diff --git a/resources/Scribe.lr8 b/resources/Scribe.lr8 --- a/resources/Scribe.lr8 +++ b/resources/Scribe.lr8 @@ -1,5231 +1,5231 @@ - + - + - + - + - + - + - + - - - - - - - - - - - - - - - - - + + + - - - + + + + + + + + + + + + + + + + + - + diff --git a/resources/resdefs.h b/resources/resdefs.h --- a/resources/resdefs.h +++ b/resources/resdefs.h @@ -1,1284 +1,1284 @@ // Generated by LgiRes // This file generated by LgiRes #define L_FUI_NEW -912 #define L_FUI_LEGEND -911 #define L_FUI_NOT -910 #define L_FUI_OPTIONS -909 #define L_FUI_CONFIGURE -908 #define L_FUI_MOVE_DOWN -907 #define L_FUI_MOVE_UP -906 #define L_FUI_DELETE -905 #define L_FUI_OR -904 #define L_FUI_AND -903 #define L_FUI_NEW_OR -902 #define L_FUI_NEW_AND -901 #define L_FUI_NEW_CONDITION -900 #define L_STORE_RESTART -803 #define L_STORE_MISMATCH -802 #define L_STORE_OS_ERR -801 #define L_STORE_WRITE_ERR -800 #define L_TOOLBAR_SHOW_TEXT -700 #define L_FR_SELECTION_ONLY -608 #define L_FR_REPLACE_WITH -607 #define L_FR_REPLACE_ALL -606 #define L_FR_REPLACE -605 #define L_FR_MATCH_CASE -604 #define L_FR_MATCH_WORD -603 #define L_FR_FIND_NEXT -602 #define L_FR_FIND_WHAT -601 #define L_FR_FIND -600 #define L_COLOUR_NONE -550 #define L_CHANGE_CHARSET -505 #define L_VIEW_IMAGES -504 #define L_VIEW_IN_DEFAULT_BROWSER -503 #define L_COPY_SOURCE -502 #define L_VIEW_SOURCE -501 #define L_COPY_LINK_LOCATION -500 #define L_FONTUI_UNDERLINE -407 #define L_FONTUI_TITLE -406 #define L_FONTUI_STYLE -405 #define L_FONTUI_PTSIZE -404 #define L_FONTUI_PREVIEW -403 #define L_FONTUI_ITALIC -402 #define L_FONTUI_FACE -401 #define L_FONTUI_BOLD -400 #define L_TEXTCTRL_TAB_SIZE -214 #define L_TEXTCTRL_INDENT_SIZE -213 #define L_TEXTCTRL_HARD_TABS -212 #define L_TEXTCTRL_SHOW_WHITESPACE -211 #define L_TEXTCTRL_UNDO -210 #define L_TEXTCTRL_REDO -209 #define L_TEXTCTRL_PASTE -208 #define L_TEXTCTRL_OPENURL -207 #define L_TEXTCTRL_GOTO_LINE -206 #define L_TEXTCTRL_FIXED -205 #define L_TEXTCTRL_EMAIL_TO -204 #define L_TEXTCTRL_CUT -203 #define L_TEXTCTRL_COPYLINK -202 #define L_TEXTCTRL_COPY -201 #define L_TEXTCTRL_AUTO_INDENT -200 #define IDS_ERROR_ESMTP_UNSUPPORTED_AUTHS -101 #define IDS_ERROR_ESMTP_NO_AUTHS -100 #define L_BTN_CANCEL -51 #define L_BTN_OK -50 #define FIELD_FLAGS 1 #define FIELD_TO 2 #define FIELD_CC 3 #define FIELD_FROM 4 #define FIELD_REPLY 5 #define FIELD_SUBJECT 6 #define FIELD_TEXT 7 #define FIELD_MESSAGE_ID 8 #define FIELD_DATE_RECEIVED 9 #define FIELD_INTERNET_HEADER 10 #define FIELD_FIRST_NAME 11 #define FIELD_LAST_NAME 12 #define FIELD_EMAIL 13 #define FIELD_HOME_STREET 14 #define FIELD_HOME_SUBURB 15 #define FIELD_HOME_POSTCODE 16 #define FIELD_HOME_STATE 17 #define FIELD_HOME_COUNTRY 18 #define FIELD_WORK_PHONE 19 #define FIELD_HOME_PHONE 20 #define FIELD_HOME_MOBILE 21 #define FIELD_HOME_IM 22 #define FIELD_HOME_FAX 23 #define FIELD_HOME_WEBPAGE 24 #define FIELD_NICK 25 #define FIELD_SPOUSE 26 #define FIELD_NOTE 27 #define FIELD_PLUGIN_ASSOC 28 #define FIELD_SIZE 29 #define FIELD_DATE_SENT 30 #define FIELD_COLUMN 31 #define FIELD_BCC 32 #define FIELD_MIME_TYPE 33 #define FIELD_PRIORITY 34 #define FIELD_FOLDER_OPEN 35 #define FIELD_CODE_PAGE 36 #define FIELD_MARK_COLOUR 37 #define FIELD_ALTERNATE_HTML 38 #define FIELD_CONTENT_ID 39 #define FIELD_FILTER_NAME 40 #define FIELD_CONDITION 41 #define FIELD_ACTION 42 #define FIELD_COND_FIELD 43 #define FIELD_COND_OPERATOR 44 #define FIELD_COND_VALUE 45 #define FIELD_ACT_TYPE 46 #define FIELD_ACT_ARG 47 #define FIELD_DIGEST_INDEX 48 #define FIELD_COMBINE_OP 49 #define FIELD_FILTER_INDEX 50 #define FIELD_FILTER_INCOMING 55 #define FIELD_FILTER_OUTGOING 56 #define FIELD_FILTER_INTERNAL 59 #define FIELD_CAL_SUBJECT 62 #define FIELD_CAL_LOCATION 63 #define FIELD_CAL_REMINDER_TIME 64 #define FIELD_CAL_REMINDER_ACTION_dep 65 #define FIELD_CAL_REMINDER_ARG_dep 66 #define FIELD_CAL_SHOW_TIME_AS 67 #define FIELD_CAL_RECUR_FREQ 68 #define FIELD_CAL_RECUR_INTERVAL 69 #define FIELD_CAL_RECUR_FILTER_DAYS 70 #define FIELD_CAL_RECUR_FILTER_MONTHS 71 #define FIELD_CAL_RECUR_FILTER_YEARS 72 #define FIELD_CAL_NOTES 73 #define FIELD_CAL_START_UTC 76 #define FIELD_CAL_END_UTC 77 #define FIELD_CAL_RECUR_FILTER_POS 78 #define FIELD_CAL_RECUR_END_DATE 79 #define FIELD_CAL_RECUR_END_COUNT 80 #define FIELD_CAL_RECUR_END_TYPE 81 #define FIELD_CAL_RECUR 82 #define IDC_COLOUR 83 #define FIELD_ATTENDEE_NAME 85 #define FIELD_ATTENDEE_EMAIL 86 #define FIELD_ATTENDEE_ATTENDENCE 87 #define FIELD_ATTENDEE_NOTE 88 #define FIELD_ATTENDEE_RESPONSE 89 #define FIELD_WORK_STREET 90 #define FIELD_WORK_SUBURB 91 #define FIELD_WORK_POSTCODE 92 #define FIELD_WORK_STATE 93 #define FIELD_WORK_COUNTRY 94 #define FIELD_WORK_MOBILE 95 #define FIELD_WORK_IM 96 #define FIELD_WORK_FAX 97 #define FIELD_WORK_WEBPAGE 98 #define FIELD_COMPANY 99 #define FIELD_LABEL 110 #define IDM_SAVE 113 #define FIELD_TITLE 114 #define FIELD_SERVER_UID 117 #define FIELD_GROUP_NAME 120 #define FIELD_GROUP_LIST 123 #define FIELD_FROM_CONTACT_NAME 126 #define IDS_ENCRYPTION_SUPPORT 150 #define FIELD_DATE_MODIFIED 162 #define FIELD_IMAP_SEQ 167 #define FIELD_RECEIVED_DOMAIN 170 #define IDD_FILTER_ITEMS 175 #define IDC_SIGNATURE_TAB 184 #define IDC_RESET_REPLY 186 #define IDC_SIG 187 #define IDC_RESET_FORWARD 189 #define IDS_205 205 #define IDS_SAVE_ITEM 208 #define IDS_DESCRIPTIVE_NAME 209 #define IDS_ERROR_SOFTWARE_UPDATE 210 #define IDS_211 211 #define IDS_235 235 #define IDC_SUB_FOLDERS 275 #define IDM_FEEDBACK 287 #define IDM_SCRIBE_LINK 291 #define IDM_INSCRIBE_LINK 292 #define IDM_FAQ 293 #define IDC_READ 316 #define IDD_SUB_FOLDERS 317 #define IDC_HAS_TEMPLATES 322 #define IDC_INBOX 324 #define IDC_OUTBOX 325 #define IDM_PAGE_SETUP 326 #define IDC_TRASH 327 #define IDC_CONTACT_FLD 328 #define IDS_DEBUG 329 #define IDC_SET_INBOX 330 #define IDC_SET_OUTBOX 331 #define IDC_SET_SENT 332 #define IDC_SET_TRASH 333 #define IDC_SET_CONTACTS 334 #define IDC_SET_FILTERS 335 #define IDC_MAX_SIZE 342 #define IDC_CONFIRM_DEL 343 #define IDS_CONTENT_ID 344 #define IDC_BOLD_UNREAD 346 #define IDC_GRID_LINES 347 #define IDC_TITLE 348 #define IDC_PREVIEW_LINES 349 #define IDC_SET_TEMPLATES 350 #define IDC_351 351 #define IDC_SMTP_AUTH 353 #define IDC_FILTERS_FLD 354 #define IDS_RETRY 355 #define IDS_FOLDER_PROPERTIES_COMPACT 356 #define IDC_HAS_SPAM 357 #define IDS_CALENDAR 359 #define IDS_NO_LOG 360 #define IDC_REC_TYPE 362 #define IDS_FIND 363 #define IDS_NO_ITEMS 364 #define IDS_RECEIVE_ALL_ACCOUNTS 365 #define IDS_NO_ITEMS_IN_FOLDER 366 #define IDS_PREVIEW_ON_SERVER 367 #define IDS_RECEIVE_MAIL 368 #define IDS_NO_TEMPLATES 369 #define IDC_STOP_FILTERING 370 #define IDS_NEW_EMAIL 371 #define IDS_EXIT 372 #define IDS_MARK_ALL_SEND 373 #define IDS_MARK 374 #define IDS_SELECT_MARKED 375 #define IDS_PRIORITY 376 #define IDS_HIGH 377 #define IDS_NORMAL 378 #define IDS_LOW 379 #define IDS_NEW_CONTACT 380 #define IDS_RECEIVE 381 #define IDC_LIMIT_TO 382 #define IDS_PRINT 383 #define IDS_CAL_SDAY_SUN 384 #define IDS_SAVE_CLOSE 385 #define IDS_FILTER 386 #define IDS_PREV_MSG 387 #define IDS_NEXT_MSG 388 #define IDS_CONDITIONS 390 #define IDS_ACTIONS 391 #define IDS_DETAIL 392 #define IDS_FIELDS 393 #define IDS_FILE_NAME 394 #define IDS_MIME_TYPE 395 #define IDS_PREVIEW 396 #define IDS_ERROR_FOLDERS_VERSION 397 #define IDS_ERROR_FOLDERS_STATUS 398 #define IDS_EXPORT 399 #define IDS_STATUS 400 #define IDD_STATUS 401 #define IDS_402 402 #define IDC_ACC_LIST 403 #define IDC_404 404 #define IDC_IN_FOLDER 406 #define IDS_407 407 #define IDS_408 408 #define IDC_STATUS_TXT 409 #define IDC_OP_TXT 410 #define IDS_411 411 #define IDC_EMAIL_TXT 412 #define IDC_EMAIL_PROG 413 #define IDD_MAIL_PROPERTIES 414 #define IDC_STOP 415 #define IDC_SEND_LOG 416 #define IDC_OP_PROG 417 #define IDC_SET_IN 418 #define IDS_HIDE_GNUPG 419 #define IDS_RESIZE 420 #define IDS_COPY_FOLDER 421 #define IDS_GNUPG_ATTACH_PUB_KEY 422 #define IDS_GNUPG_SIGN 423 #define IDS_GNUPG_ENCRYPT 424 #define IDS_GNUPG_DECRYPT 425 #define IDS_GNUPG_ERR_NOMSG 426 #define IDC_CLEAR_KEYWORDS 436 #define IDS_MONTH 437 #define IDC_BAYES_TABLE 439 #define IDS_HIGH_PRIORITY 440 #define IDD_ACCOUNT 441 #define IDS_443 443 #define IDS_444 444 #define IDS_445 445 #define IDC_MAIL_DESCRIPTION 448 #define IDC_SENT 449 #define IDC_RECEIVED 450 #define IDC_FORWARDED 451 #define IDC_REPLIED 452 #define IDC_HAS_ATTACH 453 #define IDC_MARKED 455 #define IDC_READY_SEND 456 #define IDC_OPEN_INSPECTOR 457 #define IDC_CREATED 459 #define IDD_NO_FOLDER 460 #define IDC_MESSAGE 462 #define IDS_470 470 #define IDC_CREATE_FOLDER 471 #define IDS_472 472 #define IDS_475 475 #define IDC_ACCOUNT 476 #define IDC_ACCOUNT_NAME 477 #define IDC_SMTP_PASSWORD 478 #define IDC_EXISTING 486 #define IDC_FOLDER_HISTORY 487 #define IDS_488 488 #define IDS_ASK_TNEF_DECODE 495 #define IDC_RECEIVE_TABLE 500 #define IDC_SEND_SSL 501 #define IDS_OK 502 #define IDC_NEW_FOLDER 503 #define IDC_EXISTING_FOLDER 504 #define IDC_BROWSE_NEW 505 #define IDC_BROWSE_EXISTING 506 #define IDS_YEAR 507 #define IDC_TEXT 508 #define IDC_SEARCH 509 #define IDS_510 510 #define IDC_BAYES_MODE 511 #define IDC_REPEATS 512 #define IDS_YEARS 513 #define IDS_CANCEL 514 #define IDS_SAVE 515 #define IDS_EMAIL 516 #define IDS_REPLY 517 #define IDS_REPLYALL 518 #define IDS_FORWARD 519 #define IDC_SIG_HTML 520 #define IDS_TO 521 #define IDC_DEFAULT_ALT 522 #define IDS_COMPACT_TESTING_DLG 523 #define IDS_FOLDER_COMPACT_ERR_DLG 524 #define IDS_COULDNT_OPEN 525 #define IDC_SEARCH_SUB 526 #define IDC_FIND_CASE 527 #define IDC_FIND_WORD 528 #define IDS_ATTACH_FILE 529 #define IDC_CTRLS_TABLE 530 #define IDC_MAIL_FIELD 531 #define IDC_CONTACT 532 #define IDM_BAYES_STATS 533 #define IDS_EDIT 534 #define IDC_ID_TABLE 535 #define IDC_CONTACT_FIELD 536 #define IDC_ACTION 537 #define IDS_REMOVE 538 #define IDM_UNIT_TESTS 539 #define IDC_LAYOUT 540 #define IDC_TABS 541 #define IDC_275 542 #define IDC_FIRST 543 #define IDS_544 544 #define IDC_OUT_FOLDER 545 #define IDC_SET_OUT 546 #define IDD_PAGE_SETUP 547 #define IDC_PREVIEW 548 #define IDS_ATTACH_WARNING_DLG 549 #define IDC_BROWSE_FONT 550 #define IDS_MAIL_PROPS_DLG 551 #define IDS_552 552 #define IDS_553 553 #define IDS_554 554 #define IDS_555 555 #define IDC_LEFT 556 #define IDC_TOP 557 #define IDC_RIGHT 558 #define IDC_BOTTOM 559 #define IDS_MAIL_PROPS 560 #define IDC_CUSTOM_FIELDS 561 #define IDS_ADD_CONTACTS 562 #define IDS_SUBFLD_NAME_CLASH 563 #define IDC_TREE 564 #define IDS_ERROR_NO_RECIPIENTS 565 #define IDC_USER_PASS_CONFIRM 566 #define IDS_SAVE_ATTACHMENT_AS 567 #define IDS_NO_CONNECTION_TO_SERVER 568 #define IDS_SERVER_ERROR_MSG 569 #define IDS_NO_SMTP_SERVER_SETTINGS 570 #define IDS_ASK_ABOUT_OPTIONS 571 #define IDS_THIS_WEEK 572 #define IDS_UPDATE_PERIOD 573 #define IDS_HEX_LOG 574 #define IDS_OPEN 575 #define IDS_BYTE_LOG 576 #define IDC_CALENDER 577 #define IDS_WINDOWS_SSL_INSTALL 578 #define IDC_KEYWORDS 579 #define IDC_PATH 580 #define IDC_UNREAD 581 #define IDC_LOCATION 582 #define IDS_ADDRESS 583 #define IDS_POPUP 584 #define IDC_PARAM_LABEL 585 #define IDC_DIR 586 #define IDS_LOW_PRIORITY 587 #define IDD_CAL 588 #define IDD_CAL_REMOTE 589 #define IDC_590 590 #define IDS_ADD_CAL 591 #define IDS_ADD_CAL_POPUP 592 #define IDS_SET_READ 593 #define IDS_SET_UNREAD 594 #define IDS_PROPERTIES 595 #define IDS_SUBJECT 596 #define IDS_OPTIONS 597 #define IDS_SMTP 598 #define IDS_SIZE 599 #define IDS_DATE 600 #define IDS_SAVEAS 601 #define IDS_EMPTY 602 #define IDS_ERROR_FOLDERS_DONT_EXIST 603 #define IDS_ERROR_CANT_OPEN_FOLDERS 604 #define IDS_ENTER_FILE_NAME_FOR_FOLDERS 605 #define IDS_SEND_MAIL 606 #define IDS_NEW 607 #define IDS_APPOINTMENT 608 #define IDS_CAL_EVENT 609 #define IDS_CONTACT 610 #define IDS_CREATESUBFOLDER 611 #define IDS_612 612 #define IDS_CAL_VIEW 613 #define IDS_MINUTES 614 #define IDS_HOUR 615 #define IDS_HOURS 616 #define IDS_DAY 617 #define IDS_DAYS 618 #define IDS_FREE 619 #define IDS_TENTATIVE 620 #define IDS_BUSY 621 #define IDS_OUT_OF_OFFICE 622 #define IDS_DOWNLOAD 623 #define IDS_READ_RECEIPT 624 #define IDS_CAL_SDAY_MON 625 #define IDS_RENAMEFOLDER 626 #define IDC_FOLDER_MSG 627 #define IDC_PASS 628 #define IDS_629 629 #define IDS_630 630 #define IDS_631 631 #define IDD_FOLDER_PROPS 632 #define IDS_FIRST 633 #define IDS_LOCAL_CONTACTS 634 #define IDC_ACCOUNT_TBL 635 #define IDS_MOVE_ERROR 636 #define IDS_MESSAGE 637 #define IDS_ACTION 638 #define IDS_MSGS_ERROR 639 #define IDS_CAL_LMONTH_OCT 640 #define IDC_ACCOUNTS_READ 641 #define IDS_CONFIGURE 642 #define IDS_ERROR_FILE_OVERWRITE 643 #define IDC_INTERNAL_FILTERING 644 #define IDC_STORE2_KEEP 645 #define IDS_ERROR_CANT_READ 646 #define IDC_FOLDER_WRITE 647 #define IDS_ERROR_FILE_EXISTS 648 #define IDD_BAYES_SETTINGS 649 #define IDC_USER_LEVEL_PSW 650 #define IDC_USER_PASS 651 #define IDS_ERROR_FOLDERS_ALREADY_EXIST 652 #define IDC_APW_USER 653 #define IDC_COMPACT_MS 654 #define IDD_FIND 655 #define IDC_DEF_SEND 656 #define IDC_TOOLBAR_TEXT 657 #define IDS_ADD 658 #define IDM_SAVEAS 659 #define IDC_URL 660 #define IDC_SUBJECT 661 #define IDD_MAIL_FIELDS 662 #define IDD_KEY 663 #define IDC_LABEL 664 #define IDS_147 665 #define IDC_SENT_DATE 666 #define IDS_148 667 #define IDC_RECEIVED_DATE 668 #define IDD_FILTER 669 #define IDC_PRIVACY_TYPE 670 #define IDS_671 671 #define IDM_NO_IDENTITIES 672 #define IDD_FILTER_ACTION 673 #define IDD_NEWFOLDER_F 674 #define IDD_FILES_IMPORT 675 #define IDS_ADD_LOCAL_CAL_FOLDER 676 #define IDC_UI_FNT_SIZE 677 #define IDC_UI_LANG 678 #define IDS_ERROR_LR8_FAILURE 679 #define IDC_REC_8BIT_CS 680 #define IDC_CLIENT 681 #define IDC_BLINK 682 #define IDC_FOLDER_READ 683 #define IDC_ACCOUNTS_WRITE 684 #define IDC_CUSTOM_TABLE 685 #define IDC_APR_USER 686 #define IDC_NAME_TABLE 687 #define IDC_USER 688 #define IDC_APR_ADMIN 689 #define IDC_APW_NONE 690 #define IDS_ADD_CAL_URL 691 #define IDC_REMINDER_VALUE 692 #define IDS_LIKE 693 #define IDC_PREVIEW_READ 694 #define IDS_ASK_USER_PASS 695 #define IDD_FILTER_SAVE_ATTACH 696 #define IDM_HELP 697 #define IDC_TYPES 698 #define IDC_OTHER_TABLE 699 #define IDC_BROWSE_DIR 700 #define IDC_ONLY_SEND_THIS 701 #define IDC_GROUPS_FLD 702 #define IDC_SET_GROUPS 703 #define IDS_CC 704 #define IDS_RECIPIENTS 705 #define IDS_TEXT 706 #define IDS_ATTACHMENTS 707 #define IDS_INTERNETHEADER 708 #define IDS_FOLDER_PROPERTIES_DLG 709 #define IDS_TOMORROW 710 #define IDS_NEXT_WEEK 711 #define IDC_SRC 712 #define IDC_SET_DEST 713 #define IDC_USAGE 714 #define IDC_START_TIME 715 #define IDS_ABOUT 716 #define IDC_COLLECT_SUB_MAIL 717 #define IDS_NO_MAIL_TO_FILTER 718 #define IDS_FORWARD_PREFIX 719 #define IDS_REPLY_PREFIX 720 #define IDS_SPAM 721 #define IDS_SEARCH 722 #define IDS_ITEM_FILTER 723 #define IDD_WEBDAV_PROPS 724 #define IDC_725 725 #define IDM_IMPORT_EML 726 #define IDC_CONTACTS_URL 727 #define IDS_DELETE_FOLDER_DLG 728 #define IDS_DISCONNECT 729 #define IDS_SET_DEFAULT 730 #define IDC_HTML_FONT 731 #define IDC_SET_HTML_FONT 732 #define IDS_APPEARANCE 733 #define IDS_UPDATE 734 #define IDC_EDIT_REPLY 735 #define IDC_EDIT_FORWARD 736 #define IDC_CALENDAR_URL 737 #define IDC_APW_ADMIN 738 #define IDS_ERROR_EXE_FILE 739 #define IDC_USERNAME 740 #define IDS_FROM 741 #define IDC_ADD 742 #define IDC_DATE_FORMAT 743 #define IDS_EXITING 744 #define IDS_SORT_SUBFOLDERS 745 #define IDC_DESC 746 #define IDC_948 747 #define IDS_LOADING 748 #define IDS_MOVE_FOLDER 749 #define IDC_FILTER_INDEX 750 #define IDC_FILTER_UP 751 #define IDC_FILTER_DOWN 752 #define IDM_SCRIPT_BREAK_ON_WARN 753 #define IDS_MOVE_ATTACH 754 #define IDS_ERROR_WONT_OVERWRITE_FOLDERS 755 #define IDS_NEXT_FOLDER 756 #define IDC_BAYES_READ 757 #define IDM_DELETE 758 #define IDS_SUB_FOLDER 759 #define IDS_WEEK 760 #define IDS_ERROR_READONLY_FOLDERS 761 #define IDC_TIMEZONE 762 #define IDC_LOCALTIME 763 #define IDC_HIDE_ID 764 #define IDS_SOFTWARE_UPDATE_DOWNLOAD 765 #define IDD_FILTER_SCRIPT 766 #define IDC_SCRIPT 767 #define IDS_ASK_DUPE_CONTACT 768 #define IDS_PERM_DEL_ATTACHMENTS 769 #define IDC_HTTP_PROXY 770 #define IDC_PICK_TZ 771 #define IDS_THREAD 772 #define IDS_SOFTWARE_CURRENT 773 #define IDS_TRANSLATION_AUTHORS 774 #define IDD_CSV_IMPORT 775 #define IDC_THEME 776 #define IDS_BCC 777 #define IDS_CLICK_TO_ADD 778 #define IDS_779 779 #define IDC_BROWSE_THEMES 780 #define IDD_OUTLOOK_EXPORT 781 #define IDS_SUMMARY 782 #define IDC_BROWSE_FOLDER 783 #define IDS_MERGE_TEMPLATE 784 #define IDS_MERGE_FILE 785 #define IDS_COPY 786 #define IDD_SETTINGS 787 #define IDS_DELETE_SYS_FOLDER 788 #define IDS_789 789 #define IDS_CAL_SDAY_TUE 790 #define IDS_791 791 #define IDS_792 792 #define IDS_793 793 #define IDS_794 794 #define IDS_MBOX_IMPORT 795 #define IDC_SET_READ 796 #define IDS_CAL_SDAY_WED 797 #define IDS_CAL_SDAY_THU 798 #define IDS_CAL_SDAY_FRI 799 #define IDS_CAL_SDAY_SAT 800 #define IDS_CAL_LDAY_SUN 801 #define IDS_CAL_LDAY_MON 802 #define IDS_CAL_LDAY_TUE 803 #define IDS_CAL_LDAY_WED 804 #define IDS_CAL_LDAY_THU 805 #define IDS_CAL_LDAY_FRI 806 #define IDS_CAL_LDAY_SAT 807 #define IDS_CAL_SMONTH_JAN 808 #define IDS_CAL_SMONTH_FEB 809 #define IDS_CAL_SMONTH_MAR 810 #define IDS_CAL_SMONTH_APR 811 #define IDS_CHANGED 812 #define IDS_CAL_SMONTH_MAY 813 #define IDS_CAL_SMONTH_JUN 814 #define IDS_CAL_SMONTH_JUL 815 #define IDS_CAL_SMONTH_AUG 816 #define IDS_CAL_SMONTH_SEP 817 #define IDS_CAL_SMONTH_OCT 818 #define IDS_CAL_SMONTH_NOV 819 #define IDS_CAL_SMONTH_DEC 820 #define IDS_CAL_LMONTH_JAN 821 #define IDS_EVENT_DUE 822 #define IDC_BAYES_THRESHOLD 823 #define IDS_CAL_LMONTH_FEB 824 #define IDS_CAL_LMONTH_MAR 825 #define IDS_CAL_LMONTH_APR 826 #define IDS_CAL_LMONTH_MAY 827 #define IDS_CAL_LMONTH_JUN 828 #define IDS_CAL_LMONTH_JUL 829 #define IDS_CAL_LMONTH_AUG 830 #define IDC_PREVIEW_SECONDS 831 #define IDS_CAL_LMONTH_SEP 832 #define IDC_SOCKS5_PASSWORD 833 #define IDS_CAL_LMONTH_NOV 834 #define IDS_CAL_LMONTH_DEC 835 #define IDC_RECEIVE_SSL 836 #define IDC_SEND_CHARSET1 837 #define IDC_SEND_CHARSET2 838 #define IDS_DELETE_ASK 839 #define IDS_DONT_ADJUST_TZ 840 #define IDC_DELETE_AFTER 841 #define IDC_HTML_IMAGES 842 #define IDC_AUTO_DELETE_EXE 843 #define IDD_GROUP 844 #define IDC_SEND_AUTH_TYPE 845 #define IDM_HOMEPAGE 846 #define IDC_GROUP_NAME 847 #define IDC_GROUP_LIST 848 #define IDC_START_DATE 849 #define IDC_850 850 #define IDS_TODAY 851 #define IDC_REC_ASCII_CP 852 #define IDS_FOLDER_OUTBOX 853 #define IDS_FOLDER_SENT 854 #define IDS_780 855 #define IDS_FOLDER_FILTERS 856 #define IDS_FOLDER_CONTACTS 857 #define IDS_ATTACHMENTS_NAME 858 #define IDS_ATTACHMENTS_DATA 859 #define IDS_ANYWHERE 860 #define IDS_TODO 861 #define IDS_FOLDER_TEMPLATES 862 #define IDS_FOLDER_GROUPS 863 #define IDS_FOLDER_CALENDAR 864 #define IDS_DEFAULT_CHARSET_RECEIVE 865 #define IDS_DUE 866 #define IDS_CLICK_TO_CREATE 867 #define IDC_REPEAT 868 #define IDS_1101 869 #define IDS_ERROR_ALREADY_ONLINE 870 #define IDS_NOT_LOADED 871 #define IDC_SHOW_LOCATION 872 #define IDS_ERROR_MAPI_NOT_INSTALLED 873 #define IDC_CALENDAR 874 #define IDS_PLUGINS_NO_CONF 875 #define IDC_TAB1 876 #define IDC_TAB2 877 #define IDC_CHECK_EVERY 878 #define IDS_1116 879 #define IDC_FILTER_ACTIONS 880 #define IDC_LOGIN 881 #define IDC_MSG_STORE 882 #define IDC_SRC_FOLDERS 883 #define IDC_FOLDER 884 #define IDS_ADD_ALL_CONTACTS 885 #define IDS_MAPI_LOGIN_FAILED 886 #define IDS_ACCSTAT_IDLE 887 #define IDS_BROWSE_FOLDER 888 #define IDS_3 889 #define IDS_ASK_ADMIN_PASS 890 #define IDS_LINKS 891 #define IDC_EXTRA_HEADERS 892 #define IDC_FORMAT 893 #define IDM_TABLE2 894 #define IDC_RECEIVE_AUTH_TYPE 895 #define IDS_896 896 #define IDC_SUSPECT_FOLDER 897 #define IDM_SET_UNREAD 898 #define IDS_HTML_TAGS 899 #define IDC_PROGRESS_TBL 900 #define IDS_DELETE 901 #define IDC_SET_SUSPECT_FOLDER 902 #define IDC_SEND_TABLE 903 #define IDS_838 904 #define IDC_TEMPLATE 905 #define IDS_1082 906 #define IDC_TXT_DAYS 907 #define IDC_FOLDERS 908 #define IDD_SECURITY 909 #define IDS_9 910 #define IDS_REMOVE_DUPES 911 #define IDC_SHOW_TOTALS 912 #define IDC_913 913 #define IDC_REMINDER_TYPE 914 #define IDS_ALWAYS_SHOW_REMOTE_CONTENT 915 #define IDC_TXT_SIZE 916 #define IDS_ERROR_FILE_EMPTY 917 #define IDC_REMINDER_PARAM 918 #define IDC_REMINDER_UNIT 919 #define IDD_EML_IMPORT 920 #define IDC_HOME_TABLE 921 #define IDC_APR_NONE 922 #define IDS_OPEN_CONTACT 923 #define IDS_THREAD_SELECT 924 #define IDS_THREAD_DELETE 925 #define IDS_THREAD_IGNORE 926 #define IDS_NONE 927 #define IDS_ALL 928 #define IDS_CONVERT_SELECTION 929 #define IDS_MULTIPLE_ITEMS 930 #define IDC_GROUP 931 #define IDC_MAPPING 932 #define IDS_933 933 #define IDS_934 934 #define IDC_TAB 935 #define IDC_HAS_FILTERS 936 #define IDC_MODE 937 #define IDC_MERGE 938 #define IDC_APPEND 939 #define IDC_CHECK_DEFAULT 940 #define IDC_EVERY 941 #define IDC_LOAD 942 #define IDS_ERROR_CANT_WRITE 943 #define IDS_944 944 #define IDS_SAVE_TO_OUTBOX 945 #define IDS_INC_BETA 946 #define IDS_947 947 #define IDC_TIME_TYPE 948 #define IDS_FOLDER_TRASH 949 #define IDD_FILES_EXPORT 950 #define IDS_WAITING_FOR 951 #define IDC_END_DATE 952 #define IDC_HAM 953 #define IDC_SPAM 954 #define IDC_FALSE_NEG 955 #define IDC_FALSE_POS 956 #define IDC_EFFICIENCY 957 #define IDS_RECEIPT_ASK 958 #define IDS_ERROR_NO_HELP 959 #define IDC_END_TIME 960 #define IDC_869 961 #define IDS_ERROR_CONNECTION 962 #define IDS_CREATE_FOLDER 963 #define IDC_ALL_DAY 964 #define IDC_DEF_REPLYALL_SETTING 965 #define IDS_DEFAULT_CHARSET_SEND 966 #define IDC_WEDNESDAY 967 #define IDS_WARN_NO_SECURITY 968 #define IDC_969 969 #define IDC_LAUNCH_HELP 970 #define IDC_THURSDAY 971 #define IDD_LANG 972 #define IDC_LANG 973 #define IDC_FRIDAY 974 #define IDS_975 975 #define IDS_976 976 #define IDD_FILTER_REPLY 977 #define IDD_FILTER_FORWARD 978 #define IDC_SATURDAY 979 #define IDC_SUNDAY 980 #define IDC_REC_PORT 981 #define IDS_INSPECT 982 #define IDS_FOLDER_INBOX 983 #define IDC_OCCURRENCES 984 #define IDC_CONFIGURE_REMOTE_CONTENT 985 #define IDC_TABLE3 986 #define IDC_BLACKLIST 987 #define IDC_ATTACHMENTS 988 #define IDS_GNUPG_ERR_NO_BOUNDARY 989 #define IDS_GNUPG_ERR_NO_MIME 990 #define IDS_ASK_FORWARD_ATTACHMENTS 991 #define IDC_ALL 992 #define IDC_MARK_REPLIED 993 #define IDC_MARK_FORWARDED 994 #define IDS_BOUNCE 995 #define IDS_REMOVE_WHITELIST 996 #define IDC_UNDELETE 997 #define IDS_ERROR_NO_CONFIG_SEND 998 #define IDS_ERROR_NO_CONFIG_RECEIVE 999 #define IDC_MAIL 1000 #define IDC_CONTACTS 1001 #define IDC_NAME 1002 #define IDC_TYPE 1003 #define IDC_EMAIL 1004 #define IDS_SEND 1005 #define IDC_REPLY_TO 1006 #define IDC_NICK 1007 #define IDM_SCRIBE_FAQ 1008 #define IDC_SPOUSE 1009 #define IDC_HAS_CAL_EVENTS 1010 #define IDC_QUOTE_STR 1011 #define IDC_WRAP_COLS 1012 #define IDS_ASK_DELETE_DUPES 1013 #define IDS_GNUPG_ERR_NO_RECIP 1014 #define IDC_START_IN 1015 #define IDC_SET_START_IN 1016 #define IDM_LAYOUT4 1017 #define IDC_DOWN 1018 #define IDM_REFRESH 1019 #define IDS_ERROR_REG_WRITE 1020 #define IDS_ERROR_NEED_INSTALL 1021 #define IDC_SMTP_SERVER 1022 #define IDC_SMTP_NAME 1023 #define IDC_REC_SERVER 1024 #define IDC_REC_NAME 1025 #define IDC_REC_PASSWORD 1026 #define IDC_REC_CHECK 1027 #define IDC_POP3_LEAVE 1028 #define IDC_LAST 1030 #define IDC_QUOTE 1031 #define IDC_HOME_FAX 1032 #define IDC_HOME_STREET 1033 #define IDC_ACCOUNTS 1034 #define IDC_HOME_SUBURB 1035 #define IDC_FONT 1036 #define IDC_DESCRIPTION 1037 #define IDC_NEW_MAIL_SOUND 1038 #define IDS_MAIL_MESSAGE 1039 #define IDC_SMTP_DOMAIN 1040 #define IDC_HOME_STATE 1041 #define IDC_REPLYWITHSIG 1042 #define IDC_HOME_COUNTRY 1043 #define IDS_POP3 1044 #define IDC_HOME_PHONE 1045 #define IDC_HOME_MOBILE 1046 #define IDC_HOME_IM 1047 #define IDC_HOME_WEBPAGE 1048 #define IDC_NOTE 1049 #define IDC_DEFAULT 1050 #define IDC_TRAY 1051 #define IDS_DELETEFOLDER 1052 #define IDC_CHECKDIALUP 1053 #define IDC_SET_FONT 1054 #define IDC_POP3_ON_START 1055 #define IDC_LIST 1056 #define IDC_START_WEEK 1057 #define IDC_REFRESH 1058 #define IDS_COPY_PATH 1059 #define IDC_SET_SOUND 1060 #define IDS_OE_IMPORT 1061 #define IDS_1062 1062 #define IDM_MENU_1063 1063 #define IDC_DEL_SRC_FOLDER 1064 #define IDC_PICK_FOLDER 1065 #define IDC_WRAP 1066 #define IDC_NO_SPAM_TRASH 1067 #define IDC_MSG 1069 #define IDC_KEY 1070 #define IDC_DONT_WARN 1071 #define ID_YES 1072 #define ID_NO 1073 #define IDC_REGISTER_CLIENT 1074 #define IDC_SOCKS5_SERVER 1075 #define IDC_SOCKS5_USER 1076 #define IDC_REMINDER_ADD 1077 #define IDC_USE_TEMPLATE 1078 #define IDC_SET_FOLDER 1079 #define IDC_REMINDERS 1080 #define IDC_AVAILABLE_TYPE 1081 #define IDC_AVAILABLE 1082 #define IDS_ERROR_NO_SPACE 1083 #define IDC_TEMPLATES 1084 #define IDS_RECEIPT_BODY 1085 #define IDS_SPAM_PROB 1086 #define IDS_IS_WHITELIST 1087 #define IDC_BUSY 1088 #define IDS_ERROR_MAPI_DEFAULT 1089 #define IDS_ERROR_SOFTWARE_KEY 1090 #define IDM_MANAGE_MAIL_STORES 1091 #define IDC_PUBLIC 1092 #define IDC_PRIVATE 1093 #define IDC_NEW_FILTER_ACTION 1094 #define IDC_DELETE_FILTER_ACTION 1095 #define IDS_MAIL 1096 #define IDC_RADIO1 1097 #define IDC_RADIO2 1098 #define IDC_DEF_ACTION 1099 #define IDC_WORK_COUNTRY 1100 #define IDC_WORK_PHONE 1101 #define IDC_WORK_MOBILE 1102 #define IDC_WORK_IM 1103 #define IDC_WORK_STATE 1104 #define IDC_WORK_POSTCODE 1105 #define IDC_WORK_STREET 1106 #define IDC_WORK_FAX 1107 #define IDC_WORK_SUBURB 1108 #define IDC_HOME_POSTCODE 1109 #define IDC_COMPANY 1110 #define IDC_WORK_WEBPAGE 1111 #define IDC_SOCKS5 1112 #define IDC_DELETE 1113 #define IDS_MAIL_MERGE_Q 1114 #define IDC_ADD_SRC_FOLDER 1115 #define IDC_PROPERTIES 1116 #define IDD_OUTLOOK_ADD_FLD 1117 #define IDS_ASK_FOLDER_PASS 1118 #define IDC_DEF_SEND_TXT 1119 #define IDS_ERROR_SCRIPT_COMPILE 1120 #define IDS_ANY 1121 #define IDS_ERROR_NOTHING_TO_UPGRADE 1122 #define IDC_PAGE_ALL 1123 #define IDC_SAVE 1124 #define IDC_PAGE_RANGES 1125 #define IDS_PASSWORD_SAVED 1126 #define IDS_RESIZE_JPEG_QUAL 1127 #define IDC_TXT_MIN 1128 #define IDC_TXT_DOWNLOAD 1129 #define IDC_TXT_KBS 1130 #define IDM_SCRIPTING_CONSOLE 1131 #define IDD_PRINT_PREVIEW 1132 #define IDC_SAVE_IMG 1133 #define IDS_ACCSTAT_SETUP 1134 #define IDS_ACCSTAT_CONNECT 1135 #define IDS_ACCSTAT_TRANS 1136 #define IDS_ACCSTAT_WAIT 1137 #define IDS_ACCSTAT_DELETING 1138 #define IDS_ACCSTAT_FINISHED 1139 #define IDS_ACCSTAT_CANCELLED 1140 #define IDS_ERROR 1141 #define IDS_ENTER_KEY 1142 #define IDM_SCRIPT_DEBUG 1143 #define IDC_UPDATE 1144 #define IDC_1145 1145 #define IDS_CONTAINS 1146 #define IDS_STARTS_WITH 1147 #define IDS_ENDS_WITH 1148 #define IDS_SERVER 1149 #define IDS_1150 1150 #define IDM_MENU_1151 1151 #define IDS_TIME 1152 #define IDM_HTML_EDITOR 1153 #define IDS_ERROR_MAPI_INIT_FAILED 1154 #define IDD_CAL_RECUR 1155 #define IDS_WEEKS 1156 #define IDC_DEL 1157 #define IDC_SHOW_EXTRA 1158 #define IDC_IMAGE 1159 #define IDC_GUEST_ENTRY 1160 #define IDC_ADD_GUEST 1161 #define IDS_MISSING_PARENT 1162 #define IDS_ORIGINAL_MESSAGE 1163 #define IDS_PORTABLE_Q 1164 #define IDC_TABLE 1165 #define IDS_NO_EVENTS 1166 #define IDS_UNREAD_MAIL 1167 #define IDS_1168 1168 #define IDC_SHOW_ADDR 1169 #define IDS_AND_OPERATOR 1170 #define IDS_OR_OPERATOR 1171 #define IDS_MEMBER_OF_GROUP 1172 #define IDS_ACTION_MOVE_FOLDER 1173 #define IDS_ACTION_SOUND 1174 #define IDS_ACTION_OPEN 1175 #define IDS_ACTION_EXECUTE 1176 #define IDS_ACTION_SET_COLOUR 1177 #define IDS_ACTION_SET_LABEL 1178 #define IDS_ACTION_EMPTY_FOLDER 1179 #define IDS_ACTION_MARK_SPAM 1180 #define IDS_ACTION_SAVE_ATTACHMENTS 1181 #define IDS_ACTION_DELETE_ATTACHMENTS 1182 #define IDS_ACTION_CREATE_FOLDER 1183 #define IDS_SELECT_FOLDER 1184 #define IDC_BAYES_INCREMENTAL 1185 #define IDC_BAYES_DEBUG 1186 #define IDC_IMG_NOTES_TBL 1187 #define IDC_WORK_TABLE 1188 #define IDC_OUTGOING 1189 #define IDS_ERROR_FILE_DOESNT_EXIST 1190 #define IDS_ERROR_FOLDER_DOESNT_EXIST 1191 #define IDS_IMPORT 1192 #define IDD_SCRIBE_EXPORT 1193 #define IDC_INCOMING 1194 #define IDM_MENU_1195 1195 #define IDC_DEST 1196 #define IDC_HAS_GROUPS 1198 #define IDC_CAL_URL 1199 #define IDC_SPAM_FLD 1200 #define IDC_SET_SPAM 1201 #define IDC_SPAM_FOLDER 1202 #define IDC_SET_SPAM_FOLDER 1203 #define IDC_PASSWORD 1204 #define IDS_ERROR_SERVER_CONNECT 1205 #define IDC_DST 1206 #define IDS_ERROR_PRINT_FAILED 1214 #define IDS_ASK_ACCOUNT_PASSWORD 1215 #define IDS_SELECT_IO 1216 #define IDC_GUESTS 1217 #define IDS_DONT_SHOW_AGAIN 1218 #define IDS_INSTALL 1219 #define IDC_1220 1220 #define IDS_EDIT_MAIL_STORES 1224 #define IDS_ERROR_CANT_CREATE_FOLDER 1225 #define IDS_ERROR_CANT_CREATE_DB 1226 #define IDS_SHOW_CONSOLE 1227 #define IDC_STATUS 1228 #define IDS_SELECT_ACCOUNT 1229 #define IDS_1235 1235 #define IDC_MONDAY 1238 #define IDC_TUESDAY 1239 #define IDS_MONTHS 1246 #define IDC_NEVER 1249 #define IDC_1250 1250 #define IDC_AFTER 1251 #define IDC_AFTER_COUNT 1252 #define IDC_1254 1254 #define IDC_ON 1255 #define IDC_ON_DATE 1256 #define IDC_SUMMARY 1258 #define IDS_ALWAYS_SHOW 1260 #define IDS_OPEN_SOURCE 1262 #define IDS_DEFAULT 1263 #define IDS_IMPORT_SETTINGS_Q 1264 #define IDS_IMPORT_SETTINGS_DONE 1265 #define IDS_DELETE_ATTACHMENTS 1266 #define IDS_LANGUAGE 1267 #define IDS_1268 1268 #define IDS_SHOW_REMOTE_CONTENT 1274 #define IDC_DELETE_DAYS 1275 #define IDS_RESIZE_IMGS 1277 #define IDD_REMOTE_CONTENT 1279 #define IDC_WHITELIST 1282 #define IDS_REMOTE_CONTENT_MSG 1287 #define IDS_GNUPG_ERR_SAVE_FAILED 1291 #define IDS_MESSAGES_SENT 1293 #define IDS_MAIL_MERGE_EMPTY 1294 #define IDS_GNUPG_ERR_NO_OUTPUT 1295 #define IDS_FILTER_MAILINGLIST 1299 #define IDC_ADVANCED 1300 #define IDS_ACTION_COPY 1301 #define IDC_PAGE_PARTIAL 1302 #define IDD_CSV_EXPORT 1304 #define IDS_1305 1305 #define IDS_EXPORT_MSG 1312 #define IDS_MARK_ALL_READ 1313 #define IDD_MANAGE_FOLDERS 1314 #define IDC_MS_TBL 1315 #define IDC_OPEN_MS 1316 #define IDC_CLOSE_MS 1317 #define IDC_CREATE_MS 1318 #define IDC_CONVERT_MS 1320 #define IDC_REPAIR_MS 1321 #define IDC_MAIL_STORES 1324 #define IDS_1325 1325 #define IDS_1326 1326 #define IDC_MSG_ID 1327 #define IDC_FILTER 1328 #define IDS_GNUPG_ERR_WRONG_SEGS 1329 #define IDS_RELATIVE_TIMES 1333 #define IDS_1335 1335 #define IDS_CHECKING_OBJECTS 1336 #define IDS_ERROR_FOLDER_NOT_LOADED 1337 #define IDS_1338 1338 #define IDS_1339 1339 #define IDS_1340 1340 #define IDS_1341 1341 #define IDD_REPLICATE 1342 #define IDM_CHECK_UPDATE 1350 #define IDS_1353 1353 #define IDS_1354 1354 #define IDS_ERROR_FONT_SETTINGS 1356 #define IDC_SEC_AUTH 1357 #define IDC_EDIT_CONTROL 1359 #define IDC_DELETE_LARGER 1360 #define IDC_DELETE_SIZE 1361 #define IDC_CLEAR 1364 #define IDS_ADD_TO_CAL 1367 #define IDS_ADD_TO_DICTIONARY 1368 #define IDS_ERROR_CANT_ADD_DICT 1370 #define IDS_SPELL_CHECK 1371 #define IDS_SPELL_DICT 1372 #define IDS_MAILSTORE_UPGRADE_Q 1373 #define IDS_ERROR_IMPORT 1374 #define IDS_ERROR_REPLICATION_FAILED 1375 #define IDS_ERROR_IMPORT_COUNT 1388 #define IDS_GNUPG_ERR_NOT_INSTALLED 1458 #define IDD_FOLDER_SELECT 1469 #define IDS_REPARSE 1471 #define IDD_FOLDER_FORMAT 1472 #define IDS_GNUPG_PSW_PROMPT 1473 #define IDC_V1 1481 #define IDC_V2 1482 #define IDC_UP 1483 #define IDS_GROWL_SUPPORT 1485 #define IDS_GROWL 1486 #define IDC_MSG_DEL_ACTION 1487 #define IDC_MSG_DEL_NEXT 1488 #define IDC_MSG_DEL_CLOSE 1489 #define IDC_MSG_DEL_PREV 1490 #define IDS_KILL 1497 #define IDC_RECEIVE_LOG 1514 #define IDS_EMAIL_PROGRESS 1516 #define IDS_COPY_LOG_TO_CLIP 1517 #define IDC_SMTP_PORT 1519 #define IDS_RESIZE_MAX_PX 1522 #define IDS_RESIZING 1523 #define IDS_RESIZE_MAX_SIZE 1524 #define IDS_UPGRADE_KEY 1525 #define IDC_UPGRADE 1526 #define IDS_MAIL2_DEPRECATED 1527 #define IDS_SSL_DEBUG 1528 #define IDS_CONSOLE 1529 #define IDC_SPELL_LANG 1531 #define IDC_WIDTH 1535 #define IDC_SLIDE 1537 #define IDC_BAYES_DELETE_ON_SERVER 1541 #define IDC_BAYES_DELETE_ATTACHMENTS 1543 #define IDC_TENTATIVE 1548 #define IDS_DELETING 1549 #define IDS_DONT_SHOW_EMOJI 1550 #define IDS_HELP 1551 #define IDS_DESKTOP 1552 #define IDS_PORTABLE 1553 #define IDC_BTNS_TABLE 1556 #define IDS_GNUPG_CHECKING 1558 #define IDS_GNUPG_ERR_NO_SIGN_ENC 1561 #define IDS_GNUPG_ERR_CANT_START 1565 #define IDS_GNUPG_ERR_CODE 1568 #define IDS_GNUPG_ERR_NO_CONTENT 1570 #define IDS_GNUPG_ERR_READ_FAIL 1572 #define IDS_GNUPG_ERR_NO_MAIL 1574 #define IDS_GNUPG_ERR_NO_ROOT 1578 #define IDS_GNUPG_ERR_WRONG_MIME 1580 #define IDS_GNUPG_ERR_NO_ENC_MIME 1581 #define IDS_GNUPG_ERR_NO_ID 1582 #define IDS_GNUPG_DECRYPT_CANCEL 1583 #define IDS_GNUPG_ERR_NO_DATA 1584 #define IDS_GNUPG_ERR_DECRYPT_FAIL 1585 #define IDS_GNUPG_ERR_NO_SENDER_EMAIL 1586 #define IDS_GNUPG_ERR_NO_PRIV_KEY 1587 #define IDS_GNUPG_ERR_NO_PUB_KEY 1588 #define IDS_GNUPG_ERR_IMPORT_FAIL 1589 #define IDS_GNUPG_ERR_SIGN_ENC_CANCEL 1590 #define IDS_GNUPG_ERR_TEMP_WRITE 1591 #define IDS_GNUPG_ERR_EXPORT_TEMP 1592 #define IDS_GNUPG_ERR_NEW_ATTACH_FAIL 1593 #define IDS_GNUPG_ERR_REPARENT 1594 #define IDS_GNUPG_ERR_RECIP_NO_EMAIL 1595 #define IDS_GNUPG_ERR_WRITE 1596 #define IDS_GNUPG_ERR_ENCRYPT_FAIL 1597 #define IDS_GNUPG_ERR_ONE_OR_MORE 1598 #define IDS_GNUPG_DECRYPT_OK 1599 #define IDS_GNUPG_ENCRYPTED 1600 #define IDS_GNUPG_ENCRYPTED_AND_SIGNED 1601 #define IDS_GNUPG_SIGNED 1602 #define IDS_GNUPG_GOOD_SIG 1603 #define IDS_GNUPG_BAD_SIG 1604 #define IDS_GNUPG_SIG_MSG 1605 #define IDS_GNUPG_SIG_NO_ID 1606 #define IDS_GNUPG_ERR_INVALID_DECRYPTION 1607 #define IDS_GNUPG_CHECK_MSG 1608 #define IDS_SHOW_SCRIPT_DEBUGGER 1609 #define IDC_ACC_LOG 1613 #define IDC_1615 1615 #define IDC_1616 1616 #define IDS_SHOW_SIZE_IN_KIB 1617 #define IDS_GNUPG_GET_GPG 1619 #define IDC_START_REL 1620 #define IDC_END_REL 1621 #define IDS_YESTERDAY 1622 #define IDC_1626 1626 #define IDS_MBOX_SELECT_FOLDER 2000 #define IDS_MBOX_READING 2001 #define IDS_MBOX_EXPORT 2002 #define IDS_MBOX_EXPORT_FOLDER 2003 #define IDS_MBOX_WRITING 2004 #define IDS_STORE2_ERROR_COMPACT 2005 #define IDS_STORE2_DISCARD_FIX 2006 #define IDS_STORE2_SAVE_DEBUG 2007 #define IDS_NAME 2008 #define IDS_NO_MAIL_TO_SEND 2009 #define IDS_NO_OUTGOING_FOLDER 2010 #define IDS_ERROR_NO_NAME_EMAIL 2011 #define IDS_APPNAME 2012 #define IDS_SURNAME 2013 #define IDC_SET_CALENDER 2014 #define IDC_NEW_MAIL_NOTIFY 2015 #define IDD_NEW_MAIL_NOTIFY 2016 #define IDC_NEW_MAIL 2017 #define IDC_REMEMBER_PSW 2020 #define IDS_36 2021 #define IDS_37 2022 #define IDC_OPEN 2023 #define IDC_GLYPH_SUB 2031 #define IDC_FILTERS 2032 #define IDD_OUTLOOK_IMPORT 2040 #define IDD_WARN_DEFAULT 2041 #define IDC_POP_RECIP 2042 #define IDD_ADDCONTACT 2043 #define IDD_CONTACT 2044 #define IDD_FOLDER_NAME 2045 #define IDD_POPVIEW 2047 #define IDC_FPR_NONE 3000 #define IDC_FPR_USER 3001 #define IDC_FPR_ADMIN 3002 #define IDC_FPW_NONE 3003 #define IDC_FPW_USER 3004 #define IDC_FPW_ADMIN 3005 #define IDM_BOUNCE 40000 #define IDM_SOFTWARE_KEY 40001 #define IDM_UPGRADE_MAIL_STORES 40002 #define IDM_OPTIONS 40004 #define IDM_PRINT 40005 #define IDM_PRINTSETUP 40006 #define IDM_EXIT 40007 #define IDM_NEW_EMAIL 40008 #define IDM_REPLY 40009 #define IDM_REPLY_ALL 40010 #define IDM_FORWARD 40011 #define IDM_SEND_MAIL 40012 #define IDM_NEW_CONTACT 40014 #define IDM_ABOUT 40019 #define IDM_IMPORT_NS_CONTACTS 40020 #define IDM_IMPORT_OUTLOOK_PAB 40025 #define IDM_IMPORT_OUTLOOK_ITEMS 40027 #define IDM_NEW_FILTER 40038 #define IDM_IMPORT_TEXT_MBOX 40047 #define IDM_EXPORT_TEXT_MBOX 40048 #define IDM_IMP_MBX_EMAIL 40049 #define IDM_IMP_DBX_EMAIL 40050 #define IDM_NEW_DRAFT 40060 #define IDM_NO_TEMPLATES 40061 #define IDM_FILTER_CURRENT_FOLDER 41010 #define IDM_IMP_EUDORA_ADDR 41043 #define IDM_IMP_MOZILLA_ADDR 41045 #define IDM_FIND 41055 #define IDM_IMPORT_CSV 41065 #define IDM_WORK_OFFLINE 41075 #define IDM_EXPORT_CSV 41085 #define IDM_NEW_GROUP 41095 #define IDM_SECURITY 41105 #define IDM_BAYES_SETTINGS 41116 #define IDM_BAYES_CHECK 41117 #define IDM_BUILD_BAYES_DB 41118 #define IDM_LOGOUT 41129 #define IDM_FOLDERS_DOWN_LEFT 41142 #define IDM_PREVIEW_ALONG_BOTTOM 41143 #define IDM_LAYOUT1 41144 #define IDM_LAYOUT2 41145 #define IDM_LAYOUT3 41146 #define IDM_EXPORT_OUTLOOK_ITEMS 41147 #define IDM_CRASH 41148 #define IDM_TUTORIALS 41149 #define IDM_DEBUG_INFO 41150 #define IDM_VERSION_HISTORY 41151 #define IDM_MEMECODE 41152 #define IDM_SET_READ 41155 #define IDM_IMP_MOZILLA_MAIL 41156 #define IDM_DEBUG_FILTERS 41157 #define IDM_FILTERS_DISABLE 41158 #define IDM_DUMP_MEM 41159 #define IDM_FILTER_SELECTION 41160 #define IDM_EXPORT_SCRIBE 41161 #define IDM_TOOLS_MENU 41163 #define IDM_REPLICATE 41164 #define IDM_EXPORT 41165 -#define IDM_COPY 'copy' -#define IDM_CUT 'cut ' -#define IDM_PASTE 'past' +#define IDM_COPY Lgi4CC("copy") +#define IDM_CUT Lgi4CC("cut ") +#define IDM_PASTE Lgi4CC("past") diff --git a/src/BayesianFilter.cpp b/src/BayesianFilter.cpp --- a/src/BayesianFilter.cpp +++ b/src/BayesianFilter.cpp @@ -1,1855 +1,1855 @@ #include #include "Scribe.h" #include "resdefs.h" #include "BayesianFilter.h" #include "lgi/common/LgiRes.h" #include "lgi/common/SpellCheck.h" #define SECONDS(n) ((n) * 1000) #define TIMEOUT_BAYES_LOAD SECONDS(10) #define TIMEOUT_SPELL_CHECK SECONDS(3) #define TIMEOUT_UPDATE_REBUILD SECONDS(2) #define TIMEOUT_BAYES_IDLE (50) // ms, out of 100ms idle timer. #define WHITELIST_MY_EMAIL 0 #define WHITELIST_CONTACTS 0 #define STORE_SIZE 16 #define WORD_INTEREST_CENTER 0.5 static const char HamWordsFile[] = "hamwords.idx"; static const char SpamWordsFile[] = "spamwords.idx"; static const char WhiteListFile[] = "whitelist.idx"; void ProcessWords(LString Words, std::function Callback) { char *end = Words.Get() + Words.Length(); if (!Callback) { LAssert(0); return; } for (char *s = Words; s < end; ) { char *e = s; while (*e && *e != ' ' && e < end) e++; if (*e == ' ') *e = 0; Callback(s); s = e + 1; } } double WordInterest(double d) { d -= WORD_INTEREST_CENTER; if (d < 0) d *= -1; return d; } class Token { public: LString Word; double Prob = 0.0; double Interest = 0.0; }; class TokenStore { public: constexpr static int StoreSize = STORE_SIZE; int Used; Token *Tok[StoreSize]; TokenStore() { Used = 0; ZeroObj(Tok); } ~TokenStore() { for (int i=0; i 0) return Tok[Used-1]->Interest; return 0; } double Prob(LStream *Log) { int i; if (Log) { Log->Print("%s\n", LLoadString(IDS_SPAM_PROB)); for (i=0; iPrint("\t[%i] '%s'=%f\n", i, Tok[i]->Word.Get(), Tok[i]->Prob); } } // ab //------------------- //ab + (1 - a)(1 - b) if (Used == 0) return 0.5; double top, bottom; top = Tok[0]->Prob; bottom = 1 - Tok[0]->Prob; for (i=1; iProb; bottom *= 1 - Tok[i]->Prob; } double Result = top / (top + bottom); if (Log) Log->Print("\nResult=%f\n", Result); return Result; } bool CanInsert(double i) { return Used < CountOf(Tok) || i >= Min(); } bool Insert(Token *t) { bool Status = false; if (t) { for (int i=0; iWord, t->Word) == 0) { Status = true; DeleteObj(t); goto End; } else if (t->Interest > Tok[i]->Interest) { if (Used >= CountOf(Tok)) { DeleteObj(Tok[Used-1]); memmove(Tok + i + 1, Tok + i, sizeof(Tok[0]) * (Used - i - 1)); } else { memmove(Tok + i + 1, Tok + i, sizeof(Tok[0]) * (Used - i)); Used++; } Tok[i] = t; Status = true; goto End; } } if (Used < CountOf(Tok)) { Tok[Used++] = t; Status = true; goto End; } else { DeleteObj(t); } } End: return Status; } }; class BayesianThread : public LThread, public LMutex, public LEventTargetI, public LMappedEventSink { public: enum ThreadState { BayesLoading, BayesReady, BayesExiting, }; struct Build { /// Empty all the word databases first... otherwise append new words on top of old ones bool ResetDb; LHashTbl,int> WhiteList; int HamEmailCount; LHashTbl,int> HamWords; int SpamEmailCount; LHashTbl,int> SpamWords; Build(bool Reset) : WhiteList(0, -1), HamWords(0, -1), SpamWords(0, -1) { ResetDb = Reset; HamEmailCount = 0; SpamEmailCount = 0; HamWords.SetMaxSize(HamWords.Unlimited); SpamWords.SetMaxSize(SpamWords.Unlimited); } void InsertWhiteList(const char *Word) { int c = WhiteList.Find(Word); WhiteList.Add(Word, c < 0 ? 1 : c + 1); } void InsertHamWords(const char *Word) { int c = HamWords.Find(Word); HamWords.Add(Word, c < 0 ? 1 : c + 1); } void InsertSpamWords(const char *Word) { int c = SpamWords.Find(Word); SpamWords.Add(Word, c < 0 ? 1 : c + 1); } }; /// This is used when the GUI thread requests an email to be /// tested by the Bayesian Classifier. Initially the GUI thread /// fills out this structure and passes it over to the worker /// thread and it then does the calculation and passes it back /// to the GUI thread for actioning. struct Test { bool Analyse = false; LStringPipe Log; LString FromAddr; LString MsgRef; LString Words; double Score = 0.0; bool WhiteListed = false; }; /// This is a change of classification container for /// when the email changes from ham to spam or the reverse. struct Change { LString Words; LString Str; ScribeMailType OldType = BayesMailUnknown; ScribeMailType NewType = BayesMailUnknown; bool RemoveWhite = false; bool IncrementWhite = false; }; private: ScribeWnd *App; LAutoPtr WhiteList; LAutoPtr Ham; LAutoPtr Spam; ThreadState State; LArray< LAutoPtr > Work; LArray< LAutoPtr > Tests; LArray< LAutoPtr > Results; LArray< LAutoPtr > Changes; LAutoPtr Tokens; uint64_t CheckTextTs = 0; LAutoPtr CheckText; void Empty() { WhiteList.Reset(new LWordStore); Spam.Reset(new LWordStore); Ham.Reset(new LWordStore); #define SetListFile(list, file) \ if (!list->GetFile()) \ { \ if (auto s = FindWordDb(file)) \ { \ list->SetFile(s); \ } \ } SetListFile(WhiteList, WhiteListFile); SetListFile(Spam, SpamWordsFile); SetListFile(Ham, HamWordsFile); // empty the word lists WhiteList->Empty(); WhiteList->Serialize(0, true); Spam->Empty(); Spam->Serialize(0, true); Ham->Empty(); Ham->Serialize(0, true); } public: BayesianThread(ScribeWnd *app) : LThread("BayesianThread.Thread"), LMutex ("BayesianThread.Mutex") { App = app; State = BayesLoading; Run(); } ~BayesianThread() { State = BayesExiting; int64 Start = LCurrentTime(); while (!IsExited()) { LSleep(20); if (LCurrentTime()-Start > 5000) { Terminate(); break; } } } LMessage::Result OnEvent(LMessage *Msg) override { switch (Msg->Msg()) { case M_CHECK_TEXT: CheckTextTs = LCurrentTime(); CheckText.Reset((LSpellCheck::CheckText*)Msg->A()); break; } return 0; } bool PostEvent(int Cmd, LMessage::Param a = 0, LMessage::Param b = 0, int64_t TimeoutMs = -1) override { LMessage m(Cmd, a, b); OnEvent(&m); return true; } void Add(LAutoPtr b) { if (Lock(_FL)) { Work.New() = b; Unlock(); } } void Add(LAutoPtr t) { if (Lock(_FL)) { Tests.New() = t; Unlock(); } } void Add(LAutoPtr c) { if (Lock(_FL)) { Changes.New() = c; Unlock(); } } bool GetResults(LArray< LAutoPtr > &results) { if (Lock(_FL)) { results = Results; Unlock(); } Results.Length(0); return results.Length() > 0; } ThreadState GetState() { return State; } void SetStore(LAutoPtr &s, LWordStore *ws) { if (ws && Lock(_FL)) { s.Reset(ws); Unlock(); } } LString FindWordDb(const char *Name) { LString OptPath; auto Opts = App->GetOptions(); // Look in the same folder as the options file: if (Opts && Opts->GetFile()) { LFile::Path p(Opts->GetFile()); p--; OptPath = p.GetFull(); p += Name; if (p.IsFile()) return p.GetFull(); } // Check the install folder too: LFile::Path p(LSP_APP_INSTALL); p += Name; if (p.IsFile()) return p.GetFull(); // No existing file found, so create a path using the options location: p = OptPath; p += Name; return p.GetFull(); } void OnCheckText(LSpellCheck::CheckText *Ct) { auto p = Ct->Errors.Length() ? 0.3 : 0.7; auto i = WordInterest(p); if (Tokens->CanInsert(i)) { Token *t = new Token; if (t) { t->Word = Ct->Text; t->Prob = p; t->Interest = i; Tokens->Insert(t); } } } double IsSpam(Test *t) { // Check the auto white list if (WhiteList) { long Count = WhiteList->GetWordCount(t->FromAddr); if (Count > 0) { // It's from someone we've accepted mail from before if (t->Analyse) t->Log.Print("%s\n", LLoadString(IDS_IS_WHITELIST)); t->WhiteListed = true; return 0.0; } } bool Analyse = t->Analyse; LAutoPtr Spell(App->CreateSpellObject()); Tokens.Reset(new TokenStore); if (!Ham || !Spam) { LgiTrace("%s:%i - No Ham/Spam DB loaded?\n", _FL); return 0.0; } ssize_t HamItems = Ham->Length(); ssize_t SpamItems = Spam->Length(); if (Analyse) LgiTrace("HamItems=" LPrintfSSizeT " SpamItems=" LPrintfSSizeT "\n"); if (Spell) { Spell->Check(GetHandle(), t->Words, 0, t->Words.Length()); auto Start = LCurrentTime(); while (!CheckText) // Wait for the spell check to complete { if (LCurrentTime() - Start > TIMEOUT_SPELL_CHECK) { LgiTrace("%s:%i - Bayesian filter didn't get response from spell check, continuing without.\n", _FL); break; } LSleep(10); } if (CheckText) LgiTrace("%s:%i - SpellCheck took %ims\n", _FL, (int)(LCurrentTime()-CheckTextTs)); } struct Entry { LString word; ssize_t spam = 0, ham = 0; bool spellErr = false; int Compare(Entry *e) { auto i = (spam+ham) - (e->spam+e->ham); if (i < 0) return -1; return i > 0 ? 1 : 0; } }; LArray entries; ProcessWords(t->Words, [this, t, &entries](auto w) { size_t nextErr = 0; Entry &e = entries.New(); e.word = w; e.spam = Spam->GetWordCount(w); e.ham = Ham->GetWordCount(w); size_t Cur = w - t->Words.Get(); // bool hasAt = Strchr(w, '@') != NULL; if (CheckText) { while (nextErr < CheckText->Errors.Length()) { auto &errs = CheckText->Errors[nextErr]; if (errs.Overlap(Cur)) { e.spellErr = true; nextErr++; break; } if (errs.Start < (ssize_t)Cur) nextErr++; else break; } } }); entries.Sort([](auto a, auto b) { return a->Compare(b); }); for (auto &e: entries) { double s, p, i; if (e.spam && e.ham) { s = (double) e.spam / SpamItems; p = s / ( ((double) e.ham / HamItems) + s); } else if (e.spam) p = 0.99; else if (e.ham) p = e.spellErr ? 0.6 : 0.01; else p = e.spellErr ? 0.88 : 0.4; i = WordInterest(p); if (Tokens->CanInsert(i)) { Token *t = new Token; if (t) { t->Word = e.word; t->Prob = p; t->Interest = i; Tokens->Insert(t); } } if (Analyse) LgiTrace(" %s, " LPrintfSSizeT ", " LPrintfSSizeT ", %i, %g\n", e.word.Get(), e.spam, e.ham, e.spellErr, p); } auto result = Tokens->Prob(&t->Log); if (Analyse) LgiTrace(" result=%g\n", result); return result; } void ConvertHashToBtree(LWordStore *Ws, LHashTbl,int> &Hash, int EmailCount, bool Append, LStream *Debug = NULL) { auto Items = Hash.Length(); int64 Start = LCurrentTime(); if (Debug) Debug->Print("ConvertHashToBtree(%s, %i words, %i emails)\n", Ws->GetFile(), Items, EmailCount); Ws->Empty(); for (auto i: Hash) { ssize_t Result; if (Append) { ssize_t Old = Ws->GetWordCount(i.key); Result = Ws->SetWordCount(i.key, Old + i.value); } else { Result = Ws->SetWordCount(i.key, i.value); } if (!Result) { if (Debug) Debug->Print("SetWordCount(%s, %i) failed\n", i.key, i.value); LAssert(0); return; } } if (EmailCount) { Ws->SetItems(EmailCount); } Hash.Empty(); LgiTrace("ConvertHashToBtree(%s) took %.1f sec, for " LPrintfInt64 " items.\n", Ws->GetFile(), ((double)((int64)LCurrentTime()-Start))/1000.0, Items); } void ApplyChange(Change *c, LWordStore *Ws, bool Add) { bool status = false; if (!Ws || !c) { LgiTrace("%s:%i - Invalid param: %p, %p\n", _FL, c, Ws); return; } ProcessWords(c->Words, [this, Ws, Add, &status](auto w) { ssize_t c = Ws->GetWordCount(w); if (Add) status = Ws->SetWordCount(w, c + 1) > 0; else status = Ws->SetWordCount(w, c > 0 ? c - 1 : 0) > 0; LAssert(status); }); ssize_t Total = Ws->GetItems(); status = Ws->SetItems((int)Total + (Add ? 1 : -1)); LAssert(status); } int Main() override { if (auto s = FindWordDb(HamWordsFile)) SetStore(Ham, new LWordStore(s)); if (auto s = FindWordDb(SpamWordsFile)) SetStore(Spam, new LWordStore(s)); if (auto s = FindWordDb(WhiteListFile)) SetStore(WhiteList, new LWordStore(s)); State = BayesReady; bool Notify = false; while (State == BayesReady) { LAutoPtr b; LAutoPtr t; LAutoPtr c; if (Lock(_FL)) { if (Work.Length()) { b = Work[0]; Work.DeleteAt(0, true); } else if (Tests.Length()) { t = Tests[0]; Tests.DeleteAt(0, true); } else if (Changes.Length()) { c = Changes[0]; Changes.DeleteAt(0, true); } Unlock(); } if (b) { if (b->ResetDb) Empty(); ConvertHashToBtree(Spam, b->SpamWords, b->SpamEmailCount, b->ResetDb == false); ConvertHashToBtree(Ham, b->HamWords, b->HamEmailCount, b->ResetDb == false); ConvertHashToBtree(WhiteList, b->WhiteList, 0, b->ResetDb == false); } else if (t) { t->Score = IsSpam(t); if (Lock(_FL)) { Results.New() = t; Notify = true; Unlock(); } } else if (c) { switch (c->OldType) { default: break; case BayesMailHam: ApplyChange(c, Ham, false); break; case BayesMailSpam: ApplyChange(c, Spam, false); break; } switch (c->NewType) { default: break; case BayesMailHam: ApplyChange(c, Ham, true); break; case BayesMailSpam: ApplyChange(c, Spam, true); break; } if (c->Str) { if (!WhiteList) { LgiTrace("Missing whitelist obj.\n"); } else if (c->NewType == BayesMailSpam || c->RemoveWhite) { // Make sure the email address is not in the white list... WhiteList->DeleteWord(c->Str); LAssert(WhiteList->GetWordCount(c->Str) == 0); } else if (c->IncrementWhite) { auto i = WhiteList->GetWordCount(c->Str); WhiteList->SetWordCount(c->Str, i + 1); } } } else { // No work to do... if (Notify) { App->PostEvent(M_SCRIBE_BAYES_RESULT); Notify = false; } LSleep(20); } } return 0; } }; struct BayesEvent { Mail *m; bool Loading, Done; ScribeMailType OldType, NewType; }; class BuildSpamDB { int FolderLoads = 0; int MailLoads = 0; public: ScribeWnd *App; BayesianFilter *Filter; LAutoPtr Prog; LAutoPtr Debug; // Processing part 1... load the folders: LArray Folders; // Processing part 2... convert the mail to words: struct BuildItem { Mail *m = NULL; bool loading = false; ScribeMailType type = BayesMailUnknown; void Set(Mail *mail, ScribeMailType Type) { m = mail; m->IncRef(); type = Type; loading = false; } }; LArray Items; int HamCount = 0; int SpamCount = 0; int FalsePositives = 0; int FalseNegatives = 0; int LoadFailures = 0; LAutoPtr b; BuildSpamDB(ScribeWnd *app); ~BuildSpamDB(); /// \returns true when the processing is finished bool Process(); void ProcessMail(Mail *m, ScribeMailType type); void AbortProcess(); void AddFolder(ScribeFolder *f) { Folders.Add(f); } bool IsCancelled() { return Prog ? Prog->IsCancelled() : true; } }; class BayesianFilterPriv : public LMutex { LAutoPtr Thread; public: ScribeWnd *App; uint64_t Ts; uint64_t WorkStartTs = 0; LArray Work; LAutoPtr Prog; LAutoPtr Build; BayesianFilterPriv(ScribeWnd *app) : LMutex("BayesianFilterPriv") { Ts = 0; App = app; } BayesianThread *GetThread() { if (!Thread) Thread.Reset(new BayesianThread(App)); return Thread; } bool IsCancelled() { return Build ? Build->IsCancelled() : true; } }; BuildSpamDB::BuildSpamDB(ScribeWnd *app) : App(app), Filter(app) { App->OnFolderTask(Filter->d->GetThread(), true); b.Reset(new BayesianThread::Build(true)); if (Prog.Reset(new LProgressDlg(App))) Prog->SetDescription("Scanning folders..."); LVariant i; if (App->GetOptions()->GetValue(OPT_BayesDebug, i)) { if (Debug.Reset(new LFile)) { char s[MAX_PATH_LEN]; LMakePath(s, sizeof(s), LGetExePath(), "Bayes.txt"); if (Debug->Open(s, O_WRITE)) Debug->SetSize(0); else LgiTrace("%s:%i - Couldn't open '%s'\n", _FL, s); } } } BuildSpamDB::~BuildSpamDB() { // Save stats... LVariant i; auto opts = App->GetOptions(); opts->SetValue(OPT_BayesHam, i = HamCount); opts->SetValue(OPT_BayesSpam, i = SpamCount); opts->SetValue(OPT_BayesFalsePositives, i = FalsePositives); opts->SetValue(OPT_BayesFalseNegitives, i = FalseNegatives); App->OnFolderTask(Filter->d->GetThread(), false); } void BuildSpamDB::AbortProcess() { Folders.Length(0); Items.Length(0); } bool BuildSpamDB::Process() { if (IsCancelled()) AbortProcess(); // This should execute for only a small time slice... if (Folders.Length() || FolderLoads) { if (!Folders.Length()) return false; // Just wait for them... auto f = Folders[0]; Folders.DeleteAt(0); if (f) { auto Path = f->GetPath(); ScribeMailType Type = Filter->BayesTypeFromPath(Path); if (Debug) Debug->Print("%s:%i - add folder '%s', Type=%i\n", _FL, Path.Get(), Type); auto Parent = f->GetParent(); if (Type != BayesMailUnknown && Parent) { FolderLoads++; f->WhenLoaded(_FL, [this, f, Type, Path]() { LgiTrace("%s:%i - Scanning '%s' got %i items, FolderLoads=%i\n", _FL, Path.Get(), (int)f->Items.Length(), FolderLoads); for (auto i: f->Items) { auto m = i->IsMail(); if (!m) continue; // Add item to the work queue... Items.New().Set(m, Type); } FolderLoads--; (*Prog)++; }); // FIXME: does this need to do something on callback? f->LoadThings(); } else { // LgiTrace("%s:%i - Unknown folder '%s'\n", _FL, Path.Get()); (*Prog)++; } } if (Folders.Length() == 0 && FolderLoads == 0) { Prog->SetDescription("Processing mail..."); Prog->SetRange(Items.Length()); Prog->Value(0); } return false; } if (Items.Length() || MailLoads) { if (Items.Length() && MailLoads < 100) { auto Start = LCurrentTime(); while ( (LCurrentTime() - Start) < TIMEOUT_BAYES_IDLE && Items.Length()) { // Process mail items... auto &i = Items[0]; // Operate on read mail only... auto flags = i.m->GetFlags(); if (TestFlag(flags, MAIL_READ)) { MailLoads++; // auto loaded = i.m->GetLoaded(); i.m->WhenLoaded(_FL, [this, mail = i.m, type = i.type] { ProcessMail(mail, type); MailLoads--; (*Prog)++; }); i.m->SetLoaded(); } Items.DeleteAt(0); } } return false; } // We're done... return true; } void BuildSpamDB::ProcessMail(Mail *m, ScribeMailType Type) { auto LoadState = m->GetLoaded(); if (LoadState != Store3Loaded) { LAssert(!"Should only be called on loaded email..."); return; } const char *email; if (Type == BayesMailHam && (email = m->GetFromStr(FIELD_EMAIL))) { b->InsertWhiteList(email); } LString Words; auto Status = Filter->MakeMailWordList(m, Words); if (Status != Store3Success) { LAssert(!"MakeMailWordList failed."); return; } ProcessWords(Words, [this, Type](auto w) { if (Type == BayesMailSpam) b->InsertSpamWords(w); else if (Type == BayesMailHam) b->InsertHamWords(w); // else do nothing }); auto flags = m->GetFlags(); // Remove the bayes DB flags... flags &= ~(MAIL_HAM_DB|MAIL_SPAM_DB); if (Type == BayesMailSpam) { b->SpamEmailCount++; flags |= MAIL_SPAM_DB; } else if (Type == BayesMailHam) { b->HamEmailCount++; flags |= MAIL_HAM_DB; } if (flags & MAIL_BAYES_HAM) // originally classified as ham.. { if (flags & MAIL_SPAM_DB) // but now is spam... FalseNegatives++; else if (Type == BayesMailHam) HamCount++; } else if (flags & MAIL_BAYES_SPAM) // originally classified as spam.. { if (flags & MAIL_SPAM_DB) SpamCount++; else if (Type == BayesMailHam) // but now is ham... FalsePositives++; } // Update the object.. m->SetFlags(flags); // Delete our reference... m->DecRef(); } #ifdef _DEBUG bool HashSerialize(LHashTbl,uint32_t> &h, char *file, bool write) { bool Status = false; struct Field { uint32_t Value; uint16_t Len; char Str[1]; }; LFile f; if (f.Open(file, write?O_WRITE:O_READ)) { Field *fld = (Field*)malloc(64<<10); if (fld) { int header = 6; if (write) { f.SetSize(0); // char *key; // for (int i=h.First(&key); i; i=h.Next(&key)) for (auto i : h) { fld->Value = (uint32_t)i.value; fld->Len = (uint16_t)strlen(i.key); memcpy(fld->Str, i.key, fld->Len + 1); Status = f.Write(fld, header + fld->Len) == (header + fld->Len); } } else { h.Empty(); while (!f.Eof()) { if (f.Read(fld, header) == header) { if (f.Read(fld->Str, fld->Len) == fld->Len) { fld->Str[fld->Len] = 0; Status = h.Add(fld->Str, fld->Value); } else break; } else break; } } free(fld); } } return Status; } #endif BayesianFilter::BayesianFilter(ScribeWnd *app) { d = new BayesianFilterPriv(app); App = app; } BayesianFilter::~BayesianFilter() { DeleteObj(d); } void BayesianFilter::AddFolderToSpamDb(ScribeFolder *f) { if (d->IsCancelled()) return; d->Build->AddFolder(f); for (auto c = f->GetChildFolder(); c; c = c->GetNextFolder()) AddFolderToSpamDb(c); } /* static size_t FolderCount(ScribeFolder *f) { ssize_t len = f->Length(); auto items = f->GetItems(); auto n = MAX(len, items); for (auto c = f->GetChildFolder(); c; c = c->GetNextFolder()) n += FolderCount(c); return n; } */ void BayesianFilter::BuildStats() { auto prob = App->GetFolder("/Mail3/Spam/Probably"); auto inbox = App->GetFolder("/IMAP/INBOX"); if (!prob || !inbox) return; prob->LoadThings(); inbox->LoadThings(); } bool BayesianFilter::BuildSpamDb() { if (!d->GetThread()) return false; // scan folders LVariant MoveTo; if (!App->GetOptions()->GetValue(OPT_BayesMoveTo, MoveTo)) MoveTo = "/Spam/Probably"; if (!d->Build.Reset(new BuildSpamDB(App))) return false; // Recurse over the folders for (auto &s: App->GetStorageFolders()) { if (s.Root) AddFolderToSpamDb(s.Root); } for (auto a : *App->GetAccounts()) { if (a->Receive.GetRootFolder()) AddFolderToSpamDb(a->Receive.GetRootFolder()); } d->Build->Prog->SetRange(d->Build->Folders.Length()); return true; } #define IsCJK(c) \ ( \ ((c)>=0x4E00 && (c)<=0x9FFF) || \ ((c)>=0x3400 && (c)<=0x4DFF) || \ ((c)>=0x20000 && (c)<=0x2A6DF)|| \ ((c)>=0xF900 && (c)<=0xFAFF) || \ ((c)>=0x2F800 && (c)<=0x2FA1F) \ ) bool IsUriChar(int32 ch) { if (!ch) return false; if (IsDigit(ch) || IsAlpha(ch)) return true; if (strchr("-._~:/?#[]@!$&\'()*+,;%=", ch)) return true; return false; } typedef LHashTbl,bool> TokenMap; void TokeniseText(const char *Source, bool *Lut, LString::Array &Blocks, TokenMap *Ignore = NULL) { if (!Source || !Lut) return; char buf[16 << 10]; ssize_t used = 0; auto oldWarn = LUtf8Ptr::Warn; LUtf8Ptr::Warn = false; auto emitBuf = [&Blocks, &used, &buf]() { if (used > 0) Blocks.New().Set(buf, used); used = 0; }; for (auto *s = Source; *s;) { int32 ch; LUtf8Ptr start(s); // Skip non-word while ( (ch = start) && ch < 256 && !Lut[ch] ) { start++; } // Seek end of word LUtf8Ptr end(start); while ( (ch = end) && ( ch >= 256 || Lut[ch] ) ) { if (end > start && IsCJK(ch)) break; end++; } auto len = end - start; // Is the word something that looks like a URI? bool isUrl = (len == 4 && !Strnicmp((const char*)start.GetPtr(), "http", 4)) || (len == 5 && !Strnicmp((const char*)start.GetPtr(), "https", 5)); if (isUrl) { // Seek to the end of the URI while ((ch = end) && IsUriChar(ch) && (end - start) < sizeof(buf) - 10) end++; isUrl = true; len = end - start; } if (len > 0) { ch = start; if (ch != '*' || len != 10 || Strnicmp((const char*)start.GetPtr(), "***SPAM***", len)) { if (used + len >= sizeof(buf) - 2) emitBuf(); auto word = buf + used; if (isUrl) { LUri uri(LString((char*)start.GetPtr(), len)); if (uri.sHost) { memcpy(word, uri.sHost.Get(), uri.sHost.Length()); used += uri.sHost.Length(); buf[used++] = ' '; } } else { memcpy(word, start.GetPtr(), len); used += len; if (Ignore) { buf[used] = 0; if (Ignore->Find(buf+used-len)) used -= len; // undo adding word else buf[used++] = ' '; // convert to space delimit } else { buf[used++] = ' '; } } } } else { if (ch) LgiTrace("%s:%i - Invalid utf-8, aborting parse...\n", _FL); break; } s = (const char*)end.GetPtr(); } emitBuf(); LUtf8Ptr::Warn = oldWarn; } Store3Status BayesianFilter::MakeMailWordList(Mail *m, LString &out) { LString::Array Blocks; if (!m || !m->GetObject()) return Store3Error; static bool Processing = false; if (!Processing) { Processing = true; // create word lut for deciding whether a char is part of a word or not bool Lut[256]; ZeroObj(Lut); memset(Lut + 'a', true, 'z'-'a'+1); memset(Lut + 'A', true, 'Z'-'A'+1); Lut[(int)'-'] = true; // Lut[(int)'!'] = true; Lut[(int)'$'] = true; bool Email[256]; memcpy(Email, Lut, sizeof(Email)); Email[(int)'@'] = true; Email[(int)'.'] = true; memset(Lut + 0x80, true, 128); // create ignored words list LString::Array Temp; TokenMap Ignore; for (auto a: *App->GetAccounts()) { auto s = a->Identity.Name(); if (ValidStr(s.Str())) TokeniseText(s.Str(), Lut, Temp); s = a->Identity.Email(); if (ValidStr(s.Str())) TokeniseText(s.Str(), Email, Temp); } ProcessWords(LString("").Join(Temp), [&Ignore](auto w) { Ignore.Add(w, true); }); // process various parts of the email TokeniseText(m->GetSubject(), Lut, Blocks, &Ignore); TokeniseText(m->GetFromStr(FIELD_EMAIL), Email, Blocks, &Ignore); TokeniseText(m->GetFromStr(FIELD_NAME), Lut, Blocks, &Ignore); LVariant Body; Store3State Loaded = (Store3State)m->GetObject()->GetInt(FIELD_LOADED); if (Loaded < Store3Loaded) { m->GetBody(); Loaded = (Store3State)m->GetObject()->GetInt(FIELD_LOADED); if (Loaded < Store3Loaded) { Processing = false; return Store3Delayed; } // else continue... } auto Req = m->GetValue("BodyAsText", Body); if (Req) { // auto id = m->GetMessageId(); TokeniseText(Body.Str(), Lut, Blocks, &Ignore); } else { LString path = "(nullFolder)"; auto fld = m->GetFolder(); if (fld) path = fld->GetPath(); LgiTrace("%s:%i - couldn't get body for %s/%s\n", _FL, path.Get(), m->GetMessageId()); /* Technically not an error... body can be blank. Processing = false; return Store3Error; */ } out = LString("").Join(Blocks); Processing = false; return Store3Success; } else { LAssert(!"Recursion."); return Store3Error; } } Store3Status BayesianFilter::IsSpam(double &Result, Mail *m, bool Analyse) { if (!m) { Result = 0.0; return Store3Error; } Store3Status Status = Store3NotImpl; LAutoPtr t(new BayesianThread::Test); const char *FromAddr; if ((FromAddr = m->GetFromStr(FIELD_EMAIL))) { #if WHITELIST_MY_EMAIL // Check if from yourself... if (App->IsMyEmail(FromAddr)) goto OnWhiteListed; #endif // Check the user white list LVariant Wl; if (App->GetOptions()->GetValue(OPT_BayesUserWhiteList, Wl)) { auto w = Wl.LStr().SplitDelimit("\r\n\t "); bool IsWhite = false; for (unsigned i=0; i Contacts; App->GetContacts(Contacts); for (auto c: Contacts) { if (c->HasEmail(FromAddr)) goto OnWhiteListed; } #endif t->FromAddr = FromAddr; } // Tokenise the mail... Status = MakeMailWordList(m, t->Words); if (Status == Store3Error) return Status; if (Status == Store3Delayed) { // Not loaded yet, retry it later... m->WhenLoaded(_FL, [this, Analyse, m]() { double r; IsSpam(r, m, Analyse); }); return Store3Delayed; } // Pass it over to the thread t->Analyse = Analyse; t->MsgRef = m->GetMailRef(); d->GetThread()->Add(t); return Store3Delayed; OnWhiteListed: if (Analyse) OnBayesAnalyse(LLoadString(IDS_IS_WHITELIST), FromAddr); Result = 0.0; return Store3Success; } ScribeMailType BayesianFilter::BayesTypeFromPath(LString Path) { if (!Path) return BayesMailUnknown; auto spam = App->GetFolder(FOLDER_SPAM); auto folder = App->GetFolder(Path); if (spam && folder) { if (folder == spam) return BayesMailSpam; // If folder is a child of the spam folder, it's NOT ham but "unknown". // Typically a staging ground for "possible" spam. So it should not contribute to // bayes word counts. for (auto p = folder->GetParent(); p; p = p->GetParent()) if (p == spam) return BayesMailUnknown; } else { auto t = Path.SplitDelimit("/"); ssize_t spamIdx = -1; for (size_t i=0; i spamIdx + 1 ? BayesMailUnknown : BayesMailSpam; } return BayesMailHam; } ScribeMailType BayesianFilter::BayesTypeFromPath(Mail *m) { ScribeMailType Status = BayesMailUnknown; if (m) { ScribeFolder *f = m->GetFolder(); if (f) Status = BayesTypeFromPath(f->GetPath()); } return Status; } void BayesianFilter::WhiteListIncrement(const char *Word) { if (!Word) return; LAutoPtr c(new BayesianThread::Change); c->IncrementWhite = true; c->Str = Word; d->GetThread()->Add(c); } bool BayesianFilter::RemoveFromWhitelist(const char *Email) { if (!Email) return false; LAutoPtr c(new BayesianThread::Change); c->Str = Email; c->RemoveWhite = true; d->GetThread()->Add(c); return true; } Store3Status BayesianFilter::OnBayesianMailEvent(Mail *m, ScribeMailType OldType, ScribeMailType NewType) { if (!m) return Store3Error; auto flags = m->GetFlags(); if (NewType == BayesMailHam) { if (TestFlag(flags, MAIL_HAM_DB)) return Store3Success; if (!TestFlag(flags, MAIL_BAYES_HAM|MAIL_BAYES_SPAM)) flags |= MAIL_BAYES_HAM; } if (NewType == BayesMailSpam) { if (TestFlag(flags, MAIL_SPAM_DB)) return Store3Success; if (!TestFlag(flags, MAIL_BAYES_HAM|MAIL_BAYES_SPAM)) flags |= MAIL_BAYES_SPAM; } m->SetFlags(flags); if (d->Work.Length() == 0) d->WorkStartTs = LCurrentTime(); auto &w = d->Work.New(); w.m = m; w.m->IncRef(); w.Loading = false; w.Done = false; w.OldType = OldType; w.NewType = NewType; return Store3Delayed; } void BayesianFilter::OnEvent(LMessage *Msg) { switch (Msg->Msg()) { case M_SCRIBE_IDLE: { // LProfile prof("M_SCRIBE_IDLE", 15); if (d->Build) { if (d->Build->Process()) { // Give the hash tables to the worker thread to convert to disk: d->GetThread()->Add(d->Build->b); // And finish doing the build processing: d->Build.Reset(); } break; } auto EmptyWorkQueue = [this]() { for (auto j: d->Work) { if (!j.Done && j.m) { j.m->DecRef(); j.m = NULL; } } d->Work.Length(0); }; // Look for something we can do... auto StartTs = LCurrentTime(); size_t i, processedCount = 0; for (i=0; iWork.Length(); i++) { auto &job = d->Work[i]; if (job.Done) continue; if (!job.m->GetObject()) { // Why? LgiTrace("%s:%i - Error: object not found.\n", _FL); job.Done = true; // We can't continue anyway continue; } if (job.Loading) { // prof.Add("loading"); auto loaded = job.m->GetLoaded(); if (loaded < Store3Loaded) continue; // Still hasn't loaded.. } LString words; // prof.Add("MakeMailWordList"); auto Status = MakeMailWordList(job.m, words); if (Status == Store3Error) { // Remove the work from the list... it's probably going to keep failing d->Work.DeleteAt(i--); continue; } else if (Status == Store3Delayed) { if (job.Loading) LAssert(!"Already waiting for load."); else job.Loading = true; continue; } // prof.Add("change"); LAutoPtr c(new BayesianThread::Change); c->Str = job.m->GetFromStr(FIELD_EMAIL); c->Words = words; c->OldType = job.OldType; c->NewType = job.NewType; d->GetThread()->Add(c); // Update the spam/ham flags... auto flags = job.m->GetFlags(); flags &= ~(MAIL_BAYES_SPAM|MAIL_BAYES_HAM); if (job.NewType == BayesMailHam) flags |= MAIL_BAYES_HAM; else if (job.NewType == BayesMailSpam) flags |= MAIL_BAYES_SPAM; job.m->SetFlags(flags); job.m->DecRef(); job.m = NULL; job.Done = true; processedCount++; if (LCurrentTime()-StartTs >= TIMEOUT_BAYES_IDLE) break; } // prof.Add("post"); if (d->Work.Length() > 0) { if (!processedCount) { EmptyWorkQueue(); } else { auto Now = LCurrentTime(); LAssert(d->WorkStartTs); if (Now - d->WorkStartTs > 300 && !d->Prog) { d->Prog.Reset(new LProgressDlg(App, 500)); d->Prog->SetDescription("Bayesian filtering..."); } if (d->Prog) { d->Prog->SetRange(d->Work.Length()); d->Prog->Value(i); if (d->Prog->IsCancelled()) { // Dump the work queue EmptyWorkQueue(); } } } } else { d->Prog.Reset(); d->WorkStartTs = 0; } break; } case M_SCRIBE_BAYES_RESULT: { LArray< LAutoPtr > Results; if (!d->GetThread()->GetResults(Results)) break; for (auto t: Results) { if (!t) { LAssert(!"Null ptr in Results"); continue; } if (t->Analyse) { LArray a; int Size = (int) t->Log.GetSize(); a.Length(Size+1); t->Log.Read(&a[0], Size); a[Size] = 0; - OnBayesAnalyse(&a[0], t->WhiteListed ? t->FromAddr : NULL); + OnBayesAnalyse(&a[0], t->WhiteListed ? t->FromAddr : LString()); } else if (t->MsgRef) { OnBayesResult(t->MsgRef, t->Score); } else LAssert(!"There should always be a msg ref"); } break; } } } diff --git a/src/Exp_Scribe.cpp b/src/Exp_Scribe.cpp --- a/src/Exp_Scribe.cpp +++ b/src/Exp_Scribe.cpp @@ -1,906 +1,906 @@ #include "Scribe.h" #include "lgi/common/List.h" #include "lgi/common/ProgressDlg.h" #include "lgi/common/Store3.h" #include "lgi/common/LgiRes.h" #include "lgi/common/FileSelect.h" #include "ScribeFolderSelect.h" #include "resdefs.h" #include "FolderTask.h" #define OnError(...) \ { \ Errors.Add(in->Type(), Errors.Find(in->Type()) + 1); \ LgiTrace(__VA_ARGS__); \ break; \ } #define OnSkip() \ { \ Skipped.Add(in->Type(), Skipped.Find(in->Type()) + 1); \ break; \ } #define OnCreate() \ { \ Created.Add(in->Type(), Created.Find(in->Type()) + 1); \ } struct ExportParams { bool AllFolders = false; bool ExceptTrashSpam = false; LString DestFolders; // Mail3 path for dest folders; LString DestPath; // Sub folder path for export LString::Array SrcPaths; }; struct Mail3Folders { ScribeWnd *App = NULL; LAutoPtr Store; LAutoPtr Root; Mail3Folders(ScribeWnd *app) : App(app) { } Mail3Folders(Mail3Folders &src) { App = src.App; if (src) { Store = src.Store; Root = src.Root; } else LAssert(!"Src not loaded."); } operator bool() { return Store != NULL && Root != NULL; } void LoadFolders(const char *FilePath) { if (!Store) Store.Reset(App->CreateDataStore(FilePath, true)); if (Store && !Root) { if (Root.Reset(new ScribeFolder)) { Root->App = App; Root->SetObject(Store->GetRoot(), false, _FL); } } } void Unload() { Root.Reset(); Store.Reset(); } bool CheckDirty(ScribeFolder *f) { if (f->GetDirty()) return true; for (auto c = f->GetChildFolder(); c; c = c->GetNextFolder()) if (CheckDirty(c)) return true; return false; } bool IsDirty() { if (!Root) return false; return CheckDirty(Root); } }; struct ScribeExportTask : public FolderTask { int FolderLoadErrors = 0; LHashTbl,int> Created, Errors, Skipped; LMailStore *SrcStore = NULL; // Source data store Mail3Folders Dst; ScribeFolder *Spam = NULL; ScribeFolder *Trash = NULL; ExportParams Params; // Working state, used to iterate over the exporting process while // being able to yield to the OS at regular intervals. enum ExportState { ExpNone, ExpGetNext, ExpLoadFolders, ExpItems, ExpFinished, ExpCleanup } State = ExpNone; LString::Array InputPaths; ScribeFolder *SrcFolder = NULL; LArray SrcItems; ScribeFolder *DstFolder = NULL; LDataFolderI *DstObj = NULL; LDataStoreI *DstStore = NULL; LHashTbl,LDataI*> DstObjMap; ScribeExportTask(struct ScribeExportDlg *dlg); LString ContactKey(Contact *c); bool TimeSlice(); bool CopyAttachments(LDataI *outMail, LDataPropI *outSeg, LDataPropI *inSeg, LString &err); LString MakePath(LString path) { LString sep = "/"; auto p = Params.DestPath.SplitDelimit(sep); p += path.Strip(sep).SplitDelimit(sep).Slice(1); return sep + sep.Join(p); } void CollectPaths(ScribeFolder *f, LString::Array &paths) { paths.Add(f->GetPath()); for (auto c = f->GetChildFolder(); c; c = c->GetNextFolder()) CollectPaths(c, paths); } ScribeFolder *GetFolder(LString Path, Store3ItemTypes CreateItemType = MAGIC_NONE) { if (!Dst.Root) { LAssert(!"No root loaded."); return NULL; } Dst.Root->LoadFolders(); bool Create = false; auto parts = Path.SplitDelimit("/"); ScribeFolder *f = Dst.Root; for (auto p: parts) { auto c = f->GetSubFolder(p); if (!c) { if (CreateItemType != MAGIC_NONE) { c = f->CreateSubFolder(p, CreateItemType); if (!c) { Errors.Add(MAGIC_FOLDER, Errors.Find(MAGIC_FOLDER)+1); return NULL; } Create = true; } else return NULL; } f = c; } if (Create) Created.Add(MAGIC_FOLDER, Created.Find(MAGIC_FOLDER)+1); else Skipped.Add(MAGIC_FOLDER, Skipped.Find(MAGIC_FOLDER)+1); return f; } void OnComplete() { Store3ItemTypes types[] = { MAGIC_FOLDER, MAGIC_MAIL, MAGIC_CONTACT, MAGIC_CALENDAR, MAGIC_GROUP, MAGIC_FILTER }; LStringPipe html; html.Print("\n" "Mail export complete.\n" "\n" "\n" "Type Created Errors Skipped \n"); for (int i=0; i%s %i %i %i \n", name.Get(), created, errStyle, errors, skipped); } html.Print("\n" "\n" "Created: new item created in destination store.\n" "Error: there was an error replicating item.\n" "Skipped: the item already existed in the destination store.\n" ); LHtmlMsg(NULL, App, html.NewLStr(), "Export", MB_OK); } LString GetOrCreateMessageId(LDataI &obj) { auto msgId = obj.GetStr(FIELD_MESSAGE_ID); if (msgId) return msgId; // Check the headers: auto hdrs = obj.GetStr(FIELD_INTERNET_HEADER); if (hdrs) { LAutoString Header(InetGetHeaderField(hdrs, "Message-ID")); if (Header) { auto ids = ParseIdList(Header); auto id = ids[0]; obj.SetStr(FIELD_MESSAGE_ID, id); obj.Save(); return id; } } // Msg has no ID and no header... create one. auto from = obj.GetObj(FIELD_FROM); if (!from) { LgiTrace("%s:%i - No from for email: %p\n", _FL, &obj); return LString(); } auto fromEmail = from->GetStr(FIELD_EMAIL); LVariant Email; const char *At = fromEmail ? strchr(fromEmail, '@') : NULL; if (!At) { if (App->GetOptions()->GetValue(OPT_Email, Email) && Email.Str()) At = strchr(Email.Str(), '@'); else At = "@domain.com"; } if (!At) { LgiTrace("%s:%i - No at in email: %p\n", _FL, &obj); return LString(); } char m[96], a[32], b[32]; Base36(a, LCurrentTime()); Base36(b, LRand(RAND_MAX)); sprintf_s(m, sizeof(m), "<%s.%i%s%s>", a, LRand(RAND_MAX), b, At); obj.SetStr(FIELD_MESSAGE_ID, m); obj.Save(); return m; } LString ObjToId(LDataI &obj) { switch (obj.Type()) { case MAGIC_MAIL: { return obj.GetStr(FIELD_MESSAGE_ID); } case MAGIC_CONTACT: { auto fn = obj.GetStr(FIELD_FIRST_NAME); auto ln = obj.GetStr(FIELD_LAST_NAME); auto em = obj.GetStr(FIELD_EMAIL); LString s; s.Printf("%s,%s,%s", fn, ln, em); return s; } case MAGIC_CALENDAR: { auto sub = obj.GetStr(FIELD_CAL_SUBJECT); auto start = obj.GetDate(FIELD_CAL_START_UTC); LString s; s.Printf("%s," LPrintfInt64, sub, start?start->Ts():0); return s; break; } case MAGIC_GROUP: { return obj.GetStr(FIELD_GROUP_NAME); } case MAGIC_FILTER: { return obj.GetStr(FIELD_FILTER_NAME); } default: { LAssert(!"Impl me."); break; } } return LString(); } bool CheckModified(LDataI *in, LDataI *out) { if (!out) // No existing object return true; auto inMod = in->GetDate(FIELD_DATE_MODIFIED); auto outMod = in->GetDate(FIELD_DATE_MODIFIED); if (!inMod || !outMod || !inMod->IsValid() || !outMod->IsValid()) return true; // Can't tell... no dates stored. bool mod = *inMod > *outMod; return mod; } void MakeDstObjMap() { DstObjMap.Empty(); if (!DstFolder || !DstObj) return; auto &c = DstObj->Children(); for (auto t = c.First(); t; t = c.Next()) { auto Id = ObjToId(*t); if (Id) DstObjMap.Add(Id, t); } } }; struct ScribeExportDlg : public LDialog, public LDataEventsI { ScribeWnd *App = NULL; LMailStore *SrcStore = NULL; LList *Lst = NULL; ExportParams Params; Mail3Folders Dst; ScribeExportDlg(ScribeWnd *app, LMailStore *srcStore) : SrcStore(srcStore), Dst(app) { SetParent(App = app); if (!SrcStore) SrcStore = App->GetDefaultMailStore(); if (LoadFromResource(IDD_SCRIBE_EXPORT)) { MoveToCenter(); // EnableCtrls(false); GetViewById(IDC_SRC_FOLDERS, Lst); LVariant s; if (Lst && App->GetOptions()->GetValue(OPT_ScribeExpSrcPaths, s) && s.Str()) { Params.SrcPaths = LString(s.Str()).SplitDelimit(":"); for (auto p: Params.SrcPaths) Lst->Insert(new LListItem(p)); Lst->ResizeColumnsToContent(); } if (App->GetOptions()->GetValue(OPT_ScribeExpDstPath, s) && ValidStr(s.Str())) SetCtrlName(IDC_FOLDER, s.Str()); else SetCtrlName(IDC_FOLDER, "/"); LVariant n; if (App->GetOptions()->GetValue(OPT_ScribeExpAll, n)) SetCtrlValue(IDC_ALL, n.CastInt32()); if (App->GetOptions()->GetValue(OPT_ScribeExpExclude, n)) SetCtrlValue(IDC_NO_SPAM_TRASH, n.CastInt32()); else SetCtrlValue(IDC_NO_SPAM_TRASH, true); if (App->GetOptions()->GetValue(OPT_ScribeExpFolders, s) && s.Str()) SetCtrlName(IDC_DEST, s.Str()); OnAll(); } } void OnNew(LDataFolderI *parent, LArray &new_items, int pos, bool is_new) { } bool OnDelete(LDataFolderI *parent, LArray &items) { return true; } bool OnMove(LDataFolderI *new_parent, LDataFolderI *old_parent, LArray &items) { return true; } bool OnChange(LArray &items, int FieldHint) { return true; } void OnAll() { SetCtrlEnabled(IDC_SRC_FOLDERS, !GetCtrlValue(IDC_ALL)); SetCtrlEnabled(IDC_ADD_SRC_FOLDER, !GetCtrlValue(IDC_ALL)); SetCtrlEnabled(IDC_DEL_SRC_FOLDER, !GetCtrlValue(IDC_ALL)); } int OnNotify(LViewI *c, LNotification n) { switch (c->GetId()) { case IDC_ALL: { OnAll(); break; } case IDC_SET_DEST: { auto s = new LFileSelect(this); s->Type("Scribe Folders", "*.mail3"); s->Type("All Files", LGI_ALL_FILES); s->Open([this](auto dlg, auto status) { if (status) SetCtrlName(IDC_DEST, dlg->Name()); delete dlg; }); break; } case IDC_ADD_SRC_FOLDER: { if (!Lst) break; auto s = new FolderDlg(this, App); s->DoModal([this, s](auto dlg, auto status) { if (status && ValidStr(s->Get())) { bool Has = false; for (auto n: *Lst) { if (Stricmp(n->GetText(), s->Get()) == 0) { Has = true; break; } } if (!Has) { Lst->Insert(new LListItem(s->Get())); Lst->ResizeColumnsToContent(); } } delete dlg; }); break; } case IDC_DEL_SRC_FOLDER: { if (Lst) { List i; if (Lst->GetSelection(i)) { i.DeleteObjects(); } } break; } case IDC_SET_FOLDER: { if (!Dst) Dst.LoadFolders(GetCtrlName(IDC_DEST)); if (Dst.Root) { auto s = new FolderDlg(this, App, MAGIC_NONE, Dst.Root); s->DoModal([this, s](auto dlg, auto ctrlId) { if (ctrlId) SetCtrlName(IDC_FOLDER, s->Get()); delete dlg; }); } else LgiMsg(this, "Couldn't load mail3 store.", AppName); break; } case IDOK: { Params.AllFolders = GetCtrlValue(IDC_ALL) != 0; Params.ExceptTrashSpam = GetCtrlValue(IDC_NO_SPAM_TRASH) != 0; Params.DestPath = GetCtrlName(IDC_FOLDER); Params.DestFolders = GetCtrlName(IDC_DEST); if (Lst) { Params.SrcPaths.Empty(); Params.SrcPaths.SetFixedLength(false); for (auto i: *Lst) Params.SrcPaths.Add(i->GetText()); } if (!Dst) Dst.LoadFolders(Params.DestFolders); // fall through } case IDCANCEL: { LVariant v; if (Lst) { LStringPipe p; int n=0; for (auto i : *Lst) { p.Print("%s%s", n ? (char*)":" : (char*) "", i->GetText(0)); } char *s = p.NewStr(); if (s) { App->GetOptions()->SetValue(OPT_ScribeExpSrcPaths, v = s); DeleteArray(s); } } App->GetOptions()->SetValue(OPT_ScribeExpDstPath, v = GetCtrlName(IDC_FOLDER)); App->GetOptions()->SetValue(OPT_ScribeExpAll, v = (int)GetCtrlValue(IDC_ALL)); App->GetOptions()->SetValue(OPT_ScribeExpExclude, v = (int)GetCtrlValue(IDC_NO_SPAM_TRASH)); App->GetOptions()->SetValue(OPT_ScribeExpFolders, v = GetCtrlName(IDC_DEST)); EndModal(c->GetId() == IDOK); } } return 0; } }; ScribeExportTask::ScribeExportTask(ScribeExportDlg *dlg) : - FolderTask(dlg->Dst.Root, LAutoPtr(NULL), NULL, NULL), + FolderTask(dlg->Dst.Root, LAutoPtr(NULL), LString(), NULL), Dst(dlg->Dst), SrcStore(dlg->SrcStore) { SetDescription("Initializing..."); SetType("Folders"); LAssert(SrcStore); Params = dlg->Params; if (Params.ExceptTrashSpam) { Spam = App->GetFolder("/Spam"); Trash = App->GetFolder(FOLDER_TRASH); } // Work out the folders we need to operate on: if (Params.AllFolders) CollectPaths(SrcStore->Root, InputPaths); else InputPaths = Params.SrcPaths; SetRange(InputPaths.Length()); // Kick off the processing... State = ExpGetNext; SetPulse(PULSE_MS); SetAlwaysOnTop(true); } LString ScribeExportTask::ContactKey(Contact *c) { LString p; const char *f = 0, *l = 0; auto e = c->GetAddrAt(0); c->Get(OPT_First, f); c->Get(OPT_Last, l); p.Printf("%s,%s,%s", e.Get(), f, l); return p; } #define ExportFolderStatus(b) \ { if (onStatus) onStatus(b); \ return; } bool ScribeExportTask::TimeSlice() { if (IsCancelled()) return false; switch (State) { case ExpGetNext: { if (InputPaths.Length() == 0) { State = ExpFinished; break; } // Load up the next SrcFolder... auto src = InputPaths[0]; InputPaths.DeleteAt(0, true); auto dst = MakePath(src); SrcFolder = App->GetFolder(src, SrcStore); if (!SrcFolder) { FolderLoadErrors++; return true; } DstStore = NULL; DstFolder = GetFolder(dst, SrcFolder->GetItemType()); if (!DstFolder) { return true; } State = ExpLoadFolders; SrcFolder->LoadThings(this, [this](auto status) { if (status == Store3Success) { // Load a list of things to process... SrcItems.Empty(); auto SrcObj = dynamic_cast(SrcFolder->GetObject()); if (SrcObj) { auto &c = SrcObj->Children(); for (auto t = c.First(); t; t = c.Next()) SrcItems.Add(t); } DstFolder->LoadThings(this, [this](auto status) { if (status == Store3Success) { State = ExpItems; SetDescription(SrcFolder->GetPath()); if (DstFolder->GetObject()) DstObj = dynamic_cast(DstFolder->GetObject()); else LAssert(!"No object?"); if (DstObj) DstStore = DstObj->GetStore(); else LAssert(!"No object?"); MakeDstObjMap(); } else State = ExpGetNext; }); } else { State = ExpGetNext; } }); break; } case ExpLoadFolders: { // No-op, but we should probably time out... break; } case ExpItems: { if (!SrcFolder || !DstFolder || !DstStore) { State = ExpGetNext; break; } auto Trans = DstStore->StartTransaction(); auto StartTs = LCurrentTime(); int Processed = 0; while ( SrcItems.Length() > 0 && LCurrentTime() - StartTs < WORK_SLICE_MS) { auto in = SrcItems[0]; SrcItems.DeleteAt(0); switch (in->Type()) { case MAGIC_MAIL: { auto Id = GetOrCreateMessageId(*in); if (!Id) OnError("%s:%i - Email %p has no MsgId\n", _FL, in) if (DstObjMap.Find(Id)) OnSkip() // Create new mail... auto outMail = DstStore->Create(MAGIC_MAIL); outMail->CopyProps(*in); // Now create all the attachments auto inSeg = dynamic_cast(in->GetObj(FIELD_MIME_SEG)); LDataI *outSeg = NULL; if (inSeg) { outSeg = DstStore->Create(MAGIC_ATTACHMENT); if (!outSeg) OnError("%s:%i - Failed to create attachment\n", _FL) else { outSeg->CopyProps(*inSeg); auto outMime = outSeg->GetStr(FIELD_MIME_TYPE); if (!outMime) { auto hdrs = outSeg->GetStr(FIELD_INTERNET_HEADER); if (!hdrs) { // This is going to cause an assert later outSeg->SetStr(FIELD_MIME_TYPE, sAppOctetStream); // LgiTrace("%s:%i - Setting default mime on %p\n", _FL, outSeg); } } if (outMail->SetObj(FIELD_MIME_SEG, outSeg) < Store3Delayed) OnError("%s:%i - Failed to attach seg to mail.\n", _FL) else { LString err; if (!CopyAttachments(outMail, outSeg, inSeg, err)) OnError("%s:%i - CopyAttachments failed\n", _FL) else OnCreate() } } } else OnCreate() outMail->Save(DstFolder->GetObject()); break; } default: { // Is the object already in the dst map? auto Id = ObjToId(*in); auto existing = DstObjMap.Find(Id); if (!CheckModified(in, existing)) OnSkip(); auto outObj = DstStore->Create(in->Type()); if (!outObj) { OnError("%s:%i - %s failed to create %s\n", _FL, DstStore->GetStr(FIELD_STORE_TYPE), Store3ItemTypeName((Store3ItemTypes)in->Type())) } if (!outObj->CopyProps(*in)) OnError("%s:%i - CopyProps failed.\n", _FL) if (outObj->Save(DstFolder->GetObject()) < Store3Delayed) OnError("%s:%i - Save failed\n", _FL) OnCreate(); break; } } Processed++; } if (SrcItems.Length() == 0) { SrcFolder = NULL; DstFolder = NULL; DstStore = NULL; State = ExpGetNext; (*this)++; // move progress... } // LgiTrace("Processed: %i\n", Processed); break; } case ExpFinished: { OnComplete(); State = ExpCleanup; return true; } case ExpCleanup: { if (Dst.IsDirty()) return true; // We're done... return false; } default: { LAssert(!"Not impl."); return false; } } return true; } // This should copy all the child objects of 'inSeg' to new child objects of 'outSeg' bool ScribeExportTask::CopyAttachments(LDataI *outMail, LDataPropI *outSeg, LDataPropI *inSeg, LString &err) { #define ERR(str) \ { err = str; return false; } if (!outMail || !outSeg || !inSeg) ERR("param error"); auto children = inSeg->GetList(FIELD_MIME_SEG); if (!children) return true; // Nothing to copy... for (auto i = children->First(); i; i = children->Next()) { auto inMime = i->GetStr(FIELD_MIME_TYPE); if (!inMime) continue; auto o = outMail->GetStore()->Create(MAGIC_ATTACHMENT); if (!o) ERR("couldn't create attachment"); if (!o->CopyProps(*i)) ERR("copy attachment properties failed"); auto outData = dynamic_cast(outSeg); if (!outData) ERR("outSeg isn't a LDataI object"); if (!o->Save(outData)) ERR("failed to save attachment to output mail"); if (!CopyAttachments(outMail, o, i, err)) return false; // but leave the error message untouched. } return true; } void ExportScribe(ScribeWnd *App, LMailStore *Store) { auto Dlg = new ScribeExportDlg(App, Store); Dlg->DoModal([Dlg, App](auto dlg, auto ctrlId) { if (ctrlId && Dlg->Dst) { new ScribeExportTask(Dlg); } delete dlg; }); } diff --git a/src/ScribeApp.cpp b/src/ScribeApp.cpp --- a/src/ScribeApp.cpp +++ b/src/ScribeApp.cpp @@ -1,13284 +1,13280 @@ /* ** FILE: ScribeApp.cpp ** AUTHOR: Matthew Allen ** DATE: 22/10/1998 ** DESCRIPTION: Scribe email application ** ** Copyright (C) 1998, Matthew Allen ** fret@memecode.com */ // Debug defines // #define PRINT_OUT_STORAGE_TREE // #define TEST_OBJECT_SIZE #define USE_SPELLCHECKER 1 #define USE_INTERNAL_BROWSER 1 // for help #define RUN_STARTUP_SCRIPTS 1 #define PROFILE_ON_PULSE 0 #define TRAY_CONTACT_BASE 1000 #define TRAY_MAIL_BASE 10000 // Includes #include #include #include #include #include #include "Scribe.h" #include "lgi/common/StoreConvert1To2.h" #include "lgi/common/ProgressDlg.h" #include "lgi/common/TextLabel.h" #include "lgi/common/Button.h" #include "lgi/common/CheckBox.h" #include "lgi/common/OpenSSLSocket.h" #include "lgi/common/SoftwareUpdate.h" #include "lgi/common/Html.h" #include "lgi/common/TextView3.h" #include "lgi/common/RichTextEdit.h" #include "lgi/common/Browser.h" #include "lgi/common/ClipBoard.h" #include "lgi/common/Store3.h" #include "lgi/common/Growl.h" #include "lgi/common/Edit.h" #include "lgi/common/Box.h" #include "lgi/common/LgiRes.h" #include "lgi/common/SpellCheck.h" #include "lgi/common/SubProcess.h" #include "lgi/common/CssTools.h" #include "lgi/common/Map.h" #include "lgi/common/Charset.h" #include "lgi/common/RefCount.h" #include "ScribePrivate.h" #include "PreviewPanel.h" #include "ScribeStatusPanel.h" #include "ScribeFolderDlg.h" #include "ScribePageSetup.h" #include "Calendar.h" #include "CalendarView.h" #include "ScribeSpellCheck.h" #include "Store3Common.h" #include "PrintContext.h" #include "resource.h" #include "ManageMailStores.h" #include "ReplicateDlg.h" #include "ScribeAccountPreview.h" #include "Encryption/GnuPG.h" #include "Store3Webdav/WebdavStore.h" #include "resdefs.h" #include "../unittests/UnitTest.h" #include "../src/common/Coding/ScriptingPriv.h" #define DEBUG_STORE_EVENTS 0 #if DEBUG_STORE_EVENTS #define LOG_STORE(...) LgiTrace(__VA_ARGS__) #else #define LOG_STORE(...) #endif #define IDM_LOAD_MSG 2000 #define RAISED_LOOK 0 #define SUNKEN_LOOK false #ifdef MAC #define SUNKEN_CTRL false #else #define SUNKEN_CTRL true #endif #if LGI_CARBON #define TRAY_ICON_NONE -1 #define TRAY_ICON_NORMAL -1 #define TRAY_ICON_MAIL 0 #define TRAY_ICON_ERROR 1 #elif defined(WIN32) #define TRAY_ICON_NORMAL 0 #define TRAY_ICON_ERROR 1 #define TRAY_ICON_MAIL 2 #define TRAY_ICON_NONE 3 #else #define TRAY_ICON_NONE -1 #define TRAY_ICON_NORMAL 0 #define TRAY_ICON_ERROR 1 #define TRAY_ICON_MAIL 2 #endif char ScribeThingList[] = "com.memecode.ThingList"; ScribeClipboardFmt *ScribeClipboardFmt::Alloc(bool ForFolders, size_t Size) { ScribeClipboardFmt *obj = (ScribeClipboardFmt*) calloc(sizeof(ScribeClipboardFmt)+((Size-1)*sizeof(Thing*)), 1); if (obj) { memcpy(obj->Magic, ForFolders ? ScribeFolderMagic : ScribeThingMagic, sizeof(obj->Magic)); obj->ProcessId = LAppInst->GetProcessId(); obj->Len = (uint32_t)Size; } return obj; } ScribeClipboardFmt *ScribeClipboardFmt::Alloc(List &Lst) { ScribeClipboardFmt *Fmt = Alloc(false, Lst.Length()); for (unsigned i=0; iThingAt(i, Lst[i]); return Fmt; } ScribeClipboardFmt *ScribeClipboardFmt::Alloc(LArray &Arr) { ScribeClipboardFmt *Fmt = Alloc(false, Arr.Length()); for (unsigned i=0; iThingAt(i, Arr[i]); return Fmt; } bool ScribeClipboardFmt::Is(const char *Type, void *Ptr, size_t Bytes) { // Do we have the minimum bytes for the structure? if (Bytes >= sizeof(ScribeClipboardFmt) && Ptr != NULL) { ScribeClipboardFmt *This = (ScribeClipboardFmt*)Ptr; // Check the magic is the right value if (memcmp(This->Magic, Type, 4) != 0) return false; // Check it's from this process if (This->ProcessId != LAppInst->GetProcessId()) return false; return true; } return false; } Thing *ScribeClipboardFmt::ThingAt(size_t Idx, Thing *Set) { if (memcmp(Magic, ScribeThingMagic, 4)) return NULL; if (Idx >= Len) return NULL; if (Set) Things[Idx] = Set; return Things[Idx]; } ScribeFolder *ScribeClipboardFmt::FolderAt(size_t Idx, ScribeFolder *Set) { if (memcmp(Magic, ScribeFolderMagic, 4)) return NULL; if (Idx >= Len) return NULL; if (Set) Folders[Idx] = Set; return Folders[Idx]; } size_t ScribeClipboardFmt::Sizeof() { return sizeof(*this) + ((Len - 1) * sizeof(Thing*)); } bool OptionSizeInKiB = false; bool ShowRelativeDates = false; const char *MailAddressDelimiters = "\t\r\n;,"; char16 SpellDelim[] = { ' ', '\t', '\r', '\n', ',', ',', '.', ':', ';', '{', '}', '[', ']', '!', '@', '#', '$', '%', '^', '&', '*', '(', ')', '_', '-', '+', '=', '|', '\\', '/', '?', '\"', 0 }; const char *DefaultRfXml = "---------- %s ----------\n" "%s: ()\n" "%s: ()\n" "%s: \n" "%s: \n" "\n" "\n" "\n" "\n"; uchar DateTimeFormats[] = { GDTF_DEFAULT, GDTF_DAY_MONTH_YEAR | GDTF_12HOUR, GDTF_MONTH_DAY_YEAR | GDTF_12HOUR, GDTF_YEAR_MONTH_DAY | GDTF_12HOUR, GDTF_DAY_MONTH_YEAR | GDTF_24HOUR, GDTF_MONTH_DAY_YEAR | GDTF_24HOUR, GDTF_YEAR_MONTH_DAY | GDTF_24HOUR }; SystemFolderInfo SystemFolders[] = { {FOLDER_INBOX, OPT_Inbox, NULL}, {FOLDER_OUTBOX, OPT_Outbox, NULL}, {FOLDER_SENT, OPT_Sent, NULL}, {FOLDER_CONTACTS, OPT_Contacts, NULL}, {FOLDER_TRASH, OPT_Trash, NULL}, {FOLDER_CALENDAR, OPT_Calendar, OPT_HasCalendar}, {FOLDER_TEMPLATES, OPT_Templates, OPT_HasTemplates}, {FOLDER_FILTERS, OPT_Filters, OPT_HasFilters}, {FOLDER_GROUPS, OPT_Groups, OPT_HasGroups}, {FOLDER_SPAM, OPT_SpamFolder, OPT_HasSpam}, {-1, 0, 0} }; ScribeBehaviour *ScribeBehaviour::New(ScribeWnd *app) { return 0; } void ScribeOptionsDefaults(LOptionsFile *f) { if (!f) return; f->CreateTag("Accounts"); f->CreateTag("CalendarUI"); f->CreateTag("CalendarUI.Sources"); f->CreateTag("MailUI"); f->CreateTag("ScribeUI"); f->CreateTag("Plugins"); f->CreateTag("Print"); #define DefaultIntOption(opt, def) { LVariant v; if (!f->GetValue(opt, v)) \ f->SetValue(opt, v = (int)def); } #define DefaultStrOption(opt, def) { LVariant v; if (!f->GetValue(opt, v)) \ f->SetValue(opt, v = def); } DefaultIntOption(OPT_DefaultAlternative, 1); DefaultIntOption(OPT_BoldUnread, 1); DefaultIntOption(OPT_PreviewLines, 1); DefaultIntOption(OPT_AutoDeleteExe, 1); DefaultIntOption(OPT_DefaultReplyAllSetting, MAIL_ADDR_BCC); DefaultIntOption(OPT_BlinkNewMail, 1); DefaultIntOption(OPT_MarkReadAfterSeconds, 5); DefaultStrOption(OPT_BayesThreshold, "0.9"); DefaultIntOption(OPT_SoftwareUpdate, 1); DefaultIntOption(OPT_ResizeImgAttachments, false); DefaultIntOption(OPT_ResizeJpegQual, 80); DefaultIntOption(OPT_ResizeMaxPx, 1024); DefaultIntOption(OPT_ResizeMaxKb, 200); DefaultIntOption(OPT_RegisterWindowsClient, 1); DefaultIntOption(OPT_HasTemplates, 0); DefaultIntOption(OPT_HasCalendar, 1); DefaultIntOption(OPT_HasGroups, 1); DefaultIntOption(OPT_HasFilters, 1); DefaultIntOption(OPT_HasSpam, 0); } const char *Store3ItemTypeName(Store3ItemTypes t) { switch (t) { case MAGIC_NONE: return "MAGIC_NONE"; case MAGIC_BASE: return "MAGIC_BASE"; case MAGIC_MAIL: return "MAGIC_MAIL"; case MAGIC_CONTACT: return "MAGIC_CONTACT"; // case MAGIC_FOLDER: return "MAGIC_FOLDER"; case MAGIC_MAILBOX: return "MAGIC_MAILBOX"; case MAGIC_ATTACHMENT: return "MAGIC_ATTACHMENT"; case MAGIC_ANY: return "MAGIC_ANY"; case MAGIC_FILTER: return "MAGIC_FILTER"; case MAGIC_FOLDER: return "MAGIC_FOLDER"; case MAGIC_CONDITION: return "MAGIC_CONDITION"; case MAGIC_ACTION: return "MAGIC_ACTION"; case MAGIC_CALENDAR: return "MAGIC_CALENDAR"; case MAGIC_ATTENDEE: return "MAGIC_ATTENDEE"; case MAGIC_GROUP: return "MAGIC_GROUP"; default: LAssert(0); break; } return "(error)"; } void SetRecipients(ScribeWnd *App, char *Start, LDataIt l, EmailAddressType CC) { while (Start && *Start) { LString Str; char *End = strchr(Start, ','); if (End) { Str.Set(Start, End-Start); Start = End + 1; } else { Str = Start; Start = 0; } if (Str) { ListAddr *a = new ListAddr(App); if (a) { a->CC = CC; if (_strnicmp(Str, "mailto:", 7) == 0) a->sAddr = Str(7,-1); else a->sAddr = Str; l->Insert(a); } } } } static char SoftwareUpdateUri[] = "http://www.memecode.com/update.php"; enum SoftwareStatus { SwError, SwCancel, SwOutOfDate, SwUpToDate }; static LString ExtractVer(const char *s) { char Buf[256], *Out = Buf; for (const char *In = s; *In && Out < Buf + sizeof(Buf) - 1; In++) { if (*In == ' ') break; if (IsDigit(*In) || *In == '.') *Out++ = *In; } *Out++ = 0; return LString(Buf); } void IsSoftwareUpToDate(ScribeWnd *Parent, bool WithUI, bool IncBetas, std::function callback) { // LSoftwareUpdate::UpdateInfo Info // Software update? auto Proxy = Parent->GetHttpProxy(); auto Update = new LSoftwareUpdate(AppName, SoftwareUpdateUri, Proxy); Update->CheckForUpdate( [WithUI, Parent, callback, Update](auto Info, auto errorMsg) { if (Info) { auto LocalVer = LString(ScribeVer).SplitDelimit("."); LString BuildVer = ExtractVer(Info->Build); auto OnlineVer = BuildVer.SplitDelimit("."); if (OnlineVer.Length() != LocalVer.Length()) { LgiTrace("%s:%i - Invalid online version number \"%s\"\n", _FL, Info->Version.Get()); if(callback) callback(SwError, Info); return; } unsigned i; for(i = 0; i < OnlineVer.Length(); i++) { auto l = Atoi(LocalVer[i].Get()); auto o = Atoi(OnlineVer[i].Get()); if(l < o) { if(callback) callback(SwOutOfDate, Info); return; } if(l > o) { if(callback) callback(SwUpToDate, Info); return; } } LDateTime Compile; auto Date = LString(__DATE__).SplitDelimit(" "); Compile.Month(LDateTime::MonthFromName(Date[0])); Compile.Day(atoi(Date[1])); Compile.Year(atoi(Date[2])); Compile.SetTime(__TIME__); bool DateGreaterThenCompile = Info->Date > Compile; if (callback) callback(DateGreaterThenCompile ? SwOutOfDate : SwUpToDate, Info); return; } else if (WithUI) { if (callback) callback(SwCancel, NULL); LgiMsg(Parent, LLoadString(IDS_ERROR_SOFTWARE_UPDATE), AppName, MB_OK, errorMsg); } if (callback) callback(SwError, NULL); }, WithUI ? Parent : NULL, IncBetas); } bool UpgradeSoftware(const LSoftwareUpdate::UpdateInfo *Info, ScribeWnd *Parent, bool WithUI) { bool DownloadUpdate = true; if (WithUI) { char Ds[64]; Info->Date.Get(Ds, sizeof(Ds)); DownloadUpdate = LgiMsg(Parent, LLoadString(IDS_SOFTWARE_UPDATE_DOWNLOAD), AppName, MB_YESNO, Info->Build.Get(), Info->Uri.Get(), Ds) == IDYES; } if (!DownloadUpdate) return false; LAutoString Proxy = Parent->GetHttpProxy(); LSoftwareUpdate Update(AppName, SoftwareUpdateUri, Proxy, ScribeTempPath()); // FIXME: return false; // Update.ApplyUpdate(Info, false, Parent); } void SoftwareUpdate(ScribeWnd *Parent, bool WithUI, bool IncBetas, std::function callback) { // Software update? IsSoftwareUpToDate(Parent, WithUI, IncBetas, [WithUI, Parent, callback](auto s, auto Info) { if (s == SwUpToDate) { if (WithUI) LgiMsg(Parent, LLoadString(IDS_SOFTWARE_CURRENT), AppName, MB_OK); if (callback) callback(false); // we're up to date } else if (s == SwOutOfDate) { auto status = UpgradeSoftware(Info, Parent, WithUI); if (callback) callback(status); // update is going to happen } }); } const char *AppName = "Scribe"; char HelpFile[] = "index.html"; const char OptionsFileName[] = "ScribeOptions"; const char AuthorEmailAddr[] = "fret@memecode.com"; const char AuthorHomepage[] = "http://www.memecode.com"; const char ApplicationHomepage[] = "http://www.memecode.com/scribe.php"; const char CommercialHomepage[] = "http://www.memecode.com/inscribe.php"; const char FaqHomepage[] = "http://www.memecode.com/scribe/faq.php"; const char *DefaultFolderNames[16]; Store3ItemTypes DefaultFolderTypes[] = { MAGIC_MAIL, // Inbox MAGIC_MAIL, // Outbox MAGIC_MAIL, // Sent MAGIC_ANY, // Trash MAGIC_CONTACT, // Contacts MAGIC_MAIL, // Templates MAGIC_FILTER, // Filters MAGIC_CALENDAR, // Calendar Events MAGIC_GROUP, // Groups MAGIC_MAIL, // Spam MAGIC_NONE, MAGIC_NONE, MAGIC_NONE, MAGIC_NONE }; extern void Log(char *File, char *Str, ...); ////////////////////////////////////////////////////////////////////////////// void LogMsg(char *str, ...) { #ifdef _DEBUG char f[256]; LMakePath(f, sizeof(f), LGetExePath(), "log.txt"); if (str) { char buffer[256]; va_list arg; va_start(arg ,str); vsprintf_s(buffer, sizeof(buffer), str, arg); va_end(arg); LFile File; while (!File.Open(f, O_WRITE)) { LSleep(5); } File.Seek(File.GetSize(), SEEK_SET); File.Write(buffer, strlen(buffer)); } else { FileDev->Delete(f, false); } #endif } LString GetFullAppName(bool Platform) { LString Ret = AppName; if (Platform) { LString s; const char *Build = #ifndef _DEBUG "Release"; #else "Debug"; #endif LArray Ver; int Os = LGetOs(&Ver); const char *OsName = LGetOsName(); if (Os == LGI_OS_WIN9X) { switch (Ver[1]) { case 0: OsName = "Win95"; break; case 10: OsName = "Win98"; break; case 90: OsName = "WinME"; break; } } else if (Os == LGI_OS_WIN32 || Os == LGI_OS_WIN64) { if (Ver[0] < 5) { OsName = "WinNT"; } else if (Ver[0] == 5) { if (Ver[1] == 0) OsName = "Win2k"; else OsName = "WinXP"; } else if (Ver[0] == 6) { if (Ver[1] == 0) OsName = "Vista"; else if (Ver[1] == 1) OsName = "Win7"; else if (Ver[1] == 2) OsName = "Win8"; else if (Ver[1] == 3) OsName = "Win8.1"; } else if (Ver[0] == 10) { OsName = "Win10"; } else if (Ver[0] == 11) { // What's the chances eh? OsName = "Win11"; } } s.Printf(" v%s (%s v", ScribeVer, OsName); Ret += s; for (unsigned i=0; iId); Ret += s; } s.Printf(")"); Ret += s; } return Ret; } bool MatchWord(char *Str, char *Word) { bool Status = false; if (Str && Word) { #define IsWord(c) ( IsDigit(c) || IsAlpha(c) ) for (char *s=stristr(Str, Word); s; s=stristr(s+1, Word)) { char *e = s + strlen(Word); if ( (s<=Str || !IsWord(s[-1]) ) && (e[0] == 0 || !IsWord(e[0])) ) { return true; } } } return Status; } ////////////////////////////////////////////////////////////////////////////// ScribePanel::ScribePanel(ScribeWnd *app, const char *name, int size, bool open) : LPanel(name, size, open) { App = app; } bool ScribePanel::Pour(LRegion &r) { if (App) { SetClosedSize(App->GetToolbarHeight()); } return LPanel::Pour(r); } ////////////////////////////////////////////////////////////////////////////// class NoContactType : public Contact { LString NoFace80Path; LString NoFace160Path; public: NoContactType(ScribeWnd *wnd) : Contact(wnd) { } Thing &operator =(Thing &c) override { return *this; } bool GetVariant(const char *Name, LVariant &Value, const char *Array) override { ScribeDomType Fld = StrToDom(Name); int Px = Array ? atoi(Array) : 80; LString &Str = Px == 160 ? NoFace160Path : NoFace80Path; if (!Str) { LString f; f.Printf("NoFace%i.png", Px); Str = LFindFile(f); LAssert(Str != NULL); // This should always resolve. } if (!Str) return false; if (Fld == SdImageHtml) { LString html; html.Printf("\n", Str.Get()); Value = html; return true; } else if (Fld == SdImage) { Value = Str; return true; } return false; } }; class ScribeWndPrivate : public LBrowser::LBrowserEvents, public LVmCallback, public LHtmlStaticInst { LOptionsFile::PortableType InstallMode = LOptionsFile::UnknownMode; public: ScribeWnd *App; uint64 LastTs = 0; int ClipboardFormat = 0; LFont *PreviewFont = NULL; int PrintMaxPages = -1; int NewMailTimeout = -1; bool SendAfterReceive = false; bool IngoreOnClose = false; LAutoString UiTags; LAutoPtr Growl; LArray TrayMenuContacts; bool ExitAfterSend = false; LToolButton *ShowConsoleBtn = NULL; LString MulPassword; LString CalendarSummary; LBox *SubSplit = NULL, *SearchSplit = NULL; LArray ThingSources; int LastLayout = 0; LMenuItem *DisableUserFilters = NULL; LAutoPtr Options; HttpImageThread *ImageLoader = NULL; int LastMinute = -1, LastHour = -1; LArray Store3EventCallbacks; LAutoPtr PrintOptions; LHashTbl, LString> ResFiles; // These are for the LDataEventsI callbacks to store source context // Mainly for debugging where various events came from. const char *CtxFile = NULL; int CtxLine = 0; // Contact no face images LAutoRefPtr NoContact; // Remote content white/blacklists bool RemoteContent_Init = false; LString::Array RemoteWhiteLst, RemoteBlackLst; // Spell checking int AppWndHnd; LAutoPtr SpellerThread; // Missing caps LCapabilityTarget::CapsHash MissingCaps; MissingCapsBar *Bar = NULL; LString ErrSource; // Script file that has an error. Filter *ErrFilter = NULL; // Filter that has scripting error. // Load state bool FoldersLoaded = false; // Bayesian filter LStringPipe BayesLog; // Thread item processing LArray Transfers; // Scripting... LAutoPtr Engine; LArray Scripts; LArray CurrentScripts; LScript *CurrentScript() { return CurrentScripts.Length() ? CurrentScripts.Last() : NULL; } int NextToolMenuId = IDM_TOOL_SCRIPT_BASE; LAutoPtr ScriptToolbar; LArray OnSecondTimerCallbacks; // Encryption LAutoPtr GpgInst; // Unit tests LAutoPtr UnitTestServer; class ScribeTextControlFactory : public LViewFactory { ScribeWnd *Wnd; LView *NewView(const char *Class, LRect *Pos, const char *Text) { if (!_stricmp(Class, "ScribeTextView")) return Wnd->CreateTextControl(-1, 0, true); return NULL; } public: ScribeTextControlFactory(ScribeWnd *wnd) { Wnd = wnd; } } TextControlFactory; ScribeWndPrivate(ScribeWnd *app) : App(app), TextControlFactory(app) { NoContact = new NoContactType(app); NoContact->DecRef(); // 2->1 AppWndHnd = LEventSinkMap::Dispatch.AddSink(App); #ifdef WIN32 ClipboardFormat = RegisterClipboardFormat( #ifdef UNICODE L"Scribe.Item" #else "Scribe.Item" #endif ); #endif LScribeScript::Inst = new LScribeScript(App); if (Engine.Reset(new LScriptEngine(App, LScribeScript::Inst, this))) Engine->SetConsole(LScribeScript::Inst->GetLog()); } ~ScribeWndPrivate() { // Why do we need this? ~LView will take care of it? // LEventSinkMap::Dispatch.RemoveSink(App); Options.Reset(); Scripts.DeleteObjects(); DeleteObj(ImageLoader); Engine.Reset(); DeleteObj(LScribeScript::Inst); } LGrowl *GetGrowl() { if (!Growl && Growl.Reset(new LGrowl)) { LAutoPtr r(new LGrowl::LRegister); r->App = "Scribe"; r->IconUrl = "http://memecode.com/images/scribe/growl-app.png"; LGrowl::LNotifyType &NewMail = r->Types.New(); NewMail.Name = "new-mail"; NewMail.IconUrl = "http://memecode.com/images/scribe/growl-new-mail.png"; NewMail.Enabled = true; LGrowl::LNotifyType &Cal = r->Types.New(); Cal.Name = "calendar"; Cal.IconUrl = "http://memecode.com/images/scribe/growl-calendar.png"; Cal.Enabled = true; LGrowl::LNotifyType &Debug = r->Types.New(); Debug.Name = "debug"; Debug.IconUrl = "http://memecode.com/images/scribe/growl-bug.png"; Debug.Enabled = false; LGrowl::LNotifyType &Info = r->Types.New(); Info.IconUrl = "http://memecode.com/images/scribe/growl-note.png"; Info.Name = "info"; Info.Enabled = true; Growl->Register(r); } return Growl; } LVmDebugger *AttachVm(LVirtualMachine *OriginalVm, LCompiledCode *Code, const char *Assembly) { if (!OriginalVm || !Code) return NULL; LVariant v; if (Options) Options->GetValue(OPT_ScriptDebugger, v); if (!v.CastInt32()) return NULL; LAutoPtr CopiedVm(new LVirtualMachine(OriginalVm)); LAutoPtr CopiedCode(new LCompiledCode(*Code)); return new LVmDebuggerWnd(App, this, CopiedVm, CopiedCode, Assembly); } bool CallCallback(LVirtualMachine &Vm, LString CallbackName, LScriptArguments &Args) { for (auto s: Scripts) { if (!s->Code) continue; auto Method = s->Code->GetMethod(CallbackName); if (!Method) continue; auto Status = Vm.ExecuteFunction(s->Code, Method, Args); return Status > ScriptError; } Vm.SetDebuggerEnabled(true); // Lets show the UI when we throw the callback not found error. Args.Throw(_FL, "There is no function '%s' for callback.", CallbackName.Get()); return false; } bool CompileScript(LAutoPtr &Output, const char *FileName, const char *Source) { LCompiler c; return c.Compile(Output, Engine->GetSystemContext(), LScribeScript::Inst, FileName, Source, NULL); } bool OnSearch(LBrowser *br, const char *txt) { char Path[256]; if (!App->GetHelpFilesPath(Path, sizeof(Path))) return false; auto Terms = LString(txt).SplitDelimit(", "); LStringPipe p; p.Print("\nSearch Results\n\n"); LDirectory Dir; for (int b = Dir.First(Path, "*.html"); b; b = Dir.Next()) { if (!Dir.IsDir()) { char Path[256]; Dir.Path(Path, sizeof(Path)); LFile f; if (f.Open(Path, O_READ)) { LXmlTree t(GXT_NO_DOM); LXmlTag r; if (t.Read(&r, &f)) { char *PrevName = 0; char PrevUri[256] = ""; for (auto c: r.Children) { if (c->IsTag("a")) { char *Name = c->GetAttr("name"); if (Name) { PrevName = Name; } } else if (c->GetContent()) { bool Hit = false; for (unsigned i=0; !Hit && iGetContent(), Terms[i]) != 0; } if (Hit) { LStringPipe Uri(256); char *Leaf = strrchr(Path, DIR_CHAR); Leaf = Leaf ? Leaf + 1 : Path; Uri.Print("file://%s", Path); if (PrevName) Uri.Print("#%s", PrevName); LAutoString UriStr(Uri.NewStr()); if (_stricmp(UriStr, PrevUri)) { p.Print(" %s", UriStr.Get(), Leaf); if (PrevName) p.Print("#%s", PrevName); p.Print("\n"); strcpy_s(PrevUri, sizeof(PrevUri), UriStr); } } } } } } } } p.Print("\n\n\n"); LAutoString Html(p.NewStr()); br->SetHtml(Html); return true; } void AskUserForInstallMode(std::function callback) { auto Dlg = new LAlert(App, AppName, LLoadString(IDS_PORTABLE_Q), LLoadString(IDS_HELP), LLoadString(IDS_DESKTOP), LLoadString(IDS_PORTABLE)); Dlg->SetButtonCallback(1, [this](auto idx) { App->LaunchHelp("install.html"); }); Dlg->DoModal([callback](auto dlg, auto Btn) { if (Btn == 1) { // Help LAssert(!"Help btn should use callback."); } else if (Btn == 2) { // Desktop if (callback) callback(LOptionsFile::DesktopMode); } else if (Btn == 3) { // Portable if (callback) callback(LOptionsFile::PortableMode); } else { delete dlg; LAppInst->Exit(1); } delete dlg; }); } LOptionsFile::PortableType GetInstallMode() { if (InstallMode == LOptionsFile::UnknownMode) { if (LAppInst->GetOption("portable")) { InstallMode = LOptionsFile::PortableMode; LgiTrace("Selecting portable mode based on -portable switch.\n"); } else if (LAppInst->GetOption("desktop")) { InstallMode = LOptionsFile::DesktopMode; LgiTrace("Selecting portable mode based on -desktop switch.\n"); } } if (InstallMode == LOptionsFile::UnknownMode) { bool PortableIsPossible = true; char Inst[MAX_PATH_LEN] = ""; LGetSystemPath(LSP_APP_INSTALL, Inst, sizeof(Inst)); // Do write check char Wr[MAX_PATH_LEN]; LMakePath(Wr, sizeof(Wr), Inst, "_write_test.txt"); LFile f; if (f.Open(Wr, O_WRITE)) { // Clean up f.Close(); FileDev->Delete(Wr, false); } else { // No write perms PortableIsPossible = false; } if (PortableIsPossible && LAppInst->IsElevated()) { // Check if the install is in some read only location: // e.g. c:\Program Files char Pm[MAX_PATH_LEN]; if (LGetSystemPath(LSP_USER_APPS, Pm, sizeof(Pm))) { size_t n = strlen(Pm); PortableIsPossible = _strnicmp(Pm, Inst, n) != 0; // LgiMsg(App, "%i\n%s\n%s", AppName, MB_OK, PortableIsPossible, Pm, Inst); } else LgiTrace("%s:%i - Failed to get paths.", _FL); } if (PortableIsPossible) { // Basically "ask the user" here... return LOptionsFile::UnknownMode; } else { InstallMode = LOptionsFile::DesktopMode; LgiTrace("Selecting Desktop based on lack of write permissions to install folder.\n"); } } return InstallMode; } void SetInstallMode(LOptionsFile::PortableType t) { InstallMode = t; } void DeleteCallbacks(LArray &Callbacks) { for (unsigned i=0; iGetMenu()->FindItem(Callbacks[i].Param); if (it) { it->Remove(); DeleteObj(it); } } } } }; ////////////////////////////////////////////////////////////////////////////// void UpgradeRfOption(ScribeWnd *App, const char *New, const char *Old, const char *Default) { LVariant v; /* App->GetOptions()->GetValue(New, v); if (v.Str()) { ScribePath *Path = new ScribePath(App, Old); if (Path) { char *Xml = LReadTextFile(*Path); if (Xml) { App->GetOptions()->SetValue(New, v = Xml); DeleteArray(Xml); } App->GetOptions()->DeleteValue(Old); DeleteObj(Path); } } */ if (Default && !App->GetOptions()->GetValue(New, v)) { App->GetOptions()->SetValue(New, v = Default); } } //////////////////////////////////////////////////////////////////////////// ScribeWnd::AppState ScribeWnd::ScribeState = ScribeConstructing; /* * This constructor is a little convoluted, but the basic idea is this: * * - Do some basic init. * - Attempt to load the options (could make portable/desktop mode clear) * - If the portable/desktop mode is unclear ask the user. * - Call AppConstruct1. * - If the UI language is not known, ask the user. * - Call AppConstruct2. * * Each time a dialog is needed the rest of the code needs to be in a callable function. * * It's important to note that the ScribeWnd::OnCreate method needs to be called after * the system Handle() is created, and after any dialogs in the ScribeWnd::ScribeWnd * constructor have finished. */ ScribeWnd::ScribeWnd() : BayesianFilter(this), CapabilityInstaller("Scribe", ScribeVer, "http://memecode.com/components/lookup.php", ScribeTempPath()), TrayIcon(this) { if (_Lock) _Lock->SetName("ScribeWnd"); // init some variables LApp::ObjInstance()->AppWnd = this; LCharsetSystem::Inst()->DetectCharset = ::DetectCharset; d = new ScribeWndPrivate(this); ScribeIpc = new LSharedMemory("Scribe", SCRIBE_INSTANCE_MAX * sizeof(ScribeIpcInstance)); if (ScribeIpc && ScribeIpc->GetPtr()) { ScribeIpcInstance *InstLst = (ScribeIpcInstance*) ScribeIpc->GetPtr(); for (int i=0; iMagic = SCRIBE_INSTANCE_MAGIC; ThisInst->Pid = LProcessId(); // LgiTrace("Install Scribe pid=%i to pos=%i\n", LProcessId(), i); } } } else DeleteObj(ScribeIpc); #ifndef WIN32 printf("%s\n", GetFullAppName(true).Get()); #endif auto Type = d->GetInstallMode(); if (Type == LOptionsFile::UnknownMode) { // This may make the mode more clear... if (LoadOptions()) Type = d->GetInstallMode(); } if (Type == LOptionsFile::UnknownMode) { d->AskUserForInstallMode([this](auto selectedMode) { d->SetInstallMode(selectedMode); if (!d->Options) d->Options.Reset(new LOptionsFile(selectedMode, OptionsFileName)); Construct1(); }); } else Construct1(); } void ScribeWnd::Construct1() { if (!d->Options && !LoadOptions()) { ScribeState = ScribeExiting; return; } ScribeOptionsDefaults(d->Options); LVariant GlyphSub; if (GetOptions()->GetValue(OPT_GlyphSub, GlyphSub)) { bool UseGlyphSub = GlyphSub.CastInt32() != 0; LSysFont->SubGlyphs(UseGlyphSub); LSysBold->SubGlyphs(UseGlyphSub); LFontSystem::Inst()->SetDefaultGlyphSub(UseGlyphSub); } else { GetOptions()->SetValue(OPT_GlyphSub, GlyphSub = LFontSystem::Inst()->GetDefaultGlyphSub()); } { // Limit the size of the 'Scribe.txt' log file if (auto p = LgiTraceGetFilePath()) { int64 Sz = LFileSize(p); #define MiB * 1024 * 1024 if (Sz > (3 MiB)) FileDev->Delete(p); } } // Process pre-UI options LVariant SizeAdj; int SzAdj = SizeAdj.CastInt32(); if (GetOptions()->GetValue(OPT_UiFontSize, SizeAdj) && (SzAdj = SizeAdj.CastInt32()) >= 0 && SzAdj < 5) { SzAdj -= 2; if (SzAdj) { int Pt = LSysFont->PointSize(); LSysFont->PointSize(Pt + SzAdj); LSysFont->Create(); LSysBold->PointSize(Pt + SzAdj); LSysBold->Create(); LFont *m = LMenu::GetFont(); if (m) { m->PointSize(m->PointSize() + SzAdj); m->Create(); } } } else { GetOptions()->SetValue(OPT_UiFontSize, SizeAdj = 2); } // Resources and languages SetLanguage(); // If no language set... LVariant LangId; if (!GetOptions()->GetValue(OPT_UiLanguage, LangId)) { // Ask the user... auto Dlg = new LanguageDlg(this); if (!Dlg->Ok) { delete Dlg; LgiMsg(this, "Failed to create language selection dialog.", "Scribe Error"); ScribeState = ScribeExiting; LCloseApp(); } else { Dlg->DoModal([this, Dlg](auto dlg, auto id) { if (id) { // Set the language in the options file LVariant v; GetOptions()->SetValue(OPT_UiLanguage, v = Dlg->Lang.Get()); // Reload the resource file... to get the new lang. LResources *Cur = LgiGetResObj(false); DeleteObj(Cur); SetLanguage(); Construct2(); } else // User canceled { ScribeState = ScribeExiting; LCloseApp(); } delete dlg; }); } } else Construct2(); } void ScribeWnd::Construct2() { #if 1 auto CurRes = LgiGetResObj(false); LVariant Theme; if (CurRes && GetOptions()->GetValue(OPT_Theme, Theme)) { auto Paths = ScribeThemePaths(); auto NoTheme = LLoadString(IDS_DEFAULT); if (Theme.Str() && Stricmp(NoTheme, Theme.Str())) { for (auto p: Paths) { LFile::Path Inst(p); Inst += Theme.Str(); if (Inst.Exists()) { CurRes->SetThemeFolder(Inst); d->Static->OnSystemColourChange(); break; } } } } #endif LoadCalendarStringTable(); ZeroObj(DefaultFolderNames); DefaultFolderNames[FOLDER_INBOX] = LLoadString(IDS_FOLDER_INBOX, "Inbox"); DefaultFolderNames[FOLDER_OUTBOX] = LLoadString(IDS_FOLDER_OUTBOX, "Outbox"); DefaultFolderNames[FOLDER_SENT] = LLoadString(IDS_FOLDER_SENT, "Sent"); DefaultFolderNames[FOLDER_TRASH] = LLoadString(IDS_FOLDER_TRASH, "Trash"); DefaultFolderNames[FOLDER_CONTACTS] = LLoadString(IDS_FOLDER_CONTACTS, "Contacts"); DefaultFolderNames[FOLDER_TEMPLATES] = LLoadString(IDS_FOLDER_TEMPLATES, "Templates"); DefaultFolderNames[FOLDER_FILTERS] = LLoadString(IDS_FOLDER_FILTERS, "Filters"); DefaultFolderNames[FOLDER_CALENDAR] = LLoadString(IDS_FOLDER_CALENDAR, "Calendar"); DefaultFolderNames[FOLDER_GROUPS] = LLoadString(IDS_FOLDER_GROUPS, "Groups"); DefaultFolderNames[FOLDER_SPAM] = LLoadString(IDS_SPAM, "Spam"); LStringPipe RfXml; RfXml.Print(DefaultRfXml, LLoadString(IDS_ORIGINAL_MESSAGE), LLoadString(FIELD_TO), LLoadString(FIELD_FROM), LLoadString(FIELD_SUBJECT), LLoadString(IDS_DATE)); { LAutoString Xml(RfXml.NewStr()); UpgradeRfOption(this, OPT_TextReplyFormat, "ReplyXml", Xml); UpgradeRfOption(this, OPT_TextForwardFormat, "ForwardXml", Xml); } LFontType t; if (t.GetSystemFont("small")) { d->PreviewFont = t.Create(); if (d->PreviewFont) { #if defined WIN32 d->PreviewFont->PointSize(8); #endif } } MoveOnScreen(); // Load global graphics LoadImageResources(); // Load time threads // Window name Name(AppName); SetSnapToEdge(true); ClearTempPath(); #if WINNATIVE SetStyle(GetStyle() & ~WS_VISIBLE); SetExStyle(GetExStyle() & ~WS_EX_ACCEPTFILES); CreateClassW32(AppName, LoadIcon(LProcessInst(), MAKEINTRESOURCE(IDI_APP))); #endif #if defined LINUX SetIcon("About64px.png"); LFinishXWindowsStartup(this); #endif ScribeState = ScribeConstructed; OnCreate(); } void ScribeWnd::Construct3() { if (ScribeState == ScribeConstructing) { // Constructor is still running, probably showing some UI. // Don't complete setup at this point. return; } // Load the styles LResources::StyleElement(this); // Main menu Menu = new LMenu(AppName); if (Menu) { Menu->Attach(this); if (Menu->Load(this, "ID_MENU", GetUiTags())) { LAssert(ImageList != NULL); Menu->SetImageList(ImageList, false); auto IdentityItem = Menu->FindItem(IDM_NO_IDENTITIES); if (IdentityItem) { IdentityMenu = IdentityItem->GetParent(); } CmdSend.MenuItem = Menu->FindItem(IDM_SEND_MAIL); auto NewMailMenu = Menu->FindItem(IDM_NEW_EMAIL); if (NewMailMenu) { MailMenu = NewMailMenu->GetParent(); } LVariant v; WorkOffline = Menu->FindItem(IDM_WORK_OFFLINE); if (WorkOffline && GetOptions()->GetValue(OPT_WorkOffline, v)) { WorkOffline->Checked(v.CastInt32() != 0); } if ((d->DisableUserFilters = Menu->FindItem(IDM_FILTERS_DISABLE))) { if (GetOptions()->GetValue(OPT_DisableUserFilters, v)) { d->DisableUserFilters->Checked(v.CastInt32() != 0); } } #if RUN_STARTUP_SCRIPTS // Run scripts in './Scripts' folder char s[MAX_PATH_LEN]; LMakePath(s, sizeof(s), ScribeResourcePath(), "scripts"); if (!LDirExists(s)) LMakePath(s, sizeof(s), LGetSystemPath(LSP_APP_INSTALL), #if defined(LINUX) || defined(WINDOWS) "..\\" #endif "scripts"); if (!LDirExists(s)) LgiTrace("%s:%i - Error: the scripts folder '%s' doesn't exist.\n", _FL, s); else { bool ErrorDsp = false; LDirectory Dir; for (int b = Dir.First(s); b; b = Dir.Next()) { if (Dir.IsDir()) continue; char *Ext = LGetExtension(Dir.GetName()); if (!Ext || _stricmp(Ext, "script") != 0) continue; Dir.Path(s, sizeof(s)); LStringPipe Log; char *Source = LReadTextFile(s); if (Source) { LScript *Cur = new LScript; if (Cur) { char Msg[256]; d->CurrentScripts.Add(Cur); LScribeScript::Inst->GetLog()->Write(Msg, sprintf_s(Msg, sizeof(Msg), "Compiling '%s'...\n", Dir.GetName())); LCompiler c; if (c.Compile( Cur->Code, d->Engine->GetSystemContext(), LScribeScript::Inst, s, Source, NULL)) { LFunctionInfo *Main = Cur->Code->GetMethod("Main"); if (Main) { LVirtualMachine Vm(d); LScriptArguments Args(&Vm); Args.New() = new LVariant((LDom*)this); d->Scripts.Add(Cur); if (Vm.ExecuteFunction( Cur->Code, Main, Args, LScribeScript::Inst->GetLog()) && Args.GetReturn()->CastInt32()) { d->CurrentScripts.Delete(Cur, true); Cur = NULL; } else { LgiTrace("Error: Script's main failed (%s)\n", Cur->Code->GetFileName()); if (Cur->Callbacks.Length()) d->DeleteCallbacks(Cur->Callbacks); d->Scripts.Delete(Cur); } Args.DeleteObjects(); } } else if (!ErrorDsp) { ErrorDsp = true; OnScriptCompileError(Source, NULL); } if (Cur) { d->CurrentScripts.Delete(Cur, true); DeleteObj(Cur); } } DeleteArray(Source); } } } #endif #define EnableItem(id, en) { auto i = Menu->FindItem(id); if (i) i->Enabled(en); } #define SetMenuIcon(id, ico) { auto i = Menu->FindItem(id); if (i) i->Icon(ico); } EnableItem(IDM_IMPORT_OUTLOOK_ITEMS, true); // SetMenuIcon(IDM_OPEN_FOLDERS, ICON_OPEN_FOLDER); SetMenuIcon(IDM_OPTIONS, ICON_OPTIONS); SetMenuIcon(IDM_SECURITY, ICON_LOCK); SetMenuIcon(IDM_CUT, ICON_CUT); SetMenuIcon(IDM_COPY, ICON_COPY); SetMenuIcon(IDM_PASTE, ICON_PASTE); SetMenuIcon(IDM_LAYOUT1, ICON_LAYOUT1); SetMenuIcon(IDM_LAYOUT2, ICON_LAYOUT2); SetMenuIcon(IDM_LAYOUT3, ICON_LAYOUT3); SetMenuIcon(IDM_LAYOUT4, ICON_LAYOUT4); SetMenuIcon(IDM_NEW_EMAIL, ICON_UNSENT_MAIL); SetMenuIcon(IDM_SET_READ, ICON_READ_MAIL); SetMenuIcon(IDM_SET_UNREAD, ICON_UNREAD_MAIL); SetMenuIcon(IDM_NEW_CONTACT, ICON_CONTACT); SetMenuIcon(IDM_NEW_GROUP, ICON_CONTACT_GROUP); SetMenuIcon(IDM_REPLY, ICON_FLAGS_REPLY); SetMenuIcon(IDM_REPLY_ALL, ICON_FLAGS_REPLY); SetMenuIcon(IDM_FORWARD, ICON_FLAGS_FORWARD); SetMenuIcon(IDM_BOUNCE, ICON_FLAGS_BOUNCE); SetMenuIcon(IDM_NEW_FILTER, ICON_FILTER); SetMenuIcon(IDM_FILTER_CURRENT_FOLDER, ICON_FOLDER_FILTERS); SetMenuIcon(IDM_MEMECODE, ICON_LINK); SetMenuIcon(IDM_HOMEPAGE, ICON_LINK); SetMenuIcon(IDM_SCRIBE_FAQ, ICON_LINK); SetMenuIcon(IDM_INSCRIBE_LINK, ICON_LINK); SetMenuIcon(IDM_VERSION_HISTORY, ICON_LINK); SetMenuIcon(IDM_DEBUG_INFO, ICON_LINK); SetMenuIcon(IDM_TUTORIALS, ICON_LINK); SetMenuIcon(IDM_FEEDBACK, ICON_UNREAD_MAIL); SetMenuIcon(IDM_HELP, ICON_HELP); LMenuItem *mi; if ( GetOptions()->GetValue(OPT_EditControl, v) && (mi = Menu->FindItem(IDM_HTML_EDITOR)) ) mi->Checked(v.CastInt32() != 0); Menu->SetPrefAndAboutItems(IDM_OPTIONS, IDM_ABOUT); } } // Initialize user interface SetupUi(); // Get some of the base submenu pointers. These are needed // for SetupAccounts to work correctly, e.g. populate the // send/receive/preview submenus. Folders need to be loaded // before this for the templates folder BuildDynMenus(); // Load accounts SetupAccounts(); // Recursively load folder tree LoadFolders([this](auto status) { // Redo it for the templates... now that load folders has completed. BuildDynMenus(); if (ScribeState == ScribeExiting) return; // Process command line OnCommandLine(); // Update the templates sub-menu now that the folders are loaded BuildDynMenus(); // Check registry settings SetDefaultHandler(); // Run on load scripts... LArray OnLoadCallbacks; if (GetScriptCallbacks(LOnLoad, OnLoadCallbacks)) { for (auto r: OnLoadCallbacks) { LVirtualMachine Vm; LScriptArguments Args(&Vm); Args.New() = new LVariant(this); ExecuteScriptCallback(*r, Args); Args.DeleteObjects(); } } ScribeState = ScribeRunning; }); } void ScribeWnd::SetLanguage() { LVariant LangId; if (GetOptions()->GetValue(OPT_UiLanguage, LangId)) { // Set the language to load... LAppInst->SetConfig("Language", LangId.Str()); } LResources::SetLoadStyles(true); // Load the resources (with the current lang) if (!LgiGetResObj(true, "Scribe")) { LgiMsg(NULL, "The resource file 'Scribe.lr8' is missing.", AppName); ScribeState = ScribeExiting; LCloseApp(); } } ScribeWnd::~ScribeWnd() { LAppInst->AppWnd = 0; SearchView = NULL; ScribeState = ScribeExiting; LScribeScript::Inst->ShowScriptingWindow(false); // Other cleanup... ClearTempPath(); ShutdownIpc(); SetPulse(); // Save anything thats still dirty in the folders... // just in case we crash during the shutdown phase. ScribeFolder *Cur = GetCurrentFolder(); if (Cur) Cur->SerializeFieldWidths(); SaveDirtyObjects(5000); // Tell the UI not to reference anything in the folders if (PreviewPanel) { PreviewPanel->OnThing(0, false); } Mail::NewMailLst.Empty(); // ~AccountStatusItem references the account list... must be before we // delete the accounts. DeleteObj(StatusPanel); // ~Accountlet needs to reference the root container... so // it has to go before unloading of folders. Accounts.DeleteObjects(); UnLoadFolders(); DeleteObj(PreviewPanel); SaveOptions(); DeleteObj(Commands); DeleteObj(d->PreviewFont); DeleteObj(d->SubSplit); DeleteObj(Splitter); MailList = NULL; CmdSend.ToolButton = NULL; CmdReceive.ToolButton = NULL; CmdPreview.ToolButton = NULL; CmdSend.MenuItem = NULL; CmdReceive.MenuItem = NULL; CmdPreview.MenuItem = NULL; // This could be using the OpenSSL library for HTTPS connections. So // close it before calling EndSSL. DeleteObj(d->ImageLoader); // This has to be after we close all the accounts... otherwise // they might still be using SSL functions, e.g. an IMAP/SSL connect. EndSSL(); DeleteObj(d); } LString ScribeWnd::GetResourceFile(SribeResourceType Type) { auto File = d->ResFiles.Find(Type); if (!File) LgiTrace("%s:%i - No file for resource type %i\n", _FL, Type); return File; } void ScribeWnd::LoadImageResources() { auto Res = LgiGetResObj(); LString::Array Folders; if (Res) { auto p = Res->GetThemeFolder(); if (p) Folders.Add(p); } Folders.Add(ScribeResourcePath()); for (auto p: Folders) { LDirectory Dir; LgiTrace("%s:%i - Loading resource folder '%s'\n", _FL, p.Get()); for (auto b = Dir.First(p); b; b = Dir.Next()) { if (Dir.IsDir()) continue; auto Name = Dir.GetName(); if (MatchStr("Toolbar-*.png", Name)) { if (!d->ResFiles.Find(ResToolbarFile)) d->ResFiles.Add(ResToolbarFile, Dir.FullPath()); } else if (MatchStr("xgate-icons-*.png", Name)) d->ResFiles.Add(ResToolbarFile, Dir.FullPath()); else if (MatchStr("Icons-*.png", Name)) d->ResFiles.Add(ResIconsFile, Dir.FullPath()); } } ToolbarImgs.Reset(LLoadImageList(GetResourceFile(ResToolbarFile))); ImageList.Reset(LLoadImageList(GetResourceFile(ResIconsFile))); if (!ImageList) LgiTrace("%s:%i - Failed to load toolbar image ('xgate-icons-32.png' or 'Toolbar-24.png')\n", _FL); } int ScribeWnd::GetEventHandle() { return d->AppWndHnd; } void ScribeWnd::OnCloseInstaller() { d->Bar = NULL; if (InThread()) { PourAll(); } else LAssert(0); } void ScribeWnd::OnInstall(CapsHash *Caps, bool Status) { } bool ScribeWnd::NeedsCapability(const char *Name, const char *Param) { #if DEBUG_CAPABILITIES LgiTrace("ScribeWnd::NeedsCapability(%s, %s)\n", Name, Param); #endif if (!InThread()) { #if DEBUG_CAPABILITIES LgiTrace("%s:%i - Posting M_NEEDS_CAP\n", _FL); #endif PostEvent(M_NEEDS_CAP, (LMessage::Param)NewStr(Name), (LMessage::Param)NewStr(Param)); } else { if (!Name) return false; if (d->MissingCaps.Find(Name)) { #if DEBUG_CAPABILITIES LgiTrace("%s:%i - Already in MissingCaps\n", _FL); #endif return true; } d->MissingCaps.Add(Name, true); LStringPipe MsgBuf(256); int i = 0; // const char *k; // for (bool b=d->MissingCaps.First(&k); b; b=d->MissingCaps.Next(&k), i++) for (auto k : d->MissingCaps) { MsgBuf.Print("%s%s", i?", ":"", k.key); } LVariant Actions; if (stristr(Name, "OpenSSL")) { MsgBuf.Print(LLoadString(IDS_ERROR_SERVER_CONNECT)); if (Param) MsgBuf.Print("\n%s", Param); Actions.Add(new LVariant(LLoadString(IDS_INSTALL))); } else if (stristr(Name, "Registry")) { MsgBuf.Print(LLoadString(IDS_ERROR_REG_WRITE)); Actions.Add(new LVariant(LLoadString(IDS_DONT_SHOW_AGAIN))); } else if (stristr(Name, "SpellingDictionary")) { MsgBuf.Print(LLoadString(IDS_ERROR_NEED_INSTALL), Param); Actions.Add(new LVariant(LLoadString(IDS_DOWNLOAD))); } Actions.Add(new LVariant(LLoadString(IDS_OK))); #if DEBUG_CAPABILITIES LgiTrace("%s:%i - Actions.Length()=%i, Bar=%p\n", _FL, Actions.Length(), d->Bar); #endif if (Actions.Length()) { LAutoString Msg(MsgBuf.NewStr()); // Check the script hook here... bool ShowInstallBar = true; LArray Callbacks; if (GetScriptCallbacks(LBeforeInstallBar, Callbacks)) { for (unsigned i=0; iCastInt32()) ShowInstallBar = false; else Msg.Reset(TheMsg.ReleaseStr()); } } } // Now create the capability install bar... if (!d->Bar && ShowInstallBar && Actions.Type == GV_LIST) { // FYI Capabilities are handled in ScribeWnd::StartAction. LArray Act; for (auto v : *Actions.Value.Lst) Act.Add(v->Str()); d->Bar = new MissingCapsBar(this, &d->MissingCaps, Msg, this, Act); AddView(d->Bar, 2); AttachChildren(); OnPosChange(); } } } return true; } LAutoString ScribeWnd::GetDataFolder() { LVariant v; GetOptions()->GetValue(OPT_IsPortableInstall, v); char p[MAX_PATH_LEN]; if (LGetSystemPath(v.CastInt32() ? LSP_APP_INSTALL : LSP_APP_ROOT, p, sizeof(p))) { if (!LDirExists(p)) FileDev->CreateFolder(p); return LAutoString(NewStr(p)); } else LgiTrace("%s:%i - LgiGetSystemPath failed (portable=%i).\n", _FL, v.CastInt32()); return LAutoString(); } LScriptEngine *ScribeWnd::GetScriptEngine() { return d->Engine; } LScriptCallback ScribeWnd::GetCallback(const char *CallbackMethodName) { LScriptCallback Cb; auto Cur = d->CurrentScript(); if (Cur && Cur->Code) { Cb.Script = Cur; Cb.Func = Cur->Code->GetMethod(CallbackMethodName); } if (!Cb.Func) { for (auto s: d->Scripts) { Cb.Script = s; if ((Cb.Func = s->Code->GetMethod(CallbackMethodName))) break; } } return Cb; } bool ScribeWnd::RegisterCallback(LScriptCallbackType Type, LScriptArguments &Args) { if (!d->CurrentScript()) { LgiTrace("%s:%i - No current script.\n", _FL); return false; } char *Fn = Args[1]->Str(); LScriptCallback Cb = GetCallback(Fn); if (!Cb.Func) { LgiTrace("%s:%i - No callback '%s'.\n", _FL, Fn); return false; } switch (Type) { case LToolsMenu: { char *Menu = Args[0]->Str(); auto Cur = d->CurrentScript(); if (!Menu || !Fn || !Cur) { LgiTrace("%s:%i - menu=%s, fn=%s.\n", _FL, Menu, Fn); return false; } LScriptCallback &c = Cur->Callbacks.New(); c = Cb; c.Type = Type; c.Param = d->NextToolMenuId; LMenuItem *Tools = GetMenu()->FindItem(IDM_TOOLS_MENU); auto ToolSub = Tools ? Tools->Sub() : 0; if (ToolSub) { if (d->NextToolMenuId == IDM_TOOL_SCRIPT_BASE) { ToolSub->AppendSeparator(); } ToolSub->AppendItem(Menu, c.Param, true); d->NextToolMenuId++; } break; } case LThingContextMenu: case LFolderContextMenu: case LThingUiToolbar: case LMailOnBeforeSend: case LMailOnAfterReceive: case LApplicationToolbar: case LBeforeInstallBar: case LInstallComponent: case LOnTimer: case LRenderMail: case LOnLoad: { auto Cur = d->CurrentScript(); LAssert(d->Scripts.HasItem(Cur)); LScriptCallback &c = Cur->Callbacks.New(); c = Cb; c.Type = Type; if (Args.Length() > 2) c.Data = *Args[2]; break; } default: { LAssert(!"Not a known callback type"); return false; } } return true; } bool ScribeWnd::GetScriptCallbacks(LScriptCallbackType Type, LArray &Callbacks) { for (auto s: d->Scripts) { for (auto &c: s->Callbacks) { if (c.Type == Type) Callbacks.Add(&c); } } return Callbacks.Length() > 0; } bool ScribeWnd::ExecuteScriptCallback(LScriptCallback &c, LScriptArguments &Args, bool ReturnArgs) { if (!c.Func || !c.Script) return false; // Setup LVirtualMachine Vm(d); Vm.SetDebuggerEnabled(true); d->CurrentScripts.Add(c.Script); // Call the method bool Status = Vm.ExecuteFunction( c.Script->Code, c.Func, Args, LScribeScript::Inst->GetLog(), ReturnArgs ? &Args : NULL) != ScriptError; // Cleanup d->CurrentScripts.PopLast(); return Status; } LStream *ScribeWnd::ShowScriptingConsole() { auto Item = Menu->FindItem(IDM_SCRIPTING_CONSOLE); if (Item) { Item->Checked(!Item->Checked()); LScribeScript::Inst->ShowScriptingWindow(Item->Checked()); LVariant v; GetOptions()->SetValue(OPT_ShowScriptConsole, v = Item->Checked()); } return LScribeScript::Inst->GetLog(); } LOptionsFile::PortableType ScribeWnd::GetPortableType() { return d->GetInstallMode(); } void ScribeWnd::RemoteContent_AddSender(const char *Addr, bool WhiteList) { if (!Addr) return; auto Opt = WhiteList ? OPT_RemoteContentWhiteList : OPT_RemoteContentBlackList; LVariant v; GetOptions()->GetValue(Opt, v); // Not an error if not there... auto existing = LString(v.Str()).SplitDelimit(" ,\r\n"); for (auto p: existing) { if (MatchStr(p, Addr)) { LgiTrace("%s:%i - '%s' is already in '%s'\n", _FL, Addr, Opt); return; // Already in list... } } existing.SetFixedLength(false); existing.Add(Addr); auto updated = LString("\n").Join(existing); GetOptions()->SetValue(Opt, v = updated.Get()); LgiTrace("%s:%i - Added '%s' to '%s'\n", _FL, Addr, Opt); d->RemoteContent_Init = false; } ScribeRemoteContent ScribeWnd::RemoteContent_GetSenderStatus(const char *Addr) { if (!d->RemoteContent_Init) { LVariant v; if (GetOptions()->GetValue(OPT_RemoteContentWhiteList, v)) d->RemoteWhiteLst = LString(v.Str()).SplitDelimit(" ,\r\n"); if (GetOptions()->GetValue(OPT_RemoteContentBlackList, v)) d->RemoteBlackLst = LString(v.Str()).SplitDelimit(" ,\r\n"); d->RemoteContent_Init = true; } for (auto p: d->RemoteWhiteLst) if (MatchStr(p, Addr)) return RemoteAlwaysLoad; for (auto p: d->RemoteBlackLst) if (MatchStr(p, Addr)) return RemoteNeverLoad; return RemoteDefault; } void ScribeWnd::RemoteContent_ClearCache() { d->RemoteWhiteLst.Empty(); d->RemoteBlackLst.Empty(); d->RemoteContent_Init = false; } void ScribeWnd::OnSpellerSettingChange() { // Kill the current thread d->SpellerThread.Reset(); // Setup the new thread LSpellCheck *t = GetSpellThread(); if (t) { // Trigger an install if needed t->Check(d->AppWndHnd, "thisisamispeltword", 0, 18); } } bool ScribeWnd::SetSpellThreadParams(LSpellCheck *Thread) { if (!Thread) return false; LVariant Lang, Dict; GetOptions()->GetValue(OPT_SpellCheckLanguage, Lang); GetOptions()->GetValue(OPT_SpellCheckDictionary, Dict); LAutoPtr Params(new LSpellCheck::Params); if (!Params) return false; Params->IsPortable = GetPortableType(); Params->OptionsPath = GetOptions()->GetFile(); Params->Lang = Lang.Str(); Params->Dict = Dict.Str(); Params->CapTarget = this; Thread->SetParams(Params); return true; } LSpellCheck *ScribeWnd::CreateSpellObject() { LVariant PrefAspell; GetOptions()->GetValue(OPT_PreferAspell, PrefAspell); LAutoPtr Obj; if (PrefAspell.CastInt32()) Obj = CreateAspellObject(); #if defined(MAC) if (!Obj) Obj = CreateAppleSpellCheck(); #elif defined(WINDOWS) LArray Ver; int Os = LGetOs(&Ver); if ( !Obj && (Os == LGI_OS_WIN32 || Os == LGI_OS_WIN64) && ( Ver.Length() > 1 && ( Ver[0] > 6 || (Ver[0] == 6 && Ver[1] > 1) ) ) ) Obj = CreateWindowsSpellCheck(); #endif if (!Obj) Obj = CreateAspellObject(); SetSpellThreadParams(Obj); return Obj.Release(); } LSpellCheck *ScribeWnd::GetSpellThread(bool OverrideOpt) { LVariant Use; if (OverrideOpt) Use = true; else GetOptions()->GetValue(OPT_SpellCheck, Use); #if USE_SPELLCHECKER if ((Use.CastInt32() != 0) ^ (d->SpellerThread.Get() != 0)) d->SpellerThread.Reset(Use.CastInt32() ? CreateSpellObject() : NULL); #endif return d->SpellerThread; } LAutoString ScribeWnd::GetHttpProxy() { LAutoString Proxy; LVariant v; if (GetOptions()->GetValue(OPT_HttpProxy, v) && ValidStr(v.Str())) { Proxy.Reset(v.ReleaseStr()); } else { LProxyUri p; if (p.sHost) Proxy.Reset(NewStr(p.ToString())); } return Proxy; } InstallProgress *ScribeWnd::StartAction(MissingCapsBar *Bar, LCapabilityTarget::CapsHash *Components, const char *ActionParam) { if (!ActionParam) { LgiTrace("%s:%i - No action supplied.\n", _FL); return NULL; } LArray Callbacks; LVariant Action(ActionParam); if (GetScriptCallbacks(LInstallComponent, Callbacks)) { bool StartInstall = true; for (unsigned i=0; iCastInt32()) StartInstall = false; } } if (!Action.Str()) { LgiTrace("%s:%i - GInstallComponent removed action name.\n", _FL); return NULL; } if (!StartInstall) { LgiTrace("%s:%i - GInstallComponent script canceled install of '%s'.\n", _FL, ActionParam); return NULL; } } if (!_stricmp(Action.Str(), LLoadString(IDS_OK))) { // Do nothing d->MissingCaps.Empty(); } else if (!_stricmp(Action.Str(), LLoadString(IDS_DONT_SHOW_AGAIN))) { // Turn off registering as a client. LVariant No(false); GetOptions()->SetValue(OPT_RegisterWindowsClient, No); GetOptions()->SetValue(OPT_CheckDefaultEmail, No); } else if (!_stricmp(Action.Str(), LLoadString(IDS_INSTALL))) { #ifdef WINDOWS bool IsSsl = false; for (auto c: *Components) { if (!_stricmp(c.key, "openssl")) { IsSsl = true; break; } } if (IsSsl) { LString s; s.Printf(LLoadString(IDS_WINDOWS_SSL_INSTALL), LGetOsName()); auto q = new LAlert(this, AppName, s, "Open Website", LLoadString(IDS_CANCEL)); q->DoModal([this, q](auto dlg, auto id) { switch (id) { case 1: LExecute("https://slproweb.com/products/Win32OpenSSL.html"); break; default: break; } delete dlg; }); return NULL; } #endif return CapabilityInstaller::StartAction(Bar, Components, Action.Str()); } else if (!_stricmp(Action.Str(), LLoadString(IDS_SHOW_CONSOLE))) { ShowScriptingConsole(); } else if (!_stricmp(Action.Str(), LLoadString(IDS_OPEN_SOURCE))) { if (d->ErrSource) LExecute(d->ErrSource); else if (d->ErrFilter) d->ErrFilter->DoUI(); d->ErrSource.Empty(); d->ErrFilter = NULL; } else if ( !Stricmp(Action.Str(), LLoadString(IDS_SHOW_REMOTE_CONTENT)) || !Stricmp(Action.Str(), LLoadString(IDS_ALWAYS_SHOW_REMOTE_CONTENT))) { auto c = Components->begin(); LWindow *w = Bar->GetWindow(); if ((*c).key && !Stricmp((*c).key, "RemoteContent") && w) { LScriptArguments Args(NULL); Args[0] = new LVariant(!Stricmp(Action.Str(), LLoadString(IDS_ALWAYS_SHOW_REMOTE_CONTENT))); w->CallMethod(DomToStr(SdShowRemoteContent), Args); } } else if (!_stricmp(Action.Str(), LLoadString(IDS_DOWNLOAD))) { auto t = GetSpellThread(); if (t) t->InstallDictionary(); else LgiTrace("%s:%i - No spell thread.\n", _FL); } else LAssert(!"Unknown action."); return NULL; } HttpImageThread *ScribeWnd::GetImageLoader() { if (!d->ImageLoader) { LAutoString Proxy = GetHttpProxy(); d->ImageLoader = new HttpImageThread(this, Proxy, 0); } return d->ImageLoader; } char *ScribeWnd::GetUiTags() { if (!d->UiTags) { char UiTags[256] = "inscribe" #if defined WIN32 " win32" #elif defined LINUX " linux" #elif defined MAC " mac" #endif ; LVariant Tags; if (!GetOptions()) { LAssert(!"Where is the options?"); } else if (GetOptions()->GetValue("tags", Tags)) { size_t Len = strlen(UiTags); sprintf_s(UiTags+Len, sizeof(UiTags)-Len, " %s", Tags.Str()); } d->UiTags.Reset(NewStr(UiTags)); } return d->UiTags; } void ScribeWnd::OnCreate() { // LgiTrace("ScribeWnd::OnCreate. ScribeState=%i\n", ScribeState); if (IsAttached() && ScribeState == ScribeConstructed) { ScribeState = ScribeInitializing; Construct3(); } } ScribeAccount *ScribeWnd::GetAccountByEmail(const char *Email) { if (!Email) return NULL; for (auto a : *GetAccounts()) { LVariant e = a->Identity.Email(); if (e.Str() && !_stricmp(e.Str(), Email)) { return a; } } return 0; } ScribeAccount *ScribeWnd::GetAccountById(int Id) { for (auto a : *GetAccounts()) { if (a->Receive.Id() == Id) { return a; } } return 0; } const char *ScribeWnd::EditCtrlMimeType() { LVariant Html; GetOptions()->GetValue(OPT_EditControl, Html); return Html.CastInt32() ? sTextHtml : sTextPlain; } LAutoString ScribeWnd::GetReplyXml(const char *MimeType) { bool IsHtml = MimeType && !_stricmp(MimeType, sTextHtml); LVariant s; GetOptions()->GetValue(IsHtml ? OPT_HtmlReplyFormat : OPT_TextReplyFormat, s); return LAutoString(s.ReleaseStr()); } LAutoString ScribeWnd::GetForwardXml(const char *MimeType) { bool IsHtml = MimeType && !_stricmp(MimeType, sTextHtml); LVariant s; GetOptions()->GetValue(IsHtml ? OPT_HtmlForwardFormat : OPT_TextForwardFormat, s); return LAutoString(s.ReleaseStr()); } LVmCallback *ScribeWnd::GetDebuggerCallback() { return d; } GpgConnector *ScribeWnd::GetGpgConnector() { if (!d->GpgInst) { if (!GpgConnector::IsInstalled()) return NULL; d->GpgInst.Reset(new GpgConnector()); } return d->GpgInst; } LFont *ScribeWnd::GetPreviewFont() { return d->PreviewFont; } bool ScribeWnd::IsValid() { #if 0 try { for (ScribeAccount *a = Accounts.First(); a; a = Accounts.Next()) { } } catch(...) { return false; } #endif return true; } bool ScribeWnd::ShutdownIpc() { // Remove our instance from the shared memory if (ScribeIpc && ScribeIpc->GetPtr()) { ScribeIpcInstance *InstLst = (ScribeIpcInstance*) ScribeIpc->GetPtr(); if (ThisInst) memset(ThisInst, 0, sizeof(*ThisInst)); int c = 0; for (int i=0; iDestroy(); } ThisInst = 0; DeleteObj(ScribeIpc); return true; } bool ScribeWnd::GetVariant(const char *Name, LVariant &Value, const char *Array) { ScribeDomType Fld = StrToDom(Name); switch (Fld) { case SdQuote: // Type: String { return GetOptions()->GetValue(OPT_QuoteReplyStr, Value); } case SdName: // Type: String { Value = AppName; break; } case SdHome: // Type: String { Value = LGetExePath().Get(); break; } case SdNow: // Type: String { LDateTime Now; Now.SetNow(); char s[64]; Now.Get(s, sizeof(s)); Value = s; break; } case SdFolder: // Type: ScribeFolder[] // Pass system folder index or string as array parameter. { ScribeFolder *f = 0; if (!Array) return false; if (IsDigit(*Array)) { f = GetFolder(atoi(Array)); } else { f = GetFolder(Array); } if (!f) return false; Value = (LDom*)f; break; } case SdAppName: // Type: String { Value = AppName; break; } case SdCalendarToday: // Type: String { Calendar::SummaryOfToday(this, [this](auto s) { d->CalendarSummary = s; }); return d->CalendarSummary; } case SdInboxSummary: { LStringPipe p; // Iterate through the mail stores for (auto m: Folders) { if (!m.Store) continue; auto Inbox = m.Store->GetObj(FIELD_INBOX); if (!Inbox) continue; auto Unread = Inbox->GetInt(FIELD_UNREAD); auto Name = Inbox->GetStr(FIELD_FOLDER_NAME); LString Path; Path.Printf("/%s/%s", m.Name.Get(), Name); if (Unread) p.Print("%s: %i unread", m.Name.Get(), Path.Get(), Unread); else p.Print("%s: 0 unread", m.Name.Get()); } // And also the IMAP full folders for (auto a: Accounts) { ScribeProtocol Protocol = a->Receive.ProtocolType(); if (Protocol == ProtocolImapFull) { LDataStoreI *Store = a->Receive.GetDataStore(); if (Store) { auto Inbox = Store->GetObj(FIELD_INBOX); if (Inbox) { auto Unread = Inbox->GetInt(FIELD_UNREAD); auto Name = Inbox->GetStr(FIELD_FOLDER_NAME); auto m = a->Receive.Name(); if (m.Str()) { LString Path; Path.Printf("/%s/%s", m.Str(), Name); if (Unread) p.Print("%s: %i unread", m.Str(), Path.Get(), Unread); else p.Print("%s: 0 unread", m.Str()); } } } } } Value = p.NewLStr().Get(); break; } case SdExecute: // Type: String { if (!Array) return false; const char *s = Array; char *Exe = LTokStr(s); if (!Exe) return false; while (*s && *s == ' ') s++; LStringPipe Out; LSubProcess p(Exe, (char*)s); if (p.Start()) { p.Communicate(&Out); LAutoString o(Out.NewStr()); LAutoString t(TrimStr(o)); Value = t; } DeleteArray(Exe); break; } case SdBuildType: // Type: String { #ifdef _DEBUG Value = "Debug"; #else Value = "Release"; #endif break; } case SdPlatform: // Type: String { LArray Ver; LGetOs(&Ver); LString::Array Va; for (auto i: Ver) Va.New().Printf("%i", i); #if defined __GTK_H__ auto Api = "GTK3"; #elif LGI_SDL auto Api = "SDL"; #elif LGI_COCOA auto Api = "Cocoa"; #elif LGI_CARBON auto Api = "Carbon"; #elif defined WIN32 auto Api = "WinApi"; #else #error "Impl me." auto Api = "#err"; #endif LString s; s.Printf("%s, v%s, %s", LGetOsName(), LString(".").Join(Va).Get(), Api); Value = s.Get(); break; } case SdVersion: // Type: String { char Ver[32]; sprintf_s(Ver, sizeof(Ver), "v%s", ScribeVer); Value = Ver; break; } case SdBuild: // Type: String { char s[128]; sprintf_s(s, sizeof(s), "%s, %s, %ibit", __DATE__, __TIME__, (int)(sizeof(NativeInt)*8)); Value = s; break; } case SdLanguage: // Type: String { LLanguage *l = LGetLanguageId(); if (!l) return false; char s[256]; sprintf_s(s, sizeof(s), "%s \"%s\"", l->Name, l->Id); Value = s; break; } case SdString: // Type: String { if (!Array) { LAssert(!"Missing string ID"); return false; } int Id = atoi(Array); Value = LLoadString(Id); break; } case SdCurrentFolder: // Type: ScribeFolder { Value = (LDom*) GetCurrentFolder(); break; } case SdView: // Type: LView { Value = (LView*)this; break; } case SdNoContact: // Type: Contact { Value = (NoContactType*)d->NoContact; break; } case SdAccounts: { if (Array) { if (IsDigit(*Array)) { auto i = atoi(Array); if (i >= 0 && i < (ssize_t)Accounts.Length()) { Value = (LDom*)Accounts[i]; } else return false; } else { for (auto a : Accounts) { LVariant nm = a->Send.Name(); if (nm.Str() && !_stricmp(nm.Str(), Array)) { Value = (LDom*)a; break; } } } } else { Value = (int32)Accounts.Length(); } break; } case SdOptions: { Value = GetOptions(); break; } case SdMailStorePaths: { if (!Value.SetList()) return false; for (auto Ms : Folders) Value.Add(new LVariant(Ms.Path)); break; } case SdRootFolders: { if (!Value.SetList() || !Tree) return false; for (auto *i = Tree->GetChild(); i; i = i->GetNext()) { ScribeFolder *c = dynamic_cast(i); if (c) { auto p = c->GetPath(); Value.Add(new LVariant(p)); } } break; } default: { return false; } } return true; } bool ScribeWnd::CallMethod(const char *MethodName, LScriptArguments &Args) { ScribeDomType m = StrToDom(MethodName); switch (m) { case SdGrowlOnMail: // Type: (Mail Obj) { if (Args.Length() != 1) { LgiTrace("%s:%i - Wrong arg count: %i.\n", _FL, (int)Args.Length()); return false; } Mail *m = dynamic_cast(Args[0]->CastDom()); if (!m) { LgiTrace("%s:%i - Invalid object.\n", _FL); return false; } GrowlOnMail(m); break; } case SdGrowlInfo: { auto Title = Args.Length() > 0 ? Args[0] : NULL; auto Text = Args.Length() > 1 ? Args[1] : NULL; GrowlInfo(Title ? Title->Str() : NULL, Text ? Text->Str() : NULL); break; } case SdGetClipboardText: // Type: () { LClipBoard c(this); *Args.GetReturn() = c.Text(); break; } case SdSetClipboardText: // Type: (String Text) { if (Args.Length() != 1) { LgiTrace("%s:%i - Wrong arg count: %i.\n", _FL, (int)Args.Length()); return false; } char *Str = Args[0]->CastString(); LClipBoard c(this); if (ValidStr(Str)) *Args.GetReturn() = c.Text(Str); else *Args.GetReturn() = c.Empty(); break; } case SdLookupContactGroup: // Type: (String GroupName) { if (Args.Length() != 1) { LgiTrace("%s:%i - Wrong arg count: %i.\n", _FL, (int)Args.Length()); return false; } ContactGroup *Grp = LookupContactGroup(this, Args[0]->Str()); *Args.GetReturn() = dynamic_cast(Grp); break; } case SdAskUserString: // Type: (LView ParentView, String Callback, String PromptMessage[, Bool ObsurePassword[, String DefaultValue]]) { auto Vm = dynamic_cast(Args.GetVm()); if (!Vm) return false; LVirtualMachine::Context Ctx = Vm->SaveContext(); if (!Ctx || Args.Length() < 3) { *Args.GetReturn() = false; return true; } LView *View = Args[0]->CastView(); auto CallbackName = Args[1]->Str(); auto Prompt = Args[2]->CastString(); bool IsPassword = Args.Length() > 3 ? Args[3]->CastInt32() != 0 : false; auto Default = Args.Length() > 4 ? Args[4]->Str() : NULL; auto i = new LInput(View ? View : this, Default, Prompt, AppName, IsPassword); i->DoModal([Ctx, i, CallbackName=LString(CallbackName)](auto dlg, auto id) { if (id) { LScriptArguments Args(NULL); Args.Add(new LVariant(i->GetStr())); Ctx.Call(CallbackName, Args); Args.DeleteObjects(); } delete dlg; }); *Args.GetReturn() = true; break; } case SdCreateAccount: // Type: () { ScribeAccount *a = new ScribeAccount(this, (int)Accounts.Length()); if (a) { *Args.GetReturn() = (LDom*)a; Accounts.Insert(a); a->Create(); } else return false; break; } case SdDeleteAccount: // Type: (ScribeAccount AccountToDelete) { if (Args.Length() != 1) return false; ScribeAccount *a = dynamic_cast(Args[0]->CastDom()); if (!a) { *Args.GetReturn() = false; } else { int Idx = (int)Accounts.IndexOf(a); if (Idx < 0 || a->IsOnline()) { *Args.GetReturn() = false; } else { Accounts.Delete(a); a->Delete(); delete a; // delete actual account object // Reindex remaining items so their are no gaps int i=0; auto it = Accounts.begin(); for (a = *it; a; a = *++it, i++) { a->ReIndex(i); } } } break; } case SdShowRemoteContent: { if (PreviewPanel) return PreviewPanel->CallMethod(MethodName, Args); else return false; break; } case SdSearchHtml: // Type(Html, SearchExp, ResultExp) { if (Args.Length() != 3) { LgiTrace("%s:%i - SearchHtml requires 3 arguments.\n", _FL); *Args.GetReturn() = false; return true; } auto Html = Args[0]->Str(); auto SearchExp = Args[1]->Str(); auto ResultExp = Args[2]->Str(); if (!Html || !SearchExp || !ResultExp) { LgiTrace("%s:%i - SearchHtml got non-string argument.\n", _FL); *Args.GetReturn() = false; return true; } SearchHtml(Args.GetReturn(), Html, SearchExp, ResultExp); return true; } case SdGetUri: // Type(UriToDownload, CallbackName) { if (Args.Length() < 2) { LgiTrace("%s:%i - GetUri requires at least 2 arguments.\n", _FL); *Args.GetReturn() = false; return true; } auto Uri = Args[0]->Str(); auto Callback = Args[1]->Str(); LVariant *UserData = Args.Length() > 2 ? Args[2] : NULL; new ScriptDownloadContentThread(this, Uri, Callback, UserData); *Args.GetReturn() = true; return true; } default: { LAssert(!"Unsupported method."); return false; } } return true; } LOptionsFile *ScribeWnd::GetOptions(bool Create) { if (!d->Options && Create) { LAssert(!"Not here... do it in LoadOptions."); return NULL; } return d->Options; } int OptionsFileCmp(OptionsInfo *a, OptionsInfo *b) { int64 Diff = b->Mod - a->Mod; return Diff < 0 ? -1 : (Diff > 0 ? 1 : 0); } OptionsInfo::OptionsInfo() { Score = 0; Mod = 0; Leaf = NULL; Usual = false; } OptionsInfo &OptionsInfo::operator =(char *p) { File = p; Leaf = LGetLeaf(File); if (Leaf) { char n[64]; sprintf_s(n, sizeof(n), "%s.xml", OptionsFileName); Usual = !_stricmp(n, Leaf); } return *this; } LAutoPtr OptionsInfo::Load() { // Read the file... size_t Count = 0; LXmlTag *Stores = NULL; LXmlTag *Acc = NULL; LAutoPtr Of(new LOptionsFile(File)); if (!Of) return Of; if (!Of->SerializeFile(false)) goto OnError; // Sanity check the options... Acc = Of->LockTag(OPT_Accounts, _FL); if (!Acc) goto OnError; Of->Unlock(); Stores = Of->LockTag(OPT_MailStores, _FL); if (!Stores) goto OnError; Count = Stores->Children.Length(); Of->Unlock(); if (Count == 0) goto OnError; return Of; OnError: Of.Reset(); return Of; } #define DEBUG_OPTS_SCAN 0 bool ScribeWnd::ScanForOptionsFiles(LArray &Files, LSystemPath PathType) { LString Root = LGetSystemPath(PathType); LDirectory Dir; char p[MAX_PATH_LEN]; if (IsUnitTest) Root += ".unittest"; #if DEBUG_OPTS_SCAN LgiTrace("%s:%i - Root='%s'\n", _FL, Root.Get()); #endif for (int b = Dir.First(Root); b; b = Dir.Next()) { if ( !Dir.IsDir() && Dir.Path(p, sizeof(p)) ) { LResolveShortcut(p, p, sizeof(p)); char *Ext = LGetExtension(Dir.GetName()); if (stristr(Dir.GetName(), OptionsFileName) != NULL && Ext && (!_stricmp(Ext, "xml") || !_stricmp(Ext, "bak"))) { OptionsInfo &i = Files.New(); i = p; i.Mod = Dir.GetLastWriteTime(); #if DEBUG_OPTS_SCAN LgiTrace("%s:%i - File='%s'\n", _FL, p); #endif } } } Files.Sort(OptionsFileCmp); // Scan through the results and pick out the normal file for (unsigned i=0; iOptions; i++) { if (Files[i].Usual) { d->Options = Files[i].Load(); #if DEBUG_OPTS_SCAN LgiTrace("%s:%i - Attempt '%s' = %p\n", _FL, Files[i].File.Get(), d->Options); #endif } } if (!d->Options) { // Scan through the alternative files and look for something // we can use. #if DEBUG_OPTS_SCAN LgiTrace("%s:%i - Scanning backups\n", _FL); #endif for (unsigned i=0; iOptions; i++) { if (!Files[i].Usual) { d->Options = Files[i].Load(); if (d->Options) { // Lets rename this baby back to the real filename LString Xml = OptionsFileName; Xml += ".xml"; LFile::Path Normal(Root, Xml); if (LFileExists(Normal)) FileDev->Delete(Normal); d->Options->SetFile(Normal); d->Options->SerializeFile(true); // sets to clean after changing filename. } } } } if (d->Options) { // Load OK: Clear out any old options files... #if DEBUG_OPTS_SCAN LgiTrace("%s:%i - Files.len=" LPrintfSizeT "\n", _FL, Files.Length()); #endif while (Files.Length() > 6) { auto Idx = Files.Length() - 1; auto &f = Files[Idx]; #if DEBUG_OPTS_SCAN LgiTrace("%s:%i - Delete '%s'\n", _FL, f.File.Get()); #endif FileDev->Delete(f.File); Files.DeleteAt(Idx); } } return d->Options != NULL; } bool ScribeWnd::IsUnitTest = false; bool ScribeWnd::LoadOptions() { bool Load = false; // Check if we are running unit tests... if ((IsUnitTest = LAppInst->GetOption("unittest"))) { d->UnitTestServer.Reset(new LUnitTestServer(this)); } // Look in the XGate folder #if WINNATIVE && !defined(_DEBUG) LRegKey xgate(false, "HKEY_CURRENT_USER\\Software\\XGate"); if (xgate.IsOk()) { char *Spool = xgate.GetStr("SpoolDir"); if (LDirExists(Spool)) { char File[MAX_PATH_LEN]; LMakePath(File, sizeof(File), Spool, "spool"); LMakePath(File, sizeof(File), File, OptionsFileName); strcat_s(File, sizeof(File), ".xml"); if (LFileExists(File)) { d->SetInstallMode(LOptionsFile::DesktopMode); LgiTrace("Selecting xgate mode based on options file path.\n"); d->Options.Reset(new LOptionsFile(File)); } } } #endif // Now look in the application install folder LArray Files; if (!d->Options && ScanForOptionsFiles(Files, LSP_APP_INSTALL)) { // File is in the install folder... d->SetInstallMode(LOptionsFile::PortableMode); LgiTrace("Selecting portable mode based on options file path.\n"); } // Look in the app root if ( !d->Options && ScanForOptionsFiles(Files, LSP_APP_ROOT) ) { // Desktop mode d->SetInstallMode(LOptionsFile::DesktopMode); LgiTrace("Selecting desktop mode based on options file path.\n"); } // Do multi-instance stuff if (d->Options && d->Options->GetFile()) { // Search for other instances of Scribe if (ScribeIpc) { int i; ScribeIpcInstance *InstLst = (ScribeIpcInstance*) ScribeIpc->GetPtr(); ScribeIpcInstance *Mul = 0; for (i=0; iMulPassword = Mul->Password; break; } } for (i=0; iIsScribe(), InstLst->Magic, InstLst->Pid); if (InstLst->IsScribe() && InstLst != ThisInst) { // LgiTrace("%s, %s\n", InstLst->OptionsPath, d->Options->GetFile()); if (Mul || _stricmp(InstLst->OptionsPath, d->Options->GetFile()) == 0) { int Pid = InstLst->Pid; OsAppArguments *Args = LAppInst->GetAppArgs(); if (!LIsProcess(Pid)) { continue; } char *Utf8 = 0; #if WINNATIVE Utf8 = WideToUtf8(Args->lpCmdLine); #else LStringPipe p; for (int i=1; iArgs; i++) { if (i > 1) p.Push(" "); char *Sp = strchr(Args->Arg[i], ' '); if (Sp) p.Push("\""); p.Push(Args->Arg[i]); if (Sp) p.Push("\""); } Utf8 = p.NewStr(); #endif if (Utf8) { size_t Len = strlen(Utf8); if (Len > 255) { InstLst->Flags |= SCRIBE_IPC_LONG_ARGS; InstLst->Flags &= ~SCRIBE_IPC_CONTINUE_ARGS; for (char *u = Utf8; Len > 0; u += 255) { ssize_t Part = MIN(sizeof(InstLst->Args)-1, Len); memcpy(InstLst->Args, u, Part); Len -= Part; int64 Start = LCurrentTime(); while (LCurrentTime() - Start < 60000) { if (TestFlag(InstLst->Flags, SCRIBE_IPC_CONTINUE_ARGS) && InstLst->Args[0] == 0) { Start = 0; break; } LSleep(10); } if (Start) { LgiTrace("%s:%i - SendLA timed out.\n", _FL); break; } } InstLst->Flags &= ~(SCRIBE_IPC_CONTINUE_ARGS | SCRIBE_IPC_LONG_ARGS); } else { strcpy_s(InstLst->Args, sizeof(InstLst->Args), Utf8); } DeleteArray(Utf8); ShutdownIpc(); LgiTrace("Passed args to the other running instance of Scribe (pid=%i)\n", Pid); LCloseApp(); return false; } else LgiTrace("%s:%i - No arguments to pass.\n", _FL); } } } if (Mul && LFileExists(Mul->OptionsPath)) { // No instance of Scribe is running, but MUL may be keeping // the previously run instance around. So we should run that // by using the options file and password from MUL's instance // record. d->Options.Reset(new LOptionsFile(Mul->OptionsPath)); } } // Insert ourselves into the instance list if (ThisInst) { strcpy_s(ThisInst->OptionsPath, sizeof(ThisInst->OptionsPath), d->Options->GetFile()); } } // Open file and load.. if (!Load && d->Options) { LOptionsFile *Opts = GetOptions(); Load = Opts->SerializeFile(false); if (Load) { LVariant v = d->GetInstallMode() == LOptionsFile::PortableMode; GetOptions()->SetValue(OPT_IsPortableInstall, v); } else { auto err = GetOptions()->GetError(); LgiMsg( this, LLoadString(IDS_ERROR_LR8_FAILURE), AppName, MB_OK, err); } } if (!d->Options) { // d->Options = new LOptionsFile(d->GetInstallMode(), OptionsFileName); return false; } if (d->Options) { LVariant v; if (!d->Options->GetValue(OPT_IsPortableInstall, v) && d->GetInstallMode() != LOptionsFile::UnknownMode) { v = d->GetInstallMode() == LOptionsFile::PortableMode; d->Options->SetValue(OPT_IsPortableInstall, v); } ScribeOptionsDefaults(d->Options); if (Load) { if (GetOptions()->GetValue(OPT_PrintSettings, v)) { auto *p = GetPrinter(); if (p) { LString s = v.Str(); p->Serialize(s, false); } } } if (d->Options->GetValue(OPT_PreviewLines, v)) { Mail::PreviewLines = v.CastInt32() != 0; } // upgrade smtp password const char *Pw = "SmtpPsw"; if (!GetOptions()->GetValue(OPT_EncryptedSmtpPassword, v)) { // no encrypted password, look for unencrypted password if (GetOptions()->GetValue(Pw, v)) { LPassword p; p.Set(v.Str()); p.Serialize(GetOptions(), OPT_EncryptedSmtpPassword, true); } } // if old un-encrypted password exists... // delete the key, we are now storing an encrypted // password if (GetOptions()->GetValue(Pw, v)) GetOptions()->DeleteValue(Pw); if (GetOptions()->GetValue(OPT_AdjustDateTz, v)) Mail::AdjustDateTz = !v.CastInt32(); if (!GetOptions()->GetValue(OPT_ConfirmDelete, v)) GetOptions()->SetValue(OPT_ConfirmDelete, v = true); if (!GetOptions()->GetValue(OPT_DelDirection, v)) GetOptions()->SetValue(OPT_DelDirection, v = DeleteActionPrev); if (GetOptions()->GetValue(OPT_SizeInKiB, v)) OptionSizeInKiB = v.CastInt32() != 0; if (GetOptions()->GetValue(OPT_RelativeDates, v)) ShowRelativeDates = v.CastInt32() != 0; // date format if (GetOptions()->GetValue(OPT_DateFormat, v)) { int Idx = v.CastInt32(); if (Idx >= 0 && Idx < CountOf(DateTimeFormats)) LDateTime::SetDefaultFormat(DateTimeFormats[Idx]); } // SSL debug logging if (GetOptions()->GetValue(OPT_DebugSSL, v)) SslSocket::DebugLogging = v.CastInt32() != 0; // Growl if (GetOptions()->GetValue(OPT_GrowlEnabled, v) && v.CastInt32()) { LVariant Ver, Bld; GetVariant(DomToStr(SdVersion), Ver); GetVariant("Build", Bld); LString n; n.Printf("%s\n%s", Ver.Str(), Bld.Str()); GrowlInfo("Scribe has started up...", n); } } #if LGI_EXCEPTIONS try { #endif // Default the font settings to the system font // if they don't already exist const char *OptFont[] = { OPT_EditorFont, OPT_PrintFont, OPT_HtmlFont, 0 }; int Index = 0; for (const char **Opt=OptFont; *Opt; Opt++, Index++) { LVariant v; if (!GetOptions()->GetValue(*Opt, v)) { LFontType Type; if (Type.GetSystemFont("System")) { if (Index == 2) { int Pt = Type.GetPointSize(); Type.SetPointSize(Pt+3); } Type.Serialize(GetOptions(), *Opt, true); } } } #if LGI_EXCEPTIONS } catch (...) { LgiMsg( this, LLoadString(IDS_ERROR_FONT_SETTINGS), AppName, MB_OK); } #endif return true; } bool ScribeWnd::SaveOptions() { LStringPipe Log(256); bool Status = false; bool WriteFailed = false; bool WndStateSet = false; RestartSave: if (d->Options && !d->Options->GetFile()) { bool PortableOk = true; char Path[MAX_PATH_LEN]; char Leaf[32]; sprintf_s(Leaf, sizeof(Leaf), "%s.xml", OptionsFileName); Log.Print("No current path for '%s', creating...\n", Leaf); LVariant v; GetOptions()->GetValue(OPT_IsPortableInstall, v); if (v.CastInt32()) { if (!LGetSystemPath(LSP_APP_INSTALL, Path, sizeof(Path))) { PortableOk = false; Log.Print("Error: LgiGetSystemPath(LSP_APP_INSTALL) failed.\n"); } else { LMakePath(Path, sizeof(Path), Path, Leaf); // Do write test to confirm we are good to go LFile f; if (f.Open(Path, O_WRITE)) { f.Close(); FileDev->Delete(Path, false); d->Options->SetFile(Path); } else { PortableOk = false; Log.Print("Warning: '%s' is not writable.\n", Path); } } } if (!v.CastInt32() || !PortableOk) { // Desktop mode then. if (v.CastInt32()) { const char *Msg = "Switching to desktop mode because the install folder is not writable."; Log.Print("%s\n", Msg); LgiMsg(this, Msg, AppName, MB_OK); GetOptions()->SetValue(OPT_IsPortableInstall, v = false); } if (!LGetSystemPath(LSP_APP_ROOT, Path, sizeof(Path))) { Log.Print("Error: LgiGetSystemPath(LSP_APP_ROOT) failed.\n"); } else { LMakePath(Path, sizeof(Path), Path, LAppInst->LBase::Name()); if (!LDirExists(Path)) { if (!FileDev->CreateFolder(Path)) { Log.Print("Error: CreateFolder('%s') failed.\n", Path); } } LMakePath(Path, sizeof(Path), Path, Leaf); // Do write test to confirm we are good to go LFile f; if (f.Open(Path, O_WRITE)) { f.Close(); FileDev->Delete(Path, false); d->Options->SetFile(Path); } else { Log.Print("Error: '%s' is not writable.\n", Path); } } } } if (d->Options && d->Options->GetFile() && d->Options->IsValid()) { // Backup options file char Backup[MAX_PATH_LEN]; strcpy_s(Backup, sizeof(Backup), d->Options->GetFile()); char *Ext = LGetExtension(Backup); if (Ext) { *--Ext = 0; LString s; for (int i=1; i<100; i++) { s.Printf("%s_%i.bak", Backup, i); if (!LFileExists(s)) break; } if (!LFileExists(s)) FileDev->Move(d->Options->GetFile(), s); } // Update some settings... #if LGI_VIEW_HANDLE if (Handle()) #endif WndStateSet = SerializeState(GetOptions(), OPT_ScribeWndPos, false); LVariant v; if (Splitter) GetOptions()->SetValue(OPT_SplitterPos, v = (int)Splitter->Value()); if (d->SubSplit) { auto First = d->SubSplit->GetViewAt(0); if (First == (LViewI*)SearchView) { auto Lst = (SearchView) ? d->SubSplit->GetViewAt(1) : NULL; if (Lst) GetOptions()->SetValue(OPT_SubSplitPos, v = (int)Lst->GetPos().Y()); } else GetOptions()->SetValue(OPT_SubSplitPos, v = (int)d->SubSplit->Value()); } // Write them... if (GetOptions()->SerializeFile(true)) { Status = true; } else { // We probably don't have write permissions to the install folder... Log.Print("Error: Options.Serialize failed.\n"); if (!WriteFailed) { // This blocks any possibility of an infinite loop WriteFailed = true; d->Options->SetFile(NULL); // Set desktop mode explicitly LVariant v; GetOptions()->GetValue(OPT_IsPortableInstall, v = false); Log.Print("Restarting save after setting desktop mode...\n"); goto RestartSave; } } } if (!Status) { LString a = Log.NewLStr(); LgiMsg(this, "Saving options failed:\n%s", AppName, MB_OK, a.Get()); } if (!WndStateSet) { LRect r(10, 10, 790, 590); SetPos(r); MoveToCenter(); } return Status; } // // Command Line Options: // // -m, -t : To recipient(s) // -f : The filename of the attachment // -b : Attach as a binary // -c : CC'd recipient(s) // -s : Subject for the email // -n : Send now... else UI is shown // -p : Print the file // -upgrade_folders : trigger a folder upgrade // -o : Load the following options file // -u : Load the following URL/file // void ScribeWnd::OnCommandLine() { // check command line args LString Str, File; bool CreateMail = false; CreateMail = LAppInst->GetOption("m", Str); if (!CreateMail) CreateMail = LAppInst->GetOption("t", Str); bool HasFile = LAppInst->GetOption("f", File); if (!CreateMail) CreateMail = HasFile; LString OpenArg; if (LAppInst->GetOption("u", OpenArg)) { LUri u(OpenArg); if (u.sProtocol) { OnUrl(OpenArg); } else if (LFileExists(OpenArg)) { LArray Files; Files.Add(OpenArg); OnReceiveFiles(Files); } } Mail *NewEmail = 0; if (CreateMail && Str) { // strip off quotes if needed char *In = Str, *Out = Str; for (; In && *In; In++) { if (!strchr("\'\"", *In)) { *Out++ = *In; } } *Out++ = 0; // create object NewEmail = dynamic_cast(CreateItem(MAGIC_MAIL, NULL, false)); if (NewEmail) { Mailto mt(this, Str); mt.Apply(NewEmail); // cc's? if (LAppInst->GetOption("c", Str)) { SetRecipients(this, Str, NewEmail->GetObject()->GetList(FIELD_TO), MAIL_ADDR_CC); } // attach a file? if (File) { if (LAppInst->GetOption("b")) { // attach as a binary file NewEmail->AttachFile(this, &File[0]); } else { // insert as the body LAutoString b(LReadTextFile(&File[0])); if (b) { NewEmail->SetBody(b); } } } // subject? if (LAppInst->GetOption("s", Str)) { NewEmail->SetSubject(Str); } // Send now or later? if (LAppInst->GetOption("n")) { // Check for exit after send option d->ExitAfterSend = LAppInst->GetOption("exit"); // now NewEmail->SetFlags(MAIL_CREATED | MAIL_READY_TO_SEND | NewEmail->GetFlags()); NewEmail->Save(); OnCommand(IDM_SEND_MAIL, 0, #ifndef __GTK_H__ Handle() #else NULL #endif ); } else { // later NewEmail->DoUI(); } } } // Pop3 on startup option LVariant n; if (GetOptions()->GetValue(OPT_Pop3OnStart, n) && n.CastInt32()) { OnCommand(IDM_RECEIVE_MAIL, 0, NULL); } } void ScribeWnd::SetCurrentIdentity(int i) { LVariant v = i; GetOptions()->SetValue(OPT_CurrentIdentity, v); if (DefaultIdentityItem) DefaultIdentityItem->Checked(i < 0); for (auto a: Accounts) { a->SetCheck(i == a->GetIndex()); } } ScribeAccount *ScribeWnd::GetCurrentAccount() { auto Idx = GetCurrentIdentity(); ScribeAccount *a = (Idx >= 0 && Idx < (ssize_t)Accounts.Length()) ? Accounts.ItemAt(Idx) : NULL; bool ValidId = a != NULL && a->IsValid(); if (!ValidId) { LAssert(!"No current identity?"); // Find a valid account to be the identity... for (auto a : Accounts) { if (!a->Send.Disabled() && a->Identity.IsValid()) { break; } } } return a; } int ScribeWnd::GetCurrentIdentity() { LVariant i; if (GetOptions()->GetValue(OPT_CurrentIdentity, i)) return i.CastInt32(); else if (ScribeState != ScribeInitializing) LgiTrace("%s:%i - No OPT_CurrentIdentity set.\n", _FL); return -1; } void ScribeWnd::SetupAccounts() { int i, CurrentIdentity = GetCurrentIdentity(); if (StatusPanel) { StatusPanel->Empty(); } #if !defined(COCOA) // FIXME LAssert(ReceiveMenu && PreviewMenu); #endif if (SendMenu) SendMenu->Empty(); if (ReceiveMenu) ReceiveMenu->Empty(); if (PreviewMenu) PreviewMenu->Empty(); if (IdentityMenu) { IdentityMenu->Empty(); } static bool Startup = true; bool ResetDefault = false; LArray Enabled; for (i=0; true; i++) { // char *s = 0; ScribeAccount *a = Startup ? new ScribeAccount(this, i) : Accounts[i]; if (a) { if (i == 0) { a->Create(); } a->Register(this); LVariant ReceiveName = a->Receive.Name(); LVariant ReceiveServer = a->Receive.Server(); LVariant SendServer = a->Send.Server(); if (i == 0 || ValidStr(ReceiveName.Str()) || ValidStr(ReceiveServer.Str()) || ValidStr(SendServer.Str()) ) { a->Send.SendItem = SendItem; a->Receive.ReceiveItem = ReceiveItem; a->Receive.PreviewItem = PreviewItem; if (!Accounts.HasItem(a)) { Accounts.Insert(a); } if (i) a->Create(); a->InitMenus(); // Identity Menu Item LVariant IdEmail = a->Identity.Email(); LVariant IdName = a->Identity.Name(); if (IdentityMenu && ValidStr(IdEmail.Str())) { char s[256]; if (IdName.Str()) sprintf_s(s, sizeof(s), "%s <%s>", IdName.Str(), IdEmail.Str()); else sprintf_s(s, sizeof(s), "<%s>", IdEmail.Str()); a->SetMenuItem(IdentityMenu->AppendItem(s, IDM_IDENTITY_BASE+i+1, !a->Send.Disabled())); if (a->Send.Disabled()) { a->SetCheck(false); if (i == CurrentIdentity) ResetDefault = true; } else { a->SetCheck(i == CurrentIdentity); Enabled[i] = a; } } } else { Accounts.Delete(a); DeleteObj(a); } } if (!a) break; } if ((ResetDefault || CurrentIdentity < 0) && Enabled.Length()) { for (unsigned i=0; iSetCheck(true); LVariant v; GetOptions()->SetValue(OPT_CurrentIdentity, v = (int)i); break; } } } Startup = false; if (ReceiveMenu && i == 0) { ReceiveMenu->AppendItem(LLoadString(IDS_NO_ITEMS), 0, false); } if (StatusPanel) { StatusPanel->OnAccountListChange(); } SetPulse(100); } ////////////////////////////////////////////////////////////////////////////// class LShutdown : public LDialog { LTableLayout *Tbl = NULL; LTextLabel *Msg = NULL; LButton *ActionBtn = NULL; LButton *CancelBtn = NULL; bool Disconnected = false; uint64_t WaitTs = 0; public: ScribeAccount *Waiting = NULL; LArray Accounts; LShutdown(LArray accounts) { Accounts = accounts; LRect r( 0, 0, 320 + LAppInst->GetMetric(LGI_MET_DECOR_X), 70 + LAppInst->GetMetric(LGI_MET_DECOR_Y)); SetPos(r); MoveToCenter(); LString Str; Str.Printf("%s %s", AppName, LLoadString(IDS_EXITING)); LView::Name(Str); AddView(Tbl = new LTableLayout(IDC_TABLE)); auto c = Tbl->GetCell(0, 0); c->Add(Msg = new LTextLabel(-1, 10, 10, 300, -1, LLoadString(IDS_NONE))); c = Tbl->GetCell(0, 1); c->TextAlign(LCss::AlignCenter); c->Width("100%"); c->Add(ActionBtn = new LButton(IDC_KILL, 0, 0, -1, -1, LLoadString(IDS_DISCONNECT))); c->Add(CancelBtn = new LButton(IDCANCEL, 0, 0, -1, -1, LLoadString(IDS_CANCEL))); if (ActionBtn) ActionBtn->Enabled(false); } ~LShutdown() { int asd=0; } void OnCreate() { SetPulse(100); } void OnPulse() { if (Accounts.Length()) { LArray Remove; for (auto a: Accounts) { if (!a->IsOnline()) { Remove.Add(a); if (a == Waiting) Waiting = NULL; } else if (!Waiting) { Waiting = a; LString s; LVariant v = a->Receive.Name(); s.Printf(LLoadString(IDS_WAITING_FOR), v.Str() ? v.Str() : LLoadString(IDS_NONE)); Msg->Name(s); WaitTs = LCurrentTime(); Disconnected = false; ActionBtn->Name(LLoadString(IDS_DISCONNECT)); ActionBtn->Enabled(true); } } for (auto r: Remove) Accounts.Delete(r); } else { SetPulse(); EndModal(false); } } int OnNotify(LViewI *Ctrl, LNotification n) { switch (Ctrl->GetId()) { case IDC_KILL: { if (Waiting) { WaitTs = LCurrentTime(); if (!Disconnected) { Disconnected = true; ActionBtn->Name(LLoadString(IDS_KILL)); Waiting->Disconnect(); } else { Waiting->Kill(); ActionBtn->Enabled(false); } } else { ActionBtn->Enabled(false); } break; } case IDCANCEL: { EndModal(false); break; } } return 0; } }; bool ScribeWnd::OnRequestClose(bool OsShuttingDown) { if (FolderTasks.Length() > 0) { LgiTrace("%s:%i - %i folder tasks still busy...\n", _FL, FolderTasks.Length()); return false; } LString OnClose = LAppInst->GetConfig("Scribe.OnClose"); if (!d->IngoreOnClose && !OsShuttingDown && !Stricmp(OnClose.Get(), "minimize")) { SetZoom(LZoomMin); return false; } Visible(false); if (ScribeState != ScribeRunning) { // Inside a folder load/unload or initialization // Tell the loader to quit out... ScribeState = ScribeExiting; // Leave now, we can exit when we're ready return false; } else if (IsSending() || GetActiveThreads() > 0) { // whack up a shutdown window LArray Online; for (auto i: Accounts) { i->OnEndSession(); if (i->IsOnline()) Online.Add(i); } LAssert(Online.Length() > 0); auto Dlg = new LShutdown(Online); Dlg->DoModal([this](auto dlg, auto id) { if (id) { ScribeState = ScribeExiting; LCloseApp(); } else { ScribeState = ScribeRunning; Visible(true); } delete dlg; }); return false; // At the very minimum the app has to wait for the user to respond. } else { // End all sessions if any... for (auto i: Accounts) { i->OnEndSession(); } } // close all the other top level windows while (ThingUi::All.Length() > 0) { ThingUi *Ui = ThingUi::All.First(); if (!Ui->OnRequestClose(OsShuttingDown)) { ScribeState = ScribeRunning; Visible(true); return false; } size_t Start = ThingUi::All.Length(); Ui->Quit(); if (ThingUi::All.Length() >= Start) { LAssert(0); break; } } SerializeState(GetOptions(), OPT_ScribeWndPos, false); LCloseApp(); return LWindow::OnRequestClose(OsShuttingDown); } void ScribeWnd::DoOnTimer(LScriptCallback *c) { if (!c) return; auto Now = LCurrentTime(); if (c->PrevTs) { auto Since = Now - c->PrevTs; double Sec = (double)Since / 1000.0; if (Sec >= c->fParam) { // Call the function c->PrevTs = Now; LVirtualMachine Vm; LScriptArguments Args(&Vm); LVariant This((LDom*)this); Args.Add(&This); ExecuteScriptCallback(*c, Args); } } else { c->PrevTs = Now; } } void ScribeWnd::OnMinute() { if (Folders.Length() == 0) return; // Check for calendar event alarms... Calendar::CheckReminders(); // Check for any outgoing email that should be re-attempted... ScribeFolder *Outbox = GetFolder(FOLDER_OUTBOX); if (Outbox) { bool Resend = false; for (auto t : Outbox->Items) { Mail *m = t->IsMail(); if (m && !TestFlag(m->GetFlags(), MAIL_SENT) && TestFlag(m->GetFlags(), MAIL_READY_TO_SEND) && m->SendAttempts > 0) { Resend = true; break; } } if (Resend) Send(); } LArray Cb; if (GetScriptCallbacks(LOnTimer, Cb)) { for (auto c: Cb) { if (!c->Func) continue; if (c->fParam == 0.0) { // Work out the period from 'Data' char *s = c->Data.Str(); while (*s && IsWhiteSpace(*s)) s++; char *u = s; while (*u && !IsAlpha(*u)) u++; double v = atof(s); switch (*u) { case 's': case 'S': // seconds c->fParam = v; break; case 'm': case 'M': // mins c->fParam = v * LDateTime::MinuteLength; break; case 'h': case 'H': // hours c->fParam = v * LDateTime::HourLength; break; case 'd': case 'D': // days c->fParam = v * LDateTime::DayLength; break; default: { LgiTrace("%s:%i - Couldn't understand period '%s'\n", _FL, c->Data.Str()); c->Data.Empty(); break; } } if ((c->OnSecond = c->fParam < 60.0)) { d->OnSecondTimerCallbacks.Add(c); } } if (!c->OnSecond) DoOnTimer(c); } } } void ScribeWnd::OnHour() { // Force time zone update in case of daylight savings change. LDateTime::SystemTimeZone(true); // Check if we need should be doing a software update check static bool InSoftwareCheck = false; if (!InSoftwareCheck) { char s[64]; InSoftwareCheck = true; LVariant v; if (GetOptions()->GetValue(OPT_SoftwareUpdate, v) && v.CastInt32()) { LDateTime Now, Last; Now.SetFormat(GDTF_YEAR_MONTH_DAY); Last.SetFormat(Now.GetFormat()); Now.SetNow(); if (!GetOptions()->GetValue(OPT_SoftwareUpdateLast, v) || !Last.Set(v.Str())) { // Record now as the last check point Now.Get(s, sizeof(s)); GetOptions()->SetValue(OPT_SoftwareUpdateLast, v = s); } else if (GetOptions()->GetValue(OPT_SoftwareUpdateTime, v)) { // Valid last check date/time. switch (v.CastInt32()) { case 0: // Week Last.AddDays(7); break; case 1: // Month Last.AddMonths(1); break; case 2: // Year Last.AddMonths(12); break; default: LgiTrace("%s:%i - The option '%s' is not valid\n", _FL, OPT_SoftwareUpdateTime); return; } if (Last < Now) { // Save the last date for next time... Now.Get(s, sizeof(s)); GetOptions()->SetValue(OPT_SoftwareUpdateLast, v = s); // Check for update now... GetOptions()->GetValue(OPT_SoftwareUpdateIncBeta, v); IsSoftwareUpToDate( this, false, v.CastInt32() != 0, [this](auto s, auto Info) { if (s == SwOutOfDate) if (UpgradeSoftware(Info, this, true)) LCloseApp(); }); } } } InSoftwareCheck = false; } } bool ScribeWnd::SaveDirtyObjects(int TimeLimitMs) { bool Status = false; if (Thing::DirtyThings.Length() > 0) { static bool SavingObjects = false; if (!SavingObjects) { SavingObjects = true; LArray WriteTimes; // ssize_t StartDirty = Thing::DirtyThings.Length(); uint64 Start = LCurrentTime(); for (unsigned i=0; iSave(NULL)) { WriteTimes.Add((int) (LCurrentTime() - WriteStart)); LAssert(!ThingType::DirtyThings.HasItem(t)); Status = true; } else { LgiTrace("Failed to save thing type 0x%x\n", t->Type()); FailedWrites++; if (FailedWrites > 2) { while (ThingType::DirtyThings.Length()) ThingType::DirtyThings[0]->SetDirty(false); FailedWrites = 0; } } } } SavingObjects = false; /* if (Status) { LStringPipe p; p.Print("WriteTimes: "); for (unsigned i=0; iLastTs >= 1000) { d->LastTs = Now; OnPulseSecond(); } } } void ScribeWnd::OnPulseSecond() { #if PROFILE_ON_PULSE LProfile Prof("NewMailLst handling"); Prof.HideResultsIfBelow(50); #endif if (Mail::NewMailLst.Length() > 0) { LVariant Blink; if (GetOptions()->GetValue(OPT_BlinkNewMail, Blink) && Blink.CastInt32()) { TrayIcon.Value((TrayIcon.Value() == TRAY_ICON_MAIL) ? TRAY_ICON_NONE : TRAY_ICON_MAIL); } } else { bool Err = false; for (auto a: Accounts) { if (!a->Receive.GetStatus() || !a->Send.GetStatus()) { Err = true; } } TrayIcon.Value(Err ? TRAY_ICON_ERROR : TRAY_ICON_NORMAL); } #if PROFILE_ON_PULSE Prof.Add("StatusPanel handling"); #endif if (StatusPanel) { StatusPanel->OnPulse(); } #if PROFILE_ON_PULSE Prof.Add("OnXXXX handling"); #endif LDateTime Now; Now.SetNow(); if (d->LastMinute != Now.Minutes()) // Check every minute... { d->LastMinute = Now.Minutes(); OnMinute(); } if (d->LastHour != Now.Hours()) // Check every hour... { d->LastHour = Now.Hours(); OnHour(); } { // These timers need to be checked every second... for (auto c: d->OnSecondTimerCallbacks) DoOnTimer(c); } #if PROFILE_ON_PULSE Prof.Add("Instance handling"); #endif if (ThisInst && ValidStr(ThisInst->Args)) { LStringPipe p; p.Push(ThisInst->Args); if (ThisInst->Flags & SCRIBE_IPC_LONG_ARGS) { ThisInst->Flags |= SCRIBE_IPC_CONTINUE_ARGS; int64 Start = LCurrentTime(); while ( TestFlag(ThisInst->Flags, SCRIBE_IPC_LONG_ARGS) && LCurrentTime() - Start < 60000) { ZeroObj(ThisInst->Args); while ( TestFlag(ThisInst->Flags, SCRIBE_IPC_LONG_ARGS) && !ThisInst->Args[0] && LCurrentTime() - Start < 60000) { LSleep(10); } p.Push(ThisInst->Args); } } ZeroObj(ThisInst->Args); LAutoString Arg(p.NewStr()); if (Arg) { OsAppArguments AppArgs(0, 0); LgiTrace("Received cmd line: %s\n", Arg.Get()); AppArgs.Set(Arg); LAppInst->SetAppArgs(AppArgs); if (LAppInst->GetOption("m") && LAppInst->GetOption("f")) ; else LAppInst->OnCommandLine(); OnCommandLine(); if (GetZoom() == LZoomMin) SetZoom(LZoomNormal); Visible(true); } } #if PROFILE_ON_PULSE Prof.Add("PreviewPanel handling"); #endif if (PreviewPanel) { PreviewPanel->OnPulse(); } } void ScribeWnd::AddFolderToMru(char *FileName) { if (FileName) { // read MRU List Files; int i; for (i=0; i<10; i++) { char Key[32]; LVariant f; sprintf_s(Key, sizeof(Key), "FolderMru.%i", i); if (GetOptions()->GetValue(Key, f)) { Files.Insert(NewStr(f.Str())); GetOptions()->DeleteValue(Key); } } // remove FileName if present for (auto f: Files) { if (_stricmp(f, FileName) == 0) { Files.Delete(f); DeleteArray(f); break; } } // insert FileName at the start of the list Files.Insert(NewStr(FileName)); // write MRU for (i=0; i<10; i++) { char *n = Files.ItemAt(i); if (n) { char Key[32]; sprintf_s(Key, sizeof(Key), "FolderMru.%i", i); LVariant f; GetOptions()->SetValue(Key, f = n); } else break; } // Clean up Files.DeleteArrays(); } } bool ScribeWnd::CleanFolders(ScribeFolder *f) { if (!f) return false; if (f->Select()) { f->SerializeFieldWidths(); } for (ScribeFolder *c = f->GetChildFolder(); c; c = c->GetNextFolder()) { CleanFolders(c); } return true; } void ScribeWnd::OnFolderChanged(LDataFolderI *folder) { } bool ScribeWnd::OnFolderTask(LEventTargetI *Ptr, bool Add) { if (Add) { if (FolderTasks.HasItem(Ptr)) { LAssert(!"Can't add task twice."); return false; } FolderTasks.Add(Ptr); return true; } else { if (!FolderTasks.HasItem(Ptr)) { LAssert(!"Item not part of task list."); return false; } FolderTasks.Delete(Ptr); return true; } } LMailStore *ScribeWnd::GetDefaultMailStore() { LMailStore *Def = 0; for (unsigned i=0; i Def->Priority()) { Def = &Folders[i]; } } } } return Def; } bool HasMailStore(LXmlTag *MailStores, char *Name) { for (auto t : MailStores->Children) { char *StoreName = t->GetAttr(OPT_MailStoreName); if (StoreName && Name && !_stricmp(StoreName, Name)) return true; } return false; } LDataStoreI *ScribeWnd::CreateDataStore(const char *_Full, bool CreateIfMissing) { LString Full(_Full); auto Ext = LGetExtension(Full); if (Ext) { if (!_stricmp(Ext, "mail2")) { LgiMsg(this, LLoadString(IDS_MAIL2_DEPRECATED), AppName, MB_OK, Full.Get()); } else if (!_stricmp(Ext, "mail3")) { return OpenMail3(Full, this, CreateIfMissing); } else if (!_stricmp(Ext, "sqlite")) { LTrimDir(Full); return OpenMail3(Full, this, CreateIfMissing); } else { LgiTrace("%s:%i - Not a valid mail store extension: %s\n", _FL, Full.Get()); LAssert(!"Not a valid mail store extension."); } } else LgiTrace("%s:%i - No extension for CreateDataStore: %s\n", _FL, Full.Get()); return NULL; } class MailStoreUpgrade : public LProgressDlg, public LDataPropI { public: ScribeWnd *App = NULL; LDataStoreI *Ds = NULL; int Status = -1; LString Error; MailStoreUpgrade(ScribeWnd *app, LDataStoreI *ds) : LProgressDlg(app, -1) { SetParent(App = app); Ds = ds; SetCanCancel(false); SetDescription("Upgrading mail store..."); SetPulse(1000); Ds->Upgrade(this, this, [this](auto status) { Status = status; }); } ~MailStoreUpgrade() { } void OnPulse() override { if (Status >= 0) { EndModal(0); return; } return LProgressDlg::OnPulse(); } LDataPropI &operator =(LDataPropI &p) { LAssert(0); return *this; } Store3Status SetStr(int id, const char *str) override { switch (id) { case Store3UiError: Error = str; break; default: LAssert(!"Impl me."); return Store3Error; break; } return Store3Success; } }; bool ScribeWnd::ProcessFolder(LDataStoreI *&Store, int StoreIdx, char *StoreName) { if (Store->GetInt(FIELD_VERSION) == 0) { // version error LgiMsg(this, LLoadString(IDS_ERROR_FOLDERS_VERSION), AppName, MB_OK, 0, Store->GetInt(FIELD_VERSION)); return false; } if (Store->GetInt(FIELD_READONLY)) { LgiMsg(this, LLoadString(IDS_ERROR_READONLY_FOLDERS), AppName); } // get root item LDataFolderI *Root = Store->GetRoot(); if (!Root) return false; ScribeFolder *&Mailbox = Folders[StoreIdx].Root; Mailbox = new ScribeFolder; if (Mailbox) { Mailbox->App = this; Mailbox->SetObject(Root, false, _FL); Root->SetStr(FIELD_FOLDER_NAME, StoreName); Root->SetInt(FIELD_FOLDER_TYPE, MAGIC_NONE); } #ifdef TEST_OBJECT_SIZE // debug/repair code if (Root->StoreSize != Root->Sizeof()) { SizeErrors[0]++; Root->StoreSize = Root->Sizeof(); if (Root->Object) { Root->Object->StoreDirty = true; } } #endif // Insert the root object and then... Tree->Insert(Mailbox); // Recursively load the rest of the tree { // LProfile p("Loadfolders"); Mailbox->LoadFolders(); } // This forces a re-pour to re-order the folders according to their // sort settings. Tree->UpdateAllItems(); if (ScribeState != ScribeExiting) { // Show the tree Mailbox->Expanded(Folders[StoreIdx].Expanded); // Checks the folders for a number of required objects // and creates them if required auto StoreType = Store->GetInt(FIELD_STORE_TYPE); if (StoreType == Store3Sqlite) Validate(&Folders[StoreIdx]); else if (StoreType < 0) LAssert(!"Make sure you impl the FIELD_STORE_TYPE field in the store."); // FIXME // AddFolderToMru(Full); } return true; } struct LoadMailStoreState : public LView::ViewEventTarget { typedef std::function BoolCb; typedef std::function IntCb; ScribeWnd *App; BoolCb Callback; // Final cb for entire LoadMailStoreState execution LOptionsFile *Options = NULL; LXmlTag *MailStores = NULL; LArray Que; int StoreIdx = 0; bool OptionsDirty = false; bool Status = false; std::function ReturnWithEvent; std::function ReturnOnDialog; std::function AskStoreUpgrade; LoadMailStoreState(ScribeWnd *app, std::function callback) : ViewEventTarget(app, M_LOAD_NEXT_MAIL_STORE), App(app), Callback(callback) { Options = App->GetOptions(); ReturnWithEvent = [this](bool s) { PostEvent(M_LOAD_NEXT_MAIL_STORE); return s; }; ReturnOnDialog = [this](bool s) { return s; }; AskStoreUpgrade = [this](auto FolderPath, auto Details, auto cb) { auto result = LgiMsg(App, LLoadString(IDS_MAILSTORE_UPGRADE_Q), AppName, MB_YESNO, FolderPath, ValidStr(Details) ? Details : "n/a"); cb(result); }; MailStores = Options->LockTag(OPT_MailStores, _FL); // Load up some work in the queue and start the iteration... if (MailStores) Que = MailStores->Children; } void Start() { PostEvent(M_LOAD_NEXT_MAIL_STORE); } bool OnStatus(bool b) { if (MailStores) Options->Unlock(); if (OptionsDirty) App->SaveOptions(); if (Callback) Callback(b); delete this; return b; } LMessage::Result OnEvent(LMessage *Msg) override { if (Msg->Msg() == M_LOAD_NEXT_MAIL_STORE) { if (!MailStores) OnStatus(false); else Iterate(); } return 0; } // This will process one item off the Que, // Or if no work is available call PostIterate to // finish the process. // // In most cases this function should complete with // ReturnWithEvent to trigger the next iteration... bool Iterate() { // No more work, so do the completion step: if (Que.Length() == 0) return PostIterate(); // There are 2 exits modes for this function: // // 1) Normal exit where we should post a M_LOAD_NEXT_MAIL_STORE to ourselves to // start the next iteration by calling ReturnWithEvent. // // 2) A dialog was launched and we should NOT post a M_LOAD_NEXT_MAIL_STORE event // by calling ReturnOnDialog. The dialog's callback will do that later. // Get the next Xml tag off the queue: auto MailStore = Que[0]; Que.DeleteAt(0, true); if (!MailStore->IsTag(OPT_MailStore)) return ReturnWithEvent(false); // Read the folders.. auto Path = MailStore->GetAttr(OPT_MailStoreLocation); auto ContactUrl = MailStore->GetAttr(OPT_MailStoreContactUrl); auto CalUrl = MailStore->GetAttr(OPT_MailStoreCalendarUrl); if (!Path && !ContactUrl && !CalUrl) { LgiTrace("%s:%i - No mail store path (%i).\n", _FL, StoreIdx); return ReturnWithEvent(false); } // If disabled, skip: if (MailStore->GetAsInt(OPT_MailStoreDisable) > 0) return ReturnWithEvent(false); // Check and validate the folder name: auto StoreName = MailStore->GetAttr(OPT_MailStoreName); if (!StoreName) { char Tmp[256]; for (int i=1; true; i++) { sprintf_s(Tmp, sizeof(Tmp), "Folders%i", i); if (!HasMailStore(MailStores, Tmp)) break; } MailStore->SetAttr(OPT_MailStoreName, Tmp); StoreName = MailStore->GetAttr(OPT_MailStoreName); OptionsDirty = true; } // Build a LMailStore entry in App->Folders: auto &Folder = App->Folders[StoreIdx]; Folder.Name = StoreName; if (Path) { // Mail3 folders on disk... LFile::Path p; if (LIsRelativePath(Path)) { p = Options->GetFile(); p--; p += Path; } else p = Path; auto Full = p.GetFull(); LVariant CreateFoldersIfMissing; Options->GetValue(OPT_CreateFoldersIfMissing, CreateFoldersIfMissing); // Sniff type... auto Ext = LGetExtension(Full); if (!Ext) return ReturnWithEvent(false); if (!Folder.Store) Folder.Store = App->CreateDataStore(Full, CreateFoldersIfMissing.CastInt32() != 0); if (!Folder.Store) { LgiTrace("%s:%i - Failed to create data store for '%s'\n", _FL, Full.Get()); return ReturnWithEvent(false); } Folder.Path = Full; } else if (ContactUrl || CalUrl) { // Remove Webdav folders... Folder.Store = new WebdavStore(App, App, StoreName); } else { return ReturnWithEvent(false); } LDataStoreI *&Store = Folder.Store; auto ex = MailStore->GetAsInt(OPT_MailStoreExpanded); if (ex >= 0) Folder.Expanded = ex != 0; // Check if the mail store requires upgrading... auto MsState = (Store3Status)Store->GetInt(FIELD_STATUS); if (MsState == Store3UpgradeRequired) { LgiTrace("%s:%i - this=%p\n", _FL, this); auto Details = Store->GetStr(FIELD_STATUS); AskStoreUpgrade(Folder.Path.Get(), ValidStr(Details) ? Details : "n/a", [this, Store, MailStore](auto result) { if (result == IDYES) { auto Prog = new MailStoreUpgrade(App, Store); Prog->DoModal([this, MailStore](auto dlg, auto code) { // Upgrade complete, finish the iteration.. Iterate2(MailStore); delete dlg; }); return; } // Upgrade not allowed, so do next iteration... ReturnWithEvent(false); }); return ReturnOnDialog(true); } else if (MsState == Store3Error) { auto ErrMsg = Store->GetStr(FIELD_ERROR); auto a = new LAlert(App, AppName, ErrMsg ? ErrMsg : LLoadString(IDS_ERROR_FOLDERS_STATUS), LLoadString(IDS_EDIT_MAIL_STORES), LLoadString(IDS_OK)); a->DoModal([this](auto dlg, auto code) { delete dlg; if (code == 1) { App->PostEvent(M_COMMAND, IDM_MANAGE_MAIL_STORES); // This fails the whole LoadMailStores process, because the user // is going to edit the mail store list via the dialog; OnStatus(false); } else { // We can't load this mail store, so do the next iteration... ReturnWithEvent(true); } }); return ReturnOnDialog(false); } // No upgrade or error, just keep going. return Iterate2(MailStore); } // This also should complete by calling ReturnWithEvent/ReturnOnDialog. bool Iterate2(LXmlTag *MailStore) { auto &Folder = App->Folders[StoreIdx]; auto StoreName = MailStore->GetAttr(OPT_MailStoreName); // check password LString FolderPsw; if ((FolderPsw = Folder.Store->GetStr(FIELD_STORE_PASSWORD))) { bool Verified = false; if (ValidStr(App->d->MulPassword)) { Verified = App->d->MulPassword.Equals(FolderPsw, false); App->d->MulPassword.Empty(); } if (!Verified) { auto Dlg = new LInput(App, "", LLoadString(IDS_ASK_FOLDER_PASS), AppName, true); Dlg->DoModal([this, Dlg, FolderPsw, StoreName](auto dlg, auto id) { auto psw = Dlg->GetStr(); delete dlg; if (id == IDOK) { auto &Folder = App->Folders[StoreIdx]; if (psw == FolderPsw) { Status |= App->ProcessFolder(Folder.Store, StoreIdx, StoreName); } else { // Clear the folder and don't increment the StoreIdx... Folder.Empty(); App->Folders.PopLast(); ReturnWithEvent(false); return; } } Iterate3(); }); return ReturnOnDialog(true); } } else { Status |= App->ProcessFolder(Folder.Store, StoreIdx, StoreName); } return Iterate3(); } bool Iterate3() { StoreIdx++; return ReturnWithEvent(true); } bool PostIterate() { if (Status) { // Force load some folders... ScribeFolder *Folder = App->GetFolder(FOLDER_CALENDAR); if (Folder) Folder->LoadThings(); Folder = App->GetFolder(FOLDER_FILTERS); if (Folder) Folder->LoadThings(); for (auto ms: App->Folders) { if (!ms.Root) continue; for (auto c = ms.Root->GetChildFolder(); c; c = c->GetNextFolder()) { if (c->GetItemType() == MAGIC_CONTACT || c->GetItemType() == MAGIC_FILTER) c->LoadThings(); } } List c; App->GetContacts(c); // Set selected folder to Inbox by default // if the user hasn't selected a folder already if (App->ScribeState != ScribeWnd::ScribeExiting && App->Tree && !App->Tree->Selection()) { LVariant StartInFolder; Options->GetValue(OPT_StartInFolder, StartInFolder); ScribeFolder *Start = NULL; if (ValidStr(StartInFolder.Str())) { Start = App->GetFolder(StartInFolder.Str()); } if (!Start) { Start = App->GetFolder(FOLDER_INBOX); } if (Start && App->Tree) { App->Tree->Select(Start); } } } Options->DeleteValue(OPT_CreateFoldersIfMissing); // Set system folders ScribeFolder *f = App->GetFolder(FOLDER_INBOX); if (f) f->SetSystemFolderType(Store3SystemInbox); f = App->GetFolder(FOLDER_OUTBOX); if (f) f->SetSystemFolderType(Store3SystemOutbox); f = App->GetFolder(FOLDER_SENT); if (f) f->SetSystemFolderType(Store3SystemSent); f = App->GetFolder(FOLDER_SPAM); if (f) f->SetSystemFolderType(Store3SystemSpam); return OnStatus(Status); } }; void ScribeWnd::LoadMailStores(std::function Callback) { if (auto s = new LoadMailStoreState(this, Callback)) s->Start(); } void ScribeWnd::LoadFolders(std::function Callback) { AppState PrevState = ScribeState; ScribeState = ScribeLoadingFolders; // Setup Mailstores tag { LXmlTag *MailStores = GetOptions()->LockTag(OPT_MailStores, _FL); if (!MailStores) { // Check if we can upgrade the old folder tag char n[32]; sprintf_s(n, sizeof(n), "%s-Folders", LGetOsName()); LVariant OldFolders; GetOptions()->GetValue(n, OldFolders); // Create mail store element.. GetOptions()->CreateTag(OPT_MailStores); if ((MailStores = GetOptions()->LockTag(OPT_MailStores, _FL))) { if (OldFolders.Str()) { LXmlTag *Store = MailStores->CreateTag(OPT_MailStore); if (Store) { char Opts[MAX_PATH_LEN]; LMakePath(Opts, sizeof(Opts), GetOptions()->GetFile(), ".."); auto Rel = LMakeRelativePath(Opts, OldFolders.Str()); Store->SetAttr(OPT_MailStoreLocation, Rel ? Rel.Get() : OldFolders.Str()); // No need to ask the user for a store name, it'll be // asked later in this method anyway... // Leave the old folder tag in the xml in case the user // downgrades to v1.xx } } } } GetOptions()->Unlock(); if (!MailStores) { if (Callback) Callback(false); return; } } // Set loading flags CmdSend.Enabled(false); CmdReceive.Enabled(false); CmdPreview.Enabled(false); LoadMailStores([this, PrevState, Callback](auto Status) { if (Tree) { for (auto a: Accounts) { if (!a->Receive.Disabled() && a->Receive.IsPersistant()) a->Receive.Connect(0, false); } } using BoolFn = std::function; auto FinishLoad = new BoolFn ( [this, PrevState, Callback](bool Status) { if (ScribeState == ScribeExiting) { LCloseApp(); } else { d->FoldersLoaded = true; PostEvent(M_SCRIBE_LOADED); } if (ScribeState == ScribeExiting) LCloseApp(); ScribeState = PrevState; if (Callback) Callback(Status); } ); if (Folders.Length() == 0) { auto Dlg = new ScribeFolderDlg(this); Dlg->DoModal([this, Dlg, FinishLoad, Callback, &Status](auto dlg, auto id) { if (id == IDOK) { bool CreateMailStore = false; if (Dlg->Create) { // create folders if (LFileExists(Dlg->FolderFile)) { if (LgiMsg(this, LLoadString(IDS_ERROR_FOLDERS_ALREADY_EXIST), AppName, MB_YESNO) == IDYES) CreateMailStore = true; else LgiMsg(this, LLoadString(IDS_ERROR_WONT_OVERWRITE_FOLDERS), AppName); } else if ((Status = CreateFolders(Dlg->FolderFile))) CreateMailStore = true; } else CreateMailStore = true; if (CreateMailStore) { LXmlTag *MailStores = GetOptions()->LockTag(OPT_MailStores, _FL); if (MailStores) { LXmlTag *Store = MailStores->CreateTag(OPT_MailStore); if (Store) { char p[MAX_PATH_LEN]; LMakePath(p, sizeof(p), GetOptions()->GetFile(), ".."); auto RelPath = LMakeRelativePath(p, Dlg->FolderFile); Store->SetAttr(OPT_MailStoreLocation, RelPath ? RelPath.Get() : Dlg->FolderFile.Get()); } GetOptions()->Unlock(); LoadMailStores(NULL); } } } if (id) (*FinishLoad)(Status); else if (Callback) Callback(false); delete FinishLoad; delete dlg; }); } else { (*FinishLoad)(Status); delete FinishLoad; } }); } bool ScribeWnd::UnLoadFolders() { if (FolderTasks.Length() > 0 || ScribeState == ScribeLoadingFolders) { // Um, we can't unload folders right now // something is already happening... return false; } AppState PrevState = ScribeState; ScribeState = ScribeUnloadingFolders; OnSelect(); if (MailList) { ScribeFolder *Container = MailList->GetContainer(); if (Container) { // save folder settings Container->SerializeFieldWidths(); } MailList->SetContainer(NULL); MailList->RemoveAll(); } int Error = 0; while (Thing::DirtyThings.Length() > 0) { if (!SaveDirtyObjects()) { Error++; LgiTrace("%s:%i - SaveDirtyObjects failed.\n", _FL); if (Error > 100) { // I think we're stuck... return false; } } } // Unload IMAP folders... for (auto a: Accounts) { if (!a->Receive.Disabled() && a->Receive.IsPersistant()) { a->Receive.Disconnect(); } } if (GetOptions()) { // Unload local folders... LXmlTag *MailStores = GetOptions()->LockTag(OPT_MailStores, _FL); for (size_t i=0; iExpanded(); for (auto ms: MailStores->Children) { char *StoreName = ms->GetAttr(OPT_MailStoreName); if (Folders[i].Name.Equals(StoreName)) { ms->SetAttr(OPT_MailStoreExpanded, Expanded); break; } } } DeleteObj(Folders[i].Root); DeleteObj(Folders[i].Store); } if (MailStores) { GetOptions()->Unlock(); MailStores = NULL; } } Folders.Length(0); d->FoldersLoaded = false; if (ScribeState == ScribeExiting) LCloseApp(); ScribeState = PrevState; return true; } void ScribeWnd::BuildDynMenus() { if (MailMenu) { LString SendMail = LLoadString(IDS_SEND_MAIL); LString ReceiveMail = LLoadString(IDS_RECEIVE_MAIL); LString PreviewMail = LLoadString(IDS_PREVIEW_ON_SERVER); auto ReceiveAll = LLoadString(IDS_RECEIVE_ALL_ACCOUNTS); if (!CmdReceive.MenuItem && ReceiveAll) CmdReceive.MenuItem = MailMenu->AppendItem(ReceiveAll, IDM_RECEIVE_ALL, true); if (!SendMenu && SendMail) { auto s = SendMail.SplitDelimit("\t"); SendMenu = MailMenu->AppendSub(s[0]); } if (!ReceiveMenu && ReceiveMail) { auto s = ReceiveMail.SplitDelimit("\t"); ReceiveMenu = MailMenu->AppendSub(s[0]); } if (!PreviewMenu && PreviewMail) { auto s = PreviewMail.SplitDelimit("\t"); PreviewMenu = MailMenu->AppendSub(s[0]); } } if (!NewTemplateMenu) { auto i = Menu->FindItem(IDM_NO_TEMPLATES); if (i) { NewTemplateMenu = i->GetParent(); } } if (NewTemplateMenu) { NewTemplateMenu->Empty(); int d = 0; ScribeFolder *Templates = GetFolder(FOLDER_TEMPLATES, NULL, true); if (Templates) { Templates->LoadThings(); for (auto i: Templates->Items) { Mail *m = i->IsMail(); if (m) { NewTemplateMenu->AppendItem(m->GetSubject() ? m->GetSubject() : (char*)"(no subject)", IDM_NEW_FROM_TEMPLATE + d, true); d++; } } if (d == 0) { NewTemplateMenu->AppendItem(LLoadString(IDS_NO_ITEMS_IN_FOLDER), -1, false); } } else { NewTemplateMenu->AppendItem(LLoadString(IDS_NO_TEMPLATES), -1, false); } } } int ScribeWnd::GetToolbarHeight() { return (Commands) ? MAX(Commands->Y()-1, 20) : 20; } LToolBar *ScribeWnd::LoadToolbar(LViewI *Parent, const char *File, LAutoPtr &Img) { if (!Img) Img.Reset(LLoadImageList(File)); if (!Img) { LAssert(!"Missing image resource."); return NULL; } LToolBar *Tools = NULL; if (Img) { Tools = new LToolBar; if (Tools) Tools->SetImageList(Img, Img->TileX(), Img->TileY(), false); } else { Tools = LgiLoadToolbar(Parent, File); } if (Tools) { LVariant SizeAdj; LFont *f = Tools->GetFont(); if (f) { if (GetOptions()->GetValue(OPT_UiFontSize, SizeAdj)) { SizeAdj.Cast(GV_INT32); SizeAdj.Value.Int -= 2; f->PointSize(f->PointSize()+SizeAdj.Value.Int); } } Tools->GetCss(true)->BorderSpacing(LCss::Len(LCss::LenPx, SCRIBE_TOOLBAR_BORDER_SPACING_PX)); Tools->TextLabels(ShowToolbarText()); } return Tools; } void ScribeWnd::SetListPane(LView *v) { ThingList *ThingLst = dynamic_cast(v); DynamicHtml *Html = dynamic_cast(v); if (!ThingLst) { DeleteObj(SearchView); if (MailList) MailList->RemoveAll(); } v->Sunken(SUNKEN_CTRL); if ((MailList = ThingLst)) { DeleteObj(TitlePage); if (GetCtrlValue(IDM_ITEM_FILTER)) { OnCommand(IDM_ITEM_FILTER, 0, NULL); } } else { TitlePage = Html; } SetLayout(); } bool ScribeWnd::SetItemPreview(LView *v) { v->Sunken(SUNKEN_CTRL); if (d->SubSplit->IsAttached()) { if (d->LastLayout == 2) { Splitter->SetViewAt(1, v); } else { d->SubSplit->SetViewAt(1, v); } return true; } return false; } ScribeWnd::LayoutMode ScribeWnd::GetEffectiveLayoutMode() { LVariant Mode; GetOptions()->GetValue(OPT_LayoutMode, Mode); ScribeFolder *Cur = GetCurrentFolder(); if (Cur && Cur->IsRoot()) { Mode = FoldersAndList; } if (Mode.CastInt32() == 0) { Mode = FoldersListAndPreview; } return (LayoutMode) Mode.CastInt32(); } void ScribeWnd::SetLayout(LayoutMode Mode) { // int TreeWidth = Tree ? Tree->X() : 200; // int PreviewHt = PreviewPanel ? PreviewPanel->Y() : 200; if (Mode > 0) { LVariant v; GetOptions()->SetValue(OPT_LayoutMode, v = (int)Mode); } Mode = GetEffectiveLayoutMode(); if (!Splitter) return; bool JustPreviewPane = (Mode == FoldersAndList && d->LastLayout == FoldersListAndPreview) || (Mode == FoldersListAndPreview && d->LastLayout == FoldersAndList); LView *Content = NULL; if (TitlePage) Content = TitlePage; else if (MailList) Content = MailList; if (JustPreviewPane) { // Optimized path for hide/show the preview pane that doesn't destroy the tree // control and cause it to lose focus... otherwise we can't set it's focus due // to some weird windows interaction. switch (Mode) { default: case FoldersListAndPreview: { if (Content) Content->Sunken(SUNKEN_CTRL); if (PreviewPanel) PreviewPanel->Sunken(SUNKEN_CTRL); Splitter->SetViewAt(1, d->SubSplit); d->SubSplit->SetVertical(true); int Idx = 0; if (SearchView) d->SubSplit->SetViewAt(Idx++, SearchView); d->SubSplit->SetViewAt(Idx++, Content); d->SubSplit->SetViewAt(Idx++, PreviewPanel); break; } case FoldersAndList: { if (Content) Content->Sunken(SUNKEN_CTRL); if (SearchView) { #if LGI_VIEW_HANDLE if (!d->SubSplit->Handle()) Splitter->SetViewAt(1, d->SubSplit); #endif d->SubSplit->SetVertical(true); Splitter->SetViewAt(1, d->SubSplit); int Idx = 0; if (SearchView) d->SubSplit->SetViewAt(Idx++, SearchView); d->SubSplit->SetViewAt(Idx++, Content); } else { d->SubSplit->Detach(); Splitter->SetViewAt(1, Content); } break; } } } else { if (Tree) Tree->Sunken(SUNKEN_CTRL); if (Content) Content->Sunken(SUNKEN_CTRL); if (PreviewPanel) PreviewPanel->Sunken(SUNKEN_CTRL); switch (Mode) { default: case FoldersListAndPreview: { Splitter->SetVertical(false); d->SubSplit->SetVertical(true); Splitter->SetViewAt(0, Tree); Splitter->SetViewAt(1, d->SubSplit); int Idx = 0; if (SearchView) d->SubSplit->SetViewAt(Idx++, SearchView); d->SubSplit->SetViewAt(Idx++, Content); d->SubSplit->SetViewAt(Idx++, PreviewPanel); DeleteObj(d->SearchSplit); break; } case PreviewOnBottom: { Splitter->SetVertical(true); d->SubSplit->SetVertical(false); Splitter->SetViewAt(0, d->SubSplit); Splitter->SetViewAt(1, PreviewPanel); d->SubSplit->SetViewAt(0, Tree); if (SearchView) { if (!d->SearchSplit) d->SearchSplit = new LBox; d->SubSplit->SetViewAt(1, d->SearchSplit); d->SearchSplit->SetVertical(true); d->SearchSplit->SetViewAt(0, SearchView); d->SearchSplit->SetViewAt(1, Content); } else { d->SubSplit->SetViewAt(1, Content); DeleteObj(d->SearchSplit); } break; } case FoldersAndList: { Splitter->SetVertical(false); Splitter->SetViewAt(0, Tree); if (SearchView) { d->SubSplit->SetVertical(true); Splitter->SetViewAt(1, d->SubSplit); d->SubSplit->SetViewAt(0, SearchView); d->SubSplit->SetViewAt(1, Content); } else { d->SubSplit->Detach(); Splitter->SetViewAt(1, Content); } DeleteObj(d->SearchSplit); break; } case ThreeColumn: { Splitter->SetVertical(false); Splitter->SetViewAt(0, Tree); if (SearchView) { d->SubSplit->SetVertical(true); Splitter->SetViewAt(1, d->SubSplit); d->SubSplit->SetViewAt(0, SearchView); d->SubSplit->SetViewAt(1, Content); } else { d->SubSplit->Detach(); Splitter->SetViewAt(1, Content); } Splitter->SetViewAt(2, PreviewPanel); DeleteObj(d->SearchSplit); break; } } } if (!SearchView) { LVariant Pos = 200; GetOptions()->GetValue(OPT_SplitterPos, Pos); if (Pos.CastInt32() < 10) Pos = 200; Splitter->Value(Pos.CastInt32()); LRect r = Splitter->GetPos(); r.x2++; Splitter->SetPos(r); if (d->SubSplit->IsAttached()) { Pos = 200; GetOptions()->GetValue(OPT_SubSplitPos, Pos); if (Pos.CastInt32() < 10) Pos = 200; d->SubSplit->Value(Pos.CastInt32()); } } PourAll(); - #ifdef LINUX - LYield(); - #endif - d->LastLayout = Mode; } void ScribeWnd::SetupUi() { // Show the window if (!SerializeState(GetOptions(), OPT_ScribeWndPos, true)) { LRect r(0, 0, 1023, 767); SetPos(r); MoveToCenter(); } Visible(true); // Main toolbar Commands = LoadToolbar(this, GetResourceFile(ResToolbarFile), ToolbarImgs); if (Commands) { Commands->Attach(this); #ifdef MAC Commands->Raised(false); #else Commands->Raised(RAISED_LOOK); #endif Commands->AppendButton(RemoveAmp(LLoadString(IDS_NEW_EMAIL)), IDM_NEW_EMAIL, TBT_PUSH, true, IMG_NEW_MAIL); Commands->AppendButton(RemoveAmp(LLoadString(IDS_NEW_CONTACT)), IDM_NEW_CONTACT, TBT_PUSH, true, IMG_NEW_CONTACT); Commands->AppendSeparator(); CmdSend.ToolButton = Commands->AppendButton(RemoveAmp(LLoadString(IDS_SEND)), IDM_SEND_MAIL, TBT_PUSH, true, IMG_SEND); Commands->AppendButton("+", IDM_RECEIVE_AND_SEND, TBT_PUSH, true, -2); CmdReceive.ToolButton = Commands->AppendButton(RemoveAmp(LLoadString(IDS_RECEIVE)), IDM_RECEIVE_MAIL, TBT_PUSH, true, IMG_RECEIVE); CmdPreview.ToolButton = Commands->AppendButton(RemoveAmp(LLoadString(IDS_PREVIEW)), IDM_PREVIEW_POP3, TBT_PUSH, true, IMG_PREVIEW); Commands->AppendSeparator(); Commands->AppendButton(RemoveAmp(LLoadString(IDS_DELETE)), IDM_DELETE, TBT_PUSH, true, IMG_TRASH); Commands->AppendButton(RemoveAmp(LLoadString(IDS_SPAM)), IDM_DELETE_AS_SPAM, TBT_PUSH, true, IMG_DELETE_SPAM); Commands->AppendSeparator(); Commands->AppendButton(RemoveAmp(LLoadString(IDS_REPLY)), IDM_REPLY, TBT_PUSH, true, IMG_REPLY); Commands->AppendButton(RemoveAmp(LLoadString(IDS_REPLYALL)), IDM_REPLY_ALL, TBT_PUSH, true, IMG_REPLY_ALL); Commands->AppendButton(RemoveAmp(LLoadString(IDS_FORWARD)), IDM_FORWARD, TBT_PUSH, true, IMG_FORWARD); Commands->AppendButton(RemoveAmp(LLoadString(IDS_BOUNCE)), IDM_BOUNCE, TBT_PUSH, true, IMG_BOUNCE); Commands->AppendSeparator(); Commands->AppendButton(RemoveAmp(LLoadString(IDS_PRINT)), IDM_PRINT, TBT_PUSH, true, IMG_PRINT); Commands->AppendButton(RemoveAmp(LLoadString(IDS_CALENDAR)), IDM_CALENDAR, TBT_PUSH, true, IMG_CALENDAR); Commands->AppendButton(RemoveAmp(LLoadString(IDS_ITEM_FILTER)), IDM_ITEM_FILTER, TBT_TOGGLE, true, IMG_SEARCH); Commands->AppendButton(RemoveAmp(LLoadString(IDS_THREAD)), IDM_THREAD, TBT_TOGGLE, true, IMG_THREADS); d->ShowConsoleBtn = Commands->AppendButton(RemoveAmp(LLoadString(IDS_SHOW_CONSOLE)), IDM_SHOW_CONSOLE, TBT_PUSH, true, IMG_CONSOLE_NOMSG); Commands->AppendSeparator(); Commands->AppendButton(RemoveAmp(LLoadString(IDS_HELP)), IDM_HELP, TBT_PUSH, true, IMG_HELP); Commands->Customizable(GetOptions(), OPT_ScribeWndToolbar); if (d->ScriptToolbar.Reset(new LScriptUi(Commands))) d->ScriptToolbar->SetupCallbacks(this, 0, 0, LApplicationToolbar); PourAll(); } CmdSend.Enabled(false); CmdReceive.Enabled(false); // Preview and status windows PreviewPanel = new LPreviewPanel(this); StatusPanel = new AccountStatusPanel(this, ImageList); if (PreviewPanel && StatusPanel) { #ifdef MAC StatusPanel->Raised(false); #else StatusPanel->Raised(RAISED_LOOK); #endif StatusPanel->Attach(this); PourAll(); } // Splitter window, for folders and item list Tree = new MailTree(this); if (ImageList) { Tree->AskImage(true); Tree->SetImageList(ImageList, false); } d->SubSplit = new LBox; Splitter = new LBox; if (Splitter) { Splitter->Attach(this); #ifdef MAC Splitter->Raised(false); #else Splitter->Raised(RAISED_LOOK); #endif SetLayout(); } #if WINNATIVE TrayIcon.Load(MAKEINTRESOURCE(IDI_SMALL)); TrayIcon.Load(MAKEINTRESOURCE(IDI_ERR)); TrayIcon.Load(MAKEINTRESOURCE(IDI_MAIL)); TrayIcon.Load(MAKEINTRESOURCE(IDI_BLANK)); #else TrayIcon.Load(_T("tray_small.png")); TrayIcon.Load(_T("tray_error.png")); TrayIcon.Load(_T("tray_mail.png")); #endif LStringPipe s(256); LVariant UserName; s.Print("%s", AppName); if (GetOptions()->GetValue(OPT_UserName, UserName)) { s.Print(" [%s]", UserName.Str()); } auto AppTitle = s.NewLStr(); TrayIcon.Name(AppTitle); Name(AppTitle); TrayIcon.Value(TRAY_ICON_NORMAL); TrayIcon.Visible(true); auto Item = Menu->FindItem(IDM_SCRIPTING_CONSOLE); if (Item) { LVariant v; if (GetOptions()->GetValue(OPT_ShowScriptConsole, v)) { Item->Checked(v.CastInt32() != 0); LScribeScript::Inst->ShowScriptingWindow(Item->Checked()); } } if (Tree) { Tree->Focus(true); } } Thing *ScribeWnd::CreateItem(int Type, ScribeFolder *Folder, bool Ui) { auto FolderStore = Folder && Folder->GetObject() ? Folder->GetObject()->GetStore() : NULL; auto DefaultStore = GetDefaultMailStore(); auto Store = FolderStore ? FolderStore : (DefaultStore ? DefaultStore->Store : NULL); if (!Store) { LAssert(!"no store"); LgiTrace("%s:%i - No store for creating calendar object.\n", _FL); return NULL; } auto Obj = Store->Create(Type); if (!Obj) { LAssert(!"create failed"); LgiTrace("%s:%i - store failed to create object.\n", _FL); return NULL; } #define HANDLE_CREATE_ITEM(Magic, Type) \ case Magic: \ { \ auto o = new Type(this, Obj); \ if (!o) \ { \ LgiTrace("%s:%i - Alloc failed.\n", _FL); \ break; \ } \ if (Folder) o->SetParentFolder(Folder); \ if (Ui) o->DoUI(); \ return o; \ } switch ((uint32_t)Type) { case MAGIC_MAIL: { // create a new mail message Mail *m = new Mail(this, Obj); if (!m) { LgiTrace("%s:%i - Alloc failed.\n", _FL); break; } if (!m->GetObject()) { m->DecRef(); return 0; } m->OnCreate(); if (Folder) m->SetParentFolder(Folder); if (Ui) m->DoUI(); return m; } HANDLE_CREATE_ITEM(MAGIC_CONTACT, Contact) HANDLE_CREATE_ITEM(MAGIC_CALENDAR, Calendar) HANDLE_CREATE_ITEM(MAGIC_FILTER, Filter) HANDLE_CREATE_ITEM(MAGIC_GROUP, ContactGroup) default: LAssert(!"Unhandled object type."); break; } return NULL; } void ScribeWnd::OnPaint(LSurface *pDC) { #if 0 pDC->Colour(LColour::Red); pDC->Rectangle(); #else LCssTools Tools(this); auto c = GetClient(); // c.Offset(0, -26); Tools.PaintContent(pDC, c); #endif } int CompareContacts(Contact **a, Contact **b) { if (a && b) { auto A = (*a)->GetFirst(); auto B = (*b)->GetFirst(); if (A && B) return _stricmp(A, B); } return 0; } bool ScribeWnd::OpenAMail(ScribeFolder *Folder) { if (Folder && Tree) { Folder->LoadThings(); for (auto i: Folder->Items) { Mail *m = i->IsMail(); if (m && !(m->GetFlags() & MAIL_READ)) { Tree->Select(Folder); m->DoUI(); return true; } } for (auto *t=Folder->GetChild(); t; t=t->GetNext()) { ScribeFolder *f = dynamic_cast(t); if (OpenAMail(f)) { return true; } } } return false; } void AddContactToMenu(LSubMenu *Menu, Contact *c, ssize_t Index) { if (!c || Index < 0) return; auto Email = c->GetEmail(); if (!Email) return; // has an email, list it auto First = c->GetFirst(); auto Last = c->GetLast(); if (First || Last) { char Buf[256]; sprintf_s(Buf, sizeof(Buf), "%s %s", (First)?First:"", (Last)?Last:""); auto Item = Menu->AppendItem(Buf, TRAY_CONTACT_BASE + (int)Index, true); if (Item) Item->Icon(ICON_CONTACT); } } void ScribeWnd::AddContactsToMenu(LSubMenu *Menu) { if (!Menu) return; d->TrayMenuContacts.Sort(CompareContacts); if (((ssize_t)d->TrayMenuContacts.Length() << 4) > GdcD->Y() - 200) { // Group contacts by starting letter LArray Alpha[26]; LArray Other; for (auto c: d->TrayMenuContacts) { auto First = c->GetFirst(); auto Last = c->GetLast(); auto Email = c->GetEmail(); if (Email) { // has an email, list it if (First || Last) { auto Name = First?First:Last; if ( (*Name >= 'a' && *Name <= 'z') || (*Name >= 'A' && *Name <= 'Z') ) { int Ind = tolower(*Name) - 'a'; if (Ind >= 0 && Ind < CountOf(Alpha)) Alpha[Ind].Add(c); else Other.Add(c); } else Other.Add(c); } } } for (int i=0; i 0) { char Group[64]; sprintf_s(Group, sizeof(Group), "%c...", 'a' + i); auto Sub = Menu->AppendSub(Group); if (Sub) { for (auto c: Alpha[i]) AddContactToMenu(Sub, c, d->TrayMenuContacts.IndexOf(c)); } } } if (Other.Length()) { auto Sub = Menu->AppendSub("Other..."); if (Sub) { for (auto c: Other) AddContactToMenu(Sub, c, d->TrayMenuContacts.IndexOf(c)); } } } else { // Display all... for (size_t i=0; iTrayMenuContacts.Length(); i++) { AddContactToMenu(Menu, d->TrayMenuContacts[i], i); } } } void ScribeWnd::OnUrl(const char *Url) { LUri u(Url); if (u.sProtocol && !_stricmp(u.sProtocol, "mailto")) { CreateMail(0, Url, 0); } } void ScribeWnd::OnReceiveFiles(LArray &Files) { int UnknownFormats = 0; int64 Period = LCurrentTime() - LastDrop; if (Period > 500) // Lock out drops within 500ms of an LGI drop { LString sSend, sPages; bool HasSend = LAppInst->GetOption("send", sSend); bool HasPrint = LAppInst->GetOption("p", sPages); LArray NewMail; for (unsigned i=0; i str(new LFile); if (str->Open(f, O_READ)) { if (t->Import(t->AutoCast(str), MimeType)) { if (HasSend) { Mail *m = t->IsMail(); if (m) { NewMail.Add(m); m->SetFlags(m->GetFlags() | MAIL_CREATED | MAIL_READ); } } else { t->DoUI(); } } } } } else UnknownFormats++; } bool SendNow = sSend ? atoi(sSend) != 0 : false; for (unsigned i=0; iSetFlags(m->GetFlags() | MAIL_READY_TO_SEND); m->Save(); } else if (HasPrint) { ThingPrint(NULL, m, GetPrinter(), 0, sPages ? atoi(sPages) : 0); } else { m->DoUI(); } } if (SendNow) Send(); } } void ScribeWnd::OnTrayClick(LMouse &m) { if (m.Down()) { #ifndef MAC // No support for different mouse button info so the default // action is to show the sub-menu of contacts and actions. if (m.IsContextMenu()) #endif { LWindow::OnTrayClick(m); } #ifndef MAC else if (m.Left()) { if (m.Double()) { if (Mail::NewMailLst.Length() > 0) { ScribeFolder *InBox = GetFolder(FOLDER_INBOX); OpenAMail(InBox); } } else { if (GetZoom() == LZoomMin) { SetZoom(LZoomNormal); } else { if (Obscured()) SetZoom(LZoomNormal); // Bounce in front, first. else SetZoom(LZoomMin); } Visible(true); MoveOnScreen(); Raise(); if (MailList) { MailList->Focus(true); } } } else if (m.Middle()) { Mail::NewMailLst.Empty(); } #endif } } void ScribeWnd::OnTrayMenu(LSubMenu &m) { m.SetImageList(ImageList, false); d->TrayMenuContacts.Length(0); #ifdef MAC m.AppendItem(LLoadString(IDS_OPEN), IDM_OPEN); m.AppendSeparator(); #endif LHashTbl,Contact*> Added; LArray Srcs = GetThingSources(MAGIC_CONTACT); for (auto c: Srcs) { c->LoadThings(); for (auto i: c->Items) { Contact *c = i->IsContact(); if (!c) continue; bool IsAdded = false; auto Emails = c->GetEmails(); for (auto e: Emails) { if (Added.Find(e)) IsAdded = true; } if (Emails.Length() && !IsAdded) { for (auto e: Emails) Added.Add(e, c); d->TrayMenuContacts.Add(c); } } } AddContactsToMenu(&m); m.AppendSeparator(); if (Mail::NewMailLst.Length() > 0) { int i=0; for (auto ml: Mail::NewMailLst) { LStringPipe p; // This code figures out how many UTF characters to print. We // can't split a UTF character because downstream conversions // will fail. const char *Subj = ml->GetSubject(); if (!Subj) Subj = "(No Subject)"; LUtf8Ptr u((uint8_t*)Subj); while ((int32)u && u.GetPtr() - (uchar*)Subj < 64) u++; ssize_t Bytes = u.GetPtr() - (uchar*)Subj; p.Print("%.*s, %s <%s>", Bytes, Subj?Subj:(char*)"(No Subject)", ml->GetFromStr(FIELD_NAME), ml->GetFromStr(FIELD_EMAIL)); LAutoString a(p.NewStr()); LAssert(LIsUtf8(a)); auto Item = m.AppendItem(a, TRAY_MAIL_BASE+i++, true); if (Item) { Item->Icon(ICON_UNREAD_MAIL); } } m.AppendSeparator(); } if (GetZoom() == LZoomMin) { m.AppendItem(LLoadString(IDS_OPEN), IDM_OPEN, true); } auto NewMail = m.AppendItem(LLoadString(IDS_NEW_EMAIL), IDM_NEW_EMAIL); if (NewMail) NewMail->Icon(ICON_UNSENT_MAIL); m.AppendItem(LLoadString(IDS_EXIT), IDM_EXIT); } void ScribeWnd::OnTrayMenuResult(int MenuId) { switch (MenuId) { case IDM_OPEN: { if (GetZoom() == LZoomMin) { SetZoom(LZoomNormal); } Visible(true); Raise(); if (MailList) { MailList->Focus(true); } break; } case IDM_NEW_EMAIL: { CreateMail(); break; } case IDM_EXIT: { d->IngoreOnClose = true; PostEvent(M_CLOSE); break; } default: { auto i = MenuId - TRAY_CONTACT_BASE; Contact *c = d->TrayMenuContacts.IdxCheck(i) ? d->TrayMenuContacts[i] : NULL; if (c) { CreateMail(c); } Mail *m = Mail::NewMailLst[MenuId - TRAY_MAIL_BASE]; if (m) { Mail::NewMailLst.Delete(m); m->DoUI(); } break; } } } void ScribeWnd::OnZoom(LWindowZoom Action) { if (Action == LZoomMin) { LVariant i; if (GetOptions()->GetValue(OPT_MinimizeToTray, i) && i.CastInt32()) { Visible(false); } } } struct UserInput { std::function Callback; LView *Parent; LString Msg; bool Password; UserInput() { Password = false; } }; void ScribeWnd::GetUserInput(LView *Parent, LString Msg, bool Password, std::function Callback) { if (InThread()) { auto Inp = new LInput(Parent ? Parent : this, "", Msg, AppName, Password); Inp->DoModal([this, Inp, Callback](auto dlg, auto id) { if (Callback) Callback(id ? Inp->GetStr() : LString()); delete dlg; }); } else { auto i = new UserInput; i->Parent = Parent; i->Msg = Msg; i->Password = Password; i->Callback = Callback; if (!PostEvent(M_GET_USER_INPUT, (LMessage::Param)i)) { LAssert(!"PostEvent failed."); if (Callback) Callback(LString()); } } } LMessage::Result ScribeWnd::OnEvent(LMessage *Msg) { TrayIcon.OnEvent(Msg); BayesianFilter::OnEvent(Msg); switch (Msg->Msg()) { case M_UNIT_TEST: { LAutoPtr j((LJson*)Msg->A()); if (!j) break; auto cmd = j->Get("cmd"); if (!cmd) break; if (cmd.Equals("somecmd")) { } break; } case M_CALENDAR_SOURCE_EVENT: { CalendarSource *cs = (CalendarSource*)Msg->A(); LAutoPtr m((LMessage*)Msg->B()); if (cs && m) cs->OnEvent(m); break; } case M_GET_USER_INPUT: { LAutoPtr i((UserInput*)Msg->A()); LAssert(i); LAssert(InThread()); // Least we get stuck in an infinite loop GetUserInput(i->Parent, i->Msg, i->Password, i->Callback); break; } case M_SET_HTML: { LAutoPtr Html((LString*)Msg->A()); if (PreviewPanel && Html) { LScriptArguments Arg(NULL); Arg.Add(new LVariant(Html->Get())); PreviewPanel->CallMethod(DomToStr(SdSetHtml), Arg); } break; } case M_NEW_CONSOLE_MSG: { if (d->ShowConsoleBtn) d->ShowConsoleBtn->Image(IDM_CONSOLE_MSGS); break; } case M_NEEDS_CAP: { LAutoString c((char*)Msg->A()); LAutoString param((char*)Msg->B()); NeedsCapability(c, param); return 0; break; } case M_STORAGE_EVENT: { LDataStoreI *Store = LDataStoreI::Map.Find((int)Msg->A()); if (Store) Store->OnEvent((void*)Msg->B()); break; } case M_SCRIBE_SET_MSG_FLAG: { LAutoString p((char*)Msg->A()); if (p) { char *d = strrchr(p, '/'); if (d) { *d++ = 0; ScribeFolder *f = GetFolder(p); if (f) { LUri u; LString a = u.DecodeStr(d); f->GetMessageById(a, [this, NewFlag=(int)Msg->B()](auto r) { if (r) { int ExistingFlags = r->GetFlags(); r->SetFlags(ExistingFlags | NewFlag); } }); } } } break; } case M_SCRIBE_DEL_THING: { Thing *t = (Thing*)Msg->A(); DeleteObj(t); break; } case M_SCRIBE_LOADED: { if (d->FoldersLoaded) { // Ok let the user in CmdSend.Enabled(true); CmdReceive.Enabled(true); CmdPreview.Enabled(true); } break; } case M_SCRIBE_THREAD_DONE: { // Finialize connection AccountThread *Thread = (AccountThread*) Msg->A(); Accountlet *Acc = (Accountlet*) Msg->B(); if (Thread && Acc) { OnAfterConnect(Acc->GetAccount(), Acc->IsReceive()); d->NewMailTimeout = 2; Acc->OnThreadDone(); } else { LAssert(0); } break; } case M_SCRIBE_MSG: { char *m = (char*)Msg->A(); if (m) { if (Msg->B()) { if (LgiMsg(this, m, AppName, MB_YESNO) == IDYES) { PostEvent(M_COMMAND, IDM_OPTIONS, 0); } } else { LgiMsg(this, "%s", AppName, MB_OK, m); } DeleteArray(m); } break; } /* case M_SCRIBE_LOG_MSG: { List *Log = (List*)Msg->A(); LAutoPtr Entry((LogEntry*)Msg->B()); if (ScribeState != ScribeExiting && Log && Entry) { Log->Insert(Entry.Release()); // Trim long list... while (Log->Length() > 1024) { LogEntry *e = Log->First(); Log->Delete(e); DeleteObj(e); } } break; } */ case M_SCRIBE_NEW_MAIL: { if (Lock(_FL)) { if (NewMailDlg) { NewMailDlg->AddThings(&Mail::NewMailLst); } Unlock(); } break; } case M_SCRIBE_OPEN_THING: { Thing *t = (Thing*) Msg->A(); if (t) { t->DoUI(); } break; } case M_SCRIBE_ITEM_SELECT: { if (!MailList || !IsAttached()) break; List Things; MailList->GetSelection(Things); OnSelect(&Things); break; } case M_URL: { LAutoPtr Url((LString*)Msg->A()); if (Url) { LUri u(*Url); if (u.sProtocol && !_stricmp(u.sProtocol, "mailto")) { Mailto mt(this, *Url); if (mt.To.Length() > 0) { Thing *t = CreateItem(MAGIC_MAIL, NULL, false); if (t) { Mail *m = t->IsMail(); if (m) { mt.Apply(m); m->DoUI(); } else DeleteObj(t); } } } } break; } } return LWindow::OnEvent(Msg); } bool ScribeWnd::IsMyEmail(const char *Email) { if (Email) { LVariant e; for (auto a : *GetAccounts()) { LVariant e = a->Identity.Email(); if (e.Str() && _stricmp(Email, e.Str()) == 0) { return true; } } } return false; } int ScribeWnd::GetMaxPages() { return d->PrintMaxPages; } void ScribeWnd::ThingPrint(std::function Callback, ThingType *m, LPrinter *Printer, LView *Parent, int MaxPages) { d->PrintMaxPages = MaxPages; if (!Printer) Printer = GetPrinter(); if (!Printer) { if (Callback) Callback(false); return; } Thing *t = dynamic_cast(m); if (!t) { if (Callback) Callback(false); return; } auto Events = new ScribePrintContext(this, t); Printer->Print( Events, [this, Events, Parent, Printer, Callback](auto pages) { if (pages == Events->OnBeginPrintError) { LgiMsg(Parent, "Printing failed: %s", AppName, MB_OK, Printer->GetErrorMsg().Get()); if (Callback) Callback(false); } else if (Callback) { Callback(true); } delete Events; }, AppName, -1, Parent ? Parent : this); } bool ScribeWnd::MailReplyTo(Mail *m, bool All) { bool Status = false; if (m) { LDataStoreI *Store = m->GetObject() ? m->GetObject()->GetStore() : NULL; LDataI *NewMailObj = Store && Store->GetInt(FIELD_STORE_TYPE) == Store3Sqlite ? Store->Create(MAGIC_MAIL) : NULL; Mail *NewMail = new Mail(this, NewMailObj); if (NewMail) { if (NewMail->GetObject()) { NewMail->OnReply(m, All, true); LView *w = NewMail->DoUI(); if (w) { LViewI *t = w->FindControl(IDC_TEXT); if (t) { t->Focus(true); } } Status = true; } else DeleteObj(NewMail); } } return Status; } bool ScribeWnd::MailForward(Mail *m) { bool Status = false; if (m) { Mail *NewMail = new Mail(this); if (NewMail) { if (NewMail->OnForward(m, true)) { NewMail->DoUI(); Status = true; } else { NewMail->DecRef(); } } } return Status; } bool ScribeWnd::MailBounce(Mail *m) { bool Status = false; if (m) { Mail *NewMail = new Mail(this); if (NewMail) { if (NewMail->OnBounce(m, true)) { NewMail->DoUI(); Status = true; } else { DeleteObj(NewMail); } } } return Status; } Mail *ScribeWnd::CreateMail(Contact *c, const char *Email, const char *Name) { Mail *m = dynamic_cast(CreateItem(MAGIC_MAIL, NULL, false)); if (m) { bool IsMailTo = false; if (Email) { IsMailTo = _strnicmp(Email, "mailto:", 7) == 0; if (IsMailTo) { Mailto mt(this, Email); mt.Apply(m); } } MailUi *UI = dynamic_cast(m->DoUI()); if (UI) { if (c) { UI->AddRecipient(c); } if (Email && !IsMailTo) { UI->AddRecipient(Email, Name); } } } return m; } Mail *ScribeWnd::LookupMailRef(const char *MsgRef, bool TraceAllUids) { if (!MsgRef) return 0; LAutoString p(NewStr(MsgRef)); char *RawUid = strrchr(p, '/'); if (RawUid) { *RawUid++ = 0; LUri u; LString Uid = u.DecodeStr(RawUid); // Try the mail message map first... Mail *m = Mail::GetMailFromId(Uid); if (m) return m; // Ok, not found, so look in last known folder... ScribeFolder *f = GetFolder(p); if (f) { for (auto t : f->Items) { Mail *m = t->IsMail(); if (m) { auto s = m->GetMessageId(); if (s && !strcmp(s, Uid)) { return m; } if (TraceAllUids) LgiTrace("\t%s\n", s); } } } } return 0; } void ScribeWnd::OnBayesAnalyse(const char *Msg, const char *WhiteListEmail) { LString s, q; s.Printf("%s", Msg); if (WhiteListEmail) { q.Printf(LLoadString(IDS_REMOVE_WHITELIST), WhiteListEmail); s += LString("") + q; } s += ""; LHtmlMsg([this, WhiteListEmail=LString(WhiteListEmail)](auto result) { if (result == IDYES) RemoveFromWhitelist(WhiteListEmail); }, this, s, AppName, WhiteListEmail ? MB_YESNO : MB_OK); } bool ScribeWnd::OnBayesResult(const char *MailRef, double Rating) { Mail *m = LookupMailRef(MailRef); if (m) return OnBayesResult(m, Rating); #ifdef _DEBUG else { LgiTrace("%s:%i - error finding mail ref: %s\n", _FL, MailRef); LookupMailRef(MailRef, true); LAssert(!"We should always be able to resolve the reference, unless m is completely deleted"); } #endif return false; } bool ScribeWnd::OnBayesResult(Mail *m, double Rating) { if (!m) return false; LVariant v; GetOptions()->GetValue(OPT_BayesThreshold, v); double BayesThresh = v.CastDouble(); if (BayesThresh < 0.1) BayesThresh = 0.1; if (BayesThresh > 1.0) BayesThresh = 1.0; if (Rating < BayesThresh) { // Not spam, so we continue new mail processing if (m->NewEmail == Mail::NewEmailBayes) { List Nm; Nm.Insert(m); m->NewEmail = Mail::NewEmailGrowl; OnNewMail(&Nm, true); } return false; } // Spam is pink! m->SetMarkColour(Rgb32(255, 0, 0)); m->SetFlags(m->GetFlags() | MAIL_BAYES_SPAM); ScribeBayesianFilterMode FilterMode = BayesOff; if (GetOptions()->GetValue(OPT_BayesFilterMode, v)) FilterMode = (ScribeBayesianFilterMode)v.CastInt32(); if (FilterMode == BayesTrain) { // Move to folder LVariant MoveToPath; if (!GetOptions()->GetValue(OPT_BayesMoveTo, MoveToPath)) { MoveToPath = "/Spam/Probably"; } ScribeFolder *f = GetFolder(MoveToPath.Str()); if (f) { LArray Items; Items.Add(m); f->MoveTo(Items, false, [this, m](auto result, auto status) { List obj; obj.Insert(m); OnNewMail(&obj, false); }); } } else { m->DeleteAsSpam(this); } return true; } static int AccountCmp(ScribeAccount *a, ScribeAccount *b, int Data) { return a->Identity.Sort() - b->Identity.Sort(); } class ScribePasteState : public LProgressDlg { ScribeWnd *App = NULL; ScribeFolder *Folder = NULL; LString Data; LDataStoreI::StoreTrans Trans; LProgressPane *LoadPane = NULL, *SavePane = NULL; ScribeClipboardFmt *tl = NULL; uint32_t Errors = 0; ssize_t Idx = 0; enum PasteState { LoadingThings, SavingThings, } State = LoadingThings; public: ScribePasteState(ScribeWnd *app, ScribeFolder *folder, LString data) : LProgressDlg(app), App(app), Folder(folder), Data(data) { // Paste 'ScribeThingList' tl = (ScribeClipboardFmt*)Data.Get(); Trans = Folder->GetObject()->GetStore()->StartTransaction(); LoadPane = ItemAt(0); LoadPane->SetDescription("Loading objects..."); LoadPane->SetRange(tl->Length()); SavePane = Push(); SavePane->SetRange(tl->Length()); SavePane->SetDescription("Saving: No errors..."); // LProgressDlg will do a SetPulse in it's OnCreate } void OnPulse() { auto Start = LCurrentTime(); static int TimeSlice = 300; //ms if (State == LoadingThings) { while ( Idx < tl->Length() && !IsCancelled() && LCurrentTime() - Start < TimeSlice) { Thing *t = tl->ThingAt(Idx++); if (!t) continue; auto Obj = t->GetObject(); if (Obj->GetInt(FIELD_LOADED) < Store3Loaded) Obj->SetInt(FIELD_LOADED, Store3Loaded); } Value(Idx); if (Idx >= tl->Length()) { State = SavingThings; Idx = 0; } } else if (State == SavingThings) { while ( Idx < tl->Length() && !IsCancelled() && LCurrentTime() - Start < TimeSlice) { Thing *t = tl->ThingAt(Idx++); if (!t) continue; auto Obj = t->GetObject(); LAssert(Obj->GetInt(FIELD_LOADED) == Store3Loaded); // Load loop should have done this already Thing *Dst = App->CreateItem(Obj->Type(), Folder, false); if (Dst) { *Dst = *t; Dst->Update(); if (!Dst->Save(Folder)) { LString s; s.Printf("Saving: " LPrintfSSizeT " error(s)", ++Errors); SetDescription(s); } } else Errors++; } SavePane->Value(Idx); if (Idx >= tl->Length()) { if (Errors > 0) LgiMsg(this, "Failed to save %i of %i objects.", AppName, MB_OK, Errors, tl->Length()); Quit(); return; } } LProgressDlg::OnPulse(); } }; int ScribeWnd::OnCommand(int Cmd, int Event, OsView WndHandle) { // Send mail multi-menu if (Cmd >= IDM_SEND_FROM && Cmd <= IDM_SEND_FROM + (ssize_t)Accounts.Length()) { Send(Cmd - IDM_SEND_FROM); return 0; } // Receive mail multi-menu if (Cmd >= IDM_RECEIVE_FROM && Cmd < IDM_RECEIVE_FROM + (ssize_t)Accounts.Length()) { Receive(Cmd - IDM_RECEIVE_FROM); return 0; } // Preview mail multi-menu if (Cmd >= IDM_PREVIEW_FROM && Cmd < IDM_PREVIEW_FROM + (ssize_t)Accounts.Length()) { Preview(Cmd - IDM_PREVIEW_FROM); return 0; } // Identity multi-menu if (Cmd >= IDM_IDENTITY_BASE && Cmd <= IDM_IDENTITY_BASE + (ssize_t)Accounts.Length()) { SetCurrentIdentity(Cmd - IDM_IDENTITY_BASE - 1); return 0; } // Is this a script tool? if (LScribeScript::Inst && Cmd >= IDM_TOOL_SCRIPT_BASE && Cmd < IDM_TOOL_SCRIPT_BASE + (int)d->Scripts.Length()) { // Do tools menu callback... find the right callback.... LArray c; if (GetScriptCallbacks(LToolsMenu, c)) { for (unsigned i=0; iFunc && c[i]->Param == Cmd) { // Call the callback char Msg[MAX_PATH_LEN]; LScribeScript::Inst->GetLog()->Write ( Msg, sprintf_s(Msg, sizeof(Msg), "\n\nRunning tool script '%s'...\n", c[i]->Script->Code->GetFileName()) ); // Setup the arguments... LScriptArguments Args(NULL); Args.New() = new LVariant((LDom*)this); Args.New() = new LVariant(Cmd); // Call the method ExecuteScriptCallback(*c[i], Args); // Cleanup Args.DeleteObjects(); break; } } } return 0; } // New from template multi-menu if (Cmd >= IDM_NEW_FROM_TEMPLATE && Cmd < IDM_NEW_FROM_TEMPLATE + 100) { int Index = Cmd - IDM_NEW_FROM_TEMPLATE; ScribeFolder *Templates = GetFolder(FOLDER_TEMPLATES); if (Templates) { Templates->LoadThings(); for (auto i: Templates->Items) { Mail *m = i->IsMail(); if (m) { if (Index == 0) { Thing *t = CreateItem(MAGIC_MAIL, 0, false); // GetFolder(FOLDER_OUTBOX) Mail *NewMail = IsMail(t); if (NewMail) { *NewMail = (Thing&)*m; NewMail->DoUI(); break; } } Index--; } } } return 0; } switch (Cmd) { // File menu case IDM_MANAGE_MAIL_STORES: { auto Dlg = new ManageMailStores(this); Dlg->DoModal([this, Dlg](auto dlg, auto id) { LAutoPtr mem(dlg); if (id) { SaveOptions(); if (!UnLoadFolders()) return; LXmlTag *Ms = GetOptions()->LockTag(OPT_MailStores, _FL); if (Ms) { while (Ms->Children.Length()) delete Ms->Children[0]; LXmlTag *t = Dlg->Options.GetChildTag(OPT_MailStores); if (t) { for (auto c: t->Children) { LXmlTag *n = new LXmlTag; n->Copy(*c, true); Ms->InsertTag(n); } } GetOptions()->Unlock(); } LVariant v; GetOptions()->SetValue(OPT_CreateFoldersIfMissing, v = true); if (!Dlg->Options.GetValue(OPT_StartInFolder, v)) v.Empty(); GetOptions()->SetValue(OPT_StartInFolder, v); LoadFolders(NULL); } }); break; } case IDM_REPLICATE: { auto Dlg = new ReplicateDlg(this); Dlg->DoModal([this, Dlg](auto dlg, auto id) { if (id) { UnLoadFolders(); Dlg->StartProcess(); // Don't delete dialog... let it run } else delete dlg; }); break; } case IDM_SECURITY: { // Check for user perm password... // No point allow any old one to edit the security settings. auto ShowDialog = [this]() { auto Dlg = new SecurityDlg(this); Dlg->DoModal(NULL); }; LPassword p; if (p.Serialize(GetOptions(), OPT_UserPermPassword, false)) { GetAccessLevel(this, PermRequireUser, "Security Settings", [ShowDialog](bool Allow) { if (Allow) ShowDialog(); }); } else { ShowDialog(); } break; } case IDM_OPTIONS: { LVariant ShowTotals; GetOptions()->GetValue(OPT_ShowFolderTotals, ShowTotals); // do the dialog auto Dlg = new OptionsDlg(this); Dlg->DoModal([this, Dlg, ShowTotals](auto dlg, auto id) { if (id) { // set up the POP3 accounts SetupAccounts(); SaveOptions(); // close any IMAP accounts that are now disabled. for (auto a : Accounts) { if (a->Receive.IsConfigured() && a->Receive.IsPersistant()) { if (a->Receive.Disabled()) a->Receive.Disconnect(); else Receive(a->GetIndex()); } } // List/Tree view options update LVariant i; if (GetOptions()->GetValue(OPT_ShowFolderTotals, i) && i.CastInt32() != ShowTotals.CastInt32()) { Tree->UpdateAllItems(); } if (GetOptions()->GetValue(OPT_PreviewLines, i)) { Mail::PreviewLines = i.CastInt32() != 0; } if (MailList) { if (GetOptions()->GetValue(OPT_GridLines, i)) { MailList->DrawGridLines(i.CastInt32() != 0); } MailList->Invalidate(); } // date formats if (GetOptions()->GetValue(OPT_DateFormat, i)) { int Idx = i.CastInt32(); if (Idx >= 0 && Idx < CountOf(DateTimeFormats)) { LDateTime::SetDefaultFormat(DateTimeFormats[Idx]); } } if (GetOptions()->GetValue(OPT_AdjustDateTz, i)) Mail::AdjustDateTz = i.CastInt32() == 0; // SSL debug logging if (GetOptions()->GetValue(OPT_DebugSSL, i)) SslSocket::DebugLogging = i.CastInt32() != 0; // Html edit menu if (GetOptions()->GetValue(OPT_EditControl, i)) { auto mi = Menu->FindItem(IDM_HTML_EDITOR); if (mi) mi->Checked(i.CastInt32() != 0); } } delete dlg; }); break; } case IDM_WORK_OFFLINE: { if (WorkOffline) { WorkOffline->Checked(!WorkOffline->Checked()); LVariant v; GetOptions()->SetValue(OPT_WorkOffline, v = WorkOffline->Checked()); if (!WorkOffline->Checked()) { // Offline -> Online transition. // Check if any pending messages are in the Outbox ScribeFolder *Outbox = GetFolder(FOLDER_OUTBOX); if (Outbox) { bool HasMailToSend = false; for (auto t: Outbox->Items) { Mail *m = t->IsMail(); if (m) { if (TestFlag(m->GetFlags(), MAIL_READY_TO_SEND)) { HasMailToSend = true; break; } } } if (HasMailToSend) { PostEvent(M_COMMAND, IDM_SEND_MAIL, #ifndef __GTK_H__ (LMessage::Param)Handle() #else 0 #endif ); } } } } break; } case IDM_ITEM_FILTER: { if (GetCtrlValue(IDM_ITEM_FILTER)) { if ((SearchView = new LSearchView(this))) { SearchView->Focus(true); SetLayout(); } } else { DeleteObj(SearchView); } ScribeFolder *Folder = GetCurrentFolder(); if (Folder) { Folder->Populate(MailList); } break; } case IDM_PRINT: { if (MailList) { List Sel; if (MailList->LList::GetSelection(Sel)) { for (auto i: Sel) { ThingType *t = dynamic_cast(i); ThingPrint(NULL, t); } } } break; } case IDM_PRINTSETUP: { auto *p = GetPrinter(); if (p && p->Browse(this)) { LString Str; if (p->Serialize(Str, true)) { LVariant v; GetOptions()->SetValue(OPT_PrintSettings, v = Str); } } break; } case IDM_PAGE_SETUP: { auto Dlg = new ScribePageSetup(this, GetOptions()); Dlg->DoModal(NULL); break; } case IDM_EXIT: { LMouse m; GetMouse(m); d->IngoreOnClose = m.Ctrl(); LCloseApp(); break; } // Edit menu case IDM_FIND: { auto v = GetFocus(); LDocView *doc = dynamic_cast(v); if (doc) { doc->DoFind(NULL); } else { ScribeFolder *Folder = GetCurrentFolder(); OpenFinder(this, Folder); } break; } case IDM_COPY: { if (MailList && MailList->Focus()) { List Lst; if (!MailList->GetSelection(Lst)) break; // Copy 'ScribeThingList' ScribeClipboardFmt *tl = ScribeClipboardFmt::Alloc(Lst); if (!tl) break; LClipBoard Clip(this); if (Clip.IsOpen()) { if (!Clip.Binary(d->ClipboardFormat, (uchar*)tl, tl->Sizeof(), true)) { LgiMsg(this, "Couldn't set the clipboard data.", AppName, MB_OK); } } else { LgiMsg(this, "Couldn't open the clipboard.", AppName, MB_OK); } free(tl); } else { LViewI *v = LAppInst->GetFocus(); if (v) v->PostEvent(M_COPY); } break; } case IDM_PASTE: { LViewI *v = LAppInst->GetFocus(); if (v && v->GetWindow() != (LWindow*)this) { v->PostEvent(M_PASTE); break; } if (!MailList->Focus() && !Tree->Focus()) { LgiTrace("%s:%i - List/Tree doesn't have focus.\n"); break; } ScribeFolder *Folder = dynamic_cast(Tree->Selection()); if (!Folder || !Folder->GetObject()) { LgiMsg(this, "No current folder.", AppName, MB_OK); break; } LClipBoard Clip(this); if (!Clip.IsOpen()) { LgiMsg(this, "Couldn't open the clipboard.", AppName, MB_OK); break; } Clip.Binary(d->ClipboardFormat, [this, Folder](auto Data, auto Err) { if (Data) { if (ScribeClipboardFmt::IsThing(Data.Get(), Data.Length())) { new ScribePasteState(this, Folder, Data); } } else { LgiMsg(this, "Couldn't get the clipboard data: %s", AppName, MB_OK, Err.Get()); } }); break; } case IDM_DELETE: { LViewI *f = LAppInst->GetFocus(); LEdit *e = dynamic_cast(f); if (e) { // This handles the case where on a mac the menu eats the delete key, even // when the edit control needs it LKey k(LK_DELETE, 0); k.Down(true); f->OnKey(k); k.Down(false); f->OnKey(k); } else { OnDelete(); } break; } case IDM_DELETE_AS_SPAM: { if (MailList) { List Sel; MailList->GetSelection(Sel); int Index = -1; for (auto i: Sel) { Mail *m = IsMail(i); if (m) { if (Index < 0) { Index = MailList->IndexOf(i); } m->DeleteAsSpam(this); } } if (Index >= 0) { LListItem *i = MailList->ItemAt(Index); if (!i) i = MailList->ItemAt(MailList->Length()-1); if (i) i->Select(true); } } break; } case IDM_REFRESH: { ScribeFolder *f = GetCurrentFolder(); if (!f) break; const char *s = DomToStr(SdRefresh); f->GetFldObj()->OnCommand(s); break; } // Mail menu case IDM_NEW_EMAIL: { CreateMail(); break; } case IDM_SET_READ: case IDM_SET_UNREAD: { ScribeFolder *f = GetCurrentFolder(); if (!f) break; bool SetRead = Cmd == IDM_SET_READ; f->LoadThings(); LArray Change; for (auto t: f->Items) { Mail *m = t->IsMail(); if (m && m->Select()) Change.Add(m->GetObject()); } LVariant v = MAIL_READ; LDataStoreI *Store = f->GetObject()->GetStore(); if (Store->Change(Change, FIELD_FLAGS, v, SetRead ? OpPlusEquals : OpMinusEquals) == Store3Error) { for (auto t : f->Items) { Mail *m = t->IsMail(); if (!m) continue; if (!m->Select()) continue; if (SetRead) m->SetFlags(m->GetFlags() | MAIL_READ); else m->SetFlags(m->GetFlags() & ~MAIL_READ); } } break; } case IDM_REPLY: case IDM_REPLY_ALL: { if (MailList) MailReplyTo(IsMail(MailList->GetSelected()), (Cmd == IDM_REPLY_ALL)); break; } case IDM_FORWARD: { if (MailList) MailForward(IsMail(MailList->GetSelected())); break; } case IDM_BOUNCE: { if (MailList) MailBounce(IsMail(MailList->GetSelected())); break; } case IDM_SEND_MAIL: { Send(); break; } case IDM_RECEIVE_AND_SEND: { d->SendAfterReceive = true; PostEvent(M_COMMAND, IDM_RECEIVE_MAIL, (LMessage::Param)FindControl(IDM_RECEIVE_MAIL)); break; } case IDM_THREAD: { if (MailList) { ScribeFolder *f = GetCurrentFolder(); if (f) { f->SetThreaded(!f->GetThreaded()); f->Populate(MailList); } } break; } case IDM_RECEIVE_ALL: { #define LOG_RECEIVE_ALL 0 int i = 0; Accounts.Sort(AccountCmp); for (auto a : Accounts) { #if LOG_RECEIVE_ALL auto name = a->Identity.Name(); auto email = a->Identity.Email(); LString desc; desc.Printf("%s/%s", name.Str(), email.Str()); #endif if (!a->Receive.IsConfigured()) { #if LOG_RECEIVE_ALL LgiTrace("%s:%i - %i/%s not configured.\n", _FL, a->GetIndex(), desc.Get()); #endif } else if (a->Receive.Disabled() > 0) { #if LOG_RECEIVE_ALL LgiTrace("%s:%i - %i/%s is disabled.\n", _FL, a->GetIndex(), desc.Get()); #endif } else { #if LOG_RECEIVE_ALL LgiTrace("%s:%i - %i/%s will connect.\n", _FL, a->GetIndex(), desc.Get()); #endif Receive(a->GetIndex()); } i++; } break; } case IDM_RECEIVE_MAIL: { LVariant Def; if (GetOptions()->GetValue(OPT_Pop3DefAction, Def) && Def.CastInt32() == 0) return OnCommand(IDM_RECEIVE_ALL, 0, NULL); Receive(0); break; } case IDM_PREVIEW_POP3: { LArray Account; Accounts.Sort(AccountCmp); for (auto a: Accounts) { if (!a->Receive.IsConfigured()) continue; auto Protocol = ProtocolStrToEnum(a->Receive.Protocol().Str()); if (Protocol == ProtocolPop3) { Account.Add(a); break; } } if (Account.Length() == 1) OpenPopView(this, Account); break; } case IDM_CALENDAR: { extern void OpenCalender(ScribeFolder *folder); ScribeFolder *Folder = GetFolder(FOLDER_CALENDAR); if (Folder) { OpenCalender(Folder); } break; } // Contact menu case IDM_NEW_CONTACT: { CreateItem(MAGIC_CONTACT, NULL); break; } case IDM_NEW_GROUP: { CreateItem(MAGIC_GROUP, NULL); break; } // Filter menu case IDM_NEW_FILTER: { Thing *t = CreateItem(MAGIC_FILTER, NULL, false); if (t) { t->IsFilter()->SetIncoming(true); t->DoUI(); } break; } case IDM_FILTER_CURRENT_FOLDER: { ScribeFolder *Folder = GetCurrentFolder(); if (Folder) { List Filters; GetFilters(Filters, false, false, true); List Src; for (auto i: Folder->Items) { if (i->IsMail()) { Src.Insert(i->IsMail()); } } if (!Src[0]) { LgiMsg(this, LLoadString(IDS_NO_MAIL_TO_FILTER), AppName); } else { Filter::ApplyFilters(this, Filters, Src); } } break; } case IDM_FILTER_SELECTION: { ScribeFolder *Folder = GetCurrentFolder(); if (Folder) { List Filters; GetFilters(Filters, false, false, true); List Src; for (auto i: Folder->Items) { if (i->IsMail() && i->Select()) { Src.Insert(i->IsMail()); } } if (Src.Length()) { Filter::ApplyFilters(this, Filters, Src); } } break; } case IDM_DEBUG_FILTERS: { auto i = Menu->FindItem(IDM_DEBUG_FILTERS); if (i) { i->Checked(!i->Checked()); } break; } case IDM_HTML_EDITOR: { auto i = Menu->FindItem(IDM_HTML_EDITOR); if (i) { i->Checked(!i->Checked()); LVariant v; GetOptions()->SetValue(OPT_EditControl, v = i->Checked() ? 1 : 0); } break; } case IDM_FILTERS_DISABLE: { if (d->DisableUserFilters) { d->DisableUserFilters->Checked(!d->DisableUserFilters->Checked()); LVariant v; GetOptions()->SetValue(OPT_DisableUserFilters, v = d->DisableUserFilters->Checked()); } break; } case IDM_BUILD_BAYES_DB: { BuildSpamDb(); break; } case IDM_BAYES_STATS: { BuildStats(); break; } case IDM_BAYES_SETTINGS: { auto Dlg = new BayesDlg(this); Dlg->DoModal([this, Dlg](auto dlg, auto id) { if (id) { LVariant i; if (GetOptions()->GetValue(OPT_BayesFilterMode, i)) { ScribeBayesianFilterMode m = ((ScribeBayesianFilterMode)i.CastInt32()); if (m != BayesOff) { LVariant SpamPath, ProbablyPath; GetOptions()->GetValue(OPT_SpamFolder, SpamPath); GetOptions()->GetValue(OPT_BayesMoveTo, ProbablyPath); if (m == BayesFilter) { ScribeFolder *Spam = GetFolder(SpamPath.Str()); if (!Spam) { LMailStore *RelevantStore = GetMailStoreForPath(SpamPath.Str()); if (RelevantStore) { LString p = SpamPath.Str(); LString::Array a = p.SplitDelimit("/"); Spam = RelevantStore->Root; for (unsigned i=1; iGetSubFolder(a[i]); if (!c) c = Spam->CreateSubFolder(a[i], MAGIC_MAIL); Spam = c; } } } if (Spam) { LVariant v; GetOptions()->SetValue(OPT_HasSpam, v = 1); } } else if (m == BayesTrain) { ScribeFolder *Probably = GetFolder(ProbablyPath.Str()); if (!Probably) { LgiMsg(this, "Couldn't find the folder '%s'", AppName, MB_OK, ProbablyPath.Str()); } } } } } delete dlg; }); break; } case IDM_BAYES_CHECK: { List Sel; if (MailList) MailList->GetSelection(Sel); for (auto i: Sel) { Thing *t = dynamic_cast(i); if (t) { Mail *m = t->IsMail(); if (m) { d->BayesLog.Empty(); double SpamRating = 0.0; IsSpam(SpamRating, m, true); break; } } } break; } // Tools menu case IDM_SCRIPTING_CONSOLE: case IDM_SHOW_CONSOLE: { ShowScriptingConsole(); if (d->ShowConsoleBtn) d->ShowConsoleBtn->Image(IMG_CONSOLE_NOMSG); break; } case IDM_EXPORT_TEXT_MBOX: { Export_UnixMBox(this); break; } case IDM_IMPORT_CSV: { ImportCsv(this); break; } case IDM_EXPORT_CSV: { ExportCsv(this); break; } case IDM_IMPORT_EML: { ImportEml(this); break; } case IDM_EXPORT_SCRIBE: { ExportScribe(this, NULL/* default mail store */); break; } case IDM_IMPORT_TEXT_MBOX: { Import_UnixMBox(this); break; } case IDM_IMP_EUDORA_ADDR: { Import_EudoraAddressBook(this); break; } case IDM_IMP_MOZILLA_ADDR: { Import_MozillaAddressBook(this); break; } case IDM_IMP_MOZILLA_MAIL: { Import_MozillaMail(this); break; } #if WINNATIVE case IDM_IMPORT_OUTLOOK_PAB: { Import_OutlookContacts(this); break; } case IDM_IMPORT_OUTLOOK_ITEMS: { Import_Outlook(this, IMP_OUTLOOK); break; } case IDM_EXPORT_OUTLOOK_ITEMS: { Export_Outlook(this); break; } #endif case IDM_IMP_MBX_EMAIL: { Import_OutlookExpress(this, false); // v4 break; } case IDM_IMP_DBX_EMAIL: { Import_OutlookExpress(this); // v5 break; } case IDM_IMPORT_NS_CONTACTS: { Import_NetscapeContacts(this); break; } case IDM_CHECK_UPDATE: { LVariant v; GetOptions()->GetValue(OPT_SoftwareUpdateIncBeta, v); SoftwareUpdate(this, true, v.CastInt32() != 0, [](auto goingToUpdate) { if (goingToUpdate) LCloseApp(); }); break; } case IDM_LOGOUT: { CurrentAuthLevel = PermRequireNone; auto i = Menu->FindItem(IDM_LOGOUT); if (i) i->Enabled(false); break; } case IDM_LAYOUT1: { LVariant v; int TwoThirds = GetClient().Y() >> 1; GetOptions()->SetValue(OPT_SplitterPos, v = 200); GetOptions()->SetValue(OPT_SubSplitPos, v = TwoThirds); SetLayout(FoldersListAndPreview); break; } case IDM_LAYOUT2: { LVariant v; int TwoThirds = GetClient().Y() >> 1; GetOptions()->SetValue(OPT_SplitterPos, v = TwoThirds); GetOptions()->SetValue(OPT_SubSplitPos, v = 200); SetLayout(PreviewOnBottom); break; } case IDM_LAYOUT3: { LVariant v; GetOptions()->SetValue(OPT_SplitterPos, v = 200); SetLayout(FoldersAndList); break; } case IDM_LAYOUT4: { LVariant v; GetOptions()->SetValue(OPT_SplitterPos, v = 200); GetOptions()->SetValue(OPT_SubSplitPos, v); SetLayout(ThreeColumn); break; } case IDM_CRASH: { int *Crash = 0; *Crash = true; break; } case IDM_DUMP_MEM: { LDumpMemoryStats(0); break; } case IDM_SCRIPT_DEBUG: { LVariant v; if (GetOptions()) GetOptions()->SetValue(OPT_ScriptDebugger, v = true); LVirtualMachine *vm = new LVirtualMachine(d); if (!vm) break; LVmDebugger *dbg = vm->OpenDebugger(); if (!dbg) break; break; } case IDM_SCRIPT_BREAK_ON_WARN: { auto mi = GetMenu()->FindItem(IDM_SCRIPT_BREAK_ON_WARN); if (!mi) break; LVirtualMachine::BreakOnWarning = !mi->Checked(); mi->Checked(LVirtualMachine::BreakOnWarning); break; } case IDM_UNIT_TESTS: { #ifdef _DEBUG UnitTests([this](auto ok) { LgiMsg(this, "UnitTest status: %i", AppName, MB_OK, ok); }); #endif break; } // Help menu case IDM_HELP: { LaunchHelp("index.html"); // LgiMsg(this, LLoadString(IDS_ERROR_NO_HELP), AppName, MB_OK); break; } case IDM_FEEDBACK: { LVariant e; if (GetOptions()->GetValue("author", e)) CreateMail(0, e.Str()); else CreateMail(0, AuthorEmailAddr); break; } case IDM_MEMECODE: { LExecute(AuthorHomepage); break; } case IDM_HOMEPAGE: { LVariant hp; if (GetOptions()->GetValue("homepage", hp)) LExecute(hp.Str()); else LExecute(ApplicationHomepage); break; } case IDM_VERSION_HISTORY: { LExecute("http://www.memecode.com/site/ver.php?id=445"); break; } case IDM_DEBUG_INFO: { char s[256]; sprintf_s(s, sizeof(s), "%s#debug", ApplicationHomepage); LExecute(s); break; } case IDM_TUTORIALS: { LExecute("http://www.memecode.com/scribe/tutorials"); break; } case IDM_INSCRIBE_LINK: { LExecute(CommercialHomepage); break; } case IDM_SCRIBE_FAQ: { LExecute(FaqHomepage); break; } case IDM_ABOUT: { extern void ScribeAbout(ScribeWnd *Parent); ScribeAbout(this); break; } default: { if (d->ScriptToolbar) d->ScriptToolbar->ExecuteCallbacks(this, 0, 0, Cmd); break; } } return 0; } void ScribeWnd::OnDelete() { LVariant ConfirmDelete; GetOptions()->GetValue(OPT_ConfirmDelete, ConfirmDelete); if (!ConfirmDelete.CastInt32() || LgiMsg(this, LLoadString(IDS_DELETE_ASK), AppName, MB_YESNO) == IDYES) { LArray Del; if (Tree && Tree->Focus()) { ScribeFolder *Item = dynamic_cast(Tree->Selection()); if (Item) { Tree->OnDelete(Item, false); } } else if (MailList #ifdef MAC && MailList->Focus() #endif ) { List Sel; MailList->GetSelection(Sel); for (auto i: Sel) { Thing *t = dynamic_cast(i); if (t) Del.Add(t->GetObject()); } if (Del.Length()) { auto Store = Del[0]->GetStore(); Store->Delete(Del, true); } else LgiTrace("%s:%i - Nothing to delete\n", _FL); #ifndef MAC MailList->Focus(true); #endif } } } int ScribeWnd::OnNotify(LViewI *Ctrl, LNotification n) { switch (Ctrl->GetId()) { case IDC_THING_LIST: { if (n.Type == LNotifyReturnKey) { LListItem *i = MailList ? MailList->GetSelected() : 0; Thing *t = dynamic_cast(i); if (t) { t->DoUI(); } } else if (n.Type == LNotifyDeleteKey) { /* This is now handled by the menu OnDelete(); return true; */ } if (SearchView && MailList) { SearchView->OnNotify(Ctrl, n); } break; } case IDC_TEXT: { if (PreviewPanel) { PreviewPanel->OnNotify(Ctrl, n); } break; } } return 0; } void ScribeWnd::AddThingSrc(ScribeFolder *src) { if (!d->ThingSources.HasItem(src)) d->ThingSources.Add(src); } void ScribeWnd::RemoveThingSrc(ScribeFolder *src) { d->ThingSources.Delete(src); } LArray ScribeWnd::GetThingSources(Store3ItemTypes Type) { LArray a; for (auto f: d->ThingSources) { if (f->GetItemType() == Type && !f->IsInTrash()) { a.Add(f); } } return a; } bool ScribeWnd::LogFilterActivity() { auto i = Menu->FindItem(IDM_DEBUG_FILTERS); return i ? i->Checked() : false; } bool ScribeWnd::CreateFolders(LAutoString &FileName) { bool Status = false; if (FileName) { char *Ext = LGetExtension(FileName); if (!Ext) { char File[300]; strcpy_s(File, sizeof(File), FileName); strcat(File, ".mail3"); FileName.Reset(NewStr(File)); } // Create objects, and then close the file.. it'll be reloaded later LAutoPtr m(CreateDataStore(FileName, true)); if (m) { m->GetRoot(true); Status = true; } else LgiTrace("%s:%i - CreateDataStore failed.\n", _FL); } else LgiTrace("%s:%i - No file name for CreateFolder.\n", _FL); return Status; } bool ScribeWnd::CompactFolders(LMailStore &Store, bool Interactive) { if (!Store.Store) return false; auto Dlg = new Store3Progress(this, Interactive); Dlg->SetDescription(LLoadString(IDS_CHECKING_OBJECTS)); bool Offline = false; if (WorkOffline) { Offline = WorkOffline->Checked(); WorkOffline->Checked(true); } Store.Store->Compact(this, Dlg, [this, Offline, Dlg](auto status) { LAssert(InThread()); if (WorkOffline) WorkOffline->Checked(Offline); delete Dlg; }); return true; } CalendarSource *CalendarSource::Create(ScribeWnd *App, const char *ObjName, const char *Id) { if (!Stricmp(ObjName, "RemoteCalendarSource")) return new RemoteCalendarSource(App, Id); return new FolderCalendarSource(App, Id); } int ScribeWnd::GetCalendarSources(LArray &Out) { static bool Loaded = false; if (!Loaded) { Loaded = true; CalendarSource::SetCreateIn(NULL); LVariant Create; GetOptions()->GetValue(OPT_CalendarCreateIn, Create); // This should be a list of all calendar folders in ANY mail store... auto CalFlds = GetThingSources(MAGIC_CALENDAR); LXmlTag *t = GetOptions()->LockTag(OPT_CalendarSources, _FL); if (t) { bool AutoPopulate = t->Children.Length() == 0; for (auto c: t->Children) { auto s = CalendarSource::Create(this, c->GetAttr(CalendarSource::OptObject), c->GetTag()); if (s && s->Read()) { // Add known source... if (!Stricmp(Create.Str(), c->GetTag())) { CalendarSource::SetCreateIn(s); } // Remove from CalFlds FolderCalendarSource *Fcs = dynamic_cast(c); if (Fcs) { auto Path = Fcs->GetPath(); for (auto c: CalFlds) { if (c->GetPath().Equals(Path)) { CalFlds.Delete(c); break; } } } } } if (AutoPopulate) { // Now CalFlds should be a list of all calendar folders NOT in the source XML tag for (auto c: CalFlds) { FolderCalendarSource *s = new FolderCalendarSource(this); if (s) { // So add an entry to track it... auto Path = c->GetPath(); s->SetPath(Path); s->SetDisplay(true); s->SetColour(CalendarSource::FindUnusedColour()); s->Write(); } } } GetOptions()->Unlock(); } if (!CalendarSource::GetCreateIn() && CalendarSource::GetSources().Length()) { CalendarSource::SetCreateIn(CalendarSource::GetSources().ItemAt(0)); } } for (unsigned i=0; iPathOption; fi++) { bool Check = true; if (fi->HasOption) { LVariant v; if (GetOptions()->GetValue(fi->HasOption, v)) Check = v.CastInt32() != 0; } if (Check) { ScribeFolder *c = GetFolder(fi->Id); if (c == f) return fi->Id; } } return -1; } ScribeFolder *ScribeWnd::GetCurrentFolder() { if (Tree) { auto *Item = Tree->Selection(); if (Item) { return dynamic_cast(Item); } } return 0; } bool ScribeWnd::GetSystemPath(int Folder, LVariant &Path) { char KeyName[64]; sprintf_s(KeyName, sizeof(KeyName), "Folder-%i", Folder); return GetOptions()->GetValue(KeyName, Path); } LMailStore *ScribeWnd::GetMailStoreForIdentity(const char *IdEmail) { LVariant Tmp; if (!IdEmail) { // Get current identity ScribeAccount *Cur = GetCurrentAccount(); if (Cur) { Tmp = Cur->Identity.Email(); IdEmail = Tmp.Str(); } } if (!IdEmail) return NULL; ScribeAccount *a = NULL; for (auto Acc : Accounts) { LVariant e = Acc->Identity.Email(); if (e.Str() && !_stricmp(e.Str(), IdEmail)) { a = Acc; break; } } if (!a) return NULL; LVariant DestPath = a->Receive.DestinationFolder(); if (!DestPath.Str()) return NULL; return GetMailStoreForPath(DestPath.Str()); } ScribeFolder *ScribeWnd::GetFolder(int Id, LDataI *s) { if (s) { for (auto &f: Folders) if (s->GetStore() == f.Store) return GetFolder(Id, &f); } return GetFolder(Id); } ScribeFolder *ScribeWnd::GetFolder(int Id, LMailStore *Store, bool Quiet) { char KeyName[64]; sprintf_s(KeyName, sizeof(KeyName), "Folder-%i", Id); LVariant FolderName; bool NoOption = false; if (GetOptions()->GetValue(KeyName, FolderName)) { if (ValidStr(FolderName.Str()) && strlen(FolderName.Str()) > 0) { ScribeFolder *c = GetFolder(FolderName.Str(), Store); if (c) { return c; } else if (!Quiet) { LgiTrace("%s:%i - '%s' doesn't exist.\n", _FL, FolderName.Str()); } } } else if (!Quiet) { // LgiTrace("%s:%i - No option '%s'\n", _FL, KeyName); NoOption = true; } switch (Id) { case FOLDER_INBOX: case FOLDER_OUTBOX: case FOLDER_SENT: case FOLDER_TRASH: case FOLDER_CONTACTS: case FOLDER_TEMPLATES: case FOLDER_FILTERS: case FOLDER_CALENDAR: case FOLDER_GROUPS: case FOLDER_SPAM: { ScribeFolder *c = GetFolder(DefaultFolderNames[Id], Store); if (!c) { // if (!Quiet) // LgiTrace("%s:%i - Default folder '%s' doesn't exist.\n", _FL, DefaultFolderNames[Id]); } else if (NoOption) { auto p = c->GetPath(); GetOptions()->SetValue(KeyName, FolderName = p.Get()); } return c; } } return NULL; } bool ScribeWnd::OnMailStore(LMailStore **MailStore, bool Add) { if (!MailStore) { LAssert(!"No mail store pointer?"); return false; } if (Add) { *MailStore = &Folders.New(); if (*MailStore) return true; } else { ssize_t Idx = *MailStore - &Folders[0]; if (Idx >= 0 && Idx < (ssize_t)Folders.Length()) { Folders.DeleteAt(Idx, true); *MailStore = NULL; return true; } else { LAssert(!"Index out of range."); } } return false; } LMailStore *ScribeWnd::GetMailStoreForPath(const char *Path) { if (!Path) return NULL; auto t = LString(Path).SplitDelimit("/"); if (t.Length() > 0) { const char *First = t[0]; // Find the mail store that that t[0] refers to for (unsigned i=0; iGetText(); if (RootStr && !_stricmp(RootStr, First)) { return &Folders[i]; } } } } return NULL; } ScribeFolder *ScribeWnd::GetFolder(const char *Name, LMailStore *s) { ScribeFolder *Folder = 0; if (ValidStr(Name)) { LString Sep("/"); auto t = LString(Name).Split(Sep); LMailStore tmp; LString TmpName; if (t.Length() > 0) { if (!s) { s = GetMailStoreForPath(Name); if (!s) { // IMAP folders? for (auto a: Accounts) { ScribeProtocol Proto = a->Receive.ProtocolType(); if (Proto == ProtocolImapFull) { ScribeFolder *Root = a->Receive.GetRootFolder(); if (Root) { const char *RootStr = Root->GetText(); if (RootStr && a->Receive.GetDataStore() && !_stricmp(RootStr, t[0])) { tmp.Root = Root; tmp.Store = a->Receive.GetDataStore(); s = &tmp; break; } } } } } if (s) { if (*Name == '/') Name++; Name = strchr(Name, '/'); if (!Name) Name = "/"; } } else if (s->Root) { // Check if the store name is on the start of the folder auto RootName = s->Root->GetName(true); if (RootName.Equals(t[0])) { LString::Array a; for (unsigned i=1; iRoot; Folder = s->Root ? s->Root->GetSubFolder(Name) : 0; } } return Folder; } void ScribeWnd::Update(int What) { if (What & UPDATE_TREE) { Tree->Invalidate(); return; } if (What & UPDATE_LIST) { if (MailList) MailList->Invalidate(); return; } } void ScribeWnd::DoDebug(char *s) { } Thing *ScribeWnd::CreateThingOfType(Store3ItemTypes Type, LDataI *obj) { Thing *t = NULL; switch (Type) { case MAGIC_CONTACT: { t = new Contact(this, obj); break; } case MAGIC_MAIL: { t = new Mail(this, obj); break; } case MAGIC_ATTACHMENT: { t = new Attachment(this, obj); break; } case MAGIC_FILTER: { t = new Filter(this, obj); break; } case MAGIC_CALENDAR: { t = new Calendar(this, obj); break; } case MAGIC_GROUP: { t = new ContactGroup(this, obj); break; } default: break; } if (t) { t->App = this; } return t; } void ScribeWnd::GetFilters(List &Filters, bool JustIn, bool JustOut, bool JustInternal) { auto Srcs = GetThingSources(MAGIC_FILTER); for (auto f: Srcs) { for (auto t: f->Items) { Filter *Ftr = t->IsFilter(); if (Ftr) { if (JustIn && !Ftr->GetIncoming()) continue; if (JustOut && !Ftr->GetOutgoing()) continue; if (JustInternal && !Ftr->GetInternal()) continue; Filters.Insert(Ftr); } } } extern int FilterCompare(Filter *a, Filter *b, NativeInt Data); Filters.Sort(FilterCompare); } bool ScribeWnd::ShowToolbarText() { LVariant i; if (GetOptions()->GetValue(OPT_ToolbarText, i)) { return i.CastInt32() != 0; } GetOptions()->SetValue(OPT_ToolbarText, i = true); return true; } void ScribeWnd::HashContacts(LHashTbl,Contact*> &Contacts, ScribeFolder *Folder, bool Deep) { if (!Folder) { // Default item is the contacts folder Folder = GetFolder(FOLDER_CONTACTS); // Also look at all the contact sources... auto Srcs = GetThingSources(MAGIC_CONTACT); for (auto Src: Srcs) { for (auto t: Src->Items) { Contact *c = t->IsContact(); if (!c) continue; auto emails = c->GetEmails(); for (auto e: emails) { if (!Contacts.Find(e)) Contacts.Add(e, c); } } } } // recurse through each folder and make a list // of every contact object we find. if (Folder) { Folder->LoadThings(); for (auto t: Folder->Items) { Contact *c = t->IsContact(); if (c) { auto Emails = c->GetEmails(); for (auto e: Emails) if (e && !Contacts.Find(e)) Contacts.Add(e, c); } } for (auto f = Folder->GetChildFolder(); Deep && f; f = f->GetNextFolder()) { HashContacts(Contacts, f, Deep); } } } List *ScribeWnd::GetEveryone() { return &Contact::Everyone; } bool ScribeWnd::GetContacts(List &Contacts, ScribeFolder *Folder, bool Deep) { LArray Folders; if (!Folder) { Folders = GetThingSources(MAGIC_CONTACT); auto f = GetFolder(FOLDER_CONTACTS); if (f && !Folders.HasItem(f)) Folders.Add(f); } else Folders.Add(Folder); if (!Folders.Length()) return false; for (auto f: Folders) { // recurse through each folder and make a list // of every contact object we find. ScribePerm Perm = f->GetFolderPerms(ScribeReadAccess); bool Safe = CurrentAuthLevel >= Perm; if (Safe) { f->LoadThings(); for (auto t: f->Items) { Contact *c = t->IsContact(); if (c) Contacts.Insert(c); } for (ScribeFolder *c = f->GetChildFolder(); Deep && c; c = c->GetNextFolder()) GetContacts(Contacts, c, Deep); } } return true; } /* This function goes through the database and checks for some basic requirements and fixes things up if they aren't ok. */ bool ScribeWnd::ValidateFolder(LMailStore *s, int Id) { char OptName[32]; sprintf_s(OptName, sizeof(OptName), "Folder-%i", Id); LVariant Path; if (!GetOptions()->GetValue(OptName, Path)) { char Opt[256]; sprintf_s(Opt, sizeof(Opt), "/%s", DefaultFolderNames[Id]); GetOptions()->SetValue(OptName, Path = Opt); } // If the path name has the store name at the start, strip that off... LString Sep("/"); LString::Array Parts = LString(Path.Str()).Split(Sep); if (Parts.Length() > 1) { if (Parts[0].Equals(s->Name)) { Parts.DeleteAt(0, true); Path = Sep.Join(Parts); } else { LMailStore *ms = GetMailStoreForPath(Path.Str()); if (ms) { s = ms; } else { // Most likely the user has renamed something and broken the // path. Lets just error out instead of creating the wrong folder return false; } } } // Now resolve the path... ScribeFolder *Folder = GetFolder(Path.Str(), s); if (!Folder) { char *p = Path.Str(); if (_strnicmp(p, "/IMAP ", 6) != 0) { LAssert(DefaultFolderTypes[Id] != MAGIC_NONE); Folder = s->Root->CreateSubFolder(*p=='/'?p+1:p, DefaultFolderTypes[Id]); } } if (!Folder) return false; Folder->SetDefaultFields(); return true; } void ScribeWnd::Validate(LMailStore *s) { // Check for all the basic folders int Errors = 0; for (SystemFolderInfo *fi = SystemFolders; fi->PathOption; fi++) { bool Check = true; if (fi->HasOption) { LVariant v; if (GetOptions()->GetValue(fi->HasOption, v)) Check = v.CastInt32() != 0; } if (Check) { if (!ValidateFolder(s, fi->Id)) Errors++; } } if (Errors && LgiMsg(this, "There were errors validating the system folders." "Would you like to review the mail store's system folder paths?", AppName, MB_YESNO) == IDYES) { PostEvent(M_COMMAND, IDM_MANAGE_MAIL_STORES); } } ThingFilter *ScribeWnd::GetThingFilter() { return SearchView; } ScribeAccount *ScribeWnd::GetSendAccount() { LVariant DefSendAcc = 0; if (!GetOptions()->GetValue(OPT_DefaultSendAccount, DefSendAcc)) { for (auto a : Accounts) if (a->Send.Server().Str()) return a; } ScribeAccount *i = Accounts.ItemAt(DefSendAcc.CastInt32()); if (i && i->Send.Server().Str()) return i; return NULL; } LPrinter *ScribeWnd::GetPrinter() { if (!d->PrintOptions) d->PrintOptions.Reset(new LPrinter); return d->PrintOptions; } int ScribeWnd::GetActiveThreads() { int Status = 0; for (auto i: Accounts) { if (i->IsOnline()) { Status++; } } return Status; } class DefaultClientDlg : public LDialog { public: bool DontWarn; DefaultClientDlg(LView *parent) { DontWarn = false; SetParent(parent); LoadFromResource(IDD_WARN_DEFAULT); MoveToCenter(); } int OnNotify(LViewI *Ctrl, LNotification n) { switch (Ctrl->GetId()) { case ID_YES: case ID_NO: { LCheckBox *DW; if (GetViewById(IDC_DONT_WARN, DW)) { DontWarn = DW->Value() != 0; } EndModal(Ctrl->GetId() == ID_YES); break; } } return 0; } }; #if WINNATIVE struct DefaultClient { char DefIcon[MAX_PATH_LEN]; char CmdLine[MAX_PATH_LEN]; char DllPath[MAX_PATH_LEN]; DefaultClient() { auto Exe = LGetExeFile(); sprintf_s(DefIcon, sizeof(DefIcon), "%s,1", Exe.Get()); sprintf_s(CmdLine, sizeof(CmdLine), "\"%s\" /m \"%%1\"", Exe.Get()); LMakePath(DllPath, sizeof(DllPath), Exe, "../ScribeMapi.dll"); } bool IsWindowsXp() { LArray Ver; int Os = LGetOs(&Ver); if ( ( Os == LGI_OS_WIN32 || Os == LGI_OS_WIN64 ) && Ver.Length() > 1 && Ver[0] == 5 && Ver[1] == 1 ) return true; return false; } bool InstallMailto(bool Write) { LAutoPtr mailto = CheckKey(Write, "HKCR\\mailto"); if (!mailto) return false; if (!CheckString(Write, mailto, NULL, "URL:MailTo Protocol")) return false; LAutoPtr deficon = CheckKey(Write, "HKCR\\mailto\\DefaultIcon"); if (!deficon) return false; if (!CheckString(Write, deficon, NULL, DefIcon)) return false; LAutoPtr shell = CheckKey(Write, "HKCR\\mailto\\shell"); if (!shell) return false; if (!CheckString(Write, shell, NULL, "open")) return false; LAutoPtr cmd = CheckKey(Write, "HKCR\\mailto\\shell\\open\\command"); if (!cmd) return false; if (!CheckString(Write, cmd, NULL, CmdLine)) return false; return true; } LAutoPtr CheckKey(bool Write, const char *Key, ...) const { char Buffer[512]; va_list Arg; va_start(Arg, Key); vsprintf_s(Buffer, sizeof(Buffer), Key, Arg); va_end(Arg); LAutoPtr k(new LRegKey(Write, Buffer)); if (k && Write && !k->IsOk()) { if (!k->Create()) { k.Reset(); LgiTrace("%s:%i - Failed to create '%s'\n", _FL, Buffer); } } return k; } bool CheckInt(bool Write, LRegKey *k, const char *Name, uint32_t Value) { if (!k) { LgiTrace("%s:%i - No key: '%s'\n", _FL, Name); return false; } uint32_t Cur; if (!k->GetInt(Name, Cur)) Cur = Value + 1; if (Cur == Value) return true; if (Write) { bool Status = k->SetInt(Name, Value); if (!Status) LgiTrace("%s:%i - Failed to set key '%s': '%s' to %i\n", _FL, k->Name(), Name, Value); return Status; } return false; } bool CheckString(bool Write, LRegKey *k, const char *StrName, const char *StrValue) { if (!k) { LgiTrace("%s:%i - No key: '%s' to '%s'\n", _FL, StrName, StrValue); return false; } LString v; if (k->GetStr(StrName, v)) { bool Same = Stricmp(v.Get(), StrValue) == 0; if (Write && !Same) { bool Status = k->SetStr(StrName, StrValue); if (!Status) LgiTrace("%s:%i - Failed to set key '%s': '%s' to '%s'\n", _FL, k->Name(), StrName, StrValue); return Status; } return Same; } else if (Write) { bool Status = k->SetStr(StrName, StrValue); if (!Status) LgiTrace("%s:%i - Failed to set key '%s': '%s' to '%s'\n", _FL, k->Name(), StrName, StrValue); return Status; } return false; } bool IsDefault() { LAutoPtr mail = CheckKey(false, "HKCU\\Software\\Clients\\Mail"); if (!mail) return false; LString v; if (!mail->GetStr(NULL, v)) return false; return !_stricmp(v, "Scribe"); } bool SetDefault() const { LAutoPtr mail = CheckKey(true, "HKCU\\Software\\Clients\\Mail"); if (!mail) return false; // Set the default client in the current user tree. mail->SetStr(NULL, "Scribe"); // Configure the mailto handler const char *Base = "HKEY_ROOT"; bool Error = false; LRegKey Mt(true, "%s\\mailto", Base); if (Mt.IsOk() || Mt.Create()) { if (!Mt.SetStr(0, "URL:MailTo Protocol") || !Mt.SetStr("URL Protocol", "")) Error = true; } else { LgiTrace("%s:%i - Couldn't open/create registry key (err=%i).\n", _FL, GetLastError()); Error = true; } LRegKey Di(true, "%s\\mailto\\DefaultIcon", Base); if (Di.IsOk() || Di.Create()) { if (!Di.SetStr(0, DefIcon)) Error = true; } else { LgiTrace("%s:%i - Couldn't open/create registry key (err=%i).\n", _FL, GetLastError()); Error = true; } LRegKey c(true, "%s\\mailto\\shell\\open\\command", Base); if (c.IsOk() || c.Create()) { if (!c.SetStr(NULL, CmdLine)) Error = true; } else { LgiTrace("%s:%i - Couldn't open/create registry key (err=%i).\n", _FL, GetLastError()); Error = true; } return Error; } bool InstallAsClient(char *Base, bool Write) { // Create software client entry, to put Scribe in the Internet Options for mail clients. LAutoPtr mail = CheckKey(Write, "%s\\Software\\Clients\\Mail", Base); if (!mail) return false; LAutoPtr app = CheckKey(Write, "%s\\Software\\Clients\\Mail\\Scribe", Base); if (!app) return false; if (!CheckString(Write, app, NULL, AppName)) return false; if (!CheckString(Write, app, "DllPath", DllPath)) return false; LAutoPtr shell = CheckKey(Write, "%s\\Software\\Clients\\Mail\\Scribe\\shell\\open\\command", Base); if (!shell) return false; if (!CheckString(Write, shell, NULL, CmdLine)) return false; LAutoPtr icon = CheckKey(Write, "%s\\Software\\Clients\\Mail\\Scribe\\DefaultIcon", Base); if (!icon) return false; if (!CheckString(Write, icon, NULL, DefIcon)) return false; LAutoPtr proto = CheckKey(Write, "%s\\Software\\Classes\\Protocol\\mailto", Base); if (!proto) return false; if (!CheckString(Write, proto, NULL, "URL:MailTo Protocol")) return false; if (!CheckString(Write, proto, "URL Protocol", "")) return false; if (!CheckInt(Write, proto, "EditFlags", 0x2)) return false; LAutoPtr proto_cmd = CheckKey(Write, "%s\\Software\\Classes\\Protocol\\mailto\\shell\\open\\command", Base); if (!proto_cmd) return false; if (!CheckString(Write, proto_cmd, NULL, CmdLine)) return false; return true; } struct FileType { char *Name; char *Desc; int Icon; }; static FileType FileTypes[]; bool Win7Install(bool Write) { // http://msdn.microsoft.com/en-us/library/windows/desktop/cc144154%28v=vs.85%29.aspx LArray Ver; int Os = LGetOs(&Ver); if ( ( Os == LGI_OS_WIN32 || Os == LGI_OS_WIN64 ) && Ver[0] >= 6) { char Path[MAX_PATH_LEN]; auto Exe = LGetExeFile(); for (int i=0; FileTypes[i].Name; i++) { LAutoPtr base = CheckKey(Write, "HKEY_CLASSES_ROOT\\%s", FileTypes[i].Name); if (!base) return false; if (!CheckString(Write, base, NULL, FileTypes[i].Desc)) return false; LAutoPtr r = CheckKey(Write, "HKEY_CLASSES_ROOT\\%s\\shell\\Open\\command", FileTypes[i].Name); if (!r) return false; sprintf_s(Path, sizeof(Path), "\"%s\" -u \"%%1\"", Exe.Get()); if (!CheckString(Write, r, NULL, Path)) return false; LAutoPtr ico = CheckKey(Write, "HKEY_CLASSES_ROOT\\%s\\DefaultIcon", FileTypes[i].Name); if (!ico) return false; sprintf_s(Path, sizeof(Path), "%s,%i", Exe.Get(), FileTypes[i].Icon); if (!CheckString(Write, ico, NULL, Path)) return false; } LAutoPtr r = CheckKey(Write, "HKEY_LOCAL_MACHINE\\SOFTWARE\\Clients\\Mail\\Scribe\\Capabilities"); if (!r) return false; if (!CheckString(Write, r, "ApplicationDescription", "Scribe is a small lightweight email client.") && !CheckString(Write, r, "ApplicationName", "Scribe") && !CheckString(Write, r, "ApplicationIcon", DefIcon)) return false; LAutoPtr
%s