld); const char *GetText(int Col); LArray &GetFields() { return Fields; } bool Serialize(LXmlTag *t, bool Write); LString &GetCurrentBranch(); void SetCurrentBranch(LString name); LXmlTag *Save(); LString GetConfigFile(bool local); bool GetAuthor(bool local, std::function callback); bool SetAuthor(bool local, LString name, LString email); void UpdateAuthorUi(); void Empty(); void Select(bool b); void ListCommit(VcCommit *c); void ListWorkingFolder(); void FolderStatus(const char *Path = NULL, VcLeaf *Notify = NULL); void Commit(const char *Msg, const char *Branch, bool AndPush); void StartBranch(const char *BranchName, const char *OnCreated = NULL); void Push(bool NewBranchOk = false); void Pull(int AndUpdate = -1, LoggingType Logging = LogNormal); void Clean(); bool Revert(LString::Array &uris, const char *Revision = NULL); bool Resolve(const char *Path, LvcResolve Type); bool AddFile(const char *Path, bool AsBinary = true); bool Blame(const char *Path); bool SaveFileAs(const char *Path, const char *Revision); void ReadDir(LTreeItem *Parent, const char *Uri); void SetEol(const char *Path, int Type); void GetVersion(); void Diff(VcFile *file); void DiffRange(const char *FromRev, const char *ToRev); void MergeToLocal(LString Rev); bool RenameBranch(LString NewName, LArray &Revs); void Refresh(); bool GetBranches(ParseParams *Params = NULL); void GetCurrentRevision(ParseParams *Params = NULL); void CountToTip(); bool UpdateSubs(); // Clone/checkout any sub-repositories. void LogFilter(const char *Filter); void LogFile(const char *Path); void ClearLog(); LString GetFilePart(const char *uri); void FilterCurrentFiles(); void GetRemoteUrl(std::function Callback); void SelectCommit(LWindow *Parent, LString Commit, LString Path); void Checkout(const char *Rev, bool isBranch); void OnPulse(); void OnMouseClick(LMouse &m); void OnRemove(); void OnExpand(bool b); void OnVcsType(LString errorMsg); #if HAS_LIBSSH void OnSshCmd(SshParams *p); #endif }; class VcLeaf : public LTreeItem { AppPriv *d = NULL; VcFolder *Parent = NULL; bool Folder = false; LUri Uri; LString Leaf; LTreeItem *Tmp = NULL; void DoExpand(); public: LArray Log; VcLeaf(VcFolder *parent, LTreeItem *Item, LString uri, LString leaf, bool folder); ~VcLeaf(); LString Full(); VcLeaf *FindLeaf(const char *Path, bool OpenTree); void OnBrowse(); void AfterBrowse(); void OnExpand(bool b); const char *GetText(int Col); int GetImage(int Flags); int Compare(VcLeaf *b); bool Select(); void Select(bool b); void OnMouseClick(LMouse &m); void ShowLog(); }; #endif diff --git a/test/UnitTests/win/UnitTests.vcxproj b/test/UnitTests/win/UnitTests.vcxproj --- a/test/UnitTests/win/UnitTests.vcxproj +++ b/test/UnitTests/win/UnitTests.vcxproj @@ -1,277 +1,276 @@  Debug Win32 Debug x64 Release Win32 Release x64 {18BF30E1-D77B-496E-8761-99A426DD3B41} 10.0 Application v142 false MultiByte Application v142 false MultiByte Application v142 false MultiByte Application v142 false MultiByte <_ProjectFileVersion>12.0.30501.0 $(Platform)$(Configuration)14\ $(Platform)$(Configuration)14\ true true $(Platform)$(Configuration)14\ $(Platform)$(Configuration)14\ $(Platform)$(Configuration)14\ $(Platform)$(Configuration)14\ false false $(Platform)$(Configuration)14\ $(Platform)$(Configuration)14\ .\Debug/UnitTests.tlb Disabled ..\..\..\include;..\..\..\include\lgi\win;%(AdditionalIncludeDirectories) WIN32;_DEBUG;_CONSOLE;WINDOWS;LGI_UNIT_TESTS;%(PreprocessorDefinitions) true EnableFastChecks MultiThreadedDebugDLL true $(IntDir)/UnitTests.pch $(IntDir) $(IntDir) $(IntDir)vc$(PlatformToolsetVersion).pdb true ProgramDatabase _DEBUG;%(PreprocessorDefinitions) 0x0c09 $(OutDir)$(TargetName)$(TargetExt) true true $(IntDir)/UnitTests.pdb Console false MachineX86 true .\Debug/UnitTests.bsc .\Debug/UnitTests.tlb Disabled ..\..\..\include;..\..\..\include\lgi\win;%(AdditionalIncludeDirectories) WIN32;_DEBUG;_CONSOLE;WINDOWS;LGI_UNIT_TESTS;%(PreprocessorDefinitions) EnableFastChecks MultiThreadedDebugDLL true $(IntDir)/UnitTests.pch $(IntDir) $(IntDir) $(IntDir)vc$(PlatformToolsetVersion).pdb true ProgramDatabase Level3 _DEBUG;%(PreprocessorDefinitions) 0x0c09 true true $(IntDir)/UnitTests.pdb Console false true .\Debug/UnitTests.bsc .\Release/UnitTests.tlb MinSpace OnlyExplicitInline ..\..\include;..\..\include\lgi\win;%(AdditionalIncludeDirectories) WIN32;NDEBUG;_CONSOLE;WINDOWS;LGI_UNIT_TESTS;%(PreprocessorDefinitions) true MultiThreadedDLL true true $(IntDir)/UnitTests.pch $(IntDir) $(IntDir) $(IntDir)vc$(PlatformToolsetVersion).pdb true NDEBUG;%(PreprocessorDefinitions) 0x0c09 $(OutDir)$(TargetName)$(TargetExt) true $(IntDir)/UnitTests.pdb Console false MachineX86 true .\Release/UnitTests.bsc .\Release/UnitTests.tlb MinSpace OnlyExplicitInline ..\..\include;..\..\include\lgi\win;%(AdditionalIncludeDirectories) WIN32;NDEBUG;_CONSOLE;WINDOWS;LGI_UNIT_TESTS;%(PreprocessorDefinitions) true MultiThreadedDLL true true $(IntDir)/UnitTests.pch $(IntDir) $(IntDir) $(IntDir)vc$(PlatformToolsetVersion).pdb true NDEBUG;%(PreprocessorDefinitions) 0x0c09 $(OutDir)$(TargetName)$(TargetExt) true $(IntDir)/UnitTests.pdb Console false true .\Release/UnitTests.bsc - {95df9ca4-6d37-4a85-a648-80c2712e0da1} \ No newline at end of file diff --git a/test/UnitTests/win/UnitTests.vcxproj.filters b/test/UnitTests/win/UnitTests.vcxproj.filters --- a/test/UnitTests/win/UnitTests.vcxproj.filters +++ b/test/UnitTests/win/UnitTests.vcxproj.filters @@ -1,74 +1,71 @@  {1b5d1f69-ef66-4844-baa5-25ec23d2151c} cpp;c;cxx;rc;def;r;odl;idl;hpj;bat {a734023f-ceb2-4882-9efc-5719c6bf4c8d} h;hpp;hxx;hm;inl {134d3911-e459-4919-8af8-82198f95a179} {8b34f4e6-17d2-42af-8c12-1386ba1acae0} Source Files Source Files\Testing Source Files\Testing Source Files\Testing Source Files\Testing - - Source Files\Testing - Source Files\Testing Source Files\Testing Source Files\Testing Source Files\Testing Source Files\Testing Source Files\Testing Source Files\Testing Lgi Lgi Header Files Lgi \ No newline at end of file